![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[IMG]](/icons/image2.gif) | xxv_Dell_1U_Server.svg | 2023-02-27 21:59 | 103K | |
![[IMG]](/icons/image2.gif) | wire harness.png | 2023-04-28 12:14 | 495K | |
![[IMG]](/icons/image2.gif) | wifi.jpg | 2024-10-15 20:31 | 64K | |
![[ ]](/icons/layout.gif) | wap test.pdf | 2024-01-29 01:16 | 7.2K | |
![[ ]](/icons/layout.gif) | wap test-HomePage.pdf | 2024-01-29 01:16 | 7.5K | |
![[IMG]](/icons/image2.gif) | wall mount rack.png.svg | 2023-06-27 19:13 | 48K | |
![[IMG]](/icons/image2.gif) | wall mount rack.png | 2023-06-27 19:13 | 99K | |
![[IMG]](/icons/image2.gif) | wall angle kit.png | 2023-04-25 16:04 | 144K | |
![[IMG]](/icons/image2.gif) | volume-control.svg | 2023-06-27 21:27 | 2.2K | |
![[IMG]](/icons/image2.gif) | vollmer park .pdf0.png | 2024-01-09 19:14 | 8.8K | |
![[ ]](/icons/layout.gif) | vollmer park .pdf | 2024-01-09 19:14 | 21K | |
![[IMG]](/icons/image2.gif) | vistas building 4 (pg.2).pdf0.png | 2023-07-18 13:35 | 596K | |
![[ ]](/icons/layout.gif) | vistas building 4 (pg.2).pdf | 2023-07-18 13:35 | 296K | |
![[IMG]](/icons/image2.gif) | vistas building 4 (pg.1).pdf0.png | 2023-07-18 13:35 | 822K | |
![[ ]](/icons/layout.gif) | vistas building 4 (pg.1).pdf | 2023-07-18 13:34 | 431K | |
![[IMG]](/icons/image2.gif) | vistas A Buld.pdf1.png | 2023-04-26 13:54 | 314K | |
![[IMG]](/icons/image2.gif) | vistas A Buld.pdf0.png | 2023-04-26 13:54 | 351K | |
![[ ]](/icons/layout.gif) | vistas A Buld.pdf | 2023-04-26 13:54 | 1.3M | |
![[IMG]](/icons/image2.gif) | virtical cable manager 6w double sideed.jpg | 2023-05-03 16:09 | 42K | |
![[ ]](/icons/layout.gif) | viewOriginalWageSchedule.pdf | 2024-04-05 19:58 | 1.1M | |
![[ ]](/icons/layout.gif) | viewOriginalWageSchedule - 2025-08-08T101246.015.pdf | 2025-08-20 00:17 | 1.7M | |
![[ ]](/icons/layout.gif) | viewOriginalWageSchedule - 2025-08-08T101246-015.pdf | 2025-12-14 17:29 | 1.7M | |
![[IMG]](/icons/image2.gif) | uplinking & Configuration pink.svg | 2023-05-26 12:14 | 2.7K | |
![[IMG]](/icons/image2.gif) | uplinking & Configuration light blue.svg | 2023-05-26 12:26 | 2.8K | |
![[IMG]](/icons/image2.gif) | uplinking & Configuration.png | 2023-07-10 18:27 | 3.3K | |
![[ ]](/icons/layout.gif) | updated DPD 1-24 Supply & Install Low Voltage Wiring for Town Facilities.pdf | 2024-04-29 20:02 | 2.5M | |
![[IMG]](/icons/image2.gif) | unnamed.jpg | 2023-02-10 17:43 | 4.5K | |
![[IMG]](/icons/image2.gif) | type II cut.pdf0.png | 2023-09-27 13:14 | 84K | |
![[ ]](/icons/layout.gif) | type II cut.pdf | 2023-09-27 13:14 | 64K | |
![[IMG]](/icons/image2.gif) | triangular wall bracket.png | 2023-04-25 16:20 | 61K | |
![[IMG]](/icons/image2.gif) | touch communicator.jpg | 2023-04-28 12:59 | 12K | |
![[IMG]](/icons/image2.gif) | tmobile.pdf0.png | 2023-11-11 14:43 | 29K | |
![[ ]](/icons/layout.gif) | tmobile.pdf | 2023-11-11 14:43 | 64K | |
![[IMG]](/icons/image2.gif) | threaded rod kit.png | 2023-05-03 15:55 | 12K | |
![[IMG]](/icons/image2.gif) | thin client.jpg | 2023-05-12 08:44 | 23K | |
![[IMG]](/icons/image2.gif) | thin-client.svg | 2023-06-27 22:18 | 5.0K | |
![[ ]](/icons/unknown.gif) | test 2_details.json | 2025-10-26 13:34 | 19K | |
![[IMG]](/icons/image2.gif) | term plug.jpg | 2023-04-28 12:52 | 3.1K | |
![[IMG]](/icons/image2.gif) | tera_grand_keyj_cat6pd_bl_cat6_keystone_jack_blue_1018314.jpg | 2023-05-23 02:28 | 200K | |
![[IMG]](/icons/image2.gif) | telephone svg.svg | 2023-05-22 09:58 | 132K | |
![[IMG]](/icons/image2.gif) | telephone POP.svg | 2023-05-10 17:32 | 132K | |
![[ ]](/icons/layout.gif) | tc3-1::R-1.pdf | 2023-03-21 20:49 | 130K | |
![[ ]](/icons/layout.gif) | tc3-1.pdf | 2023-03-23 11:58 | 2.8K | |
![[TXT]](/icons/text.gif) | tasks test-Layout.csv | 2023-07-18 09:51 | 5.8K | |
![[ ]](/icons/layout.gif) | svg test 5.pdf | 2023-09-27 16:11 | 135K | |
![[ ]](/icons/layout.gif) | svg test 5-R-1.pdf | 2023-09-27 16:11 | 105K | |
![[ ]](/icons/layout.gif) | svg test 5-HomePage.pdf | 2023-09-27 16:11 | 32K | |
![[ ]](/icons/layout.gif) | survey.pdf | 2024-11-12 22:32 | 111K | |
![[IMG]](/icons/image2.gif) | summit-properties_logo_0.png | 2023-12-29 21:18 | 21K | |
![[IMG]](/icons/image2.gif) | strain relief bar.svg | 2023-05-09 09:07 | 1.2K | |
![[IMG]](/icons/image2.gif) | strain relief bar.png | 2023-05-09 09:07 | 24K | |
![[IMG]](/icons/image2.gif) | strain relief bar.jpg | 2023-07-19 13:51 | 79K | |
![[IMG]](/icons/image2.gif) | steer-logo.png | 2023-10-26 17:56 | 8.7K | |
![[IMG]](/icons/image2.gif) | specific area merged.pdf4.png | 2023-05-17 08:26 | 69K | |
![[IMG]](/icons/image2.gif) | specific area merged.pdf3.png | 2023-05-17 08:26 | 133K | |
![[IMG]](/icons/image2.gif) | specific area merged.pdf2.png | 2023-05-17 08:26 | 86K | |
![[IMG]](/icons/image2.gif) | specific area merged.pdf1.png | 2023-05-17 08:26 | 36K | |
![[IMG]](/icons/image2.gif) | specific area merged.pdf0.png | 2023-05-17 08:26 | 31K | |
![[ ]](/icons/layout.gif) | specific area merged.pdf | 2023-05-17 08:26 | 342K | |
![[IMG]](/icons/image2.gif) | specfic area merged_merged (1).pdf0.png | 2023-05-15 17:23 | 2.1M | |
![[ ]](/icons/layout.gif) | specfic area merged_merged (1).pdf | 2023-05-15 17:23 | 2.0M | |
![[IMG]](/icons/image2.gif) | specfic area merged.pdf4.png | 2023-05-15 17:10 | 44K | |
![[IMG]](/icons/image2.gif) | specfic area merged.pdf3.png | 2023-05-15 17:10 | 34K | |
![[IMG]](/icons/image2.gif) | specfic area merged.pdf2.png | 2023-05-15 17:10 | 89K | |
![[IMG]](/icons/image2.gif) | specfic area merged.pdf1.png | 2023-05-15 17:10 | 53K | |
![[IMG]](/icons/image2.gif) | specfic area merged.pdf0.png | 2023-05-15 17:10 | 69K | |
![[ ]](/icons/layout.gif) | specfic area merged.pdf | 2023-05-15 17:10 | 246K | |
![[IMG]](/icons/image2.gif) | specfic area merged (1).pdf0.png | 2023-05-15 17:14 | 298K | |
![[ ]](/icons/layout.gif) | specfic area merged (1).pdf | 2023-05-15 17:14 | 249K | |
![[IMG]](/icons/image2.gif) | speaker colored.svg | 2023-05-12 09:50 | 2.0K | |
![[IMG]](/icons/image2.gif) | speaker.svg | 2023-05-11 18:44 | 2.0K | |
![[IMG]](/icons/image2.gif) | speaker.png | 2023-05-12 09:50 | 3.4K | |
![[IMG]](/icons/image2.gif) | source_2.png.svg | 2024-04-05 08:53 | 174K | |
![[IMG]](/icons/image2.gif) | source_2.png | 2024-04-05 08:53 | 331K | |
![[IMG]](/icons/image2.gif) | source.jpeg.svg | 2024-04-05 08:37 | 900K | |
![[IMG]](/icons/image2.gif) | source.jpeg | 2024-04-05 08:37 | 387K | |
![[IMG]](/icons/image2.gif) | single data wall outlet.jpg | 2023-02-10 20:01 | 1.8K | |
![[IMG]](/icons/image2.gif) | signal-2023-06-12-130103_002.jpeg.svg | 2023-07-12 09:50 | 45K | |
![[IMG]](/icons/image2.gif) | signal-2023-06-12-130103_002.jpeg | 2023-07-12 09:50 | 31K | |
![[IMG]](/icons/image2.gif) | shipping.svg | 2023-05-10 17:35 | 2.0K | |
![[IMG]](/icons/image2.gif) | shipping.png | 2023-05-10 17:35 | 3.4K | |
![[TXT]](/icons/text.gif) | sfg-Telecommunication Outlets- Assets List.csv | 2023-02-10 14:44 | 6.7K | |
![[IMG]](/icons/image2.gif) | service call plan.pdf0.png | 2023-04-28 16:59 | 422K | |
![[ ]](/icons/layout.gif) | service call plan.pdf | 2023-04-28 16:59 | 698K | |
![[IMG]](/icons/image2.gif) | sc-2.png | 2023-09-19 11:29 | 860K | |
![[IMG]](/icons/image2.gif) | sample_1920Ã1280.svg | 2023-12-28 07:12 | 1.0M | |
![[TXT]](/icons/text.gif) | sample-customer-list-to-import.csv | 2023-03-10 14:41 | 122 | |
![[IMG]](/icons/image2.gif) | safety-certificate-svgrepo-com.svg | 2023-04-18 12:11 | 3.1K | |
![[IMG]](/icons/image2.gif) | running-repair-man-with-wrench-and-kit-svgrepo-com.svg | 2023-04-17 13:01 | 3.7K | |
![[ ]](/icons/unknown.gif) | rs=w_792,h_576,cg_true.webp | 2023-12-01 14:46 | 14K | |
![[IMG]](/icons/image2.gif) | ross.PNG.svg | 2023-08-24 17:13 | 284K | |
![[IMG]](/icons/image2.gif) | ross.PNG | 2023-08-24 17:13 | 575K | |
![[IMG]](/icons/image2.gif) | roche.png | 2024-01-19 19:14 | 3.5K | |
![[ ]](/icons/layout.gif) | rfpsigninsheet.pdf | 2024-10-14 19:48 | 247K | |
![[IMG]](/icons/image2.gif) | rework lounge.pdf0.png | 2023-05-19 19:45 | 35K | |
![[ ]](/icons/layout.gif) | rework lounge.pdf | 2023-05-19 19:45 | 29K | |
![[IMG]](/icons/image2.gif) | rework lounge (1).pdf0.png | 2023-05-22 10:00 | 42K | |
![[ ]](/icons/layout.gif) | rework lounge (1).pdf | 2023-05-22 10:00 | 37K | |
![[IMG]](/icons/image2.gif) | remove.svg | 2023-05-26 12:39 | 1.1K | |
![[IMG]](/icons/image2.gif) | remove.png | 2023-05-26 12:39 | 816 | |
![[IMG]](/icons/image2.gif) | relocate.svg | 2023-06-20 14:15 | 2.1K | |
![[IMG]](/icons/image2.gif) | relocate.png | 2023-05-10 18:39 | 5.3K | |
![[IMG]](/icons/image2.gif) | recessed door contact-fotor-bg-remover-2023050142657.png | 2023-05-01 09:27 | 45K | |
![[IMG]](/icons/image2.gif) | radius drop.png | 2023-04-25 15:53 | 96K | |
![[IMG]](/icons/image2.gif) | rack to runway mounting plate.png | 2023-04-25 16:01 | 137K | |
![[IMG]](/icons/image2.gif) | rack to runway mountain plate.png | 2023-05-03 15:52 | 5.1K | |
![[ ]](/icons/layout.gif) | rack sie test.pdf | 2023-10-11 13:18 | 17M | |
![[ ]](/icons/layout.gif) | rack sie test-TC-1::R-1.pdf | 2023-10-11 13:18 | 519K | |
![[ ]](/icons/layout.gif) | rack sie test-TC-1.pdf | 2023-10-11 13:18 | 296K | |
![[ ]](/icons/layout.gif) | rack sie test-HomePage.pdf | 2023-10-11 13:18 | 16M | |
![[IMG]](/icons/image2.gif) | rack-img.png | 2023-02-08 14:03 | 412K | |
![[IMG]](/icons/image2.gif) | rack-img.jpg.svg | 2023-06-09 13:53 | 58K | |
![[IMG]](/icons/image2.gif) | rack-img.jpg | 2023-06-09 13:53 | 48K | |
![[ ]](/icons/unknown.gif) | qt=q_95.webp | 2024-11-28 03:35 | 7.4K | |
![[IMG]](/icons/image2.gif) | purple color outlet.svg | 2023-05-23 15:04 | 1.0K | |
![[IMG]](/icons/image2.gif) | pull tape svg.svg | 2023-05-05 08:55 | 23K | |
![[IMG]](/icons/image2.gif) | pueblo.pdf0.png | 2024-01-11 14:58 | 397K | |
![[ ]](/icons/layout.gif) | pueblo.pdf | 2024-01-11 14:58 | 1.9M | |
![[IMG]](/icons/image2.gif) | pueblo-reduced.pdf0.png | 2024-01-11 21:52 | 397K | |
![[ ]](/icons/layout.gif) | pueblo-reduced.pdf | 2024-01-11 21:52 | 252K | |
![[IMG]](/icons/image2.gif) | public storage.pdf0.png | 2023-09-25 12:56 | 76K | |
![[ ]](/icons/layout.gif) | public storage.pdf | 2023-09-25 12:56 | 78K | |
![[IMG]](/icons/image2.gif) | program svg.svg | 2023-05-10 18:03 | 2.6K | |
![[IMG]](/icons/image2.gif) | programming.svg | 2023-06-20 14:38 | 1.0K | |
![[IMG]](/icons/image2.gif) | programming.png | 2023-05-10 17:37 | 2.7K | |
![[ ]](/icons/unknown.gif) | prod 1202_details.json | 2025-09-12 11:59 | 1.3K | |
![[IMG]](/icons/image2.gif) | processed-982CE873-8ECF-41B8-8FAB-507E0CAB7C7A.jpeg.inetloc | 2025-09-19 01:32 | 263 | |
![[IMG]](/icons/image2.gif) | ppsd logo 226.png | 2025-05-30 20:40 | 12K | |
![[IMG]](/icons/image2.gif) | pp-c6-48P.png.svg | 2023-09-29 08:52 | 21K | |
![[IMG]](/icons/image2.gif) | pp-c6-48P.png | 2023-09-29 08:52 | 73K | |
![[IMG]](/icons/image2.gif) | polyster pull tape.png | 2023-05-04 12:08 | 147K | |
![[IMG]](/icons/image2.gif) | png2pdf.pdf4.png | 2023-05-16 14:07 | 69K | |
![[IMG]](/icons/image2.gif) | png2pdf.pdf3.png | 2023-05-16 14:07 | 124K | |
![[IMG]](/icons/image2.gif) | png2pdf.pdf2.png | 2023-05-16 14:07 | 86K | |
![[IMG]](/icons/image2.gif) | png2pdf.pdf1.png | 2023-05-16 14:07 | 36K | |
![[IMG]](/icons/image2.gif) | png2pdf.pdf0.png | 2023-05-16 14:07 | 31K | |
![[ ]](/icons/layout.gif) | png2pdf.pdf | 2023-05-16 14:07 | 333K | |
![[IMG]](/icons/image2.gif) | plattville.pdf0.png | 2024-01-04 15:40 | 249K | |
![[ ]](/icons/layout.gif) | plattville.pdf | 2024-01-04 15:40 | 1.2M | |
![[IMG]](/icons/image2.gif) | plan-floor.jpg.svg | 2023-05-19 08:07 | 15K | |
![[IMG]](/icons/image2.gif) | plan-floor.jpg | 2023-05-19 08:07 | 28K | |
![[IMG]](/icons/image2.gif) | pilot butte pg.09.pdf2.png | 2023-05-03 12:19 | 129K | |
![[IMG]](/icons/image2.gif) | pilot butte pg.09.pdf1.png | 2023-05-03 12:19 | 91K | |
![[IMG]](/icons/image2.gif) | pilot butte pg.09.pdf0.png | 2023-05-03 12:19 | 85K | |
![[ ]](/icons/layout.gif) | pilot butte pg.09.pdf | 2023-05-03 12:19 | 446K | |
![[IMG]](/icons/image2.gif) | picsvg_download.svg | 2023-05-22 09:46 | 2.0K | |
![[IMG]](/icons/image2.gif) | picsvg_download (1).svg | 2023-05-12 11:30 | 2.0K | |
![[ ]](/icons/layout.gif) | phase 2 Demo.pdf | 2024-11-12 22:31 | 95K | |
![[ ]](/icons/layout.gif) | phase 1 Demo.pdf | 2024-11-12 22:31 | 110K | |
![[ ]](/icons/unknown.gif) | phase 1 Demo.docx | 2024-11-12 22:25 | 75K | |
![[IMG]](/icons/image2.gif) | pdf-floorplan.pdf0.png | 2023-05-16 13:26 | 46K | |
![[IMG]](/icons/image2.gif) | pdf-floorplan.pdf.svg | 2023-04-14 13:55 | 190K | |
![[ ]](/icons/layout.gif) | pdf-floorplan.pdf | 2023-05-16 13:26 | 155K | |
![[IMG]](/icons/image2.gif) | p b p c-rotated.pdf0.png | 2023-05-03 12:23 | 90K | |
![[ ]](/icons/layout.gif) | p b p c-rotated.pdf | 2023-05-03 12:23 | 157K | |
![[IMG]](/icons/image2.gif) | patchpanelOrg.jpg | 2023-02-08 13:58 | 66K | |
![[IMG]](/icons/image2.gif) | patch panel.jpeg | 2023-11-03 14:35 | 80K | |
![[IMG]](/icons/image2.gif) | patch cord svg.svg | 2023-05-03 17:57 | 6.4K | |
![[IMG]](/icons/image2.gif) | patch cord.jpg | 2023-02-10 18:27 | 4.5K | |
![[IMG]](/icons/image2.gif) | panduit 2U wire manager.jpg | 2023-05-08 17:26 | 40K | |
![[ ]](/icons/unknown.gif) | overview 1_details.json | 2025-02-20 11:45 | 3.2K | |
![[IMG]](/icons/image2.gif) | northpark Basement.pdf0.png | 2024-01-09 17:02 | 20K | |
![[ ]](/icons/layout.gif) | northpark Basement.pdf | 2024-01-09 17:02 | 63K | |
![[IMG]](/icons/image2.gif) | northpark.pdf0.png | 2024-01-09 17:01 | 25K | |
![[ ]](/icons/layout.gif) | northpark.pdf | 2024-01-09 17:01 | 141K | |
![[IMG]](/icons/image2.gif) | ngc-logo-flag.svg | 2024-03-29 12:36 | 14K | |
![[ ]](/icons/unknown.gif) | new version_details.json | 2025-07-14 11:34 | 1.3K | |
![[ ]](/icons/unknown.gif) | new version 3_details.json | 2025-07-25 05:17 | 1.9K | |
![[ ]](/icons/unknown.gif) | new version 2_details.json | 2025-07-14 12:03 | 1.3K | |
![[IMG]](/icons/image2.gif) | new_floorplan.png.svg | 2023-11-16 14:19 | 279K | |
![[IMG]](/icons/image2.gif) | new_floorplan.png | 2023-11-20 12:12 | 594K | |
![[ ]](/icons/unknown.gif) | new | 2025-06-12 07:59 | 18K | |
![[IMG]](/icons/image2.gif) | network switch.png.svg | 2023-06-21 18:23 | 3.3K | |
![[IMG]](/icons/image2.gif) | network switch.png | 2023-06-21 18:23 | 1.3K | |
![[IMG]](/icons/image2.gif) | network-switch.svg | 2023-05-12 08:37 | 1.8K | |
![[IMG]](/icons/image2.gif) | network-switch-icon-10.svg | 2023-02-27 20:51 | 45K | |
![[ ]](/icons/layout.gif) | namc hugs.pdf | 2024-11-22 18:41 | 8.6M | |
![[IMG]](/icons/image2.gif) | n042001wh-front-l.jpg | 2023-02-10 14:51 | 6.0K | |
![[ ]](/icons/layout.gif) | mv21.pdf | 2025-03-24 02:18 | 1.6M | |
![[TXT]](/icons/text.gif) | multi_page_plan-Layout.csv | 2023-05-19 14:42 | 1.3K | |
![[IMG]](/icons/image2.gif) | monitor.jpg | 2023-05-26 09:50 | 9.1K | |
![[ ]](/icons/layout.gif) | maxwellofficebuilding_outdoor.pdf | 2024-10-15 20:31 | 2.0M | |
![[ ]](/icons/layout.gif) | master permit .pdf | 2025-09-19 01:34 | 1.8M | |
![[IMG]](/icons/image2.gif) | marshall without arrow fp.pdf0.png | 2023-05-18 17:33 | 702K | |
![[ ]](/icons/layout.gif) | marshall without arrow fp.pdf | 2023-05-18 17:33 | 279K | |
![[IMG]](/icons/image2.gif) | marshall training room.pdf0.png | 2023-05-15 17:11 | 44K | |
![[ ]](/icons/layout.gif) | marshall training room.pdf | 2023-05-15 17:11 | 40K | |
![[IMG]](/icons/image2.gif) | marshall learningcenter area.pdf0.png | 2023-05-18 06:27 | 69K | |
![[ ]](/icons/layout.gif) | marshall learningcenter area.pdf | 2023-05-18 06:27 | 67K | |
![[IMG]](/icons/image2.gif) | marshall frontline area.pdf0.png | 2023-05-18 06:26 | 86K | |
![[ ]](/icons/layout.gif) | marshall frontline area.pdf | 2023-05-18 06:26 | 73K | |
![[IMG]](/icons/image2.gif) | marshall frontline.pdf0.png | 2023-05-15 11:53 | 89K | |
![[ ]](/icons/layout.gif) | marshall frontline.pdf | 2023-05-15 11:53 | 75K | |
![[IMG]](/icons/image2.gif) | marshall fitting room.pdf0.png | 2023-05-15 15:10 | 34K | |
![[ ]](/icons/layout.gif) | marshall fitting room.pdf | 2023-05-15 15:10 | 32K | |
![[IMG]](/icons/image2.gif) | marshall areas merged.pdf4.png | 2023-05-17 07:56 | 69K | |
![[IMG]](/icons/image2.gif) | marshall areas merged.pdf3.png | 2023-05-17 07:56 | 124K | |
![[IMG]](/icons/image2.gif) | marshall areas merged.pdf2.png | 2023-05-17 07:56 | 86K | |
![[IMG]](/icons/image2.gif) | marshall areas merged.pdf1.png | 2023-05-17 07:56 | 36K | |
![[IMG]](/icons/image2.gif) | marshall areas merged.pdf0.png | 2023-05-17 07:56 | 31K | |
![[ ]](/icons/layout.gif) | marshall areas merged.pdf | 2023-05-17 07:56 | 333K | |
![[IMG]](/icons/image2.gif) | marshall Lounge area.pdf0.png | 2023-05-16 12:24 | 69K | |
![[IMG]](/icons/image2.gif) | marshall Lounge area .pdf0.png | 2023-05-17 08:04 | 31K | |
![[ ]](/icons/layout.gif) | marshall Lounge area.pdf | 2023-05-16 12:24 | 56K | |
![[ ]](/icons/layout.gif) | marshall Lounge area .pdf | 2023-05-17 08:04 | 28K | |
![[IMG]](/icons/image2.gif) | marshall ASM office.pdf0.png | 2023-05-15 11:53 | 53K | |
![[ ]](/icons/layout.gif) | marshall ASM office.pdf | 2023-05-15 11:53 | 46K | |
![[IMG]](/icons/image2.gif) | marshall 3rd.pdf0.png | 2023-05-10 14:59 | 3.1M | |
![[ ]](/icons/layout.gif) | marshall 3rd.pdf | 2023-05-10 14:59 | 1.0M | |
![[IMG]](/icons/image2.gif) | marshall 2 nd page.pdf0.png | 2023-05-10 14:57 | 2.0M | |
![[ ]](/icons/layout.gif) | marshall 2 nd page.pdf | 2023-05-10 14:57 | 380K | |
![[IMG]](/icons/image2.gif) | marcos logo.png | 2024-10-21 21:22 | 5.9K | |
![[IMG]](/icons/image2.gif) | marcos.pdf_0.png | 2024-11-01 15:22 | 1.2M | |
![[ ]](/icons/layout.gif) | marcos.pdf | 2024-11-01 15:21 | 658K | |
![[ ]](/icons/compressed.gif) | lynkfast-mongo-db.zip | 2023-06-26 12:40 | 6.5M | |
![[ ]](/icons/compressed.gif) | lynkfast-angular-webb.zip | 2023-06-26 12:37 | 4.7M | |
![[IMG]](/icons/image2.gif) | lube svg.svg | 2023-05-04 16:37 | 45K | |
![[IMG]](/icons/image2.gif) | logo vision.svg | 2023-12-22 19:44 | 16K | |
![[IMG]](/icons/image2.gif) | logoc.svg | 2023-08-10 10:26 | 4.2K | |
![[IMG]](/icons/image2.gif) | logo2-1.png | 2024-07-22 13:10 | 6.4K | |
![[IMG]](/icons/image2.gif) | logo.png.webp | 2023-10-16 22:09 | 14K | |
![[IMG]](/icons/image2.gif) | logo.png | 2025-01-14 13:37 | 4.2K | |
![[IMG]](/icons/image2.gif) | logo-blue.svg | 2023-05-01 22:55 | 2.6K | |
![[IMG]](/icons/image2.gif) | logo-blue (1).svg | 2023-05-05 14:25 | 2.6K | |
![[IMG]](/icons/image2.gif) | lock.jpg | 2023-04-28 12:40 | 19K | |
![[IMG]](/icons/image2.gif) | liberty-public-school-logo.png | 2024-12-31 22:08 | 29K | |
![[IMG]](/icons/image2.gif) | learning center rework.pdf0.png | 2023-05-19 20:30 | 28K | |
![[ ]](/icons/layout.gif) | learning center rework.pdf | 2023-05-19 20:30 | 28K | |
![[IMG]](/icons/image2.gif) | learning center rework (1).pdf0.png | 2023-05-22 09:09 | 22K | |
![[ ]](/icons/layout.gif) | learning center rework (1).pdf | 2023-05-22 09:09 | 23K | |
![[IMG]](/icons/image2.gif) | learning Center CO Springs.pdf0.png | 2023-06-27 18:24 | 24K | |
![[ ]](/icons/layout.gif) | learning Center CO Springs.pdf | 2023-06-27 18:24 | 18K | |
![[IMG]](/icons/image2.gif) | landscape.pdf_0.png | 2024-10-04 15:16 | 1.1M | |
![[IMG]](/icons/image2.gif) | ladder rack.png | 2023-05-09 09:51 | 62K | |
![[TXT]](/icons/text.gif) | labelling - Future-Termination Hardware- Assets List.csv | 2023-05-09 13:14 | 6.8K | |
![[TXT]](/icons/text.gif) | labelling - Future-Assets- Assets List.csv | 2023-05-11 12:34 | 116K | |
![[IMG]](/icons/image2.gif) | labeling.png.svg | 2023-07-13 16:00 | 11K | |
![[IMG]](/icons/image2.gif) | labeling.png | 2023-07-13 16:00 | 17K | |
![[IMG]](/icons/image2.gif) | jaynes-logo.svg | 2024-11-12 22:14 | 3.0K | |
![[IMG]](/icons/image2.gif) | inst wall rack.png | 2023-05-10 17:28 | 67K | |
![[IMG]](/icons/image2.gif) | inst-wall-rack.svg | 2023-05-11 17:09 | 16K | |
![[IMG]](/icons/image2.gif) | images (2).jpg | 2023-02-10 14:20 | 2.4K | |
![[IMG]](/icons/image2.gif) | images (1).jpg | 2023-02-10 14:41 | 1.8K | |
![[IMG]](/icons/image2.gif) | image_2023_11_02T12_56_02_830Z.png.svg | 2023-11-02 12:57 | 245K | |
![[IMG]](/icons/image2.gif) | image_2023_11_02T12_56_02_830Z.png | 2023-11-02 12:57 | 162K | |
![[IMG]](/icons/image2.gif) | image8.jpeg | 2023-05-01 19:37 | 4.2M | |
![[IMG]](/icons/image2.gif) | image7.jpeg | 2023-05-01 19:37 | 1.3M | |
![[IMG]](/icons/image2.gif) | image5.jpeg | 2023-05-01 19:38 | 660K | |
![[IMG]](/icons/image2.gif) | image4.jpeg | 2023-05-01 19:36 | 2.1M | |
![[IMG]](/icons/image2.gif) | image3.jpeg | 2023-05-01 19:37 | 929K | |
![[IMG]](/icons/image2.gif) | image001.png | 2024-10-28 12:06 | 5.4K | |
![[IMG]](/icons/image2.gif) | image001.pdf_0.png | 2024-10-22 20:10 | 23K | |
![[ ]](/icons/layout.gif) | image001.pdf | 2024-10-22 20:10 | 19K | |
![[IMG]](/icons/image2.gif) | image001.jpg | 2023-09-13 21:40 | 74K | |
![[IMG]](/icons/image2.gif) | image0.jpeg | 2023-05-01 19:37 | 794K | |
![[IMG]](/icons/image2.gif) | image.png.svg | 2023-06-09 13:53 | 66K | |
![[IMG]](/icons/image2.gif) | image.png | 2023-06-09 13:53 | 126K | |
![[IMG]](/icons/image2.gif) | image(1).svg | 2023-02-08 14:03 | 1.0K | |
![[ ]](/icons/layout.gif) | ifb-c000771-in-building-voice-data-network-cabling-services-3.5.24.pdf | 2024-03-18 19:15 | 532K | |
![[ ]](/icons/layout.gif) | ifb-c000771-in-building-voice-data-network-cabling-services-3-5-24.pdf | 2024-03-18 19:47 | 532K | |
![[ ]](/icons/layout.gif) | ifb-c000770-voice-video-communication-services.pdf | 2024-04-01 11:51 | 428K | |
![[IMG]](/icons/image2.gif) | i6z86aisg6ryrolkbukj.avif | 2023-03-03 12:38 | 3.9K | |
![[IMG]](/icons/image2.gif) | housing.svg | 2023-05-05 09:49 | 8.8K | |
![[IMG]](/icons/image2.gif) | horizontal cable manager.png | 2023-04-25 13:12 | 58K | |
![[IMG]](/icons/image2.gif) | h_logo.png | 2023-12-22 16:28 | 2.1K | |
![[IMG]](/icons/image2.gif) | gswanson_1U_server_2.svg | 2023-02-27 21:54 | 6.6K | |
![[IMG]](/icons/image2.gif) | greenlee lubricant.jpg | 2023-05-04 12:21 | 6.8K | |
![[ ]](/icons/layout.gif) | grading and excavation.pdf | 2024-11-12 22:31 | 132K | |
![[ ]](/icons/unknown.gif) | grading and excavation.docx | 2024-11-12 22:25 | 76K | |
![[IMG]](/icons/image2.gif) | frontline rework.pdf0.png | 2023-05-19 20:16 | 36K | |
![[ ]](/icons/layout.gif) | frontline rework.pdf | 2023-05-19 20:16 | 30K | |
![[IMG]](/icons/image2.gif) | frontline rework (1).pdf0.png | 2023-05-22 16:26 | 47K | |
![[ ]](/icons/layout.gif) | frontline rework (1).pdf | 2023-05-22 16:26 | 46K | |
![[IMG]](/icons/image2.gif) | front door.jpeg | 2023-11-03 14:30 | 62K | |
![[IMG]](/icons/image2.gif) | fp1.png | 2025-11-21 06:11 | 968K | |
![[ ]](/icons/unknown.gif) | fp-test-1_details.json | 2025-11-21 06:06 | 1.7K | |
![[IMG]](/icons/image2.gif) | fort collins.pdf0.png | 2024-01-04 18:55 | 19K | |
![[ ]](/icons/layout.gif) | fort collins.pdf | 2024-01-04 18:55 | 50K | |
![[IMG]](/icons/image2.gif) | floorplan png to compressed pdf merge.pdf19.png | 2024-03-12 12:49 | 131K | |
![[IMG]](/icons/image2.gif) | floorplan png to compressed pdf merge.pdf18.png | 2024-03-12 12:49 | 243K | |
![[IMG]](/icons/image2.gif) | floorplan png to compressed pdf merge.pdf17.png | 2024-03-12 12:49 | 269K | |
![[IMG]](/icons/image2.gif) | floorplan png to compressed pdf merge.pdf16.png | 2024-03-12 12:49 | 249K | |
![[IMG]](/icons/image2.gif) | floorplan png to compressed pdf merge.pdf15.png | 2024-03-12 12:49 | 312K | |
![[IMG]](/icons/image2.gif) | floorplan png to compressed pdf merge.pdf14.png | 2024-03-12 12:49 | 304K | |
![[IMG]](/icons/image2.gif) | floorplan png to compressed pdf merge.pdf13.png | 2024-03-12 12:49 | 317K | |
![[IMG]](/icons/image2.gif) | floorplan png to compressed pdf merge.pdf12.png | 2024-03-12 12:49 | 248K | |
![[IMG]](/icons/image2.gif) | floorplan png to compressed pdf merge.pdf11.png | 2024-03-12 12:49 | 474K | |
![[IMG]](/icons/image2.gif) | floorplan png to compressed pdf merge.pdf10.png | 2024-03-12 12:49 | 235K | |
![[IMG]](/icons/image2.gif) | floorplan png to compressed pdf merge.pdf9.png | 2024-03-12 12:49 | 249K | |
![[IMG]](/icons/image2.gif) | floorplan png to compressed pdf merge.pdf8.png | 2024-03-12 12:49 | 206K | |
![[IMG]](/icons/image2.gif) | floorplan png to compressed pdf merge.pdf7.png | 2024-03-12 12:49 | 476K | |
![[IMG]](/icons/image2.gif) | floorplan png to compressed pdf merge.pdf6.png | 2024-03-12 12:49 | 381K | |
![[IMG]](/icons/image2.gif) | floorplan png to compressed pdf merge.pdf5.png | 2024-03-12 12:49 | 299K | |
![[IMG]](/icons/image2.gif) | floorplan png to compressed pdf merge.pdf4.png | 2024-03-12 12:49 | 332K | |
![[IMG]](/icons/image2.gif) | floorplan png to compressed pdf merge.pdf3.png | 2024-03-12 12:49 | 273K | |
![[IMG]](/icons/image2.gif) | floorplan png to compressed pdf merge.pdf2.png | 2024-03-12 12:49 | 224K | |
![[IMG]](/icons/image2.gif) | floorplan png to compressed pdf merge.pdf1.png | 2024-03-12 12:49 | 262K | |
![[IMG]](/icons/image2.gif) | floorplan png to compressed pdf merge.pdf0.png | 2024-03-12 12:49 | 291K | |
![[ ]](/icons/layout.gif) | floorplan png to compressed pdf merge.pdf | 2024-03-12 12:49 | 1.3M | |
![[IMG]](/icons/image2.gif) | floorplanpng.svg | 2023-04-15 10:17 | 8.4K | |
![[IMG]](/icons/image2.gif) | floorplan2.svg | 2023-03-07 17:56 | 11K | |
![[IMG]](/icons/image2.gif) | floor plan.pdf_0.png | 2025-04-08 13:29 | 1.4M | |
![[IMG]](/icons/image2.gif) | floorplan.pdf0.png | 2023-09-08 15:38 | 129K | |
![[IMG]](/icons/image2.gif) | floor plan.pdf0.png | 2024-09-13 12:47 | 167K | |
![[ ]](/icons/layout.gif) | floorplan.pdf | 2023-09-08 15:38 | 661K | |
![[ ]](/icons/layout.gif) | floor plan.pdf | 2025-04-08 13:29 | 228K | |
![[IMG]](/icons/image2.gif) | f jack.jpg | 2023-04-25 13:44 | 25K | |
![[IMG]](/icons/image2.gif) | fixed-cam-up-facing.svg | 2023-06-02 16:10 | 3.8K | |
![[IMG]](/icons/image2.gif) | first level.pdf0.png | 2024-01-19 21:19 | 112K | |
![[ ]](/icons/layout.gif) | first level.pdf | 2024-01-19 21:19 | 665K | |
![[IMG]](/icons/image2.gif) | firestop Putty.png | 2023-05-04 13:41 | 19K | |
![[IMG]](/icons/image2.gif) | file-example_PDF_500_kB.pdf4.png | 2023-05-17 07:05 | 51K | |
![[IMG]](/icons/image2.gif) | file-example_PDF_500_kB.pdf3.png | 2023-05-17 07:05 | 315K | |
![[IMG]](/icons/image2.gif) | file-example_PDF_500_kB.pdf2.png | 2023-05-17 07:05 | 236K | |
![[IMG]](/icons/image2.gif) | file-example_PDF_500_kB.pdf1.png | 2023-05-17 07:05 | 160K | |
![[IMG]](/icons/image2.gif) | file-example_PDF_500_kB.pdf0.png | 2023-05-17 07:05 | 117K | |
![[IMG]](/icons/image2.gif) | file-example_PDF_500_kB.pdf.svg | 2023-04-14 14:46 | 259K | |
![[ ]](/icons/layout.gif) | file-example_PDF_500_kB.pdf | 2023-05-17 07:05 | 459K | |
![[IMG]](/icons/image2.gif) | file-example_PDF_1MB.pdf.svg | 2023-04-14 14:52 | 259K | |
![[ ]](/icons/layout.gif) | file-example_PDF_1MB.pdf | 2023-04-14 14:53 | 1.0M | |
![[IMG]](/icons/image2.gif) | fiber cable (2).svg | 2023-05-05 08:53 | 12K | |
![[TXT]](/icons/text.gif) | fghfg-Telecommunication Outlets- Assets List.csv | 2023-02-10 14:08 | 3.6K | |
![[ ]](/icons/layout.gif) | feeReciept (1).pdf | 2024-09-18 13:53 | 99K | |
![[IMG]](/icons/image2.gif) | f-jack.png | 2023-04-19 20:59 | 100K | |
![[IMG]](/icons/image2.gif) | ez-path-44-main.jpeg | 2023-02-10 15:02 | 64K | |
![[IMG]](/icons/image2.gif) | ework-cam-0-15x0-25-pdf-down-facing.svg | 2023-06-06 16:21 | 177K | |
![[IMG]](/icons/image2.gif) | evon logo.png | 2025-07-30 13:35 | 1.1K | |
![[IMG]](/icons/image2.gif) | end cap.jpg | 2023-05-03 15:57 | 4.4K | |
![[IMG]](/icons/image2.gif) | elevation kit for rack.png | 2023-05-03 15:49 | 16K | |
![[IMG]](/icons/image2.gif) | ele kit for rack.svg | 2023-05-09 09:51 | 12K | |
![[ ]](/icons/layout.gif) | electrical.pdf | 2024-11-12 22:31 | 114K | |
![[ ]](/icons/unknown.gif) | electrical.docx | 2024-11-12 22:25 | 76K | |
![[ ]](/icons/layout.gif) | eastcreek lynkfast.pdf | 2023-03-07 17:54 | 1.8M | |
![[IMG]](/icons/image2.gif) | dummy.jpg.svg | 2023-05-19 08:09 | 50K | |
![[IMG]](/icons/image2.gif) | dummy.jpg | 2023-05-19 08:09 | 60K | |
![[IMG]](/icons/image2.gif) | duct sealer.jpg | 2023-04-25 17:25 | 129K | |
![[IMG]](/icons/image2.gif) | download yonkers.jpeg | 2024-01-22 20:27 | 13K | |
![[IMG]](/icons/image2.gif) | download.svg | 2023-05-11 16:23 | 1.0K | |
![[IMG]](/icons/image2.gif) | download (6).svg | 2023-05-22 17:00 | 150K | |
![[IMG]](/icons/image2.gif) | download (5).svg | 2023-05-22 16:07 | 150K | |
![[IMG]](/icons/image2.gif) | download (4).svg | 2023-05-12 08:48 | 1.0K | |
![[IMG]](/icons/image2.gif) | download (3).svg | 2023-05-11 18:49 | 922 | |
![[IMG]](/icons/image2.gif) | download (3).jpg | 2023-02-10 14:54 | 2.0K | |
![[IMG]](/icons/image2.gif) | download (2).svg | 2023-05-11 18:24 | 150K | |
![[IMG]](/icons/image2.gif) | download (2).png | 2023-04-17 13:01 | 2.8K | |
![[IMG]](/icons/image2.gif) | download (2).jpg | 2023-02-10 14:43 | 1.9K | |
![[IMG]](/icons/image2.gif) | download (1).svg | 2023-05-11 16:56 | 922 | |
![[IMG]](/icons/image2.gif) | download (1).png | 2023-05-05 09:25 | 2.7K | |
![[IMG]](/icons/image2.gif) | download (1).jpg | 2023-02-10 09:08 | 2.1K | |
![[IMG]](/icons/image2.gif) | door release button.jpg | 2023-05-01 18:13 | 7.9K | |
![[IMG]](/icons/image2.gif) | door controller.JPG | 2023-04-28 12:28 | 76K | |
![[IMG]](/icons/image2.gif) | dome svg.svg | 2023-05-05 16:50 | 6.3K | |
![[IMG]](/icons/image2.gif) | dome cam.jpg | 2023-05-05 16:58 | 7.8K | |
![[IMG]](/icons/image2.gif) | dome-camera-svgrepo-com.svg | 2023-04-26 17:27 | 3.9K | |
![[IMG]](/icons/image2.gif) | dodr release button.jpg | 2023-04-28 12:37 | 35K | |
![[IMG]](/icons/image2.gif) | disconnect.svg | 2023-05-10 17:09 | 1.3K | |
![[IMG]](/icons/image2.gif) | disconnect.png | 2023-05-10 17:09 | 3.7K | |
![[TXT]](/icons/text.gif) | dfghdfghfgg-Termination Hardware- Assets List.csv | 2023-02-10 11:11 | 2.6K | |
![[TXT]](/icons/text.gif) | dfghdfghfgg-Termination Hardware- Assets List (1).csv | 2023-02-10 12:57 | 5.3K | |
![[TXT]](/icons/text.gif) | dfghdfghfgg-Link Cables- Assets List.csv | 2023-02-10 09:25 | 1.4K | |
![[TXT]](/icons/text.gif) | dfghdfghfgg-Link Cables- Assets List (2).csv | 2023-02-10 10:43 | 2.8K | |
![[TXT]](/icons/text.gif) | dfghdfghfgg-Link Cables- Assets List (1).csv | 2023-02-10 10:37 | 2.5K | |
![[ ]](/icons/layout.gif) | denver cameras.pdf | 2023-02-13 20:53 | 349K | |
![[IMG]](/icons/image2.gif) | decoder legend.svg | 2023-05-26 11:31 | 45K | |
![[IMG]](/icons/image2.gif) | decoder.png | 2023-05-26 11:31 | 106K | |
![[IMG]](/icons/image2.gif) | dataComm 24 port modular panel.jpg | 2023-04-25 15:19 | 48K | |
![[IMG]](/icons/image2.gif) | cropped-M-CO-Logo-BlackGold-2.png | 2023-12-17 18:40 | 8.2K | |
![[IMG]](/icons/image2.gif) | crate berrel.pdf0.png | 2023-07-13 21:19 | 46K | |
![[ ]](/icons/layout.gif) | crate berrel.pdf | 2023-07-13 21:19 | 84K | |
![[IMG]](/icons/image2.gif) | co sprins 2.pdf0.png | 2024-01-08 21:38 | 576K | |
![[ ]](/icons/layout.gif) | co sprins 2.pdf | 2024-01-08 21:38 | 4.0M | |
![[IMG]](/icons/image2.gif) | co springs2.pdf0.png | 2024-01-09 19:18 | 18K | |
![[ ]](/icons/layout.gif) | co springs2.pdf | 2024-01-09 19:18 | 52K | |
![[IMG]](/icons/image2.gif) | corning 1 u patch panel.jpeg | 2023-02-28 17:53 | 19K | |
![[ ]](/icons/layout.gif) | copy_testing123456.pdf | 2023-06-23 12:39 | 288K | |
![[ ]](/icons/layout.gif) | copy_testing123456-TR-1::R-1.pdf | 2023-06-23 12:39 | 145K | |
![[ ]](/icons/layout.gif) | copy_testing123456-TR-1.pdf | 2023-06-23 12:39 | 17K | |
![[ ]](/icons/layout.gif) | copy_testing123456-HomePage.pdf | 2023-06-23 12:39 | 6.7K | |
![[ ]](/icons/layout.gif) | copy_testing123456-ER-1::2-post rack-1.pdf | 2023-06-23 12:39 | 109K | |
![[ ]](/icons/layout.gif) | copy_testing123456-ER-1.pdf | 2023-06-23 12:39 | 15K | |
![[TXT]](/icons/text.gif) | constructconnect-project-details.csv | 2024-01-29 01:17 | 2.8K | |
![[ ]](/icons/layout.gif) | cdot_form_1600_buyamerica.pdf | 2024-11-23 12:17 | 204K | |
![[IMG]](/icons/image2.gif) | cat 6 svg.svg | 2023-05-16 13:14 | 8.8K | |
![[IMG]](/icons/image2.gif) | cat 6 jack.png | 2023-05-16 17:19 | 162K | |
![[IMG]](/icons/image2.gif) | cat 6 jack.jpg | 2023-04-14 21:18 | 4.6K | |
![[IMG]](/icons/image2.gif) | cat 6 cable.svg | 2023-02-10 17:06 | 6.6K | |
![[IMG]](/icons/image2.gif) | cat 6 cable (1).jpg | 2023-02-10 17:32 | 40K | |
![[IMG]](/icons/image2.gif) | cat6a jack.jpeg | 2023-02-04 20:19 | 5.1K | |
![[IMG]](/icons/image2.gif) | cat 6A term plug.jpg | 2023-04-25 13:34 | 1.0K | |
![[IMG]](/icons/image2.gif) | cat6-patch-cable-systec-website-300x300.png | 2023-02-10 10:56 | 56K | |
![[ ]](/icons/unknown.gif) | canvas test new_details.json | 2025-07-10 14:30 | 19K | |
![[ ]](/icons/layout.gif) | canvas test new- Proposal Documents.pdf | 2025-06-16 10:47 | 901K | |
![[ ]](/icons/unknown.gif) | canvas test 2_details.json | 2025-06-23 12:06 | 1.3K | |
![[ ]](/icons/layout.gif) | camera placement.pdf | 2023-10-30 16:17 | 112K | |
![[IMG]](/icons/image2.gif) | cam 1.svg | 2023-05-26 15:38 | 2.6K | |
![[IMG]](/icons/image2.gif) | cam 1-1.svg | 2023-05-26 15:45 | 1.0K | |
![[IMG]](/icons/image2.gif) | cam 1-1.png | 2023-06-02 16:10 | 1.7K | |
![[IMG]](/icons/image2.gif) | cam-up-facing.svg | 2023-06-07 15:34 | 2.2K | |
![[IMG]](/icons/image2.gif) | cam-right-facing.svg | 2023-06-07 16:06 | 2.8K | |
![[IMG]](/icons/image2.gif) | cam-left-facing.svg | 2023-06-07 17:41 | 3.5K | |
![[IMG]](/icons/image2.gif) | cam-down-facing.svg | 2023-06-07 15:22 | 2.1K | |
![[IMG]](/icons/image2.gif) | cable-svgrepo-com.svg | 2023-04-17 12:26 | 1.6K | |
![[IMG]](/icons/image2.gif) | cabinet.svg | 2023-05-23 13:43 | 4.0K | |
![[IMG]](/icons/image2.gif) | cabinet.png | 2023-05-23 13:48 | 177K | |
![[ ]](/icons/unknown.gif) | c8f160742a3781421a5a43b028f02be0.logo_white_background-720x271.webp | 2023-05-09 19:58 | 5.8K | |
![[IMG]](/icons/image2.gif) | c-b.png | 2025-12-14 17:29 | 93K | |
![[IMG]](/icons/image2.gif) | c-3.png | 2025-12-14 17:29 | 385K | |
![[IMG]](/icons/image2.gif) | c-2.png | 2025-12-14 17:29 | 165K | |
![[IMG]](/icons/image2.gif) | c-1.png | 2025-12-14 17:29 | 122K | |
![[IMG]](/icons/image2.gif) | bullet svg.svg | 2023-05-05 16:58 | 2.7K | |
![[IMG]](/icons/image2.gif) | bullet cam.png | 2023-04-28 15:26 | 40K | |
![[ ]](/icons/unknown.gif) | build test11_details.json | 2025-06-25 13:12 | 1.3K | |
![[IMG]](/icons/image2.gif) | belden cat 6 cable.jpg | 2023-04-28 12:48 | 160K | |
![[IMG]](/icons/image2.gif) | b3f28d3f-f368-4da2-9193-26a68d0cf267.jpeg | 2023-11-01 17:31 | 66K | |
![[IMG]](/icons/image2.gif) | apc-surt6000rm.svg | 2023-02-27 21:50 | 22K | |
![[IMG]](/icons/image2.gif) | ap3.jpeg | 2023-09-20 19:38 | 87K | |
![[IMG]](/icons/image2.gif) | ap2.jpeg | 2023-09-20 19:38 | 88K | |
![[IMG]](/icons/image2.gif) | ap1.jpeg | 2023-09-20 19:38 | 42K | |
![[ ]](/icons/odf6odt-20x22.png) | angular basics.odt | 2025-06-11 13:12 | 18K | |
![[ ]](/icons/unknown.gif) | adams14 logo.webp | 2023-10-19 14:31 | 5.5K | |
![[IMG]](/icons/image2.gif) | act.pdf0.png | 2023-08-18 17:27 | 180K | |
![[ ]](/icons/layout.gif) | act.pdf | 2023-08-18 17:27 | 810K | |
![[IMG]](/icons/image2.gif) | achs-d-2nd.pdf0.png | 2023-10-11 12:21 | 147K | |
![[IMG]](/icons/image2.gif) | achs-d-2nd.pdf.svg | 2023-02-10 15:36 | 95K | |
![[ ]](/icons/layout.gif) | achs-d-2nd.pdf | 2023-10-11 12:21 | 75K | |
![[IMG]](/icons/image2.gif) | achs-d-1st.pdf0.png.svg | 2023-11-16 12:24 | 74K | |
![[IMG]](/icons/image2.gif) | achs-d-1st.pdf0.png | 2023-11-16 12:24 | 249K | |
![[IMG]](/icons/image2.gif) | achs-d-1st.pdf.svg | 2023-03-02 16:45 | 92K | |
![[ ]](/icons/layout.gif) | achs-d-1st.pdf | 2023-10-11 15:09 | 73K | |
![[IMG]](/icons/image2.gif) | achs-c-2nd.pdf0.png | 2023-10-23 13:30 | 140K | |
![[IMG]](/icons/image2.gif) | achs-c-2nd.pdf.svg | 2023-02-13 13:17 | 88K | |
![[ ]](/icons/layout.gif) | achs-c-2nd.pdf | 2023-10-23 13:30 | 69K | |
![[IMG]](/icons/image2.gif) | achs-c-1st.pdf0.png | 2023-10-11 13:25 | 243K | |
![[ ]](/icons/layout.gif) | achs-c-1st.pdf | 2023-10-11 13:25 | 69K | |
![[IMG]](/icons/image2.gif) | aa.svg | 2023-06-05 13:19 | 502 | |
![[ ]](/icons/layout.gif) | _FY25 Strasburg C2 Cabling.pdf | 2025-03-12 12:31 | 251K | |
![[IMG]](/icons/image2.gif) | ZsB25U01.svg | 2023-05-03 16:09 | 8.5K | |
![[ ]](/icons/unknown.gif) | York County Fiberoptic Cable Installation_details.json | 2024-11-12 12:14 | 7.5K | |
![[ ]](/icons/layout.gif) | York County Fiberoptic Cable Installation- Proposal Documents.pdf | 2024-11-12 12:14 | 4.9M | |
![[ ]](/icons/layout.gif) | York County Fiber Optic Installation Proposal.pdf | 2024-11-12 16:09 | 326K | |
![[ ]](/icons/layout.gif) | Xerox VersaLink C415_C625 Install & Configuration Guide T-Mobile Retail Stores v1-07-2025.pdf | 2025-10-31 20:59 | 2.0M | |
![[ ]](/icons/layout.gif) | Xerox VersaLink C400-C405-C505 Install & Configuration Guide T-Mobile v2-07-2025.pdf | 2025-10-31 20:59 | 469K | |
![[ ]](/icons/layout.gif) | Xerox C230 Install & Configuration Guide T-Mobile SiS locations v4-07-2025.pdf | 2025-10-31 20:59 | 459K | |
![[ ]](/icons/layout.gif) | Xerox B410 Install & Configuration Guide v1-07-2025.pdf | 2025-10-31 20:59 | 731K | |
![[ ]](/icons/layout.gif) | Working With Rize Construction.pdf | 2024-11-08 15:52 | 123K | |
![[ ]](/icons/layout.gif) | WorkersComp.pdf | 2024-02-10 23:23 | 221K | |
![[ ]](/icons/layout.gif) | Work_Zone_Safety_Part_2_Operations_US_Job_Aid_PS5-102985.pdf | 2024-11-23 12:38 | 104K | |
![[ ]](/icons/layout.gif) | Work_Zone_Safety_Part_1_Preparation_US_Job_Aid_PS5-102968.pdf | 2024-11-23 12:38 | 18K | |
![[ ]](/icons/layout.gif) | WorkOrder113969-99995-1204295.pdf | 2025-10-26 19:41 | 419K | |
![[ ]](/icons/layout.gif) | WorkOrder112508-04129-1186907.pdf | 2025-09-19 01:34 | 709K | |
![[ ]](/icons/layout.gif) | WorkOrder111937-99999-1162987.pdf | 2025-07-04 18:08 | 444K | |
![[ ]](/icons/layout.gif) | WorkOrder111705--1169689.pdf | 2025-07-04 17:44 | 1.0M | |
![[ ]](/icons/layout.gif) | WorkOrder111201-99998-1159018.pdf | 2025-05-19 13:08 | 1.0M | |
![[IMG]](/icons/image2.gif) | WorkOrder107281-00813-1154529.pdf_3.png | 2025-09-30 17:14 | 158K | |
![[IMG]](/icons/image2.gif) | WorkOrder107281-00813-1154529.pdf_2.png | 2025-09-30 17:14 | 196K | |
![[IMG]](/icons/image2.gif) | WorkOrder107281-00813-1154529.pdf_1.png | 2025-09-30 17:14 | 90K | |
![[IMG]](/icons/image2.gif) | WorkOrder107281-00813-1154529.pdf_0.png | 2025-09-30 17:14 | 281K | |
![[ ]](/icons/layout.gif) | WorkOrder107281-00813-1154529.pdf | 2025-09-30 17:14 | 602K | |
![[ ]](/icons/layout.gif) | WorkOrder.pdf | 2025-05-23 22:33 | 157K | |
![[ ]](/icons/layout.gif) | Wire Specs ALL Chains 12_06_24 (5).pdf | 2025-07-28 01:17 | 2.6M | |
![[IMG]](/icons/image2.gif) | Winnsupply Cam plan2.pdf.svg | 2023-03-07 19:22 | 25K | |
![[ ]](/icons/layout.gif) | Winnsupply Cam plan2.pdf | 2023-03-07 19:22 | 22K | |
![[ ]](/icons/unknown.gif) | Wingstop Demo_details.json | 2024-10-18 12:27 | 14K | |
![[IMG]](/icons/image2.gif) | Wingstop-E2 .pdf_0.png | 2024-10-18 13:23 | 7.6M | |
![[ ]](/icons/layout.gif) | Wingstop-E2 .pdf | 2024-10-18 13:23 | 622K | |
![[IMG]](/icons/image2.gif) | Windsor CO.pdf0.png | 2024-01-04 04:01 | 249K | |
![[ ]](/icons/layout.gif) | Windsor CO.pdf | 2024-01-04 04:01 | 1.3M | |
![[ ]](/icons/layout.gif) | What_If_Mentality_Job_Aid_PS5-00283.pdf | 2024-11-23 12:39 | 79K | |
![[IMG]](/icons/image2.gif) | West Building.png | 2024-06-03 23:56 | 142K | |
![[IMG]](/icons/image2.gif) | West Building.PNG | 2024-05-27 19:24 | 142K | |
![[IMG]](/icons/image2.gif) | Wallmart.pdf0.png | 2023-07-19 12:25 | 649K | |
![[ ]](/icons/layout.gif) | Wallmart.pdf | 2023-07-19 12:25 | 4.3M | |
![[ ]](/icons/layout.gif) | Walk through-81023 - Request for Proposal: Structured Cabling Replacement 2 facilites- Proposal Documents.pdf | 2025-07-30 13:36 | 3.7M | |
![[ ]](/icons/layout.gif) | Walking_and_Working_Surfaces_Job_Aid_PS5-01378.pdf | 2024-11-23 12:37 | 75K | |
![[ ]](/icons/layout.gif) | Wage Determination.pdf | 2025-09-18 19:30 | 4.7M | |
![[ ]](/icons/unknown.gif) | WORK ORDER # 272505 Replace (1) tstat cable and test_details.json | 2025-04-17 16:05 | 1.4K | |
![[ ]](/icons/unknown.gif) | WORK ORDER # 272346 T-Mobile 303 RT Equipment install and Testing_details.json | 2025-04-17 16:15 | 1.5K | |
![[ ]](/icons/unknown.gif) | WM Varick Transfer Station_details.json | 2024-12-06 12:58 | 1.9K | |
![[ ]](/icons/layout.gif) | WIFI Coverage Report .pdf | 2024-02-26 18:44 | 1.6M | |
![[IMG]](/icons/image2.gif) | WAX610_hero_tcm148-151117.jpg | 2023-07-06 01:32 | 16K | |
![[ ]](/icons/layout.gif) | W9-filled.pdf | 2024-02-10 23:23 | 119K | |
![[ ]](/icons/unknown.gif) | W-9Colorado-Vendors.docx | 2024-02-06 16:36 | 1.3M | |
![[IMG]](/icons/image2.gif) | Voice wall outlet(Black).svg | 2023-02-10 20:01 | 924 | |
![[IMG]](/icons/image2.gif) | Voice Floor outlet(Black).svg | 2023-02-10 20:02 | 1.3K | |
![[IMG]](/icons/image2.gif) | Vistas building 4 FP (pg,1).pdf0.png | 2023-07-13 15:17 | 162K | |
![[ ]](/icons/layout.gif) | Vistas building 4 FP (pg,1).pdf | 2023-07-13 15:17 | 394K | |
![[IMG]](/icons/image2.gif) | Vistas building 4-FP merged.pdf6.png | 2023-07-13 15:37 | 372K | |
![[IMG]](/icons/image2.gif) | Vistas building 4-FP merged.pdf5.png | 2023-07-13 15:37 | 466K | |
![[IMG]](/icons/image2.gif) | Vistas building 4-FP merged.pdf4.png | 2023-07-13 15:37 | 908K | |
![[IMG]](/icons/image2.gif) | Vistas building 4-FP merged.pdf3.png | 2023-07-13 15:37 | 450K | |
![[IMG]](/icons/image2.gif) | Vistas building 4-FP merged.pdf2.png | 2023-07-13 15:37 | 748K | |
![[IMG]](/icons/image2.gif) | Vistas building 4-FP merged.pdf1.png | 2023-07-13 15:37 | 588K | |
![[IMG]](/icons/image2.gif) | Vistas building 4-FP merged.pdf0.png | 2023-07-13 15:37 | 810K | |
![[ ]](/icons/layout.gif) | Vistas building 4-FP merged.pdf | 2023-07-13 15:37 | 2.1M | |
![[TXT]](/icons/text.gif) | Vistas at Donelson building 4-Termination Hardware- Assets List.csv | 2023-07-17 16:06 | 5.5K | |
![[TXT]](/icons/text.gif) | Vistas at Donelson building 4-Termination Hardware- Assets List (1).csv | 2023-07-17 19:43 | 6.3K | |
![[IMG]](/icons/image2.gif) | Vistas at Donelson building 4 - FP.pdf6.png | 2023-07-13 15:20 | 94K | |
![[IMG]](/icons/image2.gif) | Vistas at Donelson building 4 - FP.pdf5.png | 2023-07-13 15:20 | 85K | |
![[IMG]](/icons/image2.gif) | Vistas at Donelson building 4 - FP.pdf4.png | 2023-07-13 15:20 | 146K | |
![[IMG]](/icons/image2.gif) | Vistas at Donelson building 4 - FP.pdf3.png | 2023-07-13 15:20 | 128K | |
![[IMG]](/icons/image2.gif) | Vistas at Donelson building 4 - FP.pdf2.png | 2023-07-13 15:20 | 192K | |
![[IMG]](/icons/image2.gif) | Vistas at Donelson building 4 - FP.pdf1.png | 2023-07-13 15:20 | 143K | |
![[IMG]](/icons/image2.gif) | Vistas at Donelson building 4 - FP.pdf0.png | 2023-07-13 15:20 | 162K | |
![[ ]](/icons/layout.gif) | Vistas at Donelson building 4 - FP.pdf | 2023-07-13 15:19 | 1.8M | |
![[TXT]](/icons/text.gif) | Vistas at Donelson Building 4-Termination Hardware- Assets List (2).csv | 2023-07-19 12:05 | 4.8K | |
![[TXT]](/icons/text.gif) | Vistas at Donelson Building 4-Other Placements- Assets List.csv | 2023-07-19 12:43 | 10K | |
![[TXT]](/icons/text.gif) | Vistas at Donelson Building 4-Network Rack Devices- Assets List.csv | 2023-07-19 13:31 | 6.8K | |
![[ ]](/icons/layout.gif) | Vistas at Donelson - Voice Video Data plan.pdf | 2023-04-17 09:40 | 692K | |
![[IMG]](/icons/image2.gif) | Vistas at Donelson - Voice Video Data new-2.png.svg | 2023-04-18 06:45 | 1.5M | |
![[IMG]](/icons/image2.gif) | Vistas at Donelson - Voice Video Data new-2.png | 2023-04-18 06:45 | 448K | |
![[IMG]](/icons/image2.gif) | Vistas at Donelson - Voice Video Data new-1.png.svg | 2023-04-18 08:40 | 2.1M | |
![[IMG]](/icons/image2.gif) | Vistas at Donelson - Voice Video Data new-1.png | 2023-04-18 08:40 | 512K | |
![[IMG]](/icons/image2.gif) | Vistas at Donelson - FP to upload.pdf6.png | 2023-07-13 15:21 | 194K | |
![[IMG]](/icons/image2.gif) | Vistas at Donelson - FP to upload.pdf5.png | 2023-07-13 15:21 | 373K | |
![[IMG]](/icons/image2.gif) | Vistas at Donelson - FP to upload.pdf4.png | 2023-07-13 15:21 | 387K | |
![[IMG]](/icons/image2.gif) | Vistas at Donelson - FP to upload.pdf3.png | 2023-07-13 15:21 | 354K | |
![[IMG]](/icons/image2.gif) | Vistas at Donelson - FP to upload.pdf2.png | 2023-07-13 15:21 | 389K | |
![[IMG]](/icons/image2.gif) | Vistas at Donelson - FP to upload.pdf1.png | 2023-07-13 15:21 | 314K | |
![[IMG]](/icons/image2.gif) | Vistas at Donelson - FP to upload.pdf0.png | 2023-07-13 15:21 | 351K | |
![[ ]](/icons/layout.gif) | Vistas at Donelson - FP to upload.pdf | 2023-07-13 15:21 | 4.3M | |
![[ ]](/icons/layout.gif) | Vistas Total.pdf | 2023-08-24 12:27 | 701K | |
![[TXT]](/icons/text.gif) | Vistas Total-Termination Hardware- Assets List.csv | 2023-07-18 09:11 | 6.3K | |
![[ ]](/icons/layout.gif) | Vistas Total-HomePage.pdf | 2023-08-24 12:27 | 701K | |
![[TXT]](/icons/text.gif) | Vistas Total-Assets- Assets List.csv | 2023-05-05 09:33 | 100K | |
![[ ]](/icons/unknown.gif) | Video Surveillance System Installation in Oakland, CA, at the Ronald Dellums Federal Building and Courthouse_details.json | 2024-11-06 13:57 | 1.5K | |
![[ ]](/icons/layout.gif) | Vicinity_Map.pdf | 2024-10-21 20:18 | 1.1M | |
![[ ]](/icons/layout.gif) | Vendor Questionnaire.pdf | 2024-12-02 20:12 | 98K | |
![[ ]](/icons/layout.gif) | Vendor Information.pdf | 2025-11-02 14:35 | 75K | |
![[ ]](/icons/layout.gif) | Vector-Borne_Disease_Awareness_Job_Aid_PS5-102687.pdf | 2024-11-23 12:35 | 93K | |
![[ ]](/icons/unknown.gif) | VSS Installation Denver Federal Center (DFC) Building 56 _details.json | 2024-10-28 17:14 | 1.4K | |
![[ ]](/icons/layout.gif) | VSS Installation - Cut Sheets.pdf | 2024-10-28 17:34 | 15M | |
![[ ]](/icons/layout.gif) | VIDEO STORAGE CALCULATION.pdf | 2024-10-28 17:34 | 161K | |
![[ ]](/icons/layout.gif) | Utilites.pdf | 2024-11-12 22:32 | 123K | |
![[ ]](/icons/layout.gif) | Using_Eyewashes_and_Emergency_Showers_Job_Aid_PS5-101017.pdf | 2024-11-23 12:35 | 83K | |
![[ ]](/icons/layout.gif) | Using_Electrical_Safety_Programs_US_Job_Aid_PS5-00207.pdf | 2024-11-23 12:40 | 44K | |
![[DIR]](/icons/folder.gif) | User/ | 2025-11-17 11:41 | - | |
![[ ]](/icons/unknown.gif) | Upgrade Information Technology - Wing Hall & Wing Hall Wing_details.json | 2024-11-05 21:12 | 1.4K | |
![[IMG]](/icons/image2.gif) | Untitled spreadsheet - Google Sheets.pdf1.png | 2024-06-04 23:15 | 20K | |
![[IMG]](/icons/image2.gif) | Untitled spreadsheet - Google Sheets.pdf0.png | 2024-06-04 23:15 | 47K | |
![[ ]](/icons/layout.gif) | Untitled spreadsheet - Google Sheets.pdf | 2024-06-04 23:15 | 257K | |
![[ ]](/icons/layout.gif) | Untitled document (3).pdf | 2025-09-17 21:11 | 50K | |
![[ ]](/icons/layout.gif) | Untitled 4.pdf | 2023-03-10 19:14 | 1.0M | |
![[ ]](/icons/layout.gif) | Untitled 3.pdf | 2023-03-10 19:11 | 1.0M | |
![[IMG]](/icons/image2.gif) | Untitled 2.pdf.svg | 2023-04-15 18:11 | 500K | |
![[ ]](/icons/layout.gif) | Untitled 2.pdf | 2023-04-15 18:11 | 637K | |
![[IMG]](/icons/image2.gif) | Untitled 2.jpg.svg | 2023-10-25 19:39 | 30K | |
![[IMG]](/icons/image2.gif) | Untitled 2.jpg | 2023-10-25 19:39 | 75K | |
![[IMG]](/icons/image2.gif) | Untitled.pdf0.png | 2024-01-03 02:23 | 523K | |
![[ ]](/icons/layout.gif) | Untitled.pdf | 2024-01-03 02:23 | 2.4M | |
![[ ]](/icons/layout.gif) | Unknown.pdf | 2024-10-14 19:48 | 245K | |
![[ ]](/icons/unknown.gif) | Unified-CMSFS Fiber Optic Cable Installation_details.json | 2025-06-16 12:42 | 14K | |
![[ ]](/icons/layout.gif) | Undoing daisy-chaining on registers (1).pdf | 2024-03-18 16:38 | 57K | |
![[ ]](/icons/unknown.gif) | USAFA Madera Center Monitor Installation_details.json | 2025-02-03 14:49 | 1.4K | |
![[ ]](/icons/layout.gif) | USAC_FCC_FORM_470_APPLICATION_250020482_CERTIFIED.pdf | 2025-02-10 13:22 | 26K | |
![[ ]](/icons/layout.gif) | UNC_DQ_222_23_Frasier_Data_Upgrade_Project_Manual copy_ tech plan (3).pdf | 2023-04-04 17:01 | 1.4M | |
![[IMG]](/icons/image2.gif) | Typical_Classroom (1).png | 2024-10-14 19:48 | 65K | |
![[ ]](/icons/unknown.gif) | Tuckernuck NYC_details.json | 2025-05-22 18:25 | 2.8K | |
![[ ]](/icons/unknown.gif) | Tuckernuck NYC Speaker Install_details.json | 2025-08-15 22:04 | 2.5K | |
![[IMG]](/icons/image2.gif) | Triple Data Wall Outlet(Blue).svg | 2023-02-10 19:13 | 2.0K | |
![[ ]](/icons/unknown.gif) | Transformation Warehouse Telecommunications Cabling and Work Area Outlets_details.json | 2025-01-03 21:56 | 1.4K | |
![[IMG]](/icons/image2.gif) | Training room Loveland.pdf0.png | 2023-05-23 11:59 | 31K | |
![[ ]](/icons/layout.gif) | Training room Loveland.pdf | 2023-05-23 11:59 | 32K | |
![[ ]](/icons/layout.gif) | Town Sq_ Gilber AZ conduit path_ SGilbertRd_WCypressSt_SEC_D1-8 Base File Update (2).pdf | 2023-03-02 19:44 | 548K | |
![[IMG]](/icons/image2.gif) | Tone and Tag.jpg.svg | 2023-07-13 16:02 | 78K | |
![[IMG]](/icons/image2.gif) | Tone and Tag.jpg | 2023-07-13 16:16 | 79K | |
![[IMG]](/icons/image2.gif) | Tone & Tag SVG.svg | 2023-07-19 13:24 | 32K | |
![[IMG]](/icons/image2.gif) | Tone & Tag.jpg | 2023-07-19 13:24 | 79K | |
![[ ]](/icons/unknown.gif) | T mobile decom test_details.json | 2025-12-15 14:41 | 5.8K | |
![[IMG]](/icons/image2.gif) | Time clock.jpg | 2023-05-22 09:46 | 7.5K | |
![[IMG]](/icons/image2.gif) | Time-clock.svg | 2023-05-11 16:10 | 7.1K | |
![[ ]](/icons/unknown.gif) | Tillster Surveys, Bronx, Brooklyn, New Rochelle,Danbury_details.json | 2025-11-09 16:59 | 1.8K | |
![[ ]](/icons/unknown.gif) | Tillster Survey_details.json | 2025-11-07 12:26 | 1.6K | |
![[IMG]](/icons/image2.gif) | Third floor prints.pdf0.png | 2024-09-11 15:53 | 187K | |
![[ ]](/icons/layout.gif) | Third floor prints.pdf | 2024-09-11 15:53 | 1.1M | |
![[IMG]](/icons/image2.gif) | Third Floor.png.svg | 2024-02-17 17:20 | 336K | |
![[IMG]](/icons/image2.gif) | Third Floor.png | 2024-02-17 17:20 | 664K | |
![[ ]](/icons/layout.gif) | The_Little_School_on_Perry_St_-_Civil___Landscape_Construction_Plans.pdf | 2024-04-23 12:19 | 22M | |
![[ ]](/icons/layout.gif) | The_Little_School_on_Perry_St_-_Building_Construction_Plans.pdf | 2024-04-23 12:19 | 43M | |
![[ ]](/icons/layout.gif) | The_Little_School_on_Perry_St._-_Building_Construction_Plans.pdf | 2024-04-23 12:18 | 43M | |
![[ ]](/icons/unknown.gif) | The Little School on Perry Street - Structured Cabling Proposal.xlsx | 2024-04-25 10:25 | 84K | |
![[ ]](/icons/layout.gif) | The Little School on Perry Street - Structured Cabling Proposal.pdf | 2024-04-25 10:25 | 154K | |
![[ ]](/icons/layout.gif) | Textura_Costs.pdf | 2024-11-21 16:49 | 479K | |
![[ ]](/icons/unknown.gif) | Test project copy_details.json | 2025-08-19 10:10 | 17K | |
![[ ]](/icons/unknown.gif) | Test project_details.json | 2025-10-26 12:13 | 1.3K | |
![[ ]](/icons/layout.gif) | Testing location.pdf | 2023-06-26 13:07 | 167K | |
![[ ]](/icons/layout.gif) | Testing location-TR-1::R-1.pdf | 2023-06-26 13:07 | 149K | |
![[ ]](/icons/layout.gif) | Testing location-TR-1.pdf | 2023-06-26 13:07 | 16K | |
![[ ]](/icons/layout.gif) | Testing location-HomePage.pdf | 2023-06-26 13:07 | 4.2K | |
![[ ]](/icons/layout.gif) | Testing (6A project)-Bill of Materials.pdf | 2023-08-28 09:00 | 3.1M | |
![[ ]](/icons/unknown.gif) | Test Results | 2025-06-12 07:59 | 2.5M | |
![[ ]](/icons/unknown.gif) | Test Project_details.json | 2025-02-27 17:37 | 16K | |
![[ ]](/icons/unknown.gif) | Tesla Warehouse Anglewood_details.json | 2024-10-21 20:16 | 1.4K | |
![[ ]](/icons/layout.gif) | Tesla Sign Spec Book.pdf | 2024-03-29 16:23 | 13M | |
![[ ]](/icons/unknown.gif) | Tesla Englewood CO Collision Center_details.json | 2025-07-30 13:12 | 1.4K | |
![[ ]](/icons/layout.gif) | Tesla - Englewood, CO - Plans.pdf | 2025-07-30 13:15 | 70M | |
![[ ]](/icons/layout.gif) | Terms & Conditions - Event 453.pdf | 2025-09-04 13:36 | 140K | |
![[IMG]](/icons/image2.gif) | Termination image.jpg | 2023-07-17 16:55 | 24K | |
![[IMG]](/icons/image2.gif) | Termination SVG.svg | 2023-07-13 16:35 | 14K | |
![[ ]](/icons/unknown.gif) | Template for Panduit CAT6A_details.json | 2025-04-08 14:47 | 1.3K | |
![[DIR]](/icons/folder.gif) | Temp/ | 2025-12-16 16:11 | - | |
![[ ]](/icons/layout.gif) | Telecommunications Room.pdf | 2023-03-23 11:58 | 2.8K | |
![[TXT]](/icons/text.gif) | Telecommunication Outlets- Assets List.csv | 2023-02-27 19:36 | 8.4K | |
![[IMG]](/icons/image2.gif) | Telecommunication Closet.svg | 2023-02-11 19:28 | 1.0K | |
![[TXT]](/icons/text.gif) | Telecom Outlet list import.csv | 2023-05-04 20:29 | 7.9K | |
![[TXT]](/icons/text.gif) | Telecom Outlet list.csv | 2023-05-04 20:33 | 7.8K | |
![[ ]](/icons/unknown.gif) | Ted- Demo_details.json | 2024-10-18 13:39 | 24K | |
![[ ]](/icons/layout.gif) | Technical specifications.pdf | 2024-12-02 20:12 | 86K | |
![[ ]](/icons/layout.gif) | Tech Infrastructure- Structure Cabling Services V2.pdf | 2024-10-10 13:47 | 568K | |
![[ ]](/icons/layout.gif) | TaxReturn DRAFT.pdf | 2024-04-03 13:42 | 596K | |
![[ ]](/icons/layout.gif) | Tatte - 315 PAS - Low Voltage Scope.pdf | 2025-09-16 18:30 | 2.2M | |
![[ ]](/icons/layout.gif) | Tatte - 2nd Ave - Low Voltage Scope.pdf | 2025-09-17 21:09 | 2.3M | |
![[ ]](/icons/layout.gif) | Tasks_and_Corrective_Actions_Job_Aid_PS5-100319.pdf | 2024-11-23 12:39 | 97K | |
![[DIR]](/icons/folder.gif) | Tasks/ | 2025-12-15 17:14 | - | |
![[ ]](/icons/layout.gif) | Table of Contents.pdf | 2024-04-29 20:02 | 51K | |
![[IMG]](/icons/image2.gif) | TV.jpeg | 2023-07-22 09:50 | 77K | |
![[ ]](/icons/layout.gif) | TSC_-_Hudson__CO_-_Review_Set.pdf | 2024-05-22 18:39 | 12M | |
![[IMG]](/icons/image2.gif) | TSC (RCC) PO2888 Systec101 $135,736.19 Vendor Copy.pdf7.png | 2024-08-12 13:32 | 122K | |
![[IMG]](/icons/image2.gif) | TSC (RCC) PO2888 Systec101 $135,736.19 Vendor Copy.pdf6.png | 2024-08-12 13:32 | 139K | |
![[IMG]](/icons/image2.gif) | TSC (RCC) PO2888 Systec101 $135,736.19 Vendor Copy.pdf5.png | 2024-08-12 13:32 | 220K | |
![[IMG]](/icons/image2.gif) | TSC (RCC) PO2888 Systec101 $135,736.19 Vendor Copy.pdf4.png | 2024-08-12 13:32 | 154K | |
![[IMG]](/icons/image2.gif) | TSC (RCC) PO2888 Systec101 $135,736.19 Vendor Copy.pdf3.png | 2024-08-12 13:32 | 145K | |
![[IMG]](/icons/image2.gif) | TSC (RCC) PO2888 Systec101 $135,736.19 Vendor Copy.pdf2.png | 2024-08-12 13:32 | 166K | |
![[IMG]](/icons/image2.gif) | TSC (RCC) PO2888 Systec101 $135,736.19 Vendor Copy.pdf1.png | 2024-08-12 13:32 | 146K | |
![[IMG]](/icons/image2.gif) | TSC (RCC) PO2888 Systec101 $135,736.19 Vendor Copy.pdf0.png | 2024-08-12 13:32 | 205K | |
![[ ]](/icons/layout.gif) | TSC (RCC) PO2888 Systec101 $135,736.19 Vendor Copy.pdf | 2024-08-12 13:31 | 3.0M | |
![[ ]](/icons/layout.gif) | TR-2.pdf | 2023-03-17 21:55 | 3.2K | |
![[ ]](/icons/layout.gif) | TR-1::TR-1.pdf | 2023-03-23 11:58 | 2.8K | |
![[ ]](/icons/layout.gif) | TR-1::R-1.pdf | 2023-03-27 14:24 | 23K | |
![[ ]](/icons/layout.gif) | TR-1.pdf | 2023-03-27 14:24 | 23K | |
![[ ]](/icons/unknown.gif) | T Mobile Test_details.json | 2025-10-31 20:45 | 10K | |
![[ ]](/icons/unknown.gif) | TJX US Store System Vendor Guide v.1 (10).docx | 2025-07-28 01:18 | 9.0M | |
![[ ]](/icons/unknown.gif) | TJX US Store System Vendor Guide .docx | 2025-07-28 01:20 | 9.0M | |
![[ ]](/icons/layout.gif) | TJX Run book_Cutover v10.pdf | 2025-08-06 21:53 | 4.5M | |
![[ ]](/icons/layout.gif) | TJX Run book_Cutover v1.0.pdf | 2025-08-06 21:53 | 4.5M | |
![[IMG]](/icons/image2.gif) | TGIF Denver CO.pdf0.png | 2023-07-06 01:27 | 143K | |
![[ ]](/icons/layout.gif) | TGIF Denver CO.pdf | 2023-07-06 01:27 | 100K | |
![[IMG]](/icons/image2.gif) | TEST Central 11 x 17 (1).png.svg | 2023-04-17 13:43 | 261K | |
![[IMG]](/icons/image2.gif) | TEST Central 11 x 17 (1).png | 2023-04-17 13:43 | 211K | |
![[IMG]](/icons/image2.gif) | TBH West.pdf0.png | 2024-04-18 13:10 | 97K | |
![[ ]](/icons/layout.gif) | TBH West.pdf | 2024-04-18 13:10 | 115K | |
![[ ]](/icons/layout.gif) | TBH Project Q and A 012924.pdf | 2024-02-09 11:58 | 64K | |
![[ ]](/icons/layout.gif) | TBH Low Voltage Rewire Project 012524.pdf | 2024-04-18 13:00 | 286K | |
![[IMG]](/icons/image2.gif) | TBH East.pdf0.png.svg | 2024-05-20 08:08 | 165K | |
![[IMG]](/icons/image2.gif) | TBH East.pdf0.png | 2024-05-20 08:08 | 122K | |
![[ ]](/icons/layout.gif) | TBH East.pdf | 2024-04-18 13:10 | 145K | |
![[IMG]](/icons/image2.gif) | TBE logo.jpg | 2023-03-03 10:35 | 7.8K | |
![[ ]](/icons/unknown.gif) | TATTE BAKERY & CAFÉ Park Ave Cabling and Hardware Install_details.json | 2025-09-17 22:31 | 102K | |
![[ ]](/icons/unknown.gif) | TATTE BAKERY & CAFÉ Cabling and Hardware Install_details.json | 2025-09-17 22:29 | 110K | |
![[ ]](/icons/unknown.gif) | TATTE BAKERY & CAFÉ Cabling abd Hardware Install_details.json | 2025-09-16 17:28 | 1.4K | |
![[ ]](/icons/unknown.gif) | TATTE BAKERY & CAFÉ 2nd Ave Cabling and Hardware Install_details.json | 2025-09-17 22:31 | 102K | |
![[ ]](/icons/layout.gif) | T103B - Structured Cabling Plan - 3 FL East IT (Final) (1).pdf | 2024-10-09 16:03 | 18M | |
![[ ]](/icons/layout.gif) | T103A - Structured Cabling Plan - 3 FL West Finance (Final).pdf | 2024-10-09 16:03 | 3.7M | |
![[ ]](/icons/unknown.gif) | T102C - Structured Cabling Plan - 2 FL West End PD (Final)(For Reference).PDF | 2024-10-09 16:08 | 5.7M | |
![[ ]](/icons/unknown.gif) | T102B - Structured Cabling Plan - 2 FL West PD (Final).PDF | 2024-10-09 16:04 | 12M | |
![[IMG]](/icons/image2.gif) | T102A - Structured Cabling - 2 FL East CD (Final).PDF_0.png | 2024-10-10 19:07 | 5.2M | |
![[ ]](/icons/unknown.gif) | T102A - Structured Cabling - 2 FL East CD (Final).PDF | 2024-10-10 19:07 | 3.7M | |
![[ ]](/icons/unknown.gif) | T101C Structured Cabling - Base PD East (Final)(For Reference).PDF | 2024-10-09 16:06 | 8.0M | |
![[ ]](/icons/layout.gif) | T101B Structured Cabling - Base PD West (Final).pdf | 2024-10-09 16:04 | 15M | |
![[ ]](/icons/unknown.gif) | T0648 W Springfield, MA Register swap_details.json | 2025-01-16 20:49 | 2.9K | |
![[IMG]](/icons/image2.gif) | T0034 Highlands Ranch CO LP Cameras.pdf0.png | 2023-07-17 11:20 | 1.7M | |
![[ ]](/icons/layout.gif) | T0034 Highlands Ranch CO LP Cameras.pdf | 2023-07-17 11:20 | 3.6M | |
![[ ]](/icons/unknown.gif) | T-mobile 9187 RT Equipment Install_details.json | 2025-06-19 10:53 | 3.5K | |
![[ ]](/icons/unknown.gif) | T-Mobile RT Remodel-Experience 2025- CHANGE ORDER Low Voltage Permit_details.json | 2025-11-03 02:37 | 1.4K | |
![[ ]](/icons/unknown.gif) | T-Mobile 9956 Yonkers NY LED,Turnover and Audit_details.json | 2025-12-04 23:14 | 2.1K | |
![[ ]](/icons/unknown.gif) | T-Mobile 9956 Yonkers NY- Rough in Wiring_details.json | 2025-09-29 15:36 | 1.8K | |
![[ ]](/icons/unknown.gif) | T-Mobile 9956 Yonkers NY- Equipment Install_details.json | 2025-12-04 23:07 | 3.9K | |
![[ ]](/icons/unknown.gif) | T-Mobile 9956 Yonkers NY-Decom_details.json | 2025-09-15 22:14 | 6.8K | |
![[ ]](/icons/unknown.gif) | T-Mobile 9254 LED Install_details.json | 2025-09-03 23:48 | 1.6K | |
![[ ]](/icons/unknown.gif) | T-Mobile 9254 LED Install,Turnover and Audit_details.json | 2025-09-29 18:58 | 9.4K | |
![[ ]](/icons/unknown.gif) | T-Mobile 9254-Decom _details.json | 2025-08-15 21:27 | 2.7K | |
![[ ]](/icons/unknown.gif) | T-Mobile 9187 Rough in Wiring_details.json | 2025-06-18 23:55 | 2.6K | |
![[ ]](/icons/unknown.gif) | T-Mobile 9187 Printer Issue_details.json | 2025-07-18 02:26 | 1.8K | |
![[ ]](/icons/unknown.gif) | T-Mobile 9187 LED Install_details.json | 2025-07-04 19:09 | 1.8K | |
![[ ]](/icons/unknown.gif) | T-Mobile 9187 - Decom_details.json | 2025-07-04 19:04 | 2.0K | |
![[ ]](/icons/unknown.gif) | T-Mobile 8958 Return Visit Printers and APs_details.json | 2025-12-04 22:45 | 2.3K | |
![[ ]](/icons/unknown.gif) | T-Mobile 8958 Aurora CO - Rough in Wiring_details.json | 2025-10-26 20:38 | 15K | |
![[ ]](/icons/unknown.gif) | T-Mobile 8958 Aurora CO - Install_details.json | 2025-12-04 22:39 | 4.1K | |
![[ ]](/icons/unknown.gif) | T-Mobile 8958 Aurora CO-Decom_details.json | 2025-09-15 22:08 | 7.3K | |
![[ ]](/icons/unknown.gif) | T-Mobile 8958,Turnover and Audit_details.json | 2025-12-04 22:17 | 3.1K | |
![[ ]](/icons/unknown.gif) | T-Mobile 8757 Aurora CO - Rough in Wiring_details.json | 2025-12-04 22:53 | 7.6K | |
![[ ]](/icons/unknown.gif) | T-Mobile 8757 Arvada CO - Rough in Wiring_details.json | 2025-12-04 22:55 | 6.3K | |
![[ ]](/icons/unknown.gif) | T-Mobile 8757 Arvada CO - RT Equipment Install_details.json | 2025-12-04 22:59 | 3.5K | |
![[ ]](/icons/unknown.gif) | T-Mobile 8757 Arvada CO-Decom_details.json | 2025-12-04 22:51 | 2.8K | |
![[ ]](/icons/unknown.gif) | T-Mobile 8757 Arvada,LED,Turnover and Audit_details.json | 2025-12-04 23:02 | 2.1K | |
![[ ]](/icons/unknown.gif) | T-Mobile 4445 RT Equipment Install_details.json | 2025-05-06 12:39 | 4.3K | |
![[ ]](/icons/unknown.gif) | T-Mobile 4445 Full store Remodel- Rough-in Wiring_details.json | 2025-04-19 00:50 | 3.9K | |
![[ ]](/icons/unknown.gif) | T-Mobile 4445 Full store Remodel- Experience Design_details.json | 2025-04-04 17:15 | 4.1K | |
![[ ]](/icons/unknown.gif) | T-Mobile 4445 Full store Remodel- Decom_details.json | 2025-04-04 17:37 | 2.1K | |
![[ ]](/icons/unknown.gif) | T-Mobile 4153 Longmont CO-DFW Swap_details.json | 2025-12-04 23:20 | 2.1K | |
![[ ]](/icons/unknown.gif) | T-Mobile-9254 Rough in Wiring_details.json | 2025-10-12 17:07 | 2.3K | |
![[ ]](/icons/unknown.gif) | T-Mobile-9254 Equipment Install_details.json | 2025-09-03 23:42 | 3.8K | |
![[ ]](/icons/unknown.gif) | T-Mobile-3SPQ-Fixture move New York, NY_details.json | 2025-06-20 00:27 | 1.7K | |
![[ ]](/icons/layout.gif) | Systec101 Proposal for 2025-008 Library Wiring.pdf | 2025-07-16 00:42 | 1.2M | |
![[ ]](/icons/layout.gif) | Systec101 - Proposal VSS Installation - 70RFPW24QW8000002 - Denver Federal Center.pdf | 2024-10-28 17:35 | 159K | |
![[DIR]](/icons/folder.gif) | Systec/ | 2023-10-03 11:41 | - | |
![[ ]](/icons/unknown.gif) | Syncfusion 1_details.json | 2024-11-11 12:39 | 1.9K | |
![[ ]](/icons/layout.gif) | Syncfusion 1- Proposal Documents.pdf | 2024-11-11 13:04 | 334K | |
![[ ]](/icons/layout.gif) | Switch Ports.pdf | 2023-06-21 17:35 | 293K | |
![[ ]](/icons/layout.gif) | Supplier Portal User Guide - Viewing & Responding to Events.pdf | 2025-09-04 13:36 | 297K | |
![[ ]](/icons/layout.gif) | Supplier Portal User Guide - Registration & Account Management Instructions.pdf | 2025-09-04 13:36 | 218K | |
![[ ]](/icons/layout.gif) | Supplier Diversity Programs FAQ.pdf | 2025-09-04 13:36 | 444K | |
![[ ]](/icons/layout.gif) | Sundar-low_voltage.pdf | 2024-02-11 00:01 | 12M | |
![[ ]](/icons/layout.gif) | Submission Requirements & Scoring Criteria - Event 453.pdf | 2025-09-04 13:36 | 546K | |
![[ ]](/icons/layout.gif) | SubmissionReceipt-DiversityAndInclusivenessInCitySolicitationsInformationRequestForm-3229.pdf | 2024-02-10 23:23 | 27K | |
![[ ]](/icons/layout.gif) | Sub PO - TR20230404.5639.pdf | 2023-12-12 14:05 | 130K | |
![[ ]](/icons/layout.gif) | Sub PO - TR20230404-5639.pdf | 2023-11-02 14:24 | 130K | |
![[ ]](/icons/layout.gif) | Sub PO - 20230824_6474.pdf | 2023-11-03 18:02 | 134K | |
![[ ]](/icons/layout.gif) | Sub PO - 20230824_6474 (2).pdf | 2023-11-03 22:22 | 136K | |
![[ ]](/icons/layout.gif) | Sub PO - 20230824_6474 (1).pdf | 2023-11-03 18:47 | 134K | |
![[ ]](/icons/unknown.gif) | Structures Cabling System for LCMS_details.json | 2024-10-09 18:18 | 1.5K | |
![[ ]](/icons/layout.gif) | Structured_Cabling_RFP (1).pdf | 2024-10-14 19:48 | 275K | |
![[ ]](/icons/layout.gif) | Structural steel.pdf | 2024-11-12 22:32 | 122K | |
![[ ]](/icons/layout.gif) | Struck-By_Caught-Between_for_Construction_Job_Aid_PS5-103640.pdf | 2024-11-23 13:00 | 129K | |
![[IMG]](/icons/image2.gif) | Strain relief bar SVG.svg | 2023-07-19 13:51 | 900 | |
![[ ]](/icons/layout.gif) | Store Sign Off.pdf | 2024-03-18 16:38 | 17K | |
![[ ]](/icons/unknown.gif) | Stonybrook University Tabler Quad New Residence H_details.json | 2024-12-27 16:51 | 1.4K | |
![[ ]](/icons/layout.gif) | Stony Brook Cottage-Bill of Materials.pdf | 2024-02-14 22:41 | 14M | |
![[IMG]](/icons/image2.gif) | Stoneybrook Cottage network cabling Floor plan.pdf0.png | 2024-02-13 18:13 | 46K | |
![[ ]](/icons/layout.gif) | Stoneybrook Cottage network cabling Floor plan.pdf | 2024-02-13 18:23 | 1.5M | |
![[ ]](/icons/layout.gif) | Stoneybrook Cottage Security Scope of Work.pdf | 2024-02-13 18:27 | 263K | |
![[ ]](/icons/layout.gif) | Stoneybrook Cottage Security Floor plan - Security (1).pdf | 2024-02-13 18:23 | 236K | |
![[ ]](/icons/layout.gif) | Stoneybrook Cottage Scope of work .pdf | 2024-02-13 18:26 | 1.7M | |
![[ ]](/icons/layout.gif) | Steel Framing.pdf | 2024-11-12 22:32 | 116K | |
![[IMG]](/icons/image2.gif) | Static Camera.svg | 2023-05-25 16:50 | 1.0K | |
![[IMG]](/icons/image2.gif) | Static Camera.png | 2023-05-25 16:50 | 7.5K | |
![[ ]](/icons/layout.gif) | Statement of Disclosures.pdf | 2024-02-02 15:43 | 888K | |
![[ ]](/icons/layout.gif) | Statement of Disclosures (1).pdf | 2024-02-13 14:03 | 888K | |
![[ ]](/icons/layout.gif) | Statement+of+Work+-+70Z03825QS0000001.pdf | 2025-01-03 22:01 | 135K | |
![[IMG]](/icons/image2.gif) | Starz_11 X 17.pdf0.png | 2023-08-17 19:27 | 75K | |
![[ ]](/icons/layout.gif) | Starz_11 X 17.pdf | 2023-08-17 19:27 | 1.9M | |
![[TXT]](/icons/text.gif) | Stars ACHS-Telecommunication Outlets- Assets List.csv | 2023-02-24 17:13 | 7.6K | |
![[IMG]](/icons/image2.gif) | StarRez Floor.jpg.svg | 2023-10-19 18:14 | 19K | |
![[IMG]](/icons/image2.gif) | StarRez Floor.jpg | 2023-10-19 18:14 | 29K | |
![[ ]](/icons/layout.gif) | Standard_T_C_04-10-23__1_.pdf | 2024-12-05 12:41 | 428K | |
![[ ]](/icons/layout.gif) | Standard_Affirmation_Form__4_.pdf | 2024-12-05 12:41 | 451K | |
![[ ]](/icons/layout.gif) | Stacking_and_Storage_Practices_for_Construction_US_Job_Aid_PS5-102018.pdf | 2024-11-23 12:38 | 124K | |
![[IMG]](/icons/image2.gif) | Splice tray.jpg | 2023-04-25 17:19 | 28K | |
![[IMG]](/icons/image2.gif) | Splice cassette svg.svg | 2023-05-03 18:01 | 32K | |
![[IMG]](/icons/image2.gif) | Splice Cassette.jpg | 2023-05-03 18:01 | 13K | |
![[ ]](/icons/layout.gif) | Spec Book.pdf | 2025-07-30 13:14 | 17M | |
![[IMG]](/icons/image2.gif) | Speakers.pdf_0.png | 2025-09-19 01:39 | 2.3M | |
![[ ]](/icons/layout.gif) | Speakers.pdf | 2025-09-19 01:39 | 423K | |
![[ ]](/icons/layout.gif) | Sourcing Project (extranet)_ Ohio Buys.pdf | 2024-12-05 12:42 | 231K | |
![[ ]](/icons/layout.gif) | Solicitation___W9128F25RA043.pdf | 2025-11-01 15:34 | 5.6M | |
![[ ]](/icons/layout.gif) | Solicitation_Amendment___W9128F25RA0430004.pdf | 2025-10-29 23:53 | 5.6M | |
![[ ]](/icons/layout.gif) | Solicitation_Amendment___W9128F25RA0430003.1.pdf | 2025-10-29 23:53 | 5.6M | |
![[ ]](/icons/layout.gif) | Solicitation_Amendment___W9128F25RA0430002.pdf | 2025-10-30 00:01 | 5.6M | |
![[ ]](/icons/layout.gif) | Solicitation_Amendment___W9128F25RA0430002-1.pdf | 2025-11-01 15:34 | 5.6M | |
![[ ]](/icons/layout.gif) | Solicitation_Amendment___W9128F25RA0430001-1.pdf | 2025-10-30 00:17 | 5.6M | |
![[ ]](/icons/layout.gif) | Solicitation_Amendment_W9128F25RA0430003_SF_30.1.pdf | 2025-10-29 23:55 | 3.3M | |
![[ ]](/icons/layout.gif) | Solicitation_Amendment_W9128F25RA0430003_SF_30-1.pdf | 2025-11-01 15:33 | 3.3M | |
![[ ]](/icons/layout.gif) | Solicitation_Amendment_W9128F25RA0430002_SF_30.1.pdf | 2025-10-30 00:16 | 651K | |
![[ ]](/icons/layout.gif) | Solicitation_Amendment_W9128F25RA0430002_SF_30-1.pdf | 2025-10-30 00:17 | 651K | |
![[ ]](/icons/layout.gif) | Solicitation_Amendment_W9128F25RA0430001_SF_30-1.pdf | 2025-10-30 00:17 | 3.2M | |
![[ ]](/icons/layout.gif) | Solicitation Amendment FA462625Q00040001 SF 30.pdf | 2025-01-13 20:41 | 222K | |
![[ ]](/icons/layout.gif) | Solicitation Amendment FA282325Q00740001 SF 30.pdf | 2025-09-02 23:08 | 1.3M | |
![[ ]](/icons/layout.gif) | Solicitation - FA462625Q0004.pdf | 2025-01-13 20:48 | 414K | |
![[ ]](/icons/layout.gif) | Solicitation - FA282325Q0074.pdf | 2025-09-18 19:30 | 350K | |
![[ ]](/icons/layout.gif) | Solicitation+Amendment+FA462625Q00040002+SF+30 (1).pdf | 2025-01-13 20:15 | 202K | |
![[ ]](/icons/layout.gif) | Solana Beeler Park.pdf | 2023-10-17 14:08 | 39M | |
![[ ]](/icons/layout.gif) | Solana Beeler Park-TR-1.pdf | 2023-10-17 14:08 | 23K | |
![[ ]](/icons/layout.gif) | Solana Beeler Park-HomePage.pdf | 2023-10-17 14:08 | 39M | |
![[ ]](/icons/layout.gif) | Solana Beeler Park-D-1::D-1.pdf | 2023-10-17 14:08 | 19K | |
![[ ]](/icons/layout.gif) | Solana Beeler Park-D-1.pdf | 2023-10-17 14:08 | 19K | |
![[TXT]](/icons/text.gif) | Solana Beeler Park-Assets- Assets List.csv | 2023-05-04 16:29 | 88K | |
![[TXT]](/icons/text.gif) | Solana Beeler Park-Assets- Assets List (1).csv | 2023-05-04 16:10 | 81K | |
![[ ]](/icons/layout.gif) | Sol_140P2024R0022_Amd_0005.pdf | 2024-02-09 12:55 | 88K | |
![[ ]](/icons/layout.gif) | Sol_140P2024R0022_Amd_0004.pdf | 2024-02-09 12:55 | 88K | |
![[ ]](/icons/layout.gif) | Sol_140P2024R0022_Amd_0003.pdf | 2024-02-09 12:55 | 88K | |
![[ ]](/icons/layout.gif) | Sol_140P2024R0022_Amd_0002.pdf | 2024-02-09 12:56 | 88K | |
![[ ]](/icons/layout.gif) | Sol_140P2024R0022_Amd_0001.pdf | 2024-02-09 12:56 | 88K | |
![[ ]](/icons/layout.gif) | Sol_140P2024R0022.pdf | 2024-02-09 12:50 | 96K | |
![[ ]](/icons/layout.gif) | Software and Licensing.pdf | 2024-10-28 17:34 | 2.1M | |
![[IMG]](/icons/image2.gif) | Skyview Elementary School.pdf_0.png | 2025-05-20 13:59 | 1.1M | |
![[ ]](/icons/layout.gif) | Skyview Elementary School.pdf | 2025-05-20 13:59 | 186K | |
![[IMG]](/icons/image2.gif) | Six Data Wall Outlet(Blue).svg | 2023-02-10 19:18 | 2.0K | |
![[ ]](/icons/unknown.gif) | Site one 415 Additional Drops_details.json | 2025-02-21 21:05 | 28K | |
![[ ]](/icons/unknown.gif) | Site one 330 Main Building Additional Drops_details.json | 2025-03-07 18:22 | 32K | |
![[ ]](/icons/unknown.gif) | Site one 330- Second Building Additional Drops_details.json | 2025-03-07 18:13 | 49K | |
![[ ]](/icons/unknown.gif) | Site one 329 Nursery Building Additional Drops_details.json | 2025-03-18 22:54 | 24K | |
![[ ]](/icons/unknown.gif) | Site one 329 Additional Drops_details.json | 2025-03-20 12:51 | 26K | |
![[ ]](/icons/unknown.gif) | Site_Visit___EAL_Template.docx | 2025-11-01 15:37 | 53K | |
![[ ]](/icons/unknown.gif) | Site_Visit___DBIDS_Request_Spreadsheet.xlsx | 2025-10-30 00:01 | 24K | |
![[ ]](/icons/layout.gif) | Site_Visit_Info.pdf | 2025-11-01 15:34 | 77K | |
![[ ]](/icons/layout.gif) | Site Visit Letter.pdf | 2025-09-18 19:30 | 289K | |
![[ ]](/icons/layout.gif) | SiteOne Standards 2024.pdf | 2023-12-27 16:39 | 1.0M | |
![[ ]](/icons/unknown.gif) | Site One BR1170 Cabling_details.json | 2025-08-15 20:20 | 19K | |
![[ ]](/icons/unknown.gif) | Site One 329 Windsor 5 Work Station and Shack Cabling_details.json | 2025-12-03 00:07 | 1.7K | |
![[ ]](/icons/unknown.gif) | Site One 329 Windsor 5 Work Station Survey_details.json | 2025-07-01 13:45 | 48K | |
![[ ]](/icons/unknown.gif) | Site One 329 Windsor 5 Work Station Cabling_details.json | 2025-07-07 23:56 | 30K | |
![[IMG]](/icons/image2.gif) | Single port Wireless access point ceiling outlet - Copy.jpg | 2023-02-10 19:46 | 2.4K | |
![[IMG]](/icons/image2.gif) | Single port Camera outlet (ceiling)(Orange).svg | 2023-02-10 19:46 | 1.4K | |
![[IMG]](/icons/image2.gif) | Single Port Wireless Access Point Outlet (Ceiling).svg | 2023-02-10 19:34 | 1.4K | |
![[IMG]](/icons/image2.gif) | Single Port Camera Outlet (wall)(Orange).svg | 2023-02-10 19:44 | 1.2K | |
![[IMG]](/icons/image2.gif) | Single Port Camera Outlet (wall)(Orange) (1).svg | 2023-05-22 15:24 | 1.1K | |
![[IMG]](/icons/image2.gif) | Single Data Wall Outlet(Blue).svg | 2023-02-10 18:50 | 1.2K | |
![[IMG]](/icons/image2.gif) | Single Data Floor Outlet(Blue).svg | 2023-02-10 18:56 | 1.4K | |
![[IMG]](/icons/image2.gif) | Single Data Ceiling Outlet(Blue).svg | 2023-02-10 18:53 | 1.4K | |
![[IMG]](/icons/image2.gif) | Silver Hills Middle School.pdf_1.png | 2025-05-20 14:18 | 1.6M | |
![[IMG]](/icons/image2.gif) | Silver Hills Middle School.pdf_0.png | 2025-05-20 14:18 | 2.4M | |
![[ ]](/icons/layout.gif) | Silver Hills Middle School.pdf | 2025-05-20 14:18 | 425K | |
![[ ]](/icons/layout.gif) | Shopping Cart.pdf | 2025-12-12 01:39 | 316K | |
![[ ]](/icons/unknown.gif) | Shop Work_details.json | 2024-12-20 14:17 | 1.5K | |
![[IMG]](/icons/image2.gif) | Shop.pdf0.png | 2024-01-09 18:30 | 20K | |
![[ ]](/icons/layout.gif) | Shop.pdf | 2024-01-09 18:30 | 92K | |
![[IMG]](/icons/image2.gif) | Shipping.jpg.svg | 2023-06-27 20:58 | 23K | |
![[IMG]](/icons/image2.gif) | Shipping.jpg | 2023-06-27 20:58 | 134K | |
![[ ]](/icons/unknown.gif) | Shake Shack Burger JFK Kiosk Install_details.json | 2025-06-19 23:19 | 1.7K | |
![[IMG]](/icons/image2.gif) | Service call plan edit-Model.pdf0.png | 2023-05-01 12:33 | 305K | |
![[ ]](/icons/layout.gif) | Service call plan edit-Model.pdf | 2023-05-01 12:33 | 515K | |
![[TXT]](/icons/text.gif) | Service Call - Access Control System-Assets- Assets List.csv | 2023-04-28 17:00 | 19K | |
![[ ]](/icons/unknown.gif) | Self Audit .docx | 2025-10-31 20:59 | 14K | |
![[IMG]](/icons/image2.gif) | Securitas Floor Plan .pdf0.png | 2023-10-20 16:58 | 71K | |
![[ ]](/icons/layout.gif) | Securitas Floor Plan .pdf | 2023-10-20 16:58 | 2.0M | |
![[ ]](/icons/layout.gif) | Securitas Additional Cabling.pdf | 2023-11-22 18:32 | 175K | |
![[ ]](/icons/layout.gif) | Securitas Additional Cabling-HomePage.pdf | 2023-11-22 18:31 | 176K | |
![[ ]](/icons/layout.gif) | Securitas - Centennial CO-Bill of Materials.pdf | 2023-11-03 18:16 | 2.1M | |
![[ ]](/icons/layout.gif) | Securitas - Centennial CO-Bill of Materials (1).pdf | 2023-11-03 18:49 | 2.1M | |
![[ ]](/icons/layout.gif) | Securitas - Centennial CO - 20230824_6474 Cabling.pdf | 2023-11-03 18:13 | 668K | |
![[ ]](/icons/layout.gif) | Securitas - Centennial CO - 20230824_6474 Cabling-MDF::2 Post Network Rack.pdf | 2023-11-03 18:10 | 130K | |
![[ ]](/icons/layout.gif) | Securitas - Centennial CO - 20230824_6474 Cabling-MDF.pdf | 2023-11-03 18:10 | 22K | |
![[ ]](/icons/layout.gif) | Securitas - Centennial CO - 20230824_6474 Cabling-MDF-1::R-1.pdf | 2023-11-03 18:10 | 7.5K | |
![[ ]](/icons/layout.gif) | Securitas - Centennial CO - 20230824_6474 Cabling-MDF-1.pdf | 2023-11-03 18:10 | 26K | |
![[ ]](/icons/layout.gif) | Securitas - Centennial CO - 20230824_6474 Cabling-HomePage.pdf | 2023-11-03 18:13 | 669K | |
![[IMG]](/icons/image2.gif) | Section 2.pdf_0.png | 2025-09-16 17:45 | 2.4M | |
![[ ]](/icons/layout.gif) | Section 2.pdf | 2025-09-16 17:45 | 704K | |
![[IMG]](/icons/image2.gif) | Section 1.pdf_0.png | 2025-09-16 17:44 | 1.4M | |
![[ ]](/icons/layout.gif) | Section 1.pdf | 2025-09-16 17:44 | 554K | |
![[IMG]](/icons/image2.gif) | Second floor prints.pdf0.png | 2024-09-11 15:52 | 148K | |
![[ ]](/icons/layout.gif) | Second floor prints.pdf | 2024-09-11 15:52 | 1.8M | |
![[IMG]](/icons/image2.gif) | Second Floor.png.svg | 2024-02-17 17:20 | 453K | |
![[IMG]](/icons/image2.gif) | Second Floor.png | 2025-05-19 20:58 | 870K | |
![[IMG]](/icons/image2.gif) | Screenshot from 2025-04-24 19-24-33.png | 2025-06-12 07:57 | 45K | |
![[IMG]](/icons/image2.gif) | Screenshot 2025-12-14 at 12.48.18 PM.png | 2025-12-14 18:08 | 7.7M | |
![[IMG]](/icons/image2.gif) | Screenshot 2025-12-02 122003.png | 2025-12-02 17:20 | 1.3M | |
![[IMG]](/icons/image2.gif) | Screenshot 2025-11-28 at 6.33.35 PM.png | 2025-12-03 00:07 | 1.1M | |
![[IMG]](/icons/image2.gif) | Screenshot 2025-11-02 at 8.59.05 AM.png | 2025-11-02 14:00 | 28K | |
![[IMG]](/icons/image2.gif) | Screenshot 2025-10-29 at 6.17.24 PM.png | 2025-10-29 22:17 | 736K | |
![[IMG]](/icons/image2.gif) | Screenshot 2025-10-20 at 7.58.46 PM.png | 2025-10-21 00:04 | 28K | |
![[IMG]](/icons/image2.gif) | Screenshot 2025-09-30 at 7.05.52 PM.png | 2025-09-30 23:06 | 516K | |
![[IMG]](/icons/image2.gif) | Screenshot 2025-09-29 at 11.43.20 AM.png | 2025-09-29 15:44 | 968K | |
![[IMG]](/icons/image2.gif) | Screenshot 2025-09-29 at 11.42.52 AM.png | 2025-09-29 15:44 | 1.4M | |
![[IMG]](/icons/image2.gif) | Screenshot 2025-07-15 at 8.26.09 PM.png | 2025-07-16 00:26 | 30K | |
![[IMG]](/icons/image2.gif) | Screenshot 2025-07-15 at 8.23.33 PM.png | 2025-07-16 00:24 | 45K | |
![[IMG]](/icons/image2.gif) | Screenshot 2025-04-08 at 11.37.00 AM.png | 2025-04-08 15:52 | 24K | |
![[IMG]](/icons/image2.gif) | Screenshot 2025-03-19 221544.png | 2025-06-12 07:39 | 80K | |
![[IMG]](/icons/image2.gif) | Screenshot 2025-03-12 at 8.23.42 AM.png | 2025-03-12 12:29 | 37K | |
![[IMG]](/icons/image2.gif) | Screenshot 2025-02-05 173406.png | 2025-06-12 07:40 | 62K | |
![[IMG]](/icons/image2.gif) | Screenshot 2025-01-06 at 2.53.14 PM.png | 2025-01-06 19:53 | 120K | |
![[IMG]](/icons/image2.gif) | Screenshot 2025-01-06 at 1.04.24 PM.png | 2025-01-06 18:14 | 444K | |
![[IMG]](/icons/image2.gif) | Screenshot 2024-12-31 at 4.18.26 PM.png | 2024-12-31 21:20 | 332K | |
![[IMG]](/icons/image2.gif) | Screenshot 2024-11-12 at 7.07.06 AM.png | 2024-11-12 12:08 | 1.0M | |
![[IMG]](/icons/image2.gif) | Screenshot 2024-06-04 120820.png.svg | 2024-06-04 18:09 | 53K | |
![[IMG]](/icons/image2.gif) | Screenshot 2024-06-04 120820.png | 2024-06-04 18:09 | 204K | |
![[IMG]](/icons/image2.gif) | Screenshot 2024-05-07 061951.png.svg | 2024-05-07 12:21 | 1.2M | |
![[IMG]](/icons/image2.gif) | Screenshot 2024-05-07 061951.png | 2024-05-07 12:21 | 3.5M | |
![[IMG]](/icons/image2.gif) | Screenshot 2024-02-10 170923.png.svg | 2024-02-11 00:12 | 12K | |
![[IMG]](/icons/image2.gif) | Screenshot 2024-02-10 170923.png | 2024-02-11 00:12 | 148K | |
![[IMG]](/icons/image2.gif) | Screenshot 2023-10-11 092857.png.svg | 2023-10-11 18:55 | 473K | |
![[IMG]](/icons/image2.gif) | Screenshot 2023-10-11 092857.png | 2023-10-11 18:55 | 156K | |
![[IMG]](/icons/image2.gif) | Screenshot 2023-05-22 at 7.59.13 PM.png | 2023-05-23 02:00 | 30K | |
![[IMG]](/icons/image2.gif) | Screenshot 2023-04-18 at 6.07.02 AM.png | 2023-04-18 12:11 | 152K | |
![[IMG]](/icons/image2.gif) | Screenshot 2023-04-12 at 6.47.34 AM.png.svg | 2023-04-15 18:00 | 211K | |
![[IMG]](/icons/image2.gif) | Screenshot 2023-04-12 at 6.47.34 AM.png | 2023-04-15 18:00 | 509K | |
![[IMG]](/icons/image2.gif) | Screenshot 2023-03-31 at 11.53.21 AM.png.svg | 2023-05-24 12:51 | 2.9K | |
![[IMG]](/icons/image2.gif) | Screenshot 2023-03-31 at 11.53.21 AM.png | 2023-05-24 12:51 | 28K | |
![[IMG]](/icons/image2.gif) | Screenshot 2023-02-11 at 12.11.29 PM.png | 2023-02-11 19:13 | 768K | |
![[IMG]](/icons/image2.gif) | Screenshot 2023-02-04 at 12.11.18 PM.png | 2023-02-04 19:16 | 771K | |
![[IMG]](/icons/image2.gif) | Screenshot 2023-02-04 at 12.10.57 PM.png | 2023-02-11 19:44 | 230K | |
![[IMG]](/icons/image2.gif) | Screenshot 2023-02-04 at 11.22.27 AM.png | 2023-02-04 18:59 | 7.7K | |
![[IMG]](/icons/image2.gif) | Screenshot.pdf0.png | 2023-12-22 16:32 | 84K | |
![[ ]](/icons/layout.gif) | Screenshot.pdf | 2023-12-22 16:32 | 595K | |
![[IMG]](/icons/image2.gif) | Screenshot-2023-01-14-at-12.58.04-PM.png | 2023-06-02 11:39 | 388K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2024-10-21 at 5.01.13 PM.png | 2024-10-21 21:01 | 759K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2024-10-16 at 11.03.04 AM.png | 2024-10-16 15:05 | 21K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2024-10-09 at 11.49.21 AM.png | 2024-10-09 15:53 | 651K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2024-04-23 at 8.16.48 AM.png.svg | 2024-04-23 12:17 | 445K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2024-04-23 at 8.16.48 AM.png | 2024-04-23 12:17 | 1.0M | |
![[IMG]](/icons/image2.gif) | Screen Shot 2024-03-05 at 10.10.13 AM.png.svg | 2024-03-05 15:10 | 111K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2024-03-05 at 10.10.13 AM.png | 2024-03-05 15:10 | 475K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2024-02-29 at 8.26.45 PM.png.svg | 2024-03-01 01:27 | 1.2M | |
![[IMG]](/icons/image2.gif) | Screen Shot 2024-02-29 at 8.26.45 PM.png | 2024-03-01 01:27 | 953K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2024-02-28 at 8.16.29 AM.png.svg | 2024-02-28 13:17 | 773K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2024-02-28 at 8.16.29 AM.png | 2024-02-28 13:17 | 428K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2024-02-22 at 9.25.55 AM.png.svg | 2024-02-22 14:35 | 421K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2024-02-22 at 9.25.55 AM.png | 2024-02-22 14:35 | 886K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2024-02-22 at 9.25.26 AM.png.svg | 2024-02-22 14:35 | 2.1M | |
![[IMG]](/icons/image2.gif) | Screen Shot 2024-02-22 at 9.25.26 AM.png | 2024-02-22 14:35 | 1.3M | |
![[IMG]](/icons/image2.gif) | Screen Shot 2024-02-22 at 9.25.13 AM.png.svg | 2024-02-22 14:34 | 288K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2024-02-22 at 9.25.13 AM.png | 2024-02-22 14:34 | 1.2M | |
![[IMG]](/icons/image2.gif) | Screen Shot 2024-02-22 at 9.24.59 AM.png.svg | 2024-02-22 14:34 | 286K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2024-02-22 at 9.24.59 AM.png | 2024-02-22 14:34 | 1.2M | |
![[IMG]](/icons/image2.gif) | Screen Shot 2024-02-22 at 9.24.42 AM.png.svg | 2024-02-22 14:33 | 259K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2024-02-22 at 9.24.42 AM.png | 2024-02-22 14:33 | 1.1M | |
![[IMG]](/icons/image2.gif) | Screen Shot 2024-02-22 at 9.24.10 AM.png.svg | 2024-02-22 14:33 | 408K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2024-02-22 at 9.24.10 AM.png | 2024-02-22 14:33 | 1.0M | |
![[IMG]](/icons/image2.gif) | Screen Shot 2024-02-21 at 8.34.58 AM.png.svg | 2024-02-21 20:51 | 868K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2024-02-21 at 8.34.58 AM.png | 2024-02-21 20:51 | 3.0M | |
![[IMG]](/icons/image2.gif) | Screen Shot 2024-02-21 at 3.50.52 PM.png.svg | 2024-02-21 20:55 | 134K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2024-02-21 at 3.50.52 PM.png | 2024-02-21 20:55 | 1.2M | |
![[IMG]](/icons/image2.gif) | Screen Shot 2024-02-19 at 3.12.27 PM.png.svg | 2024-02-19 20:12 | 218K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2024-02-19 at 3.12.27 PM.png | 2024-02-19 20:12 | 2.7M | |
![[IMG]](/icons/image2.gif) | Screen Shot 2024-02-15 at 2.02.24 PM.png.svg | 2024-02-15 19:05 | 23K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2024-02-15 at 2.02.24 PM.png | 2024-02-15 19:05 | 120K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2024-02-13 at 1.18.21 PM.png.svg | 2024-02-13 18:20 | 317K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2024-02-13 at 1.18.21 PM.png | 2024-02-13 18:22 | 1.2M | |
![[IMG]](/icons/image2.gif) | Screen Shot 2024-02-13 at 1.17.58 PM.png.svg | 2024-02-13 18:20 | 377K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2024-02-13 at 1.17.58 PM.png | 2024-02-13 18:22 | 1.2M | |
![[IMG]](/icons/image2.gif) | Screen Shot 2024-02-13 at 1.15.40 PM.png.svg | 2024-02-13 18:19 | 331K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2024-02-13 at 1.15.40 PM.png | 2024-02-13 18:22 | 444K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2024-02-13 at 1.15.16 PM.png.svg | 2024-02-13 18:19 | 366K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2024-02-13 at 1.15.16 PM.png | 2024-02-13 18:22 | 506K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2024-01-22 at 5.09.08 PM.png.svg | 2024-01-22 22:09 | 411K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2024-01-22 at 5.09.08 PM.png | 2024-01-22 22:09 | 268K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2024-01-22 at 5.08.10 PM.png.svg | 2024-01-22 22:08 | 909K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2024-01-22 at 5.08.10 PM.png | 2024-01-22 22:08 | 622K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2024-01-22 at 5.07.08 PM.png.svg | 2024-01-22 22:07 | 650K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2024-01-22 at 5.07.08 PM.png | 2024-01-22 22:07 | 369K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2024-01-22 at 5.05.15 PM.png.svg | 2024-01-22 22:05 | 408K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2024-01-22 at 5.05.15 PM.png | 2024-01-22 22:05 | 272K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2023-12-22 at 2.27.50 PM.png.svg | 2023-12-27 19:43 | 806K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2023-12-22 at 2.27.50 PM.png | 2023-12-27 19:43 | 6.1M | |
![[IMG]](/icons/image2.gif) | Screen Shot 2023-12-15 at 5.57.05 PM.png.svg | 2023-12-15 22:57 | 576K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2023-12-15 at 5.57.05 PM.png | 2023-12-15 22:57 | 6.8M | |
![[IMG]](/icons/image2.gif) | Screen Shot 2023-05-02 at 11.57.23 AM.png.svg | 2023-05-02 18:02 | 234K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2023-05-02 at 11.57.23 AM.png | 2023-05-02 18:02 | 633K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2023-04-26 at 11.25.29 AM.png | 2023-04-26 17:27 | 167K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2023-03-02 at 3.16.59 PM.png | 2023-03-02 22:19 | 814K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2023-02-27 at 2.53.24 PM.png | 2023-02-27 21:59 | 31K | |
![[IMG]](/icons/image2.gif) | Screen-Shot-2023-02-27-at-1.55.02-PM.svg | 2023-02-27 20:59 | 47K | |
![[ ]](/icons/layout.gif) | Scoring of Evaluation Criteria.pdf | 2025-09-04 13:36 | 134K | |
![[IMG]](/icons/image2.gif) | Scope of Work - Event 453.pdf_1.png | 2025-09-12 12:24 | 754K | |
![[IMG]](/icons/image2.gif) | Scope of Work - Event 453.pdf_0.png | 2025-09-12 12:24 | 1.4M | |
![[ ]](/icons/layout.gif) | Scope of Work - Event 453.pdf | 2025-09-12 12:24 | 440K | |
![[ ]](/icons/layout.gif) | Scope of Work - Event 453 (1).pdf | 2025-09-04 13:36 | 440K | |
![[ ]](/icons/layout.gif) | Schedule_-_RFP_-_Double_Helix_West_-_Building_C.pdf | 2024-10-21 20:18 | 108K | |
![[IMG]](/icons/image2.gif) | Sanville_11 X 17.pdf0.png | 2023-05-08 12:46 | 83K | |
![[ ]](/icons/layout.gif) | Sanville_11 X 17.pdf | 2023-05-08 12:46 | 1.7M | |
![[ ]](/icons/layout.gif) | Samsung_LED_IF020R_7x7_Redacted.pdf | 2025-10-21 00:04 | 4.3M | |
![[TXT]](/icons/text.gif) | Sample pricing 1-Link Cables- Assets List.csv | 2023-05-17 13:24 | 3.1K | |
![[IMG]](/icons/image2.gif) | Sample Project fp.pdf0.png | 2023-05-09 08:02 | 772K | |
![[ ]](/icons/layout.gif) | Sample Project fp.pdf | 2023-05-09 08:02 | 779K | |
![[IMG]](/icons/image2.gif) | SamplePNGImage_5mbmb.png.svg | 2023-04-18 06:37 | 4.5M | |
![[IMG]](/icons/image2.gif) | SamplePNGImage_5mbmb.png | 2023-04-18 06:37 | 5.0M | |
![[IMG]](/icons/image2.gif) | SamplePNGImage_3mbmb.png.svg | 2023-04-18 06:38 | 529K | |
![[IMG]](/icons/image2.gif) | SamplePNGImage_3mbmb.png | 2023-04-18 06:38 | 3.0M | |
![[TXT]](/icons/text.gif) | Sample-File-For-Jobs.csv | 2024-10-30 21:32 | 1.8K | |
![[TXT]](/icons/text.gif) | Sample-File-For-Jobs-Import.csv | 2024-10-30 21:28 | 1.8K | |
![[TXT]](/icons/text.gif) | Sample-File-For-Jobs-Import (1).csv | 2024-10-30 20:54 | 1.0K | |
![[TXT]](/icons/text.gif) | Sample-File-For-Customer-Import.csv | 2023-10-23 12:39 | 97 | |
![[ ]](/icons/layout.gif) | Safety_Signs_US_Job_Aid_PS5-100757.pdf | 2024-11-23 12:38 | 153K | |
![[ ]](/icons/layout.gif) | SYSTEC101 References.pdf | 2024-12-03 12:17 | 83K | |
![[ ]](/icons/layout.gif) | SYSTEC101- Proposal 2024-PZI-1238 AFLCMC Building 1614 Fiber to Desk (Hanscom AFB)(1).pdf | 2024-02-23 16:49 | 3.3M | |
![[ ]](/icons/layout.gif) | STTQ01__Specs_Volume_2.pdf | 2024-12-27 16:56 | 24M | |
![[ ]](/icons/layout.gif) | STTQ01__Specs_Volume_1.pdf | 2024-12-27 16:56 | 23M | |
![[ ]](/icons/layout.gif) | STTQ01__Drawing_Set_Volume_3.pdf | 2024-12-27 16:56 | 102M | |
![[ ]](/icons/layout.gif) | STTQ01__Drawing_Set_Volume_2.pdf | 2024-12-27 16:57 | 67M | |
![[ ]](/icons/layout.gif) | STTQ01__Drawing_Set_Volume_1.pdf | 2024-12-27 16:57 | 42M | |
![[ ]](/icons/unknown.gif) | STRUCTURED CABLING SYSTEM CLAWSON, MICHIGAN_details.json | 2024-10-30 19:00 | 3.0K | |
![[ ]](/icons/layout.gif) | STRASBURG Cover page .pdf | 2025-03-12 12:54 | 76K | |
![[ ]](/icons/layout.gif) | SST Fiber Install Proposal.pdf | 2024-10-01 13:24 | 105K | |
![[ ]](/icons/unknown.gif) | SST Fiber Cable Material and Installation_details.json | 2024-10-01 13:22 | 23K | |
![[ ]](/icons/layout.gif) | SST Fiber Cable Material and Installation-Bill of Materials.pdf | 2024-10-01 13:24 | 1.0M | |
![[IMG]](/icons/image2.gif) | SS Seward - First Floor Camreas Layout.pdf_0.png | 2025-12-13 00:42 | 1.8M | |
![[ ]](/icons/layout.gif) | SS Seward - First Floor Camreas Layout.pdf | 2025-12-13 00:42 | 186K | |
![[IMG]](/icons/image2.gif) | SRS Greeley.pdf0.png | 2023-06-08 19:31 | 24K | |
![[ ]](/icons/layout.gif) | SRS Greeley.pdf | 2023-06-08 19:31 | 39K | |
![[ ]](/icons/layout.gif) | SRS-SPSGREE-2527 Greeley CO (1).pdf | 2023-06-14 21:30 | 3.2M | |
![[ ]](/icons/layout.gif) | SRS - CPSGYPS-2526 - Gypsum CO.pdf | 2023-11-22 18:50 | 3.0M | |
![[ ]](/icons/layout.gif) | SRS - CPSGYPS-2526 - Gypsum CO - 20230920_6669.pdf | 2023-11-22 18:49 | 166K | |
![[ ]](/icons/layout.gif) | SRS - CPSGYPS-2526 - Gypsum CO - 20230920_6669-HomePage.pdf | 2023-11-22 18:48 | 166K | |
![[ ]](/icons/layout.gif) | SRS - CPSGREE-2527 - Greeley CO.pdf | 2023-06-23 10:53 | 151K | |
![[ ]](/icons/layout.gif) | SRS - CPSGREE-2527 - Greeley CO-TR-1::R-1.pdf | 2023-06-23 10:53 | 26K | |
![[ ]](/icons/layout.gif) | SRS - CPSGREE-2527 - Greeley CO-TR-1.pdf | 2023-06-23 10:53 | 18K | |
![[ ]](/icons/layout.gif) | SRS - CPSGREE-2527 - Greeley CO-Speaker-2.pdf | 2023-06-23 10:53 | 12K | |
![[ ]](/icons/layout.gif) | SRS - CPSGREE-2527 - Greeley CO-HomePage.pdf | 2023-06-23 10:53 | 98K | |
![[ ]](/icons/layout.gif) | SPECS_W9128F25RA043_buco00102.pdf | 2025-10-30 00:01 | 57M | |
![[ ]](/icons/unknown.gif) | SOURCES SOUGHT_TV Install.docx | 2025-02-03 14:50 | 18K | |
![[IMG]](/icons/image2.gif) | SME.jpg.svg | 2023-07-18 14:24 | 152K | |
![[IMG]](/icons/image2.gif) | SME.jpg | 2023-07-18 14:24 | 297K | |
![[ ]](/icons/unknown.gif) | SITE_V~1.PDF | 2025-10-30 00:00 | 1.1M | |
![[ ]](/icons/unknown.gif) | SITE_V~1.1.PDF | 2025-10-29 23:57 | 1.1M | |
![[IMG]](/icons/image2.gif) | SIP_RFP in Gunnison..pdf.svg | 2023-02-13 20:53 | 170K | |
![[ ]](/icons/layout.gif) | SIP_RFP in Gunnison..pdf | 2023-02-13 20:53 | 141K | |
![[ ]](/icons/layout.gif) | SF30+Amendment+of+solicitaion+ORXPROB-24-IT01.pdf | 2024-08-06 12:15 | 1.4M | |
![[ ]](/icons/layout.gif) | SF24-23a.pdf | 2025-01-07 22:18 | 703K | |
![[ ]](/icons/layout.gif) | SESAMI+SST+Fiber+Pull+Solicitation+-+FA254324Q0054.pdf | 2024-10-01 13:24 | 2.0M | |
![[ ]](/icons/layout.gif) | SESAMI+SST+Fiber+Pull+SOW+-+CAO+7+Aug+24 (1).pdf | 2024-09-10 13:21 | 100K | |
![[ ]](/icons/layout.gif) | SESAMI+SST+Fiber+Pull+Questions+and+Answers.pdf | 2024-10-01 13:25 | 148K | |
![[ ]](/icons/unknown.gif) | SESAMI+SST+Fiber+Cable+Path+and+Room+Layouts.pptx | 2024-10-01 13:25 | 1.1M | |
![[ ]](/icons/unknown.gif) | SESAMI+Fiber+Cable+Distance+Estimates.xlsx | 2024-10-01 13:26 | 9.2K | |
![[ ]](/icons/layout.gif) | SELLER_PROVIDED_-_Bison_Highway_Minor_Subdivision__PRELIM_GEOTECH__DN52053.000-115-R1-Signed.pdf | 2024-05-22 18:38 | 2.4M | |
![[ ]](/icons/layout.gif) | SECURITAS - Denver.pdf | 2023-11-03 18:46 | 1.1M | |
![[ ]](/icons/layout.gif) | SDP-Supplier-Portal-Instructions.pdf | 2025-01-14 13:39 | 169K | |
![[IMG]](/icons/image2.gif) | SC path cords.jpg | 2023-04-25 17:16 | 8.1K | |
![[IMG]](/icons/image2.gif) | SC-APC Corning patch cords, 2M.jpg | 2023-05-03 17:57 | 124K | |
![[ ]](/icons/layout.gif) | S2948 York County Fiberoptics Installation.pdf | 2024-10-22 13:30 | 747K | |
![[ ]](/icons/layout.gif) | S2948 Addendum 4.pdf | 2024-11-12 11:23 | 225K | |
![[ ]](/icons/layout.gif) | S2948 Addendum 3.pdf | 2024-11-12 11:23 | 231K | |
![[ ]](/icons/layout.gif) | S2948 Addendum 2.pdf | 2024-10-22 18:42 | 286K | |
![[ ]](/icons/layout.gif) | S2948 Addendum 1.pdf | 2024-10-22 13:30 | 323K | |
![[ ]](/icons/unknown.gif) | Royal Oak Schools Structured Fiber Cabling_details.json | 2024-11-15 15:24 | 1.5K | |
![[IMG]](/icons/image2.gif) | Royal Oak Logo.png | 2024-11-22 16:10 | 89K | |
![[ ]](/icons/layout.gif) | Rough_Terrain_Forklift_Safety_Part_1_Readiness_Job_Aid_PS5-102860.pdf | 2024-11-23 12:38 | 124K | |
![[ ]](/icons/layout.gif) | Rough Terrain Forklift Safety - Part 2- Operation.pdf | 2024-11-23 12:38 | 21K | |
![[IMG]](/icons/image2.gif) | Rose Hill_11 X 17 (1).pdf0.png | 2023-10-19 14:42 | 258K | |
![[ ]](/icons/layout.gif) | Rose Hill_11 X 17 (1).pdf | 2023-10-19 14:42 | 445K | |
![[ ]](/icons/unknown.gif) | Roof Top Outdoor Cellular Site Survey _details.json | 2025-05-19 20:59 | 6.6K | |
![[IMG]](/icons/image2.gif) | Romero Hall - First Floor.pdf_0.png | 2025-05-20 13:58 | 1.0M | |
![[ ]](/icons/layout.gif) | Romero Hall - First Floor.pdf | 2025-05-20 13:58 | 200K | |
![[ ]](/icons/layout.gif) | Roaring_Fork_Request_for_Proposal_-_Exhibit_A.pdf | 2024-04-24 11:23 | 4.6M | |
![[ ]](/icons/layout.gif) | Rize Construction Bid Form.pdf | 2024-11-08 15:52 | 186K | |
![[ ]](/icons/unknown.gif) | Retail Store Site Survey #M1121| Bronx_details.json | 2025-06-02 12:15 | 11K | |
![[ ]](/icons/layout.gif) | Respiratory_Protection_US_Job_Aid_PS5-00266.pdf | 2024-11-23 12:38 | 70K | |
![[IMG]](/icons/image2.gif) | Resized_20231122_093857.JPEG | 2023-11-22 17:59 | 1.0M | |
![[IMG]](/icons/image2.gif) | Resized_20231122_093846.JPEG | 2023-11-22 17:59 | 697K | |
![[IMG]](/icons/image2.gif) | Resized_20231122_093839.JPEG | 2023-11-22 17:58 | 1.1M | |
![[IMG]](/icons/image2.gif) | Resized_20231101_155050.jpg | 2023-11-03 15:29 | 612K | |
![[IMG]](/icons/image2.gif) | Resized_20231101_153817.jpg | 2023-11-03 15:31 | 115K | |
![[ ]](/icons/layout.gif) | Requirements for LV Work.pdf | 2025-07-30 13:15 | 205K | |
![[ ]](/icons/layout.gif) | Request for Proposal Structured Cabling Replacement (1).pdf | 2025-06-24 17:20 | 184K | |
![[ ]](/icons/unknown.gif) | Request for Proposal: Structured Cabling Replacement 2 facilites_details.json | 2025-07-31 02:19 | 91K | |
![[ ]](/icons/layout.gif) | Request for Proposal: Structured Cabling Replacement 2 facilites- Proposal Documents.pdf | 2025-07-31 02:48 | 5.0M | |
![[ ]](/icons/layout.gif) | Reporting_Data_Entry_Job_Aid_PS5-00284.pdf | 2024-11-23 12:39 | 40K | |
![[ ]](/icons/layout.gif) | Remodel Technician Site Survey Checklist (3).pdf | 2025-06-03 07:13 | 2.4M | |
![[ ]](/icons/unknown.gif) | Remodel RT Materials and Tools.xlsx | 2025-10-26 16:36 | 19K | |
![[ ]](/icons/unknown.gif) | Remodel RT Materials and Tools (1).xlsx | 2025-10-31 20:58 | 19K | |
![[ ]](/icons/unknown.gif) | Remodel RT Device Placement.xlsx | 2025-10-26 16:35 | 21K | |
![[ ]](/icons/layout.gif) | Remodel RT Device Placement.pdf | 2025-03-13 16:27 | 36K | |
![[ ]](/icons/unknown.gif) | Remodel RT Device Placement (1).xlsx | 2025-10-31 20:58 | 21K | |
![[ ]](/icons/layout.gif) | Register Data Cabling Template.pdf | 2024-03-18 16:38 | 14M | |
![[ ]](/icons/layout.gif) | References_.pdf | 2024-02-01 22:13 | 47K | |
![[ ]](/icons/layout.gif) | References.pdf | 2024-11-15 15:07 | 40K | |
![[ ]](/icons/layout.gif) | Redlines.pdf | 2023-06-20 19:36 | 99K | |
![[IMG]](/icons/image2.gif) | Rangley.jpg.svg | 2024-02-09 15:32 | 563K | |
![[IMG]](/icons/image2.gif) | Rangley.jpg | 2024-02-09 15:32 | 3.5M | |
![[IMG]](/icons/image2.gif) | Rack sp.jpeg | 2023-10-13 12:14 | 134K | |
![[IMG]](/icons/image2.gif) | Rack installed.jpeg | 2023-11-03 14:33 | 135K | |
![[ ]](/icons/layout.gif) | RT Decom Playbook - Experience Remodels.pdf | 2025-10-26 16:36 | 801K | |
![[ ]](/icons/layout.gif) | RT Decom Playbook - Experience Remodels (1).pdf | 2025-10-31 20:58 | 801K | |
![[IMG]](/icons/image2.gif) | RJ45F8P2.svg | 2023-04-17 10:54 | 7.4K | |
![[IMG]](/icons/image2.gif) | RJ45-Female.svg | 2023-05-10 18:21 | 7.2K | |
![[ ]](/icons/unknown.gif) | RJ45-CAT5-3M-Ethernet-Patch-LAN-Cable.webp | 2023-02-10 10:51 | 32K | |
![[ ]](/icons/layout.gif) | RFQ 70RFPW24QW9000004.pdf | 2024-11-06 13:48 | 5.1M | |
![[ ]](/icons/layout.gif) | RFP for Network Cabling FY26 thru FY28.pdf | 2025-05-30 20:41 | 270K | |
![[ ]](/icons/unknown.gif) | RFP for Network Cabling – Three Year Contract (FY26-FY28)_details.json | 2025-05-30 20:41 | 1.5K | |
![[ ]](/icons/layout.gif) | RFP_Totals (1).pdf | 2024-10-14 19:48 | 165K | |
![[ ]](/icons/layout.gif) | RFP_2025_008__Library_Wiring.pdf | 2025-06-26 14:00 | 648K | |
![[ ]](/icons/layout.gif) | RFP_2025-04_-_New_Canaan_High_School-Network_Wiring_Audio_Intercom_-_11_Farm_Road__New_Canaan__CT_06840.pdf | 2025-05-23 22:12 | 4.0M | |
![[ ]](/icons/layout.gif) | RFP_28-24.pdf | 2024-12-06 19:42 | 96K | |
![[ ]](/icons/layout.gif) | RFP Past _ Present FILLABLE.pdf | 2024-02-02 15:48 | 136K | |
![[ ]](/icons/unknown.gif) | RFP NG10561: School Cabling Enhancement_details.json | 2025-01-14 13:37 | 1.4K | |
![[ ]](/icons/layout.gif) | RFP FSC Royal Oak FY25_Bid Form (3) copy.pdf | 2024-11-22 16:10 | 149K | |
![[ ]](/icons/layout.gif) | RFP FSC Royal Oak FY25_.pdf | 2024-11-22 16:10 | 1.0M | |
![[ ]](/icons/layout.gif) | RFP EC-06-2024 #14 _ #15 Q_A Responses.pdf | 2024-07-11 01:38 | 68K | |
![[ ]](/icons/layout.gif) | RFP EC-06-2024 #14 Countywide Camera Upgrade (Cabling)_06.26.24.pdf | 2024-06-26 14:41 | 826K | |
![[ ]](/icons/layout.gif) | RFP EC-06-2024 #14 Countywide Camera Upgrade (Cabling)_06-26-24.pdf | 2024-06-26 16:46 | 826K | |
![[ ]](/icons/layout.gif) | RFP Addendum Royal Oak Fiber Cabling 25-4.pdf | 2024-11-22 16:10 | 208K | |
![[ ]](/icons/layout.gif) | RFP Addendum 2.pdf | 2024-10-14 19:48 | 53K | |
![[ ]](/icons/layout.gif) | RFP 2024-033 Herkner Network Infrastructure.pdf | 2024-04-23 20:46 | 9.1M | |
![[ ]](/icons/unknown.gif) | RFP 28-24 Telecommunications and Data Wiring_details.json | 2025-02-03 22:54 | 2.3K | |
![[ ]](/icons/layout.gif) | RFP 28-24 Telecommunications and Data Wiring- Proposal Documents.pdf | 2024-12-11 02:59 | 311K | |
![[ ]](/icons/layout.gif) | RFP25-PA DROPS.pdf | 2025-04-08 13:25 | 553K | |
![[ ]](/icons/unknown.gif) | RFP25-PA DROPS - PA SYSTEM DROPS_details.json | 2025-04-08 15:14 | 7.6K | |
![[ ]](/icons/layout.gif) | RFP 23-08 ACCESS POINT REPLACEMENT.pdf | 2024-04-05 19:58 | 208K | |
![[ ]](/icons/layout.gif) | RFP.pdf | 2025-06-13 17:33 | 89K | |
![[ ]](/icons/layout.gif) | RFP-RC-2024-006 PW.pdf | 2024-02-02 15:33 | 1.7M | |
![[ ]](/icons/layout.gif) | RFP-RC-2024-006 PW (1).pdf | 2024-02-13 14:02 | 1.7M | |
![[ ]](/icons/layout.gif) | RFP-RC-2024-006 - Access Point Installation for the Department of Social Services Building L-Bill of Materials.pdf | 2024-02-26 18:50 | 5.4M | |
![[ ]](/icons/layout.gif) | RFP-RC-2024-006- Access Point Installation.pdf | 2024-02-02 14:33 | 2.4M | |
![[ ]](/icons/layout.gif) | RFP-RC-2024-006- Access Point Installation (1).pdf | 2024-02-17 19:35 | 2.4M | |
![[ ]](/icons/layout.gif) | RFP-IT-25-018 Low Voltage MSA.pdf | 2025-08-14 20:24 | 706K | |
![[ ]](/icons/layout.gif) | RFP-IT-25-018 Low Voltage MSA (1).pdf | 2025-08-14 20:24 | 706K | |
![[ ]](/icons/layout.gif) | RFP-IT-25-018.pdf | 2025-08-14 20:24 | 24K | |
![[ ]](/icons/unknown.gif) | RFP-IT-25-018 - Low Voltage MSA_details.json | 2025-08-14 20:22 | 2.0K | |
![[ ]](/icons/layout.gif) | RFP#2022-23-147 Required Forms Packet.pdf | 2024-03-04 17:51 | 366K | |
![[ ]](/icons/layout.gif) | RFP#2022-23-147 MYR DAS.pdf | 2024-03-04 15:32 | 1.4M | |
![[ ]](/icons/layout.gif) | RFI Oakland - SYSTEC101.pdf | 2024-11-22 16:10 | 335K | |
![[IMG]](/icons/image2.gif) | RFI-001-23 CARD MANAGEMENT SYSTEM Final 13DEC2022 (1).pdf.svg | 2023-02-13 20:36 | 911K | |
![[ ]](/icons/layout.gif) | RFI-001-23 CARD MANAGEMENT SYSTEM Final 13DEC2022 (1).pdf | 2023-02-13 20:36 | 260K | |
![[ ]](/icons/layout.gif) | RFB 2024-25 introduction.pdf | 2024-10-31 19:44 | 75K | |
![[ ]](/icons/layout.gif) | RFB 2024-25.36 Cable Installation.pdf | 2024-10-29 19:21 | 330K | |
![[ ]](/icons/unknown.gif) | RFB 2024-25.36 - Cable Installation, As-Needed_details.json | 2024-11-12 21:21 | 1.5K | |
![[ ]](/icons/layout.gif) | RFB 2024-25.36 - Cable Installation, As-Needed- Proposal Documents.pdf | 2024-11-12 21:35 | 3.8M | |
![[ ]](/icons/layout.gif) | RFB 2024-25-36 Cable Installation.pdf | 2024-10-31 19:17 | 1.5M | |
![[ ]](/icons/layout.gif) | RFB 2024-20 Prevailing Wage Packet.pdf | 2024-05-07 12:43 | 1.1M | |
![[ ]](/icons/layout.gif) | RFB 2024-20 HazMat Survey and Work Plan.pdf | 2024-05-07 12:43 | 4.4M | |
![[ ]](/icons/layout.gif) | RFB 2024-20 Drawings (1).pdf | 2024-05-07 12:43 | 13M | |
![[ ]](/icons/layout.gif) | RFB 2024-20.36_Previous Year Summary.pdf | 2024-10-29 19:21 | 76K | |
![[ ]](/icons/layout.gif) | RFB 2024-20-36_Previous Year Summary.pdf | 2024-10-29 19:23 | 76K | |
![[ ]](/icons/layout.gif) | RFB-RC-2025-086 Access Point Installation.pdf | 2025-12-14 17:29 | 4.6M | |
![[ ]](/icons/unknown.gif) | RFB-RC-2025-086 - Access Point Installation- 50 Sanatorium Road Building C_details.json | 2025-12-14 17:28 | 1.5K | |
![[ ]](/icons/layout.gif) | RFB-7092_Addendum 2_2.13.24.pdf | 2024-02-13 21:11 | 383K | |
![[ ]](/icons/layout.gif) | RFB-7092_Addendum 2-2-13-24.pdf | 2024-02-16 12:27 | 383K | |
![[ ]](/icons/layout.gif) | RFB-7092 PWviewOriginalWageSchedule.do.pdf | 2024-12-27 16:27 | 1.1M | |
![[ ]](/icons/layout.gif) | RFB-7092 PWviewOriginalWageSchedule-do.pdf | 2024-12-27 16:28 | 1.1M | |
![[ ]](/icons/layout.gif) | RFB-7092 Inside network cabling services - 20 South Broadway.pdf | 2024-02-19 14:16 | 1.1M | |
![[ ]](/icons/layout.gif) | RFB-7092 Addendum No 1 - 20 South Broadway.pdf | 2024-02-13 21:13 | 523K | |
![[ ]](/icons/layout.gif) | RFB-2024-20 SUNY SCCC Elston Hall - Lobby _ Mohawk Room Renovation.pdf | 2024-05-07 12:43 | 7.1M | |
![[ ]](/icons/layout.gif) | RFB-2024-20 Notice to Bidders.pdf | 2024-05-07 12:43 | 105K | |
![[ ]](/icons/layout.gif) | RFB-24-29 Fiber Network Project - Sewer District readable version.pdf | 2024-10-03 16:30 | 72M | |
![[ ]](/icons/layout.gif) | RFB-24-29 Fiber Network Project - Sewer District - NON-COLLUSIVE BIDDING CERTIFICATION.pdf | 2024-10-03 16:29 | 91K | |
![[ ]](/icons/layout.gif) | RFB-24-29 Fiber Network Project - Sewer District - CERTIFICATION of COMPLIANCE.pdf | 2024-10-03 16:29 | 75K | |
![[ ]](/icons/layout.gif) | RFB-24-29 Fiber Network Project - Sewer District - BID FORM.pdf | 2024-10-03 16:29 | 63K | |
![[ ]](/icons/layout.gif) | RFB-24-29 Addendum #1 Fiber Network Project RCSD.pdf | 2024-10-03 16:29 | 200K | |
![[ ]](/icons/layout.gif) | RFB-24-29 - Fiber Network Project - Rensselaer County Sewer District - Proposal.pdf | 2024-10-03 16:29 | 175K | |
![[ ]](/icons/layout.gif) | RFB-004-025 Data Cabling - Hardware (2).pdf | 2024-04-25 14:02 | 14M | |
![[ ]](/icons/unknown.gif) | RELOCATE LIBRARY’S SPECIAL COLLECTION, WAESCHE HALL, U.S. COAST GUARD ACADEMY, NEW LONDON, CT (NEW LONDON COUNTY) PROJECT NO. 22020230_details.json | 2025-01-07 22:15 | 1.5K | |
![[IMG]](/icons/image2.gif) | R23-115SL Fiber Optic Cable Installation Project (1).pdf67.png | 2024-01-30 11:06 | 18K | |
![[IMG]](/icons/image2.gif) | R23-115SL Fiber Optic Cable Installation Project (1).pdf66.png | 2024-01-30 11:06 | 21K | |
![[IMG]](/icons/image2.gif) | R23-115SL Fiber Optic Cable Installation Project (1).pdf65.png | 2024-01-30 11:06 | 18K | |
![[IMG]](/icons/image2.gif) | R23-115SL Fiber Optic Cable Installation Project (1).pdf64.png | 2024-01-30 11:06 | 19K | |
![[IMG]](/icons/image2.gif) | R23-115SL Fiber Optic Cable Installation Project (1).pdf63.png | 2024-01-30 11:06 | 20K | |
![[IMG]](/icons/image2.gif) | R23-115SL Fiber Optic Cable Installation Project (1).pdf62.png | 2024-01-30 11:06 | 21K | |
![[IMG]](/icons/image2.gif) | R23-115SL Fiber Optic Cable Installation Project (1).pdf61.png | 2024-01-30 11:06 | 13K | |
![[IMG]](/icons/image2.gif) | R23-115SL Fiber Optic Cable Installation Project (1).pdf60.png | 2024-01-30 11:06 | 48K | |
![[IMG]](/icons/image2.gif) | R23-115SL Fiber Optic Cable Installation Project (1).pdf59.png | 2024-01-30 11:06 | 259K | |
![[IMG]](/icons/image2.gif) | R23-115SL Fiber Optic Cable Installation Project (1).pdf58.png | 2024-01-30 11:06 | 284K | |
![[IMG]](/icons/image2.gif) | R23-115SL Fiber Optic Cable Installation Project (1).pdf57.png | 2024-01-30 11:06 | 123K | |
![[IMG]](/icons/image2.gif) | R23-115SL Fiber Optic Cable Installation Project (1).pdf56.png | 2024-01-30 11:06 | 140K | |
![[IMG]](/icons/image2.gif) | R23-115SL Fiber Optic Cable Installation Project (1).pdf55.png | 2024-01-30 11:06 | 117K | |
![[IMG]](/icons/image2.gif) | R23-115SL Fiber Optic Cable Installation Project (1).pdf54.png | 2024-01-30 11:06 | 13K | |
![[IMG]](/icons/image2.gif) | R23-115SL Fiber Optic Cable Installation Project (1).pdf53.png | 2024-01-30 11:06 | 16K | |
![[IMG]](/icons/image2.gif) | R23-115SL Fiber Optic Cable Installation Project (1).pdf52.png | 2024-01-30 11:06 | 23K | |
![[IMG]](/icons/image2.gif) | R23-115SL Fiber Optic Cable Installation Project (1).pdf51.png | 2024-01-30 11:06 | 33K | |
![[IMG]](/icons/image2.gif) | R23-115SL Fiber Optic Cable Installation Project (1).pdf50.png | 2024-01-30 11:06 | 207K | |
![[IMG]](/icons/image2.gif) | R23-115SL Fiber Optic Cable Installation Project (1).pdf49.png | 2024-01-30 11:06 | 199K | |
![[IMG]](/icons/image2.gif) | R23-115SL Fiber Optic Cable Installation Project (1).pdf48.png | 2024-01-30 11:06 | 224K | |
![[IMG]](/icons/image2.gif) | R23-115SL Fiber Optic Cable Installation Project (1).pdf47.png | 2024-01-30 11:06 | 183K | |
![[IMG]](/icons/image2.gif) | R23-115SL Fiber Optic Cable Installation Project (1).pdf46.png | 2024-01-30 11:06 | 63K | |
![[IMG]](/icons/image2.gif) | R23-115SL Fiber Optic Cable Installation Project (1).pdf45.png | 2024-01-30 11:06 | 111K | |
![[IMG]](/icons/image2.gif) | R23-115SL Fiber Optic Cable Installation Project (1).pdf44.png | 2024-01-30 11:06 | 137K | |
![[IMG]](/icons/image2.gif) | R23-115SL Fiber Optic Cable Installation Project (1).pdf43.png | 2024-01-30 11:06 | 83K | |
![[IMG]](/icons/image2.gif) | R23-115SL Fiber Optic Cable Installation Project (1).pdf42.png | 2024-01-30 11:06 | 40K | |
![[IMG]](/icons/image2.gif) | R23-115SL Fiber Optic Cable Installation Project (1).pdf41.png | 2024-01-30 11:06 | 49K | |
![[IMG]](/icons/image2.gif) | R23-115SL Fiber Optic Cable Installation Project (1).pdf40.png | 2024-01-30 11:06 | 257K | |
![[IMG]](/icons/image2.gif) | R23-115SL Fiber Optic Cable Installation Project (1).pdf39.png | 2024-01-30 11:06 | 253K | |
![[IMG]](/icons/image2.gif) | R23-115SL Fiber Optic Cable Installation Project (1).pdf38.png | 2024-01-30 11:06 | 230K | |
![[IMG]](/icons/image2.gif) | R23-115SL Fiber Optic Cable Installation Project (1).pdf37.png | 2024-01-30 11:06 | 257K | |
![[IMG]](/icons/image2.gif) | R23-115SL Fiber Optic Cable Installation Project (1).pdf36.png | 2024-01-30 11:06 | 244K | |
![[IMG]](/icons/image2.gif) | R23-115SL Fiber Optic Cable Installation Project (1).pdf35.png | 2024-01-30 11:06 | 280K | |
![[IMG]](/icons/image2.gif) | R23-115SL Fiber Optic Cable Installation Project (1).pdf34.png | 2024-01-30 11:06 | 335K | |
![[IMG]](/icons/image2.gif) | R23-115SL Fiber Optic Cable Installation Project (1).pdf33.png | 2024-01-30 11:06 | 304K | |
![[IMG]](/icons/image2.gif) | R23-115SL Fiber Optic Cable Installation Project (1).pdf32.png | 2024-01-30 11:06 | 311K | |
![[IMG]](/icons/image2.gif) | R23-115SL Fiber Optic Cable Installation Project (1).pdf31.png | 2024-01-30 11:06 | 264K | |
![[IMG]](/icons/image2.gif) | R23-115SL Fiber Optic Cable Installation Project (1).pdf30.png | 2024-01-30 11:06 | 308K | |
![[IMG]](/icons/image2.gif) | R23-115SL Fiber Optic Cable Installation Project (1).pdf29.png | 2024-01-30 11:06 | 256K | |
![[IMG]](/icons/image2.gif) | R23-115SL Fiber Optic Cable Installation Project (1).pdf28.png | 2024-01-30 11:06 | 277K | |
![[IMG]](/icons/image2.gif) | R23-115SL Fiber Optic Cable Installation Project (1).pdf27.png | 2024-01-30 11:06 | 164K | |
![[IMG]](/icons/image2.gif) | R23-115SL Fiber Optic Cable Installation Project (1).pdf26.png | 2024-01-30 11:06 | 87K | |
![[IMG]](/icons/image2.gif) | R23-115SL Fiber Optic Cable Installation Project (1).pdf25.png | 2024-01-30 11:06 | 222K | |
![[IMG]](/icons/image2.gif) | R23-115SL Fiber Optic Cable Installation Project (1).pdf24.png | 2024-01-30 11:06 | 202K | |
![[IMG]](/icons/image2.gif) | R23-115SL Fiber Optic Cable Installation Project (1).pdf23.png | 2024-01-30 11:06 | 140K | |
![[IMG]](/icons/image2.gif) | R23-115SL Fiber Optic Cable Installation Project (1).pdf22.png | 2024-01-30 11:06 | 219K | |
![[IMG]](/icons/image2.gif) | R23-115SL Fiber Optic Cable Installation Project (1).pdf21.png | 2024-01-30 11:06 | 50K | |
![[IMG]](/icons/image2.gif) | R23-115SL Fiber Optic Cable Installation Project (1).pdf20.png | 2024-01-30 11:06 | 129K | |
![[IMG]](/icons/image2.gif) | R23-115SL Fiber Optic Cable Installation Project (1).pdf19.png | 2024-01-30 11:06 | 105K | |
![[IMG]](/icons/image2.gif) | R23-115SL Fiber Optic Cable Installation Project (1).pdf18.png | 2024-01-30 11:06 | 24K | |
![[IMG]](/icons/image2.gif) | R23-115SL Fiber Optic Cable Installation Project (1).pdf17.png | 2024-01-30 11:06 | 179K | |
![[IMG]](/icons/image2.gif) | R23-115SL Fiber Optic Cable Installation Project (1).pdf16.png | 2024-01-30 11:06 | 221K | |
![[IMG]](/icons/image2.gif) | R23-115SL Fiber Optic Cable Installation Project (1).pdf15.png | 2024-01-30 11:06 | 226K | |
![[IMG]](/icons/image2.gif) | R23-115SL Fiber Optic Cable Installation Project (1).pdf14.png | 2024-01-30 11:06 | 122K | |
![[IMG]](/icons/image2.gif) | R23-115SL Fiber Optic Cable Installation Project (1).pdf13.png | 2024-01-30 11:06 | 68K | |
![[IMG]](/icons/image2.gif) | R23-115SL Fiber Optic Cable Installation Project (1).pdf12.png | 2024-01-30 11:06 | 234K | |
![[IMG]](/icons/image2.gif) | R23-115SL Fiber Optic Cable Installation Project (1).pdf11.png | 2024-01-30 11:06 | 252K | |
![[IMG]](/icons/image2.gif) | R23-115SL Fiber Optic Cable Installation Project (1).pdf10.png | 2024-01-30 11:06 | 219K | |
![[IMG]](/icons/image2.gif) | R23-115SL Fiber Optic Cable Installation Project (1).pdf9.png | 2024-01-30 11:06 | 208K | |
![[IMG]](/icons/image2.gif) | R23-115SL Fiber Optic Cable Installation Project (1).pdf8.png | 2024-01-30 11:06 | 124K | |
![[IMG]](/icons/image2.gif) | R23-115SL Fiber Optic Cable Installation Project (1).pdf7.png | 2024-01-30 11:06 | 235K | |
![[IMG]](/icons/image2.gif) | R23-115SL Fiber Optic Cable Installation Project (1).pdf6.png | 2024-01-30 11:06 | 248K | |
![[IMG]](/icons/image2.gif) | R23-115SL Fiber Optic Cable Installation Project (1).pdf5.png | 2024-01-30 11:06 | 223K | |
![[IMG]](/icons/image2.gif) | R23-115SL Fiber Optic Cable Installation Project (1).pdf4.png | 2024-01-30 11:06 | 221K | |
![[IMG]](/icons/image2.gif) | R23-115SL Fiber Optic Cable Installation Project (1).pdf3.png | 2024-01-30 11:06 | 164K | |
![[IMG]](/icons/image2.gif) | R23-115SL Fiber Optic Cable Installation Project (1).pdf2.png | 2024-01-30 11:06 | 24K | |
![[IMG]](/icons/image2.gif) | R23-115SL Fiber Optic Cable Installation Project (1).pdf1.png | 2024-01-30 11:06 | 51K | |
![[IMG]](/icons/image2.gif) | R23-115SL Fiber Optic Cable Installation Project (1).pdf0.png | 2024-01-30 11:06 | 84K | |
![[ ]](/icons/layout.gif) | R23-115SL Fiber Optic Cable Installation Project (1).pdf | 2024-01-30 11:06 | 946K | |
![[IMG]](/icons/image2.gif) | R1.jpeg | 2023-10-06 00:47 | 99K | |
![[ ]](/icons/layout.gif) | Questions from Pre-Bid Meeting 9_20_24.pdf | 2024-10-14 19:48 | 59K | |
![[ ]](/icons/unknown.gif) | Questions and Answers.docx | 2024-10-12 00:00 | 15K | |
![[IMG]](/icons/image2.gif) | Quad Data Wall Outlet(Blue).svg | 2023-02-10 19:15 | 1.1K | |
![[ ]](/icons/layout.gif) | Q&A Document 1 (8).pdf | 2024-11-04 20:50 | 8.1K | |
![[ ]](/icons/unknown.gif) | Purchase Order Agreement-Subcontractors.docx | 2024-11-18 20:01 | 62K | |
![[ ]](/icons/layout.gif) | Pueblo drops and WAps.pdf | 2023-02-13 20:53 | 270K | |
![[IMG]](/icons/image2.gif) | Pueblo.pdf0.png | 2024-01-08 02:17 | 407K | |
![[ ]](/icons/layout.gif) | Pueblo.pdf | 2024-01-08 02:17 | 1.9M | |
![[ ]](/icons/unknown.gif) | Public Bid 24-071 Data Frame Replacement - Elementary and Middle Schools - E-Rate Compliant.PDF | 2025-01-14 12:03 | 210K | |
![[ ]](/icons/layout.gif) | Public Bid 24-071 Data Frame Replacement - Elementary and Middle Schools - E-Rate Compliant - Proposal.pdf | 2025-01-14 12:03 | 1.9M | |
![[ ]](/icons/unknown.gif) | Public Bid 24-071 Data Frame Replacement - Elementary and Middle Schools - E-Rate Compliant (References).PDF | 2025-01-14 12:03 | 153K | |
![[ ]](/icons/unknown.gif) | Public Bid 24-071 Data Frame Replacement - Elementary and Middle Schools - E-Rate Compliant (Bid Proposal and Exception forms).PDF | 2025-01-14 12:03 | 198K | |
![[ ]](/icons/layout.gif) | Public Bid 24-071 Data Frame Replacement - Elementary and Middle Schools - E-Rate Compliant (3).pdf | 2024-12-31 22:28 | 377K | |
![[ ]](/icons/layout.gif) | Public Bid 24-071 Addendum # 1.pdf | 2024-12-31 22:28 | 119K | |
![[ ]](/icons/layout.gif) | Public Bid 24-070 Fiber Cable Replacement - Elementary and Middle Schools - References.pdf | 2025-01-13 16:06 | 146K | |
![[ ]](/icons/layout.gif) | Public Bid 24-070 Fiber Cable Replacement - Elementary and Middle Schools - E-Rate Compliant (1).pdf | 2024-12-31 22:18 | 3.9M | |
![[ ]](/icons/layout.gif) | Public Bid 24-070 Fiber Cable Replacement - Elementary and Middle Schools - Bid Form 2 with Exceptions.pdf | 2025-01-13 16:06 | 187K | |
![[ ]](/icons/layout.gif) | Public Bid 24-070 Fiber Cable Replacement - Elementary and Middle Schools - Bid Form 1.pdf | 2025-01-13 16:06 | 185K | |
![[ ]](/icons/layout.gif) | Public Bid 24-070 Addendum # 2.pdf | 2024-12-31 22:18 | 122K | |
![[ ]](/icons/layout.gif) | Public Bid 24-070 Addendum # 1.pdf | 2024-12-31 22:18 | 86K | |
![[ ]](/icons/layout.gif) | Public Bid 24-069 Cable Repair - Elementary School Labs - E-Rate Compliant.pdf | 2025-01-13 23:42 | 210K | |
![[ ]](/icons/layout.gif) | Public Bid 24-069 Cable Repair - Elementary School Labs - E-Rate Compliant (References).pdf | 2025-01-13 23:42 | 153K | |
![[ ]](/icons/layout.gif) | Public Bid 24-069 Cable Repair - Elementary School Labs - E-Rate Compliant (Bid proposal and Exceptions forms) (1).pdf | 2025-01-13 23:42 | 196K | |
![[ ]](/icons/layout.gif) | Public Bid 24-069 Cable Repair - Elementary School Labs - E-Rate Compliant (1).pdf | 2024-12-31 22:24 | 377K | |
![[ ]](/icons/layout.gif) | Public Bid 24-069 Addendum # 1.pdf | 2024-12-31 22:24 | 119K | |
![[TXT]](/icons/text.gif) | Proposal format test-Network Room Elements- Assets List.csv | 2023-02-27 20:20 | 2.5K | |
![[TXT]](/icons/text.gif) | Proposal format test-Network Rack Devices- Assets List.csv | 2023-02-27 20:24 | 768 | |
![[ ]](/icons/unknown.gif) | Proposal format Test_details.json | 2024-10-06 21:48 | 12K | |
![[ ]](/icons/layout.gif) | Proposal .pdf | 2025-12-14 17:29 | 2.5M | |
![[ ]](/icons/layout.gif) | Proposal-Sundar Apartments,Clubhouse and Maintainence Building - proposal.pdf | 2024-02-15 21:39 | 436K | |
![[ ]](/icons/layout.gif) | Prologis Essentials HIS Innovations Master Legend (1) (2).pdf | 2023-10-23 15:55 | 855K | |
![[DIR]](/icons/folder.gif) | Projects/ | 2024-09-24 18:37 | - | |
![[ ]](/icons/layout.gif) | Project details.pdf | 2024-12-11 21:50 | 285K | |
![[ ]](/icons/layout.gif) | Project Bill of Materials.pdf | 2024-02-23 16:49 | 3.1M | |
![[ ]](/icons/layout.gif) | Professional Services Agreement Sample.pdf | 2024-10-16 15:08 | 675K | |
![[DIR]](/icons/folder.gif) | Products/ | 2025-12-14 17:55 | - | |
![[TXT]](/icons/text.gif) | Product Catalogue List.csv | 2023-08-08 14:58 | 539 | |
![[ ]](/icons/layout.gif) | Pricing Matrix updated.xlsx - RFP-XXX Pricing Matrix.pdf | 2025-01-14 14:29 | 57K | |
![[ ]](/icons/unknown.gif) | Pricing Matrix updated.xlsx | 2025-01-14 14:27 | 67K | |
![[ ]](/icons/layout.gif) | Pricing Matrix updated.pdf | 2025-01-14 14:30 | 57K | |
![[ ]](/icons/layout.gif) | Pricing-Matrix updated.pdf | 2025-01-14 14:42 | 57K | |
![[ ]](/icons/layout.gif) | Preventing_Cuts_and_Puncture_Wounds_Job_Aid_PS5-01367.pdf | 2024-11-23 12:38 | 70K | |
![[ ]](/icons/layout.gif) | Preventing_Back_Injury_Job_Aid_PS5-00295.pdf | 2024-11-23 12:38 | 124K | |
![[ ]](/icons/layout.gif) | Prevailing_Wage_Poster_B_2024.pdf | 2024-11-12 22:20 | 3.8M | |
![[ ]](/icons/unknown.gif) | Premise Wiring at Joint Base Lewis McChord , WA 98433_details.json | 2025-05-13 22:15 | 148K | |
![[ ]](/icons/layout.gif) | Premise Wiring at Joint Base Lewis McChord , WA 98433- Proposal Documents.pdf | 2025-05-13 22:36 | 8.0M | |
![[ ]](/icons/layout.gif) | Pre_Solicitation_Notice_W9128F25RA043_PIMCS_06_26_2025.pdf | 2025-10-30 00:01 | 264K | |
![[ ]](/icons/layout.gif) | Pre-Terminated Cables .pdf | 2024-11-04 21:12 | 1.1M | |
![[ ]](/icons/layout.gif) | Pre-Job_Briefings_Job_Aid_PS5-00623.pdf | 2024-11-23 12:39 | 169K | |
![[IMG]](/icons/image2.gif) | Power transfer Hinge.jpg | 2023-04-28 11:59 | 17K | |
![[ ]](/icons/layout.gif) | Power_Tool_Safety_for_Construction_Job_Aid_PS5-102361.pdf | 2024-11-23 13:00 | 87K | |
![[ ]](/icons/unknown.gif) | Power Distribution at Rack.pptx | 2025-10-26 16:36 | 4.0M | |
![[ ]](/icons/unknown.gif) | Power Distribution at Rack (1).pptx | 2025-10-31 20:58 | 4.0M | |
![[ ]](/icons/unknown.gif) | Port Map Cheat Sheet - Experience Port Map (1).xlsx | 2025-10-26 16:35 | 73K | |
![[ ]](/icons/unknown.gif) | Port Map (Juniper).docx | 2025-10-26 16:35 | 72K | |
![[ ]](/icons/unknown.gif) | Port Map (Juniper) (1).docx | 2025-10-31 20:58 | 72K | |
![[ ]](/icons/layout.gif) | Policy Document Systec101.pdf | 2025-07-31 02:23 | 106K | |
![[ ]](/icons/layout.gif) | Plumbing.pdf | 2024-11-12 22:32 | 105K | |
![[ ]](/icons/layout.gif) | PlatvilleJDL1-00-6669 BR 1185 SYSTEC101 SUBLABOR PO 142881.pdf | 2024-01-09 03:01 | 106K | |
![[ ]](/icons/layout.gif) | PlanHub _ Supplier.pdf | 2024-12-27 17:00 | 364K | |
![[ ]](/icons/unknown.gif) | PipelineLogo1.webp | 2024-02-13 18:10 | 16K | |
![[IMG]](/icons/image2.gif) | Pioneer sites.pdf2.png | 2024-06-04 23:35 | 24K | |
![[IMG]](/icons/image2.gif) | Pioneer sites.pdf1.png | 2024-06-04 23:35 | 39K | |
![[IMG]](/icons/image2.gif) | Pioneer sites.pdf0.png | 2024-06-04 23:35 | 44K | |
![[ ]](/icons/layout.gif) | Pioneer sites.pdf | 2024-06-04 23:35 | 327K | |
![[IMG]](/icons/image2.gif) | Picture2.png | 2023-03-03 11:30 | 148K | |
![[IMG]](/icons/image2.gif) | Picture1.png | 2023-03-03 10:34 | 213K | |
![[IMG]](/icons/image2.gif) | Picture1.pdf_0.png | 2024-12-06 12:57 | 8.3M | |
![[ ]](/icons/layout.gif) | Picture1.pdf | 2024-12-06 12:57 | 706K | |
![[ ]](/icons/layout.gif) | Personal_Factors_in_Safety_Job_Aid_PS5-102414.pdf | 2024-11-23 12:38 | 100K | |
![[IMG]](/icons/image2.gif) | Patch cord Data (Cat 6 - 7 ft) (Blue).svg | 2023-02-10 18:27 | 12K | |
![[IMG]](/icons/image2.gif) | Patch cord Data (Cat 6 - 3 ft) (Blue).svg | 2023-02-10 17:43 | 13K | |
![[IMG]](/icons/image2.gif) | Patch cord (Cat 6A - X ft).svg | 2023-05-16 17:27 | 5.5K | |
![[IMG]](/icons/image2.gif) | Patch cord (Cat 6 - X ft).svg | 2023-05-23 14:42 | 5.3K | |
![[IMG]](/icons/image2.gif) | Patch-Panel-1U-RJ45-24port.svg | 2023-05-15 06:24 | 7.5K | |
![[ ]](/icons/layout.gif) | Past Performance - Att C -3.pdf | 2024-10-28 17:35 | 613K | |
![[ ]](/icons/layout.gif) | Past Performance - Att C -2.pdf | 2024-10-28 17:35 | 614K | |
![[ ]](/icons/layout.gif) | Past Performance - Att C -1.pdf | 2024-10-28 17:34 | 641K | |
![[IMG]](/icons/image2.gif) | Palmer plan merged.pdf1.png | 2024-03-20 12:27 | 289K | |
![[IMG]](/icons/image2.gif) | Palmer plan merged.pdf0.png | 2024-03-20 12:27 | 321K | |
![[ ]](/icons/layout.gif) | Palmer plan merged.pdf | 2024-03-20 12:27 | 222K | |
![[ ]](/icons/unknown.gif) | Palisades 21, NY - Site Survey_details.json | 2025-06-11 01:49 | 2.4K | |
![[IMG]](/icons/image2.gif) | Page2.pdf.svg | 2023-03-10 17:46 | 307K | |
![[ ]](/icons/layout.gif) | Page2.pdf | 2023-03-10 17:46 | 232K | |
![[ ]](/icons/layout.gif) | PZI-2024-1238+Questions+and+Answers.pdf | 2024-02-23 16:49 | 216K | |
![[ ]](/icons/unknown.gif) | PWS_PKC Madera Center TV Install.docx | 2025-02-03 14:50 | 79K | |
![[ ]](/icons/layout.gif) | PWS.pdf | 2025-09-18 19:30 | 843K | |
![[IMG]](/icons/image2.gif) | PVN.jpeg | 2023-07-06 18:22 | 15K | |
![[IMG]](/icons/image2.gif) | PVM legend.svg | 2023-05-26 09:50 | 4.4K | |
![[IMG]](/icons/image2.gif) | PTZ camera.svg | 2023-05-26 08:54 | 5.2K | |
![[IMG]](/icons/image2.gif) | PTZ camera.png | 2023-05-26 08:54 | 25K | |
![[ ]](/icons/layout.gif) | PREVAILING WAGE VENDOR COMPLIANCE (1).pdf | 2024-02-13 14:02 | 581K | |
![[ ]](/icons/layout.gif) | PR12464789-Synopsis_ Technical infrastructure_Structure Cabling Services_Final.pdf | 2024-09-09 19:56 | 213K | |
![[ ]](/icons/layout.gif) | PR12464789-Synopsis_+Technical+infrastructure_Structure+Cabling+Services (1).pdf | 2024-09-09 19:56 | 212K | |
![[ ]](/icons/layout.gif) | PR12464789-Scope of Work renovation 2nd and 3th floors.pdf | 2024-09-09 19:56 | 559K | |
![[ ]](/icons/unknown.gif) | PR12464789-QA.docx | 2024-09-09 19:56 | 23K | |
![[TXT]](/icons/text.gif) | PP test-Telecommunication Outlets- Assets List.csv | 2023-02-20 00:19 | 7.0K | |
![[TXT]](/icons/text.gif) | PP test-Network Rack Devices- Assets List.csv | 2023-02-27 21:05 | 1.6K | |
![[TXT]](/icons/text.gif) | PP test-Network Rack Devices- Assets List (2).csv | 2023-02-28 18:10 | 5.3K | |
![[TXT]](/icons/text.gif) | PP test-Network Rack Devices- Assets List (1).csv | 2023-02-27 22:08 | 4.0K | |
![[ ]](/icons/layout.gif) | PLK Tillster Pedestal Kiosk Install Checklist September 19 2025.pdf | 2025-11-18 00:23 | 2.0M | |
![[ ]](/icons/layout.gif) | PLK Tillster Pedestal Kiosk Install Checklist September 19 2025 (1).pdf | 2025-12-12 23:16 | 2.0M | |
![[ ]](/icons/unknown.gif) | PLK Tillster Install Templete_details.json | 2025-12-13 00:54 | 39K | |
![[ ]](/icons/unknown.gif) | PLK-14204 Bronx- Install_details.json | 2025-11-28 16:13 | 2.0K | |
![[ ]](/icons/unknown.gif) | PLK-14096 Brooklyn Install_details.json | 2025-11-28 16:18 | 2.1K | |
![[ ]](/icons/unknown.gif) | PLK-11176 Kiosk Installation_details.json | 2025-08-14 20:36 | 2.5K | |
![[ ]](/icons/unknown.gif) | PLK- 10963 Brooklyn Install_details.json | 2025-12-17 03:42 | 1.7K | |
![[ ]](/icons/unknown.gif) | PIMCS B442 - Telecommunications_details.json | 2025-10-29 23:49 | 1.4K | |
![[IMG]](/icons/image2.gif) | PILOT BUTTE PLAN CUT.pdf2.png | 2023-05-03 12:12 | 129K | |
![[IMG]](/icons/image2.gif) | PILOT BUTTE PLAN CUT.pdf1.png | 2023-05-03 12:12 | 91K | |
![[IMG]](/icons/image2.gif) | PILOT BUTTE PLAN CUT.pdf0.png | 2023-05-03 12:12 | 85K | |
![[ ]](/icons/layout.gif) | PILOT BUTTE PLAN CUT.pdf | 2023-05-03 12:12 | 446K | |
![[ ]](/icons/layout.gif) | Orion Office Cat6 Cabling.pdf | 2023-10-30 16:08 | 24M | |
![[ ]](/icons/layout.gif) | Orion Office Cat6 Cabling-TR-1::R-1.pdf | 2023-10-30 16:08 | 558K | |
![[ ]](/icons/layout.gif) | Orion Office Cat6 Cabling-TR-1.pdf | 2023-10-30 16:08 | 289K | |
![[ ]](/icons/layout.gif) | Orion Office Cat6 Cabling-HomePage.pdf | 2023-10-30 16:08 | 23M | |
![[ ]](/icons/layout.gif) | Orion Office Cat6 Cabling-D-21|D-22.pdf | 2023-10-19 18:25 | 26K | |
![[ ]](/icons/layout.gif) | Orion Office Cat6 Cabling (1).pdf | 2023-10-30 16:10 | 24M | |
![[ ]](/icons/layout.gif) | OriginalWageSchedule_RFB 2024-25.36.pdf | 2024-10-29 19:22 | 1.1M | |
![[ ]](/icons/layout.gif) | OriginalWageSchedule_RFB 2024-25-36.pdf | 2024-10-29 19:23 | 1.1M | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_155.png | 2024-11-18 15:32 | 9.1M | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_154.png | 2024-11-18 15:32 | 2.8M | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_153.png | 2024-11-18 15:32 | 5.1M | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_152.png | 2024-11-18 15:32 | 4.6M | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_151.png | 2024-11-18 15:32 | 6.7M | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_150.png | 2024-11-18 15:32 | 7.6M | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_149.png | 2024-11-18 15:32 | 9.4M | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_148.png | 2024-11-18 15:32 | 83K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_147.png | 2024-11-18 15:32 | 58K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_146.png | 2024-11-18 15:32 | 96K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_145.png | 2024-11-18 15:32 | 167K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_144.png | 2024-11-18 15:32 | 83K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_143.png | 2024-11-18 15:32 | 131K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_142.png | 2024-11-18 15:32 | 137K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_141.png | 2024-11-18 15:32 | 156K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_140.png | 2024-11-18 15:32 | 58K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_139.png | 2024-11-18 15:32 | 90K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_138.png | 2024-11-18 15:32 | 210K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_137.png | 2024-11-18 15:32 | 160K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_136.png | 2024-11-18 15:32 | 241K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_135.png | 2024-11-18 15:32 | 194K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_134.png | 2024-11-18 15:32 | 141K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_133.png | 2024-11-18 15:32 | 58K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_132.png | 2024-11-18 15:32 | 58K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_131.png | 2024-11-18 15:32 | 58K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_130.png | 2024-11-18 15:32 | 64K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_129.png | 2024-11-18 15:32 | 64K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_128.png | 2024-11-18 15:32 | 64K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_127.png | 2024-11-18 15:32 | 58K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_126.png | 2024-11-18 15:32 | 58K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_125.png | 2024-11-18 15:32 | 59K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_124.png | 2024-11-18 15:32 | 58K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_123.png | 2024-11-18 15:32 | 58K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_122.png | 2024-11-18 15:32 | 58K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_121.png | 2024-11-18 15:32 | 58K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_120.png | 2024-11-18 15:32 | 64K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_119.png | 2024-11-18 15:32 | 91K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_118.png | 2024-11-18 15:32 | 158K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_117.png | 2024-11-18 15:32 | 107K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_116.png | 2024-11-18 15:32 | 121K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_115.png | 2024-11-18 15:32 | 77K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_114.png | 2024-11-18 15:32 | 58K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_113.png | 2024-11-18 15:32 | 205K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_112.png | 2024-11-18 15:32 | 129K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_111.png | 2024-11-18 15:32 | 64K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_110.png | 2024-11-18 15:32 | 64K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_109.png | 2024-11-18 15:32 | 64K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_108.png | 2024-11-18 15:32 | 64K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_107.png | 2024-11-18 15:32 | 85K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_106.png | 2024-11-18 15:32 | 99K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_105.png | 2024-11-18 15:32 | 85K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_104.png | 2024-11-18 15:32 | 58K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_103.png | 2024-11-18 15:32 | 64K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_102.png | 2024-11-18 15:32 | 58K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_101.png | 2024-11-18 15:32 | 59K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_100.png | 2024-11-18 15:32 | 59K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_99.png | 2024-11-18 15:32 | 65K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_98.png | 2024-11-18 15:32 | 59K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_97.png | 2024-11-18 15:32 | 55K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_96.png | 2024-11-18 15:32 | 94K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_95.png | 2024-11-18 15:32 | 108K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_94.png | 2024-11-18 15:32 | 55K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_93.png | 2024-11-18 15:32 | 125K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_92.png | 2024-11-18 15:32 | 106K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_91.png | 2024-11-18 15:32 | 575K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_90.png | 2024-11-18 15:32 | 1.1M | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_89.png | 2024-11-18 15:32 | 1.0M | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_88.png | 2024-11-18 15:32 | 1.6M | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_87.png | 2024-11-18 15:32 | 1.4M | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_86.png | 2024-11-18 15:32 | 1.5M | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_85.png | 2024-11-18 15:32 | 1.2M | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_84.png | 2024-11-18 15:32 | 1.3M | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_83.png | 2024-11-18 15:32 | 1.4M | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_82.png | 2024-11-18 15:32 | 1.4M | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_81.png | 2024-11-18 15:32 | 1.0M | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_80.png | 2024-11-18 15:32 | 64K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_79.png | 2024-11-18 15:32 | 64K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_78.png | 2024-11-18 15:32 | 64K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_77.png | 2024-11-18 15:32 | 64K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_76.png | 2024-11-18 15:32 | 64K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_75.png | 2024-11-18 15:32 | 178K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_74.png | 2024-11-18 15:32 | 64K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_73.png | 2024-11-18 15:32 | 64K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_72.png | 2024-11-18 15:32 | 105K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_71.png | 2024-11-18 15:32 | 87K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_70.png | 2024-11-18 15:32 | 1.1M | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_69.png | 2024-11-18 15:32 | 1.5M | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_68.png | 2024-11-18 15:32 | 1.6M | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_67.png | 2024-11-18 15:32 | 1.5M | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_66.png | 2024-11-18 15:32 | 1.4M | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_65.png | 2024-11-18 15:32 | 1.3M | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_64.png | 2024-11-18 15:32 | 1.2M | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_63.png | 2024-11-18 15:32 | 1.5M | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_62.png | 2024-11-18 15:32 | 1.1M | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_61.png | 2024-11-18 15:32 | 100K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_60.png | 2024-11-18 15:32 | 184K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_59.png | 2024-11-18 15:32 | 64K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_58.png | 2024-11-18 15:32 | 80K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_57.png | 2024-11-18 15:32 | 64K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_56.png | 2024-11-18 15:32 | 64K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_55.png | 2024-11-18 15:32 | 64K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_54.png | 2024-11-18 15:32 | 64K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_53.png | 2024-11-18 15:32 | 96K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_52.png | 2024-11-18 15:32 | 64K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_51.png | 2024-11-18 15:32 | 100K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_50.png | 2024-11-18 15:32 | 95K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_49.png | 2024-11-18 15:32 | 111K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_48.png | 2024-11-18 15:32 | 104K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_47.png | 2024-11-18 15:32 | 64K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_46.png | 2024-11-18 15:32 | 127K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_45.png | 2024-11-18 15:32 | 64K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_44.png | 2024-11-18 15:32 | 64K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_43.png | 2024-11-18 15:32 | 184K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_42.png | 2024-11-18 15:32 | 191K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_41.png | 2024-11-18 15:32 | 280K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_40.png | 2024-11-18 15:32 | 113K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_39.png | 2024-11-18 15:32 | 64K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_38.png | 2024-11-18 15:32 | 100K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_37.png | 2024-11-18 15:32 | 154K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_36.png | 2024-11-18 15:32 | 98K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_35.png | 2024-11-18 15:32 | 214K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_34.png | 2024-11-18 15:32 | 86K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_33.png | 2024-11-18 15:32 | 64K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_32.png | 2024-11-18 15:32 | 113K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_31.png | 2024-11-18 15:32 | 64K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_30.png | 2024-11-18 15:32 | 74K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_29.png | 2024-11-18 15:32 | 98K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_28.png | 2024-11-18 15:32 | 100K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_27.png | 2024-11-18 15:32 | 142K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_26.png | 2024-11-18 15:32 | 70K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_25.png | 2024-11-18 15:32 | 59K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_24.png | 2024-11-18 15:32 | 106K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_23.png | 2024-11-18 15:32 | 65K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_22.png | 2024-11-18 15:32 | 64K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_21.png | 2024-11-18 15:32 | 200K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_20.png | 2024-11-18 15:32 | 59K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_19.png | 2024-11-18 15:32 | 64K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_18.png | 2024-11-18 15:32 | 64K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_17.png | 2024-11-18 15:32 | 64K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_16.png | 2024-11-18 15:32 | 120K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_15.png | 2024-11-18 15:32 | 287K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_14.png | 2024-11-18 15:32 | 1.1M | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_13.png | 2024-11-18 15:32 | 122K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_12.png | 2024-11-18 15:32 | 56K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_11.png | 2024-11-18 15:32 | 56K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_10.png | 2024-11-18 15:32 | 64K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_9.png | 2024-11-18 15:32 | 100K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_8.png | 2024-11-18 15:32 | 118K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_7.png | 2024-11-18 15:32 | 100K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_6.png | 2024-11-18 15:32 | 139K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_5.png | 2024-11-18 15:32 | 118K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_4.png | 2024-11-18 15:32 | 120K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_3.png | 2024-11-18 15:32 | 59K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_2.png | 2024-11-18 15:32 | 57K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_1.png | 2024-11-18 15:32 | 60K | |
![[IMG]](/icons/image2.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf_0.png | 2024-11-18 15:32 | 619K | |
![[ ]](/icons/layout.gif) | Org 131 Zaragoza ES_ Addendum02_2024-0911.pdf | 2024-11-18 15:27 | 4.0M | |
![[IMG]](/icons/image2.gif) | Offices.pdf0.png | 2024-02-27 22:11 | 169K | |
![[ ]](/icons/layout.gif) | Offices.pdf | 2024-02-27 22:10 | 580K | |
![[IMG]](/icons/image2.gif) | Office Space _12000 N. Pecos Street, Suite 290, Westminster.pdf0.png | 2023-12-13 19:46 | 4.1M | |
![[ ]](/icons/layout.gif) | Office Space _12000 N. Pecos Street, Suite 290, Westminster.pdf | 2023-12-13 19:46 | 2.4M | |
![[IMG]](/icons/image2.gif) | Office Space _12000 N. Pecos Street, Suite 290, Westminster-2.pdf0.png | 2023-09-28 13:42 | 4.1M | |
![[ ]](/icons/layout.gif) | Office Space _12000 N. Pecos Street, Suite 290, Westminster-2.pdf | 2023-09-28 13:42 | 2.4M | |
![[ ]](/icons/unknown.gif) | OSha_details.json | 2024-11-23 12:21 | 1.3K | |
![[ ]](/icons/unknown.gif) | OSha30_details.json | 2024-12-05 20:04 | 1.3K | |
![[ ]](/icons/unknown.gif) | OSha 30_details.json | 2024-12-05 14:45 | 1.3K | |
![[IMG]](/icons/image2.gif) | OSP Plan.pdf_0.png | 2025-01-06 14:17 | 5.8M | |
![[ ]](/icons/layout.gif) | OSP Plan.pdf | 2025-01-06 14:17 | 472K | |
![[ ]](/icons/layout.gif) | OSHA_Inspections_Multi-Employer_Job_Aid_PS5-103027.pdf | 2024-11-23 12:40 | 31K | |
![[ ]](/icons/layout.gif) | OSHA30ConstructionIndustryCompleteJobAid.pdf | 2024-12-05 20:05 | 3.1M | |
![[ ]](/icons/unknown.gif) | OSBT Logo_RBG.webp | 2023-07-06 01:25 | 25K | |
![[ ]](/icons/unknown.gif) | OSBT Logo.webp | 2023-08-27 10:30 | 25K | |
![[ ]](/icons/layout.gif) | ORP+Horizontal+Cabling+Project+RFQ+FY2024+(Amended).pdf | 2024-08-06 12:15 | 871K | |
![[ ]](/icons/layout.gif) | OPSU_Student_Union_Renovation_100__Specifications.pdf | 2024-04-17 14:15 | 7.0M | |
![[ ]](/icons/layout.gif) | OPSU_Student_Union_Renovation_100__Drawings.pdf | 2024-04-17 14:15 | 21M | |
![[ ]](/icons/layout.gif) | OPSU_Student_Union_Renovation_-_Bid_Manual.pdf | 2024-04-17 14:16 | 38M | |
![[ ]](/icons/layout.gif) | OPIR+Site+Integration+Standard+(OSIS)_Rev+1+(2).pdf | 2024-10-01 13:25 | 914K | |
![[ ]](/icons/layout.gif) | OES_Binder1-20.pdf | 2023-02-13 18:34 | 394K | |
![[ ]](/icons/layout.gif) | OES_Binder1-19.pdf | 2023-02-21 20:10 | 547K | |
![[ ]](/icons/layout.gif) | OES_Binder1-18.pdf | 2023-02-13 18:31 | 390K | |
![[IMG]](/icons/image2.gif) | O'CONNOR -First Floor.pdf_0.png | 2024-10-21 13:49 | 1.0M | |
![[ ]](/icons/layout.gif) | O'CONNOR -First Floor.pdf | 2024-10-21 13:49 | 237K | |
![[ ]](/icons/unknown.gif) | Northrise U-Haul Cabling_details.json | 2025-05-16 22:31 | 1.6K | |
![[ ]](/icons/unknown.gif) | Noodles and Company_details.json | 2024-10-17 15:58 | 2.1K | |
![[ ]](/icons/unknown.gif) | Noodles and Company IA_details.json | 2024-10-17 16:32 | 2.9K | |
![[ ]](/icons/unknown.gif) | Noodles-Demo_details.json | 2024-10-18 15:39 | 34K | |
![[ ]](/icons/layout.gif) | NonCollusiveCertificate.pdf | 2024-12-06 19:42 | 36K | |
![[ ]](/icons/unknown.gif) | Newburgh Enlarged Central School District District _details.json | 2024-12-11 21:55 | 1.3K | |
![[IMG]](/icons/image2.gif) | New_Canaan_logo2.png | 2025-05-23 22:11 | 108K | |
![[TXT]](/icons/text.gif) | Network Room Elements- Assets List.csv | 2023-02-14 18:04 | 1.6K | |
![[TXT]](/icons/text.gif) | Network Room Elements- Assets List (2).csv | 2023-02-14 19:11 | 2.0K | |
![[TXT]](/icons/text.gif) | Network Room Elements- Assets List (1).csv | 2023-02-14 19:03 | 2.3K | |
![[ ]](/icons/unknown.gif) | Network Cabling for 2 Avon Town Facilities_details.json | 2025-07-30 21:19 | 35K | |
![[ ]](/icons/unknown.gif) | Network Cabling System and Installation_details.json | 2024-11-06 13:18 | 1.5K | |
![[IMG]](/icons/image2.gif) | Nationwide.pdf0.png | 2023-05-23 02:00 | 154K | |
![[ ]](/icons/layout.gif) | Nationwide.pdf | 2023-05-23 02:00 | 549K | |
![[ ]](/icons/unknown.gif) | NY Driver license_details.json | 2025-03-24 02:16 | 1.4K | |
![[ ]](/icons/layout.gif) | NWO_Approved_JA_Generator_POWER_MCS_Redacted.pdf | 2025-10-30 00:01 | 800K | |
![[ ]](/icons/layout.gif) | NG10561 - Bid Document (1-8-25).pdf | 2025-01-14 13:38 | 4.9M | |
![[ ]](/icons/layout.gif) | NG10561 - Addendum #2.pdf | 2025-01-14 13:38 | 162K | |
![[ ]](/icons/layout.gif) | NG10561 - Addendum #1.pdf | 2025-01-14 13:38 | 122K | |
![[ ]](/icons/layout.gif) | NFPA 70E® Table Samples- Approach Boundaries.pdf | 2024-11-23 12:40 | 230K | |
![[ ]](/icons/layout.gif) | NFPA 70E® Table Sample- PPE.pdf | 2024-11-23 12:40 | 174K | |
![[ ]](/icons/layout.gif) | NEW Quote - SYSTEC101.pdf | 2023-11-01 17:43 | 60K | |
![[ ]](/icons/unknown.gif) | NEW CANAAN HIGH SCHOOL-NETWORK WIRING 2 Drops_details.json | 2025-07-14 00:59 | 14K | |
![[ ]](/icons/unknown.gif) | NEW CANAAN HIGH SCHOOL- Additional AV Drops_details.json | 2025-11-14 03:25 | 14K | |
![[ ]](/icons/layout.gif) | NECSD BID ADD 001 2024_12_04.pdf | 2024-12-11 22:00 | 14M | |
![[ ]](/icons/layout.gif) | NCHS-MDF- MER Cable Certification Results.pdf | 2025-08-18 21:07 | 7.7M | |
![[ ]](/icons/layout.gif) | NCHS-IDF4-Cable Certification Results.pdf | 2025-08-18 21:09 | 6.6M | |
![[ ]](/icons/layout.gif) | NCHS-IDF3-Cable Certification Results.pdf | 2025-08-18 21:09 | 7.6M | |
![[ ]](/icons/layout.gif) | NCHS-IDF2-Cable Certification Results.pdf | 2025-08-18 21:08 | 5.4M | |
![[ ]](/icons/layout.gif) | NCHS-IDF1-Cable Certification Results.pdf | 2025-08-18 21:08 | 6.7M | |
![[IMG]](/icons/image2.gif) | NATHOM-New Lynkfast Chat (CHIP) Structure-130524-124842.pdf1.png | 2024-06-05 12:25 | 51K | |
![[IMG]](/icons/image2.gif) | NATHOM-New Lynkfast Chat (CHIP) Structure-130524-124842.pdf0.png | 2024-06-05 12:25 | 108K | |
![[ ]](/icons/layout.gif) | NATHOM-New Lynkfast Chat (CHIP) Structure-130524-124842.pdf | 2024-12-06 14:20 | 172K | |
![[ ]](/icons/layout.gif) | NATHOM-Chat Interface Connection Development Steps-201223-123429 (1).pdf | 2024-02-29 14:09 | 207K | |
![[IMG]](/icons/image2.gif) | NATHOM-Chat Documentation-161123-160442.pdf4.png | 2024-01-31 12:58 | 59K | |
![[IMG]](/icons/image2.gif) | NATHOM-Chat Documentation-161123-160442.pdf3.png | 2024-01-31 12:58 | 76K | |
![[IMG]](/icons/image2.gif) | NATHOM-Chat Documentation-161123-160442.pdf2.png | 2024-01-31 12:58 | 90K | |
![[IMG]](/icons/image2.gif) | NATHOM-Chat Documentation-161123-160442.pdf1.png | 2024-01-31 12:58 | 92K | |
![[IMG]](/icons/image2.gif) | NATHOM-Chat Documentation-161123-160442.pdf0.png | 2024-01-31 12:58 | 99K | |
![[ ]](/icons/layout.gif) | NATHOM-Chat Documentation-161123-160442.pdf | 2024-01-31 12:58 | 669K | |
![[ ]](/icons/unknown.gif) | NAMC_details.json | 2024-12-05 21:37 | 1.6K | |
![[ ]](/icons/unknown.gif) | NAF FSS WIFI Cabling_details.json | 2025-01-06 19:53 | 46K | |
![[ ]](/icons/layout.gif) | NAF FSS WIFI Cabling- Proposal Documents.pdf | 2025-01-13 20:51 | 6.6M | |
![[ ]](/icons/layout.gif) | NAF FSS Cabling Proposal - Google Docs.pdf | 2025-01-06 19:45 | 120K | |
![[ ]](/icons/layout.gif) | NAF FSS Cabling Proposal - Cover Page.pdf | 2025-01-13 20:05 | 121K | |
![[IMG]](/icons/image2.gif) | Mutoa.jpeg | 2023-02-10 19:31 | 3.1K | |
![[IMG]](/icons/image2.gif) | Multi User Telecommunications Outlet Assembly (MUTOA)(Blue).svg | 2023-02-10 19:31 | 2.9K | |
![[IMG]](/icons/image2.gif) | Mullion camera.svg | 2023-05-25 16:36 | 2.1K | |
![[IMG]](/icons/image2.gif) | Mullion camera.png | 2023-05-25 16:36 | 11K | |
![[ ]](/icons/unknown.gif) | Mule Tape Install for VCT Technologies_details.json | 2025-04-11 21:39 | 4.7K | |
![[ ]](/icons/unknown.gif) | Morefar Brewster NY Cat6A and Fiber Cabling_details.json | 2025-03-25 11:16 | 123K | |
![[IMG]](/icons/image2.gif) | Monument.pdf0.png | 2024-01-09 04:55 | 400K | |
![[ ]](/icons/layout.gif) | Monument.pdf | 2024-01-09 04:55 | 1.9M | |
![[ ]](/icons/layout.gif) | Montgomary County Cable Certifications.pdf | 2025-11-09 14:14 | 21M | |
![[IMG]](/icons/image2.gif) | Monaco_11-X-17-_6_.svg | 2023-10-09 10:58 | 1.8M | |
![[IMG]](/icons/image2.gif) | Monaco_11-X-17-_6_.png.svg | 2024-06-04 13:09 | 245K | |
![[IMG]](/icons/image2.gif) | Monaco_11-X-17-_6_.png | 2024-06-04 13:09 | 162K | |
![[ ]](/icons/unknown.gif) | Model Main Task Order Contract.docx | 2025-09-04 13:31 | 67K | |
![[ ]](/icons/layout.gif) | Mobile_Elevated_Work_Platforms_Job_Aid_PS5-102964.pdf | 2024-11-23 12:37 | 90K | |
![[ ]](/icons/layout.gif) | Mist AP Orientation.pptx.pdf | 2025-10-31 20:59 | 202K | |
![[ ]](/icons/layout.gif) | Mist AP Orientation.pdf | 2025-10-26 16:32 | 202K | |
![[ ]](/icons/layout.gif) | Mist AP Orientation - pptx.pdf | 2025-10-31 21:00 | 202K | |
![[IMG]](/icons/image2.gif) | Miscellaneous materials.png | 2023-05-04 12:32 | 39K | |
![[ ]](/icons/unknown.gif) | Miniso Cabling Repair_details.json | 2024-10-22 23:58 | 2.0K | |
![[IMG]](/icons/image2.gif) | Milan Laser Loveland, CO. Low Volt.pdf0.png | 2023-12-22 16:33 | 1.3M | |
![[ ]](/icons/layout.gif) | Milan Laser Loveland, CO. Low Volt.pdf | 2023-12-22 16:32 | 509K | |
![[ ]](/icons/unknown.gif) | Media player names and ports.xlsx | 2025-10-26 16:35 | 56K | |
![[ ]](/icons/unknown.gif) | Media player names and ports (1).xlsx | 2025-10-31 20:58 | 56K | |
![[IMG]](/icons/image2.gif) | McD Hyundai Revised Lower Level 8-16-23.pdf0.png | 2023-11-09 15:10 | 797K | |
![[ ]](/icons/layout.gif) | McD Hyundai Revised Lower Level 8-16-23.pdf | 2023-11-09 15:09 | 1.1M | |
![[ ]](/icons/layout.gif) | Maxwell.pdf | 2024-10-15 20:31 | 5.9M | |
![[ ]](/icons/layout.gif) | Materials_Handling_Practices_for_Construction_US_Job_Aid_PS5-102168.pdf | 2024-11-23 12:38 | 45K | |
![[IMG]](/icons/image2.gif) | Mass Notification Outlet(Wall)(Yellow).svg | 2023-02-10 19:39 | 1.2K | |
![[IMG]](/icons/image2.gif) | Mass Notification Outlet(Wall)(Yellow) (1).svg | 2023-05-22 16:45 | 1.1K | |
![[IMG]](/icons/image2.gif) | Mass Notification Outlet(Ceiling)(Yellow).svg | 2023-02-10 19:41 | 1.4K | |
![[ ]](/icons/unknown.gif) | Marshalls Test_details.json | 2025-12-03 00:53 | 10K | |
![[ ]](/icons/unknown.gif) | Marshalls M1121 Cabling_details.json | 2025-08-19 10:30 | 88K | |
![[ ]](/icons/layout.gif) | Marshalls 323 M0323 Longmont CO.pdf | 2023-06-23 10:52 | 1.0M | |
![[ ]](/icons/layout.gif) | Marshalls 323 M0323 Longmont CO-X402.pdf | 2023-06-23 10:52 | 49K | |
![[ ]](/icons/layout.gif) | Marshalls 323 M0323 Longmont CO-Install-1.pdf | 2023-06-23 10:52 | 10K | |
![[ ]](/icons/layout.gif) | Marshalls 323 M0323 Longmont CO-HomePage.pdf | 2023-06-23 10:52 | 924K | |
![[ ]](/icons/layout.gif) | Marshalls 323 M0323 Longmont CO-De-Install.pdf | 2023-06-23 10:52 | 43K | |
![[TXT]](/icons/text.gif) | Marshalls 323 Longmont CO - Remodel-Other Placements- Assets List.csv | 2023-05-12 10:24 | 13K | |
![[TXT]](/icons/text.gif) | Marshalls 323 Longmont CO - Remodel-Other Placements- Assets List (1).csv | 2023-05-12 11:55 | 6.4K | |
![[IMG]](/icons/image2.gif) | Marshall merged.pdf5.png | 2023-05-15 15:42 | 44K | |
![[IMG]](/icons/image2.gif) | Marshall merged.pdf4.png | 2023-05-15 15:42 | 34K | |
![[IMG]](/icons/image2.gif) | Marshall merged.pdf3.png | 2023-05-15 15:42 | 89K | |
![[IMG]](/icons/image2.gif) | Marshall merged.pdf2.png | 2023-05-15 15:42 | 53K | |
![[IMG]](/icons/image2.gif) | Marshall merged.pdf1.png | 2023-05-15 15:42 | 69K | |
![[IMG]](/icons/image2.gif) | Marshall merged.pdf0.png | 2023-05-15 15:42 | 1.7M | |
![[ ]](/icons/layout.gif) | Marshall merged.pdf | 2023-05-15 15:42 | 657K | |
![[TXT]](/icons/text.gif) | Marshall's with timing-Other Placements- Assets List.csv | 2023-05-15 09:39 | 15K | |
![[IMG]](/icons/image2.gif) | Marshall's Loveland CO FP to be uploaded.pdf0.png | 2023-06-02 15:30 | 1.0M | |
![[ ]](/icons/layout.gif) | Marshall's Loveland CO FP to be uploaded.pdf | 2023-06-02 15:29 | 343K | |
![[TXT]](/icons/text.gif) | Marshall's CO (Can Use)-Other Placements- Assets List.csv | 2023-05-15 09:47 | 20K | |
![[IMG]](/icons/image2.gif) | Marcos Data plan.pdf_0.png | 2024-12-06 22:09 | 1.1M | |
![[ ]](/icons/layout.gif) | Marcos Data plan.pdf | 2024-12-06 22:09 | 656K | |
![[ ]](/icons/unknown.gif) | Marco's Pizza - Thornton_details.json | 2024-10-24 14:51 | 70K | |
![[ ]](/icons/layout.gif) | Malmstrom ISP-OSP Infrastructure Upgrade SOO Rev01 10-29-24.pdf | 2025-01-03 22:44 | 322K | |
![[ ]](/icons/layout.gif) | Machine_Guarding_Part_2_Precautions_Job_Aid_PS5-103353.pdf | 2024-11-23 12:38 | 22K | |
![[ ]](/icons/unknown.gif) | MYC+Long+Logo-235w.webp | 2024-02-13 19:20 | 3.3K | |
![[ ]](/icons/layout.gif) | MXRD210004+-+Fiber+to+Desk+SOW+-+V4.pdf | 2024-02-23 17:07 | 169K | |
![[ ]](/icons/layout.gif) | MOOccupationalTitleRule.pdf | 2024-12-31 22:08 | 131K | |
![[ ]](/icons/layout.gif) | MOOWOrder31.pdf | 2024-12-31 22:08 | 212K | |
![[IMG]](/icons/image2.gif) | MIDDLE SCHOOL MS-T101-MS-T101F.pdf_0.png | 2025-06-24 15:08 | 2.2M | |
![[ ]](/icons/layout.gif) | MIDDLE SCHOOL MS-T101-MS-T101F.pdf | 2025-06-24 15:08 | 566K | |
![[ ]](/icons/layout.gif) | MEPSpecs_287E17_10-18-2024.pdf | 2024-12-06 19:16 | 5.0M | |
![[IMG]](/icons/image2.gif) | MDF.svg | 2023-02-10 20:32 | 952 | |
![[ ]](/icons/layout.gif) | MDF-UPS Backup Time Calculation.pdf | 2024-10-28 17:35 | 479K | |
![[ ]](/icons/unknown.gif) | MAXWELL HQ.xlsx | 2024-10-15 20:31 | 125K | |
![[IMG]](/icons/image2.gif) | MATTRESS FIRM LOW VOLT SCOPE OF WORK 122922.pdf0.png | 2023-12-14 17:20 | 596K | |
![[ ]](/icons/layout.gif) | MATTRESS FIRM LOW VOLT SCOPE OF WORK 122922.pdf | 2023-12-14 17:20 | 220K | |
![[IMG]](/icons/image2.gif) | MARSHALL's.pdf0.png | 2023-05-12 15:51 | 1.7M | |
![[ ]](/icons/layout.gif) | MARSHALL's.pdf | 2023-05-12 15:51 | 412K | |
![[IMG]](/icons/image2.gif) | MARSHALL's (1).pdf0.png | 2023-05-12 17:03 | 1.7M | |
![[ ]](/icons/layout.gif) | MARSHALL's (1).pdf | 2023-05-12 17:03 | 412K | |
![[ ]](/icons/unknown.gif) | M1121 Technician Scope of Work document 07_08_2025.docx | 2025-07-28 01:18 | 1.2M | |
![[IMG]](/icons/image2.gif) | M1121 CCTV-05.15.25 (2).pdf_0.png | 2025-07-28 01:14 | 8.5M | |
![[ ]](/icons/layout.gif) | M1121 CCTV-05.15.25 (2).pdf | 2025-07-28 01:18 | 542K | |
![[IMG]](/icons/image2.gif) | M1121 CCTV-05.15.25 (1).pdf_0.png | 2025-07-28 01:16 | 8.5M | |
![[ ]](/icons/layout.gif) | M1121 CCTV-05.15.25 (1).pdf | 2025-07-28 01:16 | 542K | |
![[IMG]](/icons/image2.gif) | M1121 CCTV-05-15-25 (2).pdf_0.png | 2025-07-28 01:20 | 8.5M | |
![[ ]](/icons/layout.gif) | M1121 CCTV-05-15-25 (2).pdf | 2025-07-28 01:20 | 542K | |
![[ ]](/icons/layout.gif) | M1121 - Network switches Info SWITCH H3.pdf | 2025-08-06 21:56 | 188K | |
![[ ]](/icons/layout.gif) | M1121 - Network switches Info SWITCH H2.pdf | 2025-08-06 21:56 | 188K | |
![[ ]](/icons/layout.gif) | M1121 - Network switches Info SWITCH H1.pdf | 2025-08-06 21:56 | 188K | |
![[IMG]](/icons/image2.gif) | M192 floor plan.pdf0.png | 2024-01-31 12:31 | 279K | |
![[ ]](/icons/layout.gif) | M192 floor plan.pdf | 2024-01-31 12:31 | 742K | |
![[IMG]](/icons/image2.gif) | M0761 Aurora CO LP Cameras.pdf0.png | 2023-10-19 20:43 | 1.2M | |
![[ ]](/icons/layout.gif) | M0761 Aurora CO LP Cameras.pdf | 2023-10-19 20:43 | 748K | |
![[ ]](/icons/unknown.gif) | M0169 Survey Bronx_details.json | 2025-08-04 22:47 | 1.4K | |
![[ ]](/icons/unknown.gif) | M0169 Cabling Bronx_details.json | 2025-09-15 11:21 | 1.7K | |
![[IMG]](/icons/image2.gif) | Lynkfast Proposal Document - Instructions.pdf.svg | 2023-04-15 10:46 | 234K | |
![[ ]](/icons/layout.gif) | Lynkfast Proposal Document - Instructions.pdf | 2023-04-15 10:46 | 825K | |
![[ ]](/icons/unknown.gif) | Lynkfast Demo_details.json | 2024-11-01 13:24 | 24K | |
![[IMG]](/icons/image2.gif) | LynkFast Website Design-2.png.svg | 2023-04-18 06:46 | 2.7M | |
![[IMG]](/icons/image2.gif) | LynkFast Website Design-2.png | 2023-04-18 06:45 | 5.9M | |
![[ ]](/icons/layout.gif) | LynkFast Project Overview Page .pdf | 2024-11-29 13:12 | 23K | |
![[ ]](/icons/layout.gif) | LynkFast Description (1).pdf | 2024-02-10 14:13 | 29K | |
![[ ]](/icons/layout.gif) | LynkFast Demo.pdf | 2023-10-31 13:05 | 9.0M | |
![[ ]](/icons/layout.gif) | LynkFast Demo-TR-1::2 Post Network Rack 45U.pdf | 2023-10-31 13:01 | 3.2K | |
![[ ]](/icons/layout.gif) | LynkFast Demo-TR-1.pdf | 2023-10-31 13:01 | 1.1M | |
![[ ]](/icons/layout.gif) | LynkFast Demo-HomePage.pdf | 2023-10-31 13:05 | 9.0M | |
![[IMG]](/icons/image2.gif) | LynkFast - Cover Letter Sample.pdf.svg | 2023-03-07 07:12 | 655K | |
![[ ]](/icons/layout.gif) | LynkFast - Cover Letter Sample.pdf | 2023-03-07 07:12 | 516K | |
![[ ]](/icons/unknown.gif) | Lululemon Athletica - 21029 Circuit extension (cat6)_details.json | 2025-06-11 22:38 | 12K | |
![[ ]](/icons/unknown.gif) | Lululemon Athletica - 21029 Circuit extension (OS2 Fiber)_details.json | 2025-06-11 22:40 | 10K | |
![[ ]](/icons/unknown.gif) | Lululemon Athletica - 21029 Circuit extension (Cat6)_details.json | 2025-06-11 23:58 | 5.0K | |
![[ ]](/icons/layout.gif) | Low-Speed_Vehicle_Job_Aid_PS5-102855.pdf | 2024-11-23 13:03 | 685K | |
![[IMG]](/icons/image2.gif) | Loveland CO camera FP to upload.pdf0.png | 2023-06-06 16:00 | 966K | |
![[ ]](/icons/layout.gif) | Loveland CO camera FP to upload.pdf | 2023-06-06 16:00 | 335K | |
![[ ]](/icons/unknown.gif) | Loveland CO UHaul Cabling Help p4_details.json | 2025-04-04 16:32 | 1.4K | |
![[ ]](/icons/unknown.gif) | Loveland CO UHaul Cabling Help p3_details.json | 2025-02-25 00:08 | 1.4K | |
![[ ]](/icons/unknown.gif) | Loveland CO UHaul Cabling Help p2_details.json | 2025-01-17 00:08 | 1.4K | |
![[ ]](/icons/unknown.gif) | Loveland CO UHaul Cabling Help_details.json | 2024-11-28 03:36 | 1.4K | |
![[IMG]](/icons/image2.gif) | Lounge Loveland.pdf0.png | 2023-05-23 11:59 | 30K | |
![[ ]](/icons/layout.gif) | Lounge Loveland.pdf | 2023-05-23 11:59 | 26K | |
![[ ]](/icons/layout.gif) | Lounge.pdf | 2023-05-14 01:38 | 0 | |
![[ ]](/icons/layout.gif) | Louisa_County_MS_Addition_-_Electrical__4-4-24_ (1).pdf | 2024-10-14 19:48 | 3.7M | |
![[ ]](/icons/layout.gif) | Louisa County MS Addition - Ceiling Plans.pdf | 2024-10-14 19:48 | 4.2M | |
![[IMG]](/icons/image2.gif) | Longmont camera FP to upload.pdf0.png | 2023-05-25 16:11 | 710K | |
![[ ]](/icons/layout.gif) | Longmont camera FP to upload.pdf | 2023-05-25 16:11 | 293K | |
![[IMG]](/icons/image2.gif) | Longmont CO.pdf0.png | 2024-01-03 12:01 | 277K | |
![[ ]](/icons/layout.gif) | Longmont CO.pdf | 2024-01-03 12:01 | 1.3M | |
![[IMG]](/icons/image2.gif) | Longmont.pdf0.png | 2024-01-03 18:26 | 18K | |
![[ ]](/icons/layout.gif) | Longmont.pdf | 2024-01-03 18:26 | 40K | |
![[IMG]](/icons/image2.gif) | Logo.svg | 2024-12-06 19:16 | 8.8K | |
![[ ]](/icons/layout.gif) | Lockout-Tagout_LOTO_Programs_and_Procedures_Job_Aid_PS5-103023.pdf | 2024-11-23 12:39 | 71K | |
![[IMG]](/icons/image2.gif) | Littleton CO.pdf0.png | 2024-01-08 17:53 | 463K | |
![[ ]](/icons/layout.gif) | Littleton CO.pdf | 2024-01-08 17:53 | 2.4M | |
![[ ]](/icons/layout.gif) | Lithium-Ion_Battery_Awareness_Job_Aid_PS5-102688.pdf | 2024-11-23 13:00 | 92K | |
![[ ]](/icons/layout.gif) | Library Wiring Bid SOW.pdf | 2025-07-16 00:29 | 91K | |
![[ ]](/icons/layout.gif) | Library Wiring Bid Intro page.pdf | 2025-07-16 00:28 | 77K | |
![[IMG]](/icons/image2.gif) | Level 2 technology_240119_173526.pdf1.png | 2024-01-19 19:44 | 3.8K | |
![[IMG]](/icons/image2.gif) | Level 2 technology_240119_173526.pdf0.png | 2024-01-19 19:44 | 399K | |
![[ ]](/icons/layout.gif) | Level 2 technology_240119_173526.pdf | 2024-01-19 19:44 | 214K | |
![[IMG]](/icons/image2.gif) | Level 1 technology_240119_173648 (2).pdf1.png | 2024-01-19 19:43 | 3.8K | |
![[IMG]](/icons/image2.gif) | Level 1 technology_240119_173648 (2).pdf0.png | 2024-01-19 19:43 | 753K | |
![[ ]](/icons/layout.gif) | Level 1 technology_240119_173648 (2).pdf | 2024-01-19 19:43 | 470K | |
![[ ]](/icons/layout.gif) | Letter of Interest_241010_173411.pdf | 2024-10-10 13:47 | 75K | |
![[IMG]](/icons/image2.gif) | Lester Arnold_11 X 17.pdf0.png | 2023-06-16 15:49 | 127K | |
![[ ]](/icons/layout.gif) | Lester Arnold_11 X 17.pdf | 2023-06-16 15:49 | 1.8M | |
![[ ]](/icons/layout.gif) | Lead_Poisoning_Job_Aid_PS5-103169.pdf | 2024-11-23 12:38 | 35K | |
![[ ]](/icons/layout.gif) | Ladder_Safety_for_Construction_Setup_Job_Aid_PS5-102189.pdf | 2024-11-23 12:36 | 124K | |
![[IMG]](/icons/image2.gif) | Ladder 4X1.svg | 2023-02-14 18:15 | 4.4K | |
![[IMG]](/icons/image2.gif) | Labelling svg.svg | 2023-05-10 17:53 | 5.7K | |
![[ ]](/icons/layout.gif) | LVPlans_287E17_10-18-2024.pdf | 2024-12-06 19:18 | 33M | |
![[ ]](/icons/unknown.gif) | LOW VOLTAGE – IT, & STURCTURED CABLING SERVICES_details.json | 2024-11-26 13:18 | 1.3K | |
![[IMG]](/icons/image2.gif) | LOCKABLE CABINET - 24RU 26%22 DEPTH.svg | 2023-03-03 17:03 | 1.2K | |
![[ ]](/icons/layout.gif) | LJA_-_Referral_Response_and_Redlines_-_Case_24-04___24-05.pdf | 2024-05-22 18:39 | 20M | |
![[ ]](/icons/unknown.gif) | LEGEN TEST_details.json | 2024-11-01 16:37 | 71K | |
![[ ]](/icons/layout.gif) | LED Fixture Tolerence 01082025.pdf | 2025-10-26 16:35 | 6.3M | |
![[IMG]](/icons/image2.gif) | LC path cords.jpg | 2023-04-19 17:03 | 8.1K | |
![[IMG]](/icons/image2.gif) | LCPSOutletGuide (1).png | 2024-10-14 19:48 | 25K | |
![[ ]](/icons/unknown.gif) | LCMS Cabling (b t)_details.json | 2024-10-18 15:15 | 31K | |
![[ ]](/icons/unknown.gif) | LCMS Cabling (BT)_details.json | 2024-10-14 12:55 | 2.0K | |
![[IMG]](/icons/image2.gif) | LCMS-502.pdf_0.png | 2024-10-14 19:42 | 1.2M | |
![[ ]](/icons/layout.gif) | LCMS-502.pdf | 2024-10-14 19:42 | 414K | |
![[ ]](/icons/layout.gif) | LCC Single Mode Fiber Backbone.pdf | 2024-06-03 23:50 | 230K | |
![[ ]](/icons/layout.gif) | LCC PO3884 (RCC) Systec101 $57,784 Vendor Copy.pdf | 2024-06-04 00:07 | 3.0M | |
![[ ]](/icons/layout.gif) | LCC PO3884 (RCC) Systec101 $57,784.59 Vendor Copy.pdf | 2024-06-04 00:06 | 3.0M | |
![[ ]](/icons/layout.gif) | LCC Cat6 Cabling West Building.pdf | 2024-06-03 23:55 | 4.7M | |
![[ ]](/icons/layout.gif) | LCC Cat6 Cabling East Building.pdf | 2024-05-27 19:13 | 6.9M | |
![[ ]](/icons/layout.gif) | LCC Cat6 Cabling East Building (1).pdf | 2024-06-03 23:52 | 6.9M | |
![[ ]](/icons/layout.gif) | LCC Bowman Lib Complete Project Manual BID SET_3-12-2024.pdf | 2024-04-01 19:39 | 16M | |
![[ ]](/icons/layout.gif) | LCC 24-07 Todd Burch Hall Low Voltage Rewire Project-Bill of Materials.pdf | 2024-02-19 21:38 | 7.1M | |
![[IMG]](/icons/image2.gif) | Kroger Denver Drawing.pdf0.png | 2023-06-10 03:30 | 92K | |
![[ ]](/icons/layout.gif) | Kroger Denver Drawing.pdf | 2023-06-10 03:30 | 1.4M | |
![[ ]](/icons/unknown.gif) | Knoebel Insurance Requirements.docx | 2025-07-30 13:15 | 140K | |
![[IMG]](/icons/image2.gif) | Knoebel-Logo-Rev.png | 2024-03-29 16:22 | 19K | |
![[ ]](/icons/unknown.gif) | Kinross C.F. - Wi-Fi Cabling Infrastructure_details.json | 2024-12-02 20:27 | 1.4K | |
![[IMG]](/icons/image2.gif) | Kids First.pdf.svg | 2023-02-20 00:03 | 354K | |
![[ ]](/icons/layout.gif) | Kids First.pdf | 2023-02-20 00:03 | 475K | |
![[ ]](/icons/layout.gif) | Kiddie Academy The Meadows ITB.pdf | 2024-02-29 18:08 | 122K | |
![[ ]](/icons/layout.gif) | Kiddie Academy The Meadows 07 Electrical Plans.pdf | 2024-02-29 18:07 | 9.9M | |
![[ ]](/icons/layout.gif) | Kiddie Academy The Meadows 01 General Plans.pdf | 2024-02-29 18:07 | 3.5M | |
![[IMG]](/icons/image2.gif) | Kemp_11 X 17.pdf0.png | 2024-04-16 14:46 | 138K | |
![[ ]](/icons/layout.gif) | Kemp_11 X 17.pdf | 2024-04-16 14:46 | 6.5M | |
![[IMG]](/icons/image2.gif) | KMS.pdf0.png | 2023-10-20 21:42 | 247K | |
![[ ]](/icons/layout.gif) | KMS.pdf | 2023-10-20 21:42 | 234K | |
![[IMG]](/icons/image2.gif) | KEMP.pdf0.png | 2024-04-01 15:41 | 73K | |
![[ ]](/icons/layout.gif) | KEMP.pdf | 2024-04-01 15:41 | 256K | |
![[ ]](/icons/unknown.gif) | KANTECH-DK.PDF | 2023-10-23 15:56 | 482K | |
![[ ]](/icons/unknown.gif) | Juniper Hardware Refresh Installation Guide for Retail Store.docx | 2025-10-31 20:59 | 3.8M | |
![[IMG]](/icons/image2.gif) | JuctionSpliceKit.png | 2023-04-25 16:10 | 145K | |
![[IMG]](/icons/image2.gif) | Johnson Hall - Third Floor.pdf0.png | 2024-07-08 12:47 | 83K | |
![[ ]](/icons/layout.gif) | Johnson Hall - Third Floor.pdf | 2024-07-08 12:47 | 199K | |
![[IMG]](/icons/image2.gif) | Johnson Hall - Second Floor.pdf_0.png | 2024-09-30 17:49 | 1.0M | |
![[IMG]](/icons/image2.gif) | Johnson Hall - Second Floor.pdf0.png | 2024-07-08 12:47 | 88K | |
![[ ]](/icons/layout.gif) | Johnson Hall - Second Floor.pdf | 2024-09-30 17:49 | 206K | |
![[IMG]](/icons/image2.gif) | Johnson Hall - First Floor.pdf0.png | 2024-07-08 12:46 | 84K | |
![[ ]](/icons/layout.gif) | Johnson Hall - First Floor.pdf | 2024-07-08 12:46 | 202K | |
![[ ]](/icons/layout.gif) | Job_Hazard_Analysis_JHA_Job_Aid_PS5-00666.pdf | 2024-11-23 12:39 | 42K | |
![[ ]](/icons/layout.gif) | JobAid-WeldingCuttingandBrazingPart3of3HealthHazardsPS5-102190.pdf | 2024-11-23 12:33 | 28K | |
![[ ]](/icons/layout.gif) | JobAid-WeldingCuttingandBrazingPart2of3PhysicalHazardsPS5-102191.pdf | 2024-11-23 12:33 | 75K | |
![[ ]](/icons/layout.gif) | JobAid-WeldingCuttingandBrazingPart1of3MethodsPS5-102194.pdf | 2024-11-23 12:33 | 80K | |
![[ ]](/icons/layout.gif) | JobAid-SlipsTripsandFallsforConstructionPS5-101943.pdf | 2024-11-23 12:37 | 102K | |
![[ ]](/icons/layout.gif) | JobAid-SafetyandYouforSupervisorsPS5-104002.pdf | 2024-11-23 12:38 | 196K | |
![[ ]](/icons/layout.gif) | JobAid-PersonalProtectiveEquipmentPPEHeadProtectionPS5-103767.pdf | 2024-11-23 12:38 | 29K | |
![[ ]](/icons/layout.gif) | JobAid-PersonalProtectiveEquipmentPPEHazardAssessmentPS5-103766.pdf | 2024-11-23 12:38 | 134K | |
![[ ]](/icons/layout.gif) | JobAid-PersonalProtectiveEquipmentPPEFootandLegProtectionPS5-103773.pdf | 2024-11-23 12:37 | 83K | |
![[ ]](/icons/layout.gif) | JobAid-PersonalProtectiveEquipmentPPEEyeandFaceProtectionPS5-103769.pdf | 2024-11-23 12:35 | 26K | |
![[ ]](/icons/layout.gif) | JobAid-PersonalProtectiveEquipmentPPEElectricalProtectionPS5-103774.pdf | 2024-11-23 12:40 | 28K | |
![[ ]](/icons/layout.gif) | JobAid-PersonalProtectiveEquipmentPPEBodyProtectionPS5-103771.pdf | 2024-11-23 12:38 | 75K | |
![[ ]](/icons/layout.gif) | JobAid-MachineGuardingPart1HazardsPS5-103287.pdf | 2024-11-23 12:38 | 64K | |
![[ ]](/icons/layout.gif) | JobAid-LoneWorkerRiskAssessmentPS5-103494.pdf | 2024-11-23 12:39 | 25K | |
![[ ]](/icons/layout.gif) | JobAid-LoneWorkerConcernsPS5-103493.pdf | 2024-11-23 12:39 | 21K | |
![[ ]](/icons/layout.gif) | JobAid-IndustrialErgonomicsPS5-00291.pdf | 2024-11-23 12:38 | 55K | |
![[ ]](/icons/layout.gif) | JobAid-HexavalentChromiumPS5-101016.pdf | 2024-11-23 12:38 | 104K | |
![[ ]](/icons/layout.gif) | JobAid-DemolitionHazardsUSPS5-103942.pdf | 2024-11-23 12:38 | 47K | |
![[ ]](/icons/layout.gif) | JobAid-ConfinedSpacesConstructionRequirementsPS5-103661.pdf | 2024-11-23 13:00 | 27K | |
![[ ]](/icons/layout.gif) | Jesse_Owens_-_Communications_Optical_Fiber_Backbone_Cabling_w_revisions.pdf | 2024-12-05 12:42 | 133K | |
![[IMG]](/icons/image2.gif) | Jesse Lee Fiber work.pdf0.png | 2023-10-01 15:30 | 641K | |
![[ ]](/icons/layout.gif) | Jesse Lee Fiber work.pdf | 2023-10-01 15:30 | 47K | |
![[IMG]](/icons/image2.gif) | Jesse-Lee-Logo-website-Header-150-27.png | 2023-10-01 13:28 | 4.4K | |
![[IMG]](/icons/image2.gif) | Jack Cat 6A.svg | 2023-02-04 20:19 | 6.2K | |
![[IMG]](/icons/image2.gif) | Jack Cat 6A (1).svg | 2023-02-09 15:00 | 6.2K | |
![[IMG]](/icons/image2.gif) | Jack Cat 6.svg | 2023-05-05 09:25 | 5.9K | |
![[IMG]](/icons/image2.gif) | J__4_TMC Communications_TMC-C 14.07 Hilton Garden Inn - Marlborough_Dwgs_30 Construction Documents_Comm_T1.05 T1.pdf0.png | 2024-06-27 11:35 | 809K | |
![[ ]](/icons/layout.gif) | J__4_TMC Communications_TMC-C 14.07 Hilton Garden Inn - Marlborough_Dwgs_30 Construction Documents_Comm_T1.05 T1.pdf | 2024-06-27 11:35 | 584K | |
![[ ]](/icons/layout.gif) | JESSE LEE FIBER BACKBONE.pdf | 2024-02-05 15:26 | 269K | |
![[ ]](/icons/layout.gif) | JDL1-00-6666 BR 1177 SYSTEC101 SUBLABOR PO 142876.pdf | 2024-01-08 03:05 | 106K | |
![[IMG]](/icons/image2.gif) | JBLM-2019-update-black-R-on-transparency.png | 2025-05-13 22:15 | 450K | |
![[ ]](/icons/unknown.gif) | J.Crew New Store Install Guide 2025 (2.27 update) - HM edit - 5.26.docx | 2025-09-19 01:32 | 8.5M | |
![[ ]](/icons/unknown.gif) | J.Crew Factory 4129 - Phase 1_details.json | 2025-09-05 11:52 | 3.5K | |
![[ ]](/icons/unknown.gif) | J.Crew - 4129 (Chappaqua, NY) PHASE 1 ROUGH-IN_details.json | 2025-09-19 01:39 | 4.8K | |
![[ ]](/icons/layout.gif) | J -Crew New Store Install Guide 2025 (2.27 update) - HM edit - 5-26.pdf | 2025-09-19 01:36 | 8.8M | |
![[ ]](/icons/unknown.gif) | J -Crew New Store Install Guide 2025 (2.27 update) - HM edit - 5-26.docx | 2025-09-19 01:35 | 8.5M | |
![[ ]](/icons/layout.gif) | J -Crew New Store Install Guide 2025 (2-27 update) - HM edit - 5-26.pdf | 2025-09-19 01:36 | 8.8M | |
![[ ]](/icons/layout.gif) | Iran Economic Sanctions Act Certification.pdf | 2024-09-30 18:18 | 189K | |
![[ ]](/icons/layout.gif) | Invoice test .pdf | 2024-02-26 13:59 | 303K | |
![[ ]](/icons/layout.gif) | Invoice test -TR-1::R-1.pdf | 2023-11-01 08:38 | 4.2K | |
![[ ]](/icons/layout.gif) | Invoice test -TR-1.pdf | 2023-11-01 08:38 | 21K | |
![[ ]](/icons/layout.gif) | Invoice test -HomePage.pdf | 2023-11-01 08:38 | 167K | |
![[ ]](/icons/layout.gif) | Invoice2459.pdf | 2023-09-20 19:32 | 58K | |
![[ ]](/icons/layout.gif) | Invoice2458.pdf | 2023-09-20 19:31 | 62K | |
![[ ]](/icons/layout.gif) | Introduction_to_OSHA_US_Job_Aid_PS5-00217.pdf | 2024-11-23 12:40 | 116K | |
![[IMG]](/icons/image2.gif) | Intercom in Colorado springs.pdf.svg | 2023-02-13 20:37 | 55K | |
![[ ]](/icons/layout.gif) | Intercom in Colorado springs.pdf | 2023-02-13 20:37 | 230K | |
![[ ]](/icons/layout.gif) | Integrated_Systems_Achieving_Organizational_Excellence_Job_Aid_PS5-00554.pdf | 2024-11-23 12:39 | 101K | |
![[ ]](/icons/layout.gif) | Instruction to Bidders 9.5.2024 (1).pdf | 2024-10-18 18:44 | 235K | |
![[ ]](/icons/layout.gif) | Instruction to Bidders 9-5-2024 (1).pdf | 2024-10-18 18:46 | 235K | |
![[ ]](/icons/layout.gif) | Instructions to Bidders.pdf | 2024-11-05 21:13 | 250K | |
![[ ]](/icons/layout.gif) | Instruction+to+Offerors+-+70Z03825QS0000001.pdf | 2025-01-03 22:01 | 371K | |
![[ ]](/icons/layout.gif) | Inspections_and_Observations_Job_Aid_PS5-00277.pdf | 2024-11-23 12:39 | 123K | |
![[ ]](/icons/layout.gif) | Industrial_Hygiene_Awareness_Job_Aid_PS5-103029.pdf | 2024-11-23 12:35 | 20K | |
![[ ]](/icons/layout.gif) | Incident_Investigation_Job_Aid_PS5-00732.pdf | 2024-11-23 12:39 | 79K | |
![[ ]](/icons/layout.gif) | Important Event Information.pdf | 2025-09-04 13:36 | 154K | |
![[IMG]](/icons/image2.gif) | Image not visible in mobile.jpeg | 2023-09-15 13:14 | 68K | |
![[IMG]](/icons/image2.gif) | Image not visible in mobile (1).jpeg | 2023-09-15 13:13 | 68K | |
![[IMG]](/icons/image2.gif) | Image 12-26-23 at 9.23 AM.jpeg.svg | 2023-12-26 14:23 | 326K | |
![[IMG]](/icons/image2.gif) | Image 12-26-23 at 9.23 AM.jpeg | 2023-12-26 14:23 | 312K | |
![[IMG]](/icons/image2.gif) | Image 7-5-23 at 9.30 PM.jpeg.svg | 2023-07-06 01:32 | 14K | |
![[IMG]](/icons/image2.gif) | Image 7-5-23 at 9.30 PM.jpeg | 2023-07-06 01:32 | 83K | |
![[IMG]](/icons/image2.gif) | Image 1-2-24 at 2.19 PM.jpeg.svg | 2024-01-02 19:38 | 298K | |
![[IMG]](/icons/image2.gif) | Image 1-2-24 at 2.19 PM.jpeg | 2024-01-02 19:38 | 348K | |
![[IMG]](/icons/image2.gif) | Image 1-1-24 at 5.47 PM.jpeg.svg | 2024-01-02 19:07 | 585K | |
![[IMG]](/icons/image2.gif) | Image 1-1-24 at 5.47 PM.jpeg | 2024-01-02 19:07 | 567K | |
![[ ]](/icons/unknown.gif) | Ignacio Zaragoza Elementary School_details.json | 2024-11-20 13:02 | 1.9K | |
![[ ]](/icons/unknown.gif) | ITN PAAA 2026_0002 - CAIC Backend Development and Support.docx | 2025-09-04 13:31 | 78K | |
![[ ]](/icons/unknown.gif) | ITN PAAA 2026*0002 - CAIC BACKEND DEVELOPMENT AND SUPPORT_details.json | 2025-09-04 13:30 | 3.5K | |
![[ ]](/icons/unknown.gif) | IT Issues_details.json | 2025-04-08 19:58 | 1.6K | |
![[ ]](/icons/layout.gif) | ITC's added in rooms punch list 9_25_25 - Sheet1.pdf | 2025-10-27 13:06 | 51K | |
![[IMG]](/icons/image2.gif) | IMG_4574.jpg | 2023-09-20 19:41 | 3.3M | |
![[IMG]](/icons/image2.gif) | IMG_4574.HEIC | 2023-09-12 13:54 | 2.1M | |
![[IMG]](/icons/image2.gif) | IMG_4573.HEIC.jpeg | 2023-09-15 13:15 | 8.6M | |
![[IMG]](/icons/image2.gif) | IMG_4573.HEIC | 2023-09-15 13:15 | 2.2M | |
![[IMG]](/icons/image2.gif) | IMG_4573 (1).HEIC.jpeg | 2023-11-10 12:18 | 8.6M | |
![[IMG]](/icons/image2.gif) | IMG_4573 (1).HEIC | 2023-11-10 12:17 | 2.2M | |
![[IMG]](/icons/image2.gif) | IMG_4572.HEIC | 2023-09-12 13:54 | 4.2M | |
![[IMG]](/icons/image2.gif) | IMG_1518.PNG.svg | 2024-01-29 11:01 | 45K | |
![[IMG]](/icons/image2.gif) | IMG_1518.PNG | 2024-02-07 13:49 | 226K | |
![[IMG]](/icons/image2.gif) | IMG_1517.PNG.svg | 2024-01-31 13:18 | 82K | |
![[IMG]](/icons/image2.gif) | IMG_1517.PNG | 2024-01-31 13:18 | 299K | |
![[IMG]](/icons/image2.gif) | IMG_1516.PNG.svg | 2024-01-24 10:22 | 78K | |
![[IMG]](/icons/image2.gif) | IMG_1516.PNG | 2024-01-24 10:22 | 241K | |
![[IMG]](/icons/image2.gif) | IFP Westminister Cabling As Build.pdf1.png | 2023-10-03 13:55 | 42K | |
![[IMG]](/icons/image2.gif) | IFP Westminister Cabling As Build.pdf0.png | 2023-10-03 13:55 | 337K | |
![[ ]](/icons/layout.gif) | IFP Westminister Cabling As Build.pdf | 2023-10-03 13:55 | 1.0M | |
![[ ]](/icons/layout.gif) | IFP Westminister Cabling.pdf | 2023-10-02 11:29 | 1.0M | |
![[ ]](/icons/layout.gif) | IFP Westminister Cabling-R-1.pdf | 2023-10-02 11:29 | 41K | |
![[ ]](/icons/layout.gif) | IFP Westminister Cabling-HomePage.pdf | 2023-10-02 11:29 | 1.0M | |
![[IMG]](/icons/image2.gif) | IFB 24-031 TSC Cat6 Cabling_Addendum 1_drawings-page1.pdf_0.png.svg | 2024-08-12 07:07 | 8.2K | |
![[IMG]](/icons/image2.gif) | IFB 24-031 TSC Cat6 Cabling_Addendum 1_drawings-page1.pdf_0.png | 2024-08-12 07:07 | 16K | |
![[ ]](/icons/layout.gif) | IFB24-031 TSC (RCCP) Cat6 Cabling Removal and Install FINAL TO POST 5.7.2024 (1).pdf | 2024-05-09 02:09 | 3.4M | |
![[ ]](/icons/layout.gif) | IFB24-031 TSC (RCCP) Cat6 Cabling Removal and Install FINAL TO POST 5-7-2024.pdf | 2024-05-09 02:09 | 3.4M | |
![[IMG]](/icons/image2.gif) | IDF SVG.svg | 2023-04-27 13:30 | 3.2K | |
![[IMG]](/icons/image2.gif) | IDF SVG (2).svg | 2023-04-27 15:27 | 3.2K | |
![[IMG]](/icons/image2.gif) | IDF Cabinet.svg | 2023-05-23 13:48 | 3.9K | |
![[ ]](/icons/layout.gif) | IDF-UPS Backup Time Calculation.pdf | 2024-10-28 17:34 | 357K | |
![[ ]](/icons/layout.gif) | Hydrogen_Sulfide_H2S_Awareness_Job_Aid_PS5-102133.pdf | 2024-11-23 12:34 | 20K | |
![[ ]](/icons/layout.gif) | Hydraulic_Safety_Job_Aid_PS5-00294.pdf | 2024-11-23 12:38 | 58K | |
![[IMG]](/icons/image2.gif) | Huggins East -Second Floor.pdf_0.png | 2025-07-25 05:18 | 1.0M | |
![[IMG]](/icons/image2.gif) | Huggins East -Second Floor.pdf0.png | 2024-08-26 17:17 | 91K | |
![[ ]](/icons/layout.gif) | Huggins East -Second Floor.pdf | 2025-07-25 05:18 | 225K | |
![[IMG]](/icons/image2.gif) | Huggins East -First Floor.pdf0.png | 2024-08-12 13:34 | 87K | |
![[ ]](/icons/layout.gif) | Huggins East -First Floor.pdf | 2024-08-12 13:34 | 215K | |
![[IMG]](/icons/image2.gif) | Huggings plans.pdf5.png | 2024-08-12 13:34 | 156K | |
![[IMG]](/icons/image2.gif) | Huggings plans.pdf4.png | 2024-08-12 13:34 | 153K | |
![[IMG]](/icons/image2.gif) | Huggings plans.pdf3.png | 2024-08-12 13:34 | 153K | |
![[IMG]](/icons/image2.gif) | Huggings plans.pdf2.png | 2024-08-12 13:34 | 157K | |
![[IMG]](/icons/image2.gif) | Huggings plans.pdf1.png | 2024-08-12 13:34 | 161K | |
![[IMG]](/icons/image2.gif) | Huggings plans.pdf0.png | 2024-08-12 13:34 | 148K | |
![[ ]](/icons/layout.gif) | Huggings plans.pdf | 2024-08-12 13:34 | 619K | |
![[ ]](/icons/layout.gif) | Hudson__Colorado-_Project_Schedule.pdf | 2024-05-22 18:39 | 108K | |
![[ ]](/icons/layout.gif) | How_To_Respond_to_Negotiations.pdf | 2025-01-14 13:38 | 326K | |
![[ ]](/icons/layout.gif) | Housekeeping_on_the_Job_Job_Aid_PS5-103016.pdf | 2024-11-23 12:37 | 94K | |
![[ ]](/icons/layout.gif) | Hot_Work_for_Construction_Job_Aid_PS5-102201.pdf | 2024-11-23 12:33 | 135K | |
![[IMG]](/icons/image2.gif) | Horizon High School.pdf_6.png | 2025-07-14 12:20 | 351K | |
![[IMG]](/icons/image2.gif) | Horizon High School.pdf_5.png | 2025-07-14 12:20 | 332K | |
![[IMG]](/icons/image2.gif) | Horizon High School.pdf_4.png | 2025-07-14 12:20 | 350K | |
![[IMG]](/icons/image2.gif) | Horizon High School.pdf_3.png | 2025-07-14 12:20 | 348K | |
![[IMG]](/icons/image2.gif) | Horizon High School.pdf_2.png | 2025-07-14 12:20 | 294K | |
![[IMG]](/icons/image2.gif) | Horizon High School.pdf_1.png | 2025-07-14 12:20 | 884K | |
![[IMG]](/icons/image2.gif) | Horizon High School.pdf_0.png | 2025-07-14 12:20 | 1.7M | |
![[ ]](/icons/layout.gif) | Horizon High School.pdf | 2025-07-14 12:20 | 693K | |
![[IMG]](/icons/image2.gif) | Home run.svg | 2023-04-27 13:25 | 3.7K | |
![[ ]](/icons/layout.gif) | Home page Items.pdf | 2023-03-10 19:09 | 1.0M | |
![[IMG]](/icons/image2.gif) | Home_Run_18527.png | 2023-04-18 15:13 | 5.7K | |
![[ ]](/icons/layout.gif) | Home Page Design.pdf | 2023-12-26 14:20 | 418K | |
![[ ]](/icons/layout.gif) | Home Page Design-TR-1::R-1.pdf | 2023-12-26 14:20 | 171K | |
![[ ]](/icons/layout.gif) | Home Page Design-TR-1.pdf | 2023-12-26 14:20 | 51K | |
![[ ]](/icons/layout.gif) | Home Page Design-HomePage.pdf | 2023-12-26 14:20 | 199K | |
![[ ]](/icons/layout.gif) | HomePage.pdf | 2023-06-20 19:35 | 99K | |
![[IMG]](/icons/image2.gif) | Hoffman wall mount cabinet.png | 2023-04-25 12:41 | 172K | |
![[IMG]](/icons/image2.gif) | Hoffman-2 post rack.jpg | 2023-04-19 15:34 | 30K | |
![[ ]](/icons/unknown.gif) | Hilton CSD Capital Projects 2023 Phase 2A_details.json | 2025-02-11 13:29 | 1.5K | |
![[ ]](/icons/layout.gif) | Hilton CSD Capital Projects 2023 Phase 2A __ Rotolite-Elliott Online Planroom.pdf | 2025-02-11 13:34 | 212K | |
![[ ]](/icons/layout.gif) | Hilton CSD CIP 2023 PHASE 2A_Project Manual_Vol-2_01-27-25+.pdf | 2025-02-11 13:32 | 8.4M | |
![[ ]](/icons/layout.gif) | Hilton CSD CIP 2023 PHASE 2A_Project Manual_Vol-1_01-27-25+.pdf | 2025-02-11 13:32 | 36M | |
![[ ]](/icons/layout.gif) | Hilton CSD CIP 2023 PHASE 2A_Plans_01.27.25+.pdf | 2025-02-11 13:30 | 65M | |
![[ ]](/icons/layout.gif) | Hilton CSD CIP 2023 PHASE 2A_Plans_01-27-25+.pdf | 2025-02-11 13:31 | 65M | |
![[IMG]](/icons/image2.gif) | Highlands Ranch CO.pdf0.png | 2024-01-08 16:04 | 682K | |
![[ ]](/icons/layout.gif) | Highlands Ranch CO.pdf | 2024-01-08 16:04 | 3.2M | |
![[IMG]](/icons/image2.gif) | Highlands Ranch - FP to upload.pdf0.png | 2023-07-14 10:14 | 701K | |
![[ ]](/icons/layout.gif) | Highlands Ranch - FP to upload.pdf | 2023-07-14 10:14 | 889K | |
![[ ]](/icons/layout.gif) | Helix_Industrial__Geotech__DN51883-125-R1-Signed.pdf | 2024-10-21 20:18 | 5.2M | |
![[ ]](/icons/layout.gif) | Heat_Stress_Poster_PS5-102885.pdf | 2024-11-23 13:00 | 1.1M | |
![[ ]](/icons/layout.gif) | Heat_Stress_Job_Aid_PS5-102885.pdf | 2024-11-23 12:34 | 86K | |
![[ ]](/icons/layout.gif) | Heat_Index_PS5-102885.pdf | 2024-11-23 13:00 | 114K | |
![[ ]](/icons/layout.gif) | Hearing_Conservation_US_Job_Aid_PS5-00263.pdf | 2024-11-23 12:38 | 127K | |
![[ ]](/icons/unknown.gif) | Headstart Early Childhood Cabling_details.json | 2025-01-09 22:29 | 85K | |
![[ ]](/icons/layout.gif) | Hazard_Communication_for_Construction_Written_Program_US_Job_Aid_PS5-102200.pdf | 2024-11-23 12:35 | 84K | |
![[IMG]](/icons/image2.gif) | Hanson.pdf0.png | 2023-08-29 20:28 | 117K | |
![[ ]](/icons/layout.gif) | Hanson.pdf | 2023-08-29 20:28 | 161K | |
![[ ]](/icons/layout.gif) | Handwashing_Awareness_Job_Aid_PS5-103131.pdf | 2024-11-23 12:35 | 74K | |
![[ ]](/icons/layout.gif) | Hand_Wrist_and_Finger_Safety_Job_Aid_PS5-01417.pdf | 2024-11-23 12:38 | 89K | |
![[ ]](/icons/layout.gif) | Hand_Tool_Safety_for_Construction_Job_Aid_PS5-102360.pdf | 2024-11-23 12:38 | 69K | |
![[IMG]](/icons/image2.gif) | Hallmark.pdf0.png | 2023-07-24 10:51 | 54K | |
![[ ]](/icons/layout.gif) | Hallmark.pdf | 2023-07-24 10:51 | 252K | |
![[IMG]](/icons/image2.gif) | HILTON HAMPTON INN & SUITES.pdf.svg | 2023-03-31 19:19 | 388K | |
![[ ]](/icons/layout.gif) | HILTON HAMPTON INN & SUITES.pdf | 2023-03-31 19:19 | 206K | |
![[IMG]](/icons/image2.gif) | HIGH SCHOOL HS-T101-HS-T101D.pdf_0.png | 2025-06-24 15:11 | 2.1M | |
![[ ]](/icons/layout.gif) | HIGH SCHOOL HS-T101-HS-T101D.pdf | 2025-06-24 15:11 | 307K | |
![[ ]](/icons/layout.gif) | HCTS_-_TIA_Report_-_2024-04-24.pdf | 2024-05-22 18:39 | 5.1M | |
![[ ]](/icons/layout.gif) | HCTS_-_Land_Use_Application_-_2024-04-24.pdf | 2024-05-22 18:39 | 783K | |
![[ ]](/icons/layout.gif) | HCTS_-_Final_Plat_-_2024-04-24.pdf | 2024-05-22 18:39 | 759K | |
![[ ]](/icons/layout.gif) | HCTS_-_FSP_-_2024-04-24.pdf | 2024-05-22 18:39 | 4.4M | |
![[ ]](/icons/layout.gif) | HCTS_-_Construction_Plan_Checklist.pdf | 2024-05-22 18:39 | 157K | |
![[ ]](/icons/layout.gif) | HCTS_-_CD_-_2024-04-24.pdf | 2024-05-22 18:39 | 5.9M | |
![[IMG]](/icons/image2.gif) | HC6RPB_HC6RRB_HC6SPB_HC6SRB_1200.jpg | 2023-02-10 10:25 | 40K | |
![[ ]](/icons/layout.gif) | HAZWOPER_Direct_Reading_Gas_Detector_Safety_Job_Aid_PS5-103454.pdf | 2024-11-23 12:34 | 29K | |
![[ ]](/icons/layout.gif) | HANSON MDF-MONACO IDF121-ACHS IDF E126-DUPONT IDF-KEMP MDF-ACMS IDF1-KMS IDF2-KMS IDF3-LAHS MDF-MONACO MDF-ROSE HILL MDF-HANSON IDF-ACHS MDF-SANVILLE MDF-DUPONT MDF-ACMS MDF-KMS MDF-ACMS IDF3-ROSE HILL IDF111-ACHS D127-ACHS C216-STARS MDF-A.pdf | 2023-11-06 14:16 | 89M | |
![[ ]](/icons/unknown.gif) | Greenwood Lake Union Free School District - 2023_details.json | 2024-11-28 15:31 | 1.3K | |
![[IMG]](/icons/image2.gif) | Greenlee drag.jpg | 2023-05-04 14:31 | 18K | |
![[IMG]](/icons/image2.gif) | Greeley CO.pdf0.png | 2024-01-04 03:56 | 220K | |
![[ ]](/icons/layout.gif) | Greeley CO.pdf | 2024-01-04 03:56 | 1.1M | |
![[ ]](/icons/layout.gif) | Graybar Quotation 0245893938.pdf | 2024-04-17 14:29 | 286K | |
![[ ]](/icons/layout.gif) | Graybar Order Acknowledgement 112508-04129-2 3000439999.pdf | 2025-09-19 01:34 | 416K | |
![[ ]](/icons/unknown.gif) | Grant St Apartments 287 E. 17th Avenue_details.json | 2024-12-06 19:16 | 1.7K | |
![[IMG]](/icons/image2.gif) | Golden Hill.pdf_0.png | 2025-12-13 00:43 | 1.6M | |
![[ ]](/icons/layout.gif) | Golden Hill.pdf | 2025-12-13 00:43 | 150K | |
![[ ]](/icons/layout.gif) | Global Furniture - Denver CO - TR20230404.5639 .pdf | 2023-11-03 15:24 | 443K | |
![[ ]](/icons/layout.gif) | Global Furniture - Denver CO - TR20230404.5639 -HomePage.pdf | 2023-11-03 15:23 | 239K | |
![[ ]](/icons/layout.gif) | Global Furniture - Denver CO - TR20230404.5639 -C-1.pdf | 2023-11-03 15:23 | 205K | |
![[ ]](/icons/layout.gif) | Global Furniture - Denver CO - TR20230404-5639 .pdf | 2023-11-03 15:26 | 443K | |
![[ ]](/icons/layout.gif) | Global Furniture - Denver CO -.pdf | 2023-11-03 14:47 | 723K | |
![[ ]](/icons/layout.gif) | Giving_and_Receiving_Feedback_Job_Aid_PS5-00279.pdf | 2024-11-23 12:39 | 109K | |
![[IMG]](/icons/image2.gif) | Gilber AZ.pdf0.png | 2023-09-25 21:09 | 143K | |
![[IMG]](/icons/image2.gif) | Gilber AZ.pdf.svg | 2023-03-07 17:56 | 181K | |
![[ ]](/icons/layout.gif) | Gilber AZ.pdf | 2023-09-25 21:09 | 165K | |
![[ ]](/icons/unknown.gif) | Genesee ISD ECPS Construction Cabling & Equipment RFP.xlsx | 2024-09-30 18:16 | 80K | |
![[ ]](/icons/layout.gif) | Genesee ISD - ECPS Construction Cabling and Equipment 2024 A2.pdf | 2024-09-30 18:16 | 1.0M | |
![[ ]](/icons/layout.gif) | Genesee ISD - ECPS Construction Cabling and Equipment 2024.pdf | 2024-09-30 18:17 | 141K | |
![[ ]](/icons/layout.gif) | Genesee ISD - ECPS Construction Cabling and Equipment 2024 - Addendum 2.pdf | 2024-09-30 18:16 | 115K | |
![[ ]](/icons/layout.gif) | Genesee ISD - ECPS Construction Cabling and Equipment 2024 - Addendum 1.pdf | 2024-09-30 18:16 | 90K | |
![[ ]](/icons/unknown.gif) | Genesee ISD - ECPS Construction Cabling and Equipment 2024 - 04 - Attachment B1 - Bid Form.xlsx | 2024-10-18 18:45 | 48K | |
![[ ]](/icons/layout.gif) | GarageCondosRacine_Bldg D Elec_Permit.pdf | 2024-02-27 21:56 | 2.1M | |
![[ ]](/icons/layout.gif) | GarageCondosRacine_Bldg C Elec_Permit.pdf | 2024-02-27 21:56 | 1.2M | |
![[ ]](/icons/layout.gif) | GarageCondosRacine_Bldg B Elec_Permit.pdf | 2024-02-27 21:55 | 1.2M | |
![[IMG]](/icons/image2.gif) | GarageCondosRacine_Bldg A_Elec Permit.pdf2.png | 2024-07-29 02:08 | 616K | |
![[IMG]](/icons/image2.gif) | GarageCondosRacine_Bldg A_Elec Permit.pdf1.png | 2024-07-29 02:08 | 618K | |
![[IMG]](/icons/image2.gif) | GarageCondosRacine_Bldg A_Elec Permit.pdf0.png | 2024-07-29 02:08 | 1.6M | |
![[ ]](/icons/layout.gif) | GarageCondosRacine_Bldg A_Elec Permit.pdf | 2024-07-29 02:08 | 1.5M | |
![[ ]](/icons/layout.gif) | GWL 2023 CIP Bid Spec Volume 2.pdf | 2024-11-28 15:32 | 5.2M | |
![[ ]](/icons/layout.gif) | GWL 2023 CIP Bid Spec Volume 1.pdf | 2024-11-28 15:32 | 17M | |
![[ ]](/icons/layout.gif) | GWL 2023 CIP Bid Drawings.pdf | 2024-11-28 15:32 | 19M | |
![[ ]](/icons/unknown.gif) | GISD Early Childhood Programs_details.json | 2024-10-01 13:04 | 1.6K | |
![[IMG]](/icons/image2.gif) | Frontline POP Loveland.pdf0.png | 2023-05-23 11:58 | 35K | |
![[ ]](/icons/layout.gif) | Frontline POP Loveland.pdf | 2023-05-23 11:58 | 33K | |
![[IMG]](/icons/image2.gif) | Frontline POP Loveland (1).pdf0.png | 2023-05-23 13:23 | 35K | |
![[ ]](/icons/layout.gif) | Frontline POP Loveland (1).pdf | 2023-05-23 13:23 | 34K | |
![[IMG]](/icons/image2.gif) | Frontline POP's CO Springs.pdf0.png | 2023-06-27 18:24 | 29K | |
![[ ]](/icons/layout.gif) | Frontline POP's CO Springs.pdf | 2023-06-27 18:24 | 34K | |
![[ ]](/icons/unknown.gif) | FrontierBank Fiber Repair_details.json | 2025-09-04 17:48 | 1.9K | |
![[IMG]](/icons/image2.gif) | Frame.svg | 2025-05-27 18:55 | 31K | |
![[ ]](/icons/layout.gif) | Foundation.pdf | 2024-11-12 22:31 | 110K | |
![[ ]](/icons/unknown.gif) | Foundation.docx | 2024-11-12 22:25 | 75K | |
![[IMG]](/icons/image2.gif) | Fort Collins CO.pdf0.png | 2024-01-04 04:08 | 376K | |
![[ ]](/icons/layout.gif) | Fort Collins CO.pdf | 2024-01-04 04:08 | 1.8M | |
![[IMG]](/icons/image2.gif) | Fluke certification SVG.svg | 2023-07-21 17:30 | 23K | |
![[IMG]](/icons/image2.gif) | Fluke certification.jpeg | 2023-07-21 17:30 | 15K | |
![[ ]](/icons/unknown.gif) | Florida Union Freee School District Qoute_details.json | 2025-12-11 21:56 | 68K | |
![[IMG]](/icons/image2.gif) | Floorplans.pdf_2.png | 2024-11-28 01:51 | 4.3M | |
![[IMG]](/icons/image2.gif) | Floorplans.pdf_1.png | 2024-11-28 01:51 | 4.6M | |
![[IMG]](/icons/image2.gif) | Floorplans.pdf_0.png | 2024-11-28 01:51 | 4.9M | |
![[ ]](/icons/layout.gif) | Floorplans.pdf | 2024-11-28 01:51 | 1.6M | |
![[IMG]](/icons/image2.gif) | Floor plan.pdf_0.png | 2025-05-09 12:46 | 1.7M | |
![[ ]](/icons/layout.gif) | Floor plan.pdf | 2025-05-09 12:46 | 289K | |
![[IMG]](/icons/image2.gif) | Floor_1.pdf0.png | 2024-02-11 00:08 | 133K | |
![[ ]](/icons/layout.gif) | Floor_1.pdf | 2024-02-11 00:08 | 183K | |
![[ ]](/icons/layout.gif) | Floor Plans.pdf | 2025-01-03 22:44 | 1.4M | |
![[IMG]](/icons/image2.gif) | Floor Plan BR1184 South Side.png.svg | 2024-01-16 20:38 | 41K | |
![[IMG]](/icons/image2.gif) | Floor Plan BR1184 South Side.png | 2024-01-16 20:38 | 67K | |
![[IMG]](/icons/image2.gif) | Floor Plan BR1184 South Side.jpg.svg | 2024-01-31 14:30 | 40K | |
![[IMG]](/icons/image2.gif) | Floor Plan BR1184 South Side.jpg | 2024-01-31 14:30 | 88K | |
![[IMG]](/icons/image2.gif) | Floor Plan BR1184 North Side.png.svg | 2024-01-16 20:38 | 67K | |
![[IMG]](/icons/image2.gif) | Floor Plan BR1184 North Side.png | 2024-01-16 20:38 | 106K | |
![[IMG]](/icons/image2.gif) | Floor Plan BR1182 Upstairs.png.svg | 2024-01-12 19:59 | 19K | |
![[IMG]](/icons/image2.gif) | Floor Plan BR1182 Upstairs.png | 2024-01-12 19:59 | 28K | |
![[IMG]](/icons/image2.gif) | Floor Plan BR1182 Main Floor.png.svg | 2024-01-12 19:58 | 30K | |
![[IMG]](/icons/image2.gif) | Floor Plan BR1182 Main Floor.png | 2024-01-12 19:58 | 49K | |
![[IMG]](/icons/image2.gif) | Floor Plan BR1172 Shop Upstairs.png.svg | 2024-01-25 11:25 | 28K | |
![[IMG]](/icons/image2.gif) | Floor Plan BR1172 Shop Upstairs.png | 2024-01-25 11:25 | 43K | |
![[IMG]](/icons/image2.gif) | Floor Plan BR1172 Shop Main Floor.png.svg | 2024-01-25 11:25 | 62K | |
![[IMG]](/icons/image2.gif) | Floor Plan BR1172 Shop Main Floor.png | 2024-01-25 11:25 | 79K | |
![[IMG]](/icons/image2.gif) | Floor Plan BR1172 Sales.png.svg | 2024-01-25 11:23 | 51K | |
![[IMG]](/icons/image2.gif) | Floor Plan BR1172 Sales.png | 2024-01-25 11:23 | 68K | |
![[IMG]](/icons/image2.gif) | Floor Plan BR1171 Sales.png.svg | 2024-01-12 23:02 | 42K | |
![[IMG]](/icons/image2.gif) | Floor Plan BR1171 Sales.png | 2024-01-12 23:02 | 63K | |
![[IMG]](/icons/image2.gif) | Floor Plan BR1171 Office Main Floor.png.svg | 2024-06-05 15:27 | 39K | |
![[IMG]](/icons/image2.gif) | Floor Plan BR1171 Office Main Floor.png | 2024-06-05 15:27 | 66K | |
![[IMG]](/icons/image2.gif) | Floor Plan BR1171 Office Main Floor (3).png.svg | 2024-06-04 22:05 | 39K | |
![[IMG]](/icons/image2.gif) | Floor Plan BR1171 Office Main Floor (3).png | 2024-06-04 22:05 | 66K | |
![[IMG]](/icons/image2.gif) | Floor Plan BR1171 Office Main Floor (3).jpeg.svg | 2024-06-04 18:07 | 40K | |
![[IMG]](/icons/image2.gif) | Floor Plan BR1171 Office Main Floor (3).jpeg | 2025-07-26 19:21 | 62K | |
![[IMG]](/icons/image2.gif) | Floor Plan BR1171 Office Main Floor (2).png.svg | 2024-06-05 23:54 | 39K | |
![[IMG]](/icons/image2.gif) | Floor Plan BR1171 Office Main Floor (2).png | 2024-06-05 23:54 | 66K | |
![[IMG]](/icons/image2.gif) | Floor Plan BR1171 Office Basement.png.svg | 2024-01-12 23:03 | 41K | |
![[IMG]](/icons/image2.gif) | Floor Plan BR1171 Office Basement.png | 2024-01-12 23:03 | 50K | |
![[IMG]](/icons/image2.gif) | Floor Plan BR1171 Office Basement (1).png.svg | 2024-06-05 23:54 | 41K | |
![[IMG]](/icons/image2.gif) | Floor Plan BR1171 Office Basement (1).png | 2024-06-05 23:54 | 50K | |
![[IMG]](/icons/image2.gif) | Floor Plan BR1171 Admin Main Floor.png.svg | 2024-06-04 22:03 | 40K | |
![[IMG]](/icons/image2.gif) | Floor Plan BR1171 Admin Main Floor.png | 2024-06-04 22:03 | 61K | |
![[IMG]](/icons/image2.gif) | Floor Plan BR1171 Admin Basement.png.svg | 2024-05-31 23:59 | 46K | |
![[IMG]](/icons/image2.gif) | Floor Plan BR1171 Admin Basement.png | 2024-05-31 23:59 | 64K | |
![[IMG]](/icons/image2.gif) | Floor Plan 1178.png.svg | 2024-01-12 16:40 | 30K | |
![[IMG]](/icons/image2.gif) | Floor Plan 1178.png | 2024-01-12 16:40 | 56K | |
![[IMG]](/icons/image2.gif) | Floor Plan 1176.png.svg | 2024-01-16 19:44 | 36K | |
![[IMG]](/icons/image2.gif) | Floor Plan 1176.png | 2024-11-12 23:38 | 51K | |
![[IMG]](/icons/image2.gif) | Floor Plan 1_9b07caaf-5477-4b30-8a17-30b47ff36db1_230920_162208.pdf3.png | 2023-09-20 16:26 | 274K | |
![[IMG]](/icons/image2.gif) | Floor Plan 1_9b07caaf-5477-4b30-8a17-30b47ff36db1_230920_162208.pdf2.png | 2023-09-20 16:26 | 71K | |
![[IMG]](/icons/image2.gif) | Floor Plan 1_9b07caaf-5477-4b30-8a17-30b47ff36db1_230920_162208.pdf1.png | 2023-09-20 16:26 | 683K | |
![[IMG]](/icons/image2.gif) | Floor Plan 1_9b07caaf-5477-4b30-8a17-30b47ff36db1_230920_162208.pdf0.png | 2023-09-20 16:26 | 68K | |
![[ ]](/icons/layout.gif) | Floor Plan 1_9b07caaf-5477-4b30-8a17-30b47ff36db1_230920_162208.pdf | 2023-09-20 16:26 | 2.1M | |
![[IMG]](/icons/image2.gif) | Floor Plan 1 (51) (1).pdf0.png | 2023-10-12 13:12 | 50K | |
![[ ]](/icons/layout.gif) | Floor Plan 1 (51) (1).pdf | 2023-10-12 13:12 | 160K | |
![[IMG]](/icons/image2.gif) | Floor Plan 1 (2).pdf0.png | 2023-10-12 20:48 | 121K | |
![[ ]](/icons/layout.gif) | Floor Plan 1 (2).pdf | 2023-10-12 20:47 | 1.7M | |
![[IMG]](/icons/image2.gif) | Floor Plan.pdf0.png | 2024-02-27 20:55 | 290K | |
![[ ]](/icons/layout.gif) | Floor Plan.pdf | 2024-02-27 20:55 | 1.1M | |
![[IMG]](/icons/image2.gif) | Floor PLan BR1171 Office Upstairs.png.svg | 2024-06-05 23:53 | 34K | |
![[IMG]](/icons/image2.gif) | Floor PLan BR1171 Office Upstairs.png | 2024-06-05 23:53 | 56K | |
![[IMG]](/icons/image2.gif) | Floor 3.pdf0.png | 2024-02-12 18:00 | 88K | |
![[ ]](/icons/layout.gif) | Floor 3.pdf | 2024-02-12 18:00 | 823K | |
![[IMG]](/icons/image2.gif) | Floor 2.pdf0.png | 2024-02-12 17:59 | 87K | |
![[ ]](/icons/layout.gif) | Floor 2.pdf | 2024-02-12 17:59 | 821K | |
![[IMG]](/icons/image2.gif) | Floor 1.pdf0.png | 2024-02-07 13:36 | 259K | |
![[IMG]](/icons/image2.gif) | Floor 1 .pdf0.png | 2024-02-12 17:59 | 88K | |
![[ ]](/icons/layout.gif) | Floor 1.pdf | 2024-02-07 13:36 | 1.1M | |
![[ ]](/icons/layout.gif) | Floor 1 .pdf | 2024-02-12 17:59 | 808K | |
![[IMG]](/icons/image2.gif) | Floor-plan-with-dimensions.jpg.svg | 2023-10-03 18:16 | 61K | |
![[IMG]](/icons/image2.gif) | Floor-plan-with-dimensions.jpg | 2023-10-03 18:16 | 36K | |
![[IMG]](/icons/image2.gif) | Floor+Plans.pdf_13.png | 2025-01-04 00:09 | 1.6M | |
![[IMG]](/icons/image2.gif) | Floor+Plans.pdf_12.png | 2025-01-04 00:09 | 1.3M | |
![[IMG]](/icons/image2.gif) | Floor+Plans.pdf_11.png | 2025-01-04 00:09 | 2.1M | |
![[IMG]](/icons/image2.gif) | Floor+Plans.pdf_10.png | 2025-01-04 00:09 | 1.4M | |
![[IMG]](/icons/image2.gif) | Floor+Plans.pdf_9.png | 2025-01-04 00:09 | 1.7M | |
![[IMG]](/icons/image2.gif) | Floor+Plans.pdf_8.png | 2025-01-04 00:09 | 1.7M | |
![[IMG]](/icons/image2.gif) | Floor+Plans.pdf_7.png | 2025-01-04 00:09 | 1.7M | |
![[IMG]](/icons/image2.gif) | Floor+Plans.pdf_6.png | 2025-01-04 00:09 | 1.7M | |
![[IMG]](/icons/image2.gif) | Floor+Plans.pdf_5.png | 2025-01-04 00:09 | 1.7M | |
![[IMG]](/icons/image2.gif) | Floor+Plans.pdf_4.png | 2025-01-04 00:09 | 1.4M | |
![[IMG]](/icons/image2.gif) | Floor+Plans.pdf_3.png | 2025-01-04 00:09 | 1.5M | |
![[IMG]](/icons/image2.gif) | Floor+Plans.pdf_2.png | 2025-01-04 00:09 | 1.5M | |
![[IMG]](/icons/image2.gif) | Floor+Plans.pdf_1.png | 2025-01-04 00:09 | 29M | |
![[IMG]](/icons/image2.gif) | Floor+Plans.pdf_0.png | 2025-01-04 00:09 | 1.4M | |
![[ ]](/icons/layout.gif) | Floor+Plans.pdf | 2025-01-04 00:07 | 1.4M | |
![[IMG]](/icons/image2.gif) | Fleet Main Floor.pdf_0.png | 2025-07-30 13:46 | 763K | |
![[ ]](/icons/layout.gif) | Fleet Main Floor.pdf | 2025-07-30 13:46 | 187K | |
![[IMG]](/icons/image2.gif) | Fleet 2nd Floor.pdf_0.png | 2025-07-30 14:58 | 535K | |
![[ ]](/icons/layout.gif) | Fleet 2nd Floor.pdf | 2025-07-30 14:58 | 100K | |
![[ ]](/icons/layout.gif) | Flammable_and_Combustible_Liquids_Job_Aid_PS5-00571.pdf | 2024-11-23 12:34 | 82K | |
![[IMG]](/icons/image2.gif) | Fitting room rework.pdf0.png | 2023-05-19 20:24 | 18K | |
![[ ]](/icons/layout.gif) | Fitting room rework.pdf | 2023-05-19 20:24 | 17K | |
![[IMG]](/icons/image2.gif) | Fitting room rework (1).pdf0.png | 2023-05-22 09:08 | 30K | |
![[ ]](/icons/layout.gif) | Fitting room rework (1).pdf | 2023-05-22 09:08 | 31K | |
![[IMG]](/icons/image2.gif) | First Floor.png.svg | 2024-02-17 17:20 | 536K | |
![[IMG]](/icons/image2.gif) | First Floor.png | 2024-02-17 17:20 | 1.0M | |
![[IMG]](/icons/image2.gif) | Firestop plug.svg | 2023-05-04 16:36 | 77K | |
![[IMG]](/icons/image2.gif) | Fire rated cable pathway(Red).svg | 2023-02-10 15:02 | 856 | |
![[ ]](/icons/layout.gif) | Fire_Extinguisher_Safety_for_Construction_Part_2_US_Job_Aid_PS5-102204.pdf | 2024-11-23 12:34 | 69K | |
![[ ]](/icons/layout.gif) | Fire_Extinguisher_Safety_for_Construction_Part_1_US_Job_Aid_PS5-102202.pdf | 2024-11-23 12:34 | 36K | |
![[IMG]](/icons/image2.gif) | Fire Rated Backboard 48inX2in.svg | 2023-02-10 20:44 | 14K | |
![[IMG]](/icons/image2.gif) | Fire Rated Backboard 48inX2in (1).svg | 2023-02-11 19:44 | 14K | |
![[IMG]](/icons/image2.gif) | Fire Rated Backboard 4ftX8ft.svg | 2023-02-11 19:44 | 12K | |
![[IMG]](/icons/image2.gif) | Fire Extinguisher.svg | 2023-02-11 19:13 | 5.5K | |
![[ ]](/icons/layout.gif) | Final Proposal .pdf | 2025-02-21 16:42 | 5.8M | |
![[IMG]](/icons/image2.gif) | Fiber termination.svg | 2023-04-27 13:32 | 5.1K | |
![[IMG]](/icons/image2.gif) | Fiber termination (2).svg | 2023-05-03 17:51 | 4.5K | |
![[ ]](/icons/unknown.gif) | Fiber Uplink Between Buildings_details.json | 2025-12-14 18:29 | 11K | |
![[ ]](/icons/layout.gif) | Fiber To Desktop-Bill of Materials.pdf | 2024-02-22 20:08 | 6.1M | |
![[ ]](/icons/layout.gif) | Fiber TEst.pdf | 2024-02-23 00:06 | 145K | |
![[ ]](/icons/layout.gif) | Fiber TEst-TR-1::Cabinet-1.pdf | 2024-02-23 00:06 | 92K | |
![[ ]](/icons/layout.gif) | Fiber TEst-TR-1.pdf | 2024-02-23 00:06 | 38K | |
![[ ]](/icons/layout.gif) | Fiber TEst-HomePage.pdf | 2024-02-23 00:06 | 18K | |
![[ ]](/icons/unknown.gif) | Fiber Link Installation and Legacy Cable_details.json | 2025-11-07 20:01 | 1.3K | |
![[ ]](/icons/unknown.gif) | Fiber Circuit extension for VCT Technologies_details.json | 2025-04-11 21:14 | 8.2K | |
![[ ]](/icons/unknown.gif) | Fiber Cable Replacement_details.json | 2024-12-31 22:17 | 1.4K | |
![[IMG]](/icons/image2.gif) | F connector.jpg.svg | 2023-07-18 12:51 | 86K | |
![[IMG]](/icons/image2.gif) | F connector.jpg | 2023-07-18 13:40 | 59K | |
![[IMG]](/icons/image2.gif) | F connector (1).jpg.svg | 2023-07-18 13:40 | 86K | |
![[IMG]](/icons/image2.gif) | F connector (1).jpg | 2023-07-18 13:40 | 59K | |
![[ ]](/icons/layout.gif) | Farmington Public Schools Structured Cabling - Base Bid - Proposal.pdf | 2025-01-07 13:04 | 259K | |
![[ ]](/icons/unknown.gif) | Farmington Municipal Schools Preschool Academy East_details.json | 2024-11-12 22:15 | 2.6K | |
![[ ]](/icons/layout.gif) | Fall_Protection_Rescues_Job_Aid_PS5-102794.pdf | 2024-11-23 12:39 | 41K | |
![[ ]](/icons/layout.gif) | FallProtection_US_Job_Aid_PS5-00198.pdf | 2024-11-23 12:39 | 52K | |
![[ ]](/icons/layout.gif) | FY26SchumacherCablingAddendum1.pdf | 2024-12-31 22:08 | 71K | |
![[ ]](/icons/layout.gif) | FY26CablingUpgradesSCERFP.pdf | 2024-12-31 22:08 | 346K | |
![[ ]](/icons/unknown.gif) | FY25 Strasburg C2 Cabling_details.json | 2025-03-12 12:29 | 1.4K | |
![[ ]](/icons/layout.gif) | FY25 Strasburg C2 Cabling Scope of Work.pdf | 2025-02-10 13:22 | 1.4M | |
![[ ]](/icons/layout.gif) | FY25 Strasburg C2 Cabling- Proposal Documents.pdf | 2025-03-12 13:41 | 4.1M | |
![[ ]](/icons/layout.gif) | FPS Structured Cabling RFP - App C.pdf | 2024-12-02 19:57 | 315K | |
![[ ]](/icons/layout.gif) | FPS Structured Cabling RFP - APP B (3).pdf | 2024-12-02 19:57 | 15M | |
![[ ]](/icons/layout.gif) | FPS Structured Cabling RFP - APP A (1).pdf | 2024-12-02 20:12 | 65K | |
![[ ]](/icons/layout.gif) | FPS Structured Cabling RFP (2).pdf | 2024-12-02 19:57 | 449K | |
![[ ]](/icons/layout.gif) | FPS Structured Cabling 2025 RFP - App B.pdf | 2025-12-16 14:32 | 167K | |
![[ ]](/icons/layout.gif) | FPS Structured Cabling 2025 RFP - APP C.pdf | 2025-12-16 14:33 | 25M | |
![[ ]](/icons/layout.gif) | FPS Structured Cabling 2025 RFP - APP C - Addendum 1.pdf | 2025-12-16 14:32 | 25M | |
![[ ]](/icons/layout.gif) | FPS Structured Cabling 2025 RFP - APP C (1).pdf | 2025-12-16 14:33 | 25M | |
![[ ]](/icons/unknown.gif) | FPS Structured Cabling 2025 RFP - APP A.xlsm | 2025-12-16 14:32 | 101K | |
![[ ]](/icons/unknown.gif) | FPS Structured Cabling 2025 RFP - APP A - Addendum 1.xlsm | 2025-12-16 14:32 | 103K | |
![[ ]](/icons/unknown.gif) | FPS Structured Cabling 2025 RFP - APP A - Addendum 1 (2).xlsm | 2025-12-16 14:33 | 103K | |
![[ ]](/icons/layout.gif) | FPS Structured Cabling 2025 RFP (1).pdf | 2025-12-16 14:33 | 454K | |
![[ ]](/icons/layout.gif) | FPS Structured Cabling - Addendum 1.pdf | 2025-12-16 14:32 | 129K | |
![[ ]](/icons/layout.gif) | FPS Structured Cabling - Addendum 1 (1).pdf | 2025-12-16 14:33 | 129K | |
![[IMG]](/icons/image2.gif) | FP200 fire stop plug.jpg | 2023-05-04 16:36 | 45K | |
![[ ]](/icons/layout.gif) | FMS PRESCHOOL-SS-95_.pdf | 2024-11-12 22:23 | 8.1M | |
![[ ]](/icons/layout.gif) | FMS PRESCHOOL-FA-95_.pdf | 2024-11-12 22:23 | 4.1M | |
![[ ]](/icons/layout.gif) | FMS Acad Permit Set 2024-03-21 Plans.pdf | 2024-11-12 22:33 | 95M | |
![[ ]](/icons/layout.gif) | FMS Acad Permit Set 2024-03-21 - Spec V2.pdf | 2024-11-12 22:24 | 12M | |
![[ ]](/icons/unknown.gif) | FIBER NETWORK PROJECT _details.json | 2024-10-03 16:28 | 1.4K | |
![[ ]](/icons/layout.gif) | FCC Form 498.pdf | 2024-02-10 23:23 | 625K | |
![[ ]](/icons/layout.gif) | FB 1,2 AND A,B.pdf | 2024-04-29 20:02 | 1.5M | |
![[ ]](/icons/layout.gif) | FB-15,16.pdf | 2024-04-29 20:02 | 68K | |
![[ ]](/icons/layout.gif) | FB-12,13,14 copy.pdf | 2024-04-29 20:02 | 2.0M | |
![[ ]](/icons/layout.gif) | FB-11.pdf | 2024-04-29 20:02 | 88K | |
![[ ]](/icons/layout.gif) | FB-10.pdf | 2024-04-29 20:02 | 115K | |
![[ ]](/icons/layout.gif) | FB-6,FB-7,FB-8.pdf | 2024-04-29 20:02 | 94K | |
![[ ]](/icons/layout.gif) | FB-4 FB-5.pdf | 2024-04-29 20:02 | 111K | |
![[ ]](/icons/layout.gif) | FB-3.pdf | 2024-04-29 20:02 | 158K | |
![[ ]](/icons/unknown.gif) | FARMINGTON PUBLIC SCHOOLS STRUCTURED CABLING 2025_details.json | 2025-12-16 14:36 | 1.7K | |
![[ ]](/icons/unknown.gif) | FARMINGTON PUBLIC SCHOOLS - RESTRUCTURE CABLING_details.json | 2024-12-02 19:56 | 1.4K | |
![[ ]](/icons/layout.gif) | FA251724Q0065 - Bld 350 ISP Phase 2 Solicitation Amendment 01.pdf | 2024-06-26 14:35 | 223K | |
![[ ]](/icons/layout.gif) | FA251724Q0065 - Bld 350 ISP Phase 2 Solicitaiton.pdf | 2024-06-26 14:35 | 223K | |
![[ ]](/icons/layout.gif) | F04600A01_BergenValleyES Addition_ConstDocs-Dwgs_07-31-2023.pdf | 2024-01-17 03:45 | 89M | |
![[ ]](/icons/layout.gif) | F04600A01_BergenValleyES Addition_ConformedSet-ProjMan_01-08-2024.pdf | 2024-01-25 22:02 | 35M | |
![[IMG]](/icons/image2.gif) | F-type jack.png.svg | 2023-07-18 13:08 | 30K | |
![[IMG]](/icons/image2.gif) | F-type jack.png | 2023-07-18 13:43 | 251K | |
![[IMG]](/icons/image2.gif) | F-type connector SVG.svg | 2023-07-17 14:59 | 22K | |
![[IMG]](/icons/image2.gif) | F-jack SVG.svg | 2023-07-18 13:43 | 17K | |
![[IMG]](/icons/image2.gif) | Export.PNG | 2024-02-07 13:49 | 19K | |
![[ ]](/icons/unknown.gif) | Expo build_details.json | 2025-07-26 18:44 | 1.3K | |
![[ ]](/icons/layout.gif) | Experience Full and Half Rack Diagrams.xlsx - Data Rack Build (42U).pdf | 2025-10-26 16:57 | 584K | |
![[ ]](/icons/layout.gif) | Experience Full and Half Rack Diagrams.pdf | 2025-10-26 16:57 | 584K | |
![[ ]](/icons/unknown.gif) | Experience Full and Half Rack Diagrams (1).xlsx | 2025-10-26 16:36 | 459K | |
![[ ]](/icons/layout.gif) | Experience Design Concept Remodel Install Guide v1.1 Melliot_ABAZARA.pdf | 2025-10-26 16:35 | 2.7M | |
![[ ]](/icons/unknown.gif) | Experience Design Concept Remodel Install Guide Updates.docx | 2025-10-31 21:00 | 241K | |
![[ ]](/icons/unknown.gif) | Expand Emergency Department Cheyenne WY_details.json | 2024-11-06 14:08 | 1.5K | |
![[ ]](/icons/layout.gif) | Exhibit_B_2020.pdf | 2024-11-21 16:49 | 404K | |
![[ ]](/icons/layout.gif) | Exhibit_B_-_City_of_Aspen_POS_-_Office_Renovation_-_Permit_Specifications_-_2024_05-16.pdf | 2024-11-20 15:23 | 7.3M | |
![[ ]](/icons/layout.gif) | Exhibit_A_-_City_of_Aspen_POS_-_Office_Renovation_-_Bid_Set_-_2024-11-04__1_.pdf | 2024-11-20 15:23 | 14M | |
![[ ]](/icons/layout.gif) | Exhibit E- Federal Clauses.pdf | 2024-11-23 12:17 | 641K | |
![[ ]](/icons/layout.gif) | Exhibit E - CAT 6A Ceiling Connector.pdf | 2024-03-18 19:16 | 433K | |
![[ ]](/icons/layout.gif) | Exhibit E - Build America, Buy America.pdf | 2024-11-23 12:17 | 171K | |
![[ ]](/icons/layout.gif) | Exhibit D - Prevailing Wage Schedule..pdf | 2024-03-18 19:17 | 7.3M | |
![[ ]](/icons/layout.gif) | Exhibit C - Cable Manufacturer List.pdf | 2024-03-18 19:17 | 44K | |
![[ ]](/icons/layout.gif) | Exhibit B Colorado PO Terms Conditions DQ 2026000176 CCA Fiber Install for Networked Fire Alarm.pdf | 2025-11-02 00:51 | 270K | |
![[ ]](/icons/layout.gif) | Exhibit B - Low Volt Responsibility Matrix.pdf | 2024-11-23 12:17 | 159K | |
![[ ]](/icons/layout.gif) | Exhibit B- Additional Standards for Work Performed.pdf | 2024-03-18 19:17 | 128K | |
![[IMG]](/icons/image2.gif) | Exhibit A - Sample Project Specifications.pdf_0.png | 2025-09-02 01:38 | 1.1M | |
![[ ]](/icons/layout.gif) | Exhibit A - Sample Project Specifications.pdf | 2025-09-02 01:38 | 297K | |
![[ ]](/icons/layout.gif) | Exhibit A - Sample Project Specifications (2).pdf | 2025-08-14 20:24 | 297K | |
![[ ]](/icons/layout.gif) | Exhibit A - Cabling Industry Standard Guidelines.pdf | 2024-03-18 19:17 | 104K | |
![[ ]](/icons/layout.gif) | Exhibit A - 90% Electrical Construction Documents.pdf | 2024-11-23 12:17 | 25M | |
![[ ]](/icons/layout.gif) | Exhibit 3 - Data Termination Parts (1).pdf | 2025-03-10 23:28 | 1.2M | |
![[ ]](/icons/layout.gif) | Exhibit 2 - NYS-UCS-DoT_CablingStandards 1.pdf | 2025-03-10 23:28 | 867K | |
![[ ]](/icons/layout.gif) | Excavation_and_Trenching_Safety_US_JobAid_PS5-01394.pdf | 2024-11-23 12:38 | 129K | |
![[IMG]](/icons/image2.gif) | Equipment Room.svg | 2023-02-11 19:05 | 959 | |
![[ ]](/icons/unknown.gif) | Equipment Disposition - Experience Remodels.xlsx | 2025-10-31 21:01 | 19K | |
![[IMG]](/icons/image2.gif) | Env2_Mark Up.JPG.svg | 2024-06-11 20:11 | 308K | |
![[IMG]](/icons/image2.gif) | Env2_Mark Up.JPG | 2024-06-11 20:11 | 106K | |
![[IMG]](/icons/image2.gif) | Entrance Facility.svg | 2023-02-11 19:04 | 959 | |
![[IMG]](/icons/image2.gif) | EndCapKit.png | 2023-04-25 16:16 | 101K | |
![[ ]](/icons/unknown.gif) | Ellis county Courts & Administration Renovation_details.json | 2024-11-18 19:59 | 3.4K | |
![[ ]](/icons/layout.gif) | Ellis county Courts & Administration Renovation.pdf | 2024-11-27 21:22 | 34M | |
![[IMG]](/icons/image2.gif) | Elevation Kit for rack.png | 2023-04-26 15:46 | 23K | |
![[IMG]](/icons/image2.gif) | Elevation Kit for rack (1).png | 2023-05-08 17:56 | 16K | |
![[ ]](/icons/layout.gif) | Electric and Low Voltage Permit_1.pdf | 2025-09-30 17:14 | 236K | |
![[ ]](/icons/layout.gif) | Electrical_Safety_for_Construction_Power_Lines_and_Lockout_Tagout_US_Job_Aid_PS5-102235.pdf | 2024-11-23 12:39 | 77K | |
![[ ]](/icons/layout.gif) | Electrical_Safety_for_Construction_Cord_and_Plug_Connected_Equipment_US_Job_Aid_PS5-102231.pdf | 2024-11-23 12:40 | 88K | |
![[ ]](/icons/layout.gif) | ElecPlans_287E17_10-18-2024.pdf | 2024-12-06 19:17 | 24M | |
![[IMG]](/icons/image2.gif) | EkdR8s5b.jpeg | 2023-02-22 15:57 | 18K | |
![[ ]](/icons/layout.gif) | Egress_and_Emergency_Action_Plans_US_Job_Aid_PS5-00231.pdf | 2024-11-23 12:38 | 117K | |
![[IMG]](/icons/image2.gif) | East Building.png.svg | 2024-06-04 18:10 | 192K | |
![[IMG]](/icons/image2.gif) | East Building.png | 2024-06-04 18:10 | 178K | |
![[IMG]](/icons/image2.gif) | East Building.PNG | 2024-05-27 19:24 | 178K | |
![[IMG]](/icons/image2.gif) | Eagle.pdf_2.png | 2025-02-27 17:32 | 547K | |
![[IMG]](/icons/image2.gif) | Eagle.pdf_1.png | 2025-02-27 17:32 | 956K | |
![[IMG]](/icons/image2.gif) | Eagle.pdf_0.png | 2025-02-27 17:32 | 1.3M | |
![[ ]](/icons/layout.gif) | Eagle.pdf | 2025-02-27 17:32 | 297K | |
![[ ]](/icons/unknown.gif) | EXHIBIT I - Bid# 2024-39 Data Cabling II for Niagara County Information Technology.xlsx | 2024-10-15 21:07 | 21K | |
![[ ]](/icons/layout.gif) | EXHIBIT I - Bid# 2024-35 Data Cabling for Niagara County Information Technology - Sheet1.pdf | 2024-05-10 01:13 | 149K | |
![[ ]](/icons/layout.gif) | ETS TS Drawings.pdf | 2025-11-03 22:55 | 33M | |
![[ ]](/icons/layout.gif) | EPRevisedSheetsForRFP.pdf | 2024-12-06 19:42 | 2.1M | |
![[ ]](/icons/layout.gif) | EAST CREEK CONDUIT PATHWAY _ YorkSt_E152ndPkwy_NEC_D1-3 (1).pdf | 2023-03-06 22:12 | 1.3M | |
![[IMG]](/icons/image2.gif) | E1863016-1C27-492A-8252-899F25751883.jpeg.svg | 2023-12-28 13:08 | 802K | |
![[IMG]](/icons/image2.gif) | E1863016-1C27-492A-8252-899F25751883.jpeg | 2023-12-28 13:08 | 1.0M | |
![[IMG]](/icons/image2.gif) | E401 Enlarged Meeting & BOH marked.pdf0.png | 2024-04-01 15:40 | 915K | |
![[ ]](/icons/layout.gif) | E401 Enlarged Meeting & BOH marked.pdf | 2024-04-01 15:40 | 621K | |
![[IMG]](/icons/image2.gif) | E103 Electrical Data Special Systems Plan.pdf0.png | 2024-04-17 11:51 | 701K | |
![[ ]](/icons/layout.gif) | E103 Electrical Data Special Systems Plan.pdf | 2024-04-17 11:51 | 317K | |
![[IMG]](/icons/image2.gif) | E101 Main Level marked.pdf0.png | 2024-04-01 15:39 | 2.0M | |
![[ ]](/icons/layout.gif) | E101 Main Level marked.pdf | 2024-04-01 15:39 | 717K | |
![[IMG]](/icons/image2.gif) | E101-E104 plans-merged.pdf3.png | 2024-03-29 20:22 | 1.0M | |
![[IMG]](/icons/image2.gif) | E101-E104 plans-merged.pdf2.png | 2024-03-29 20:22 | 1.1M | |
![[IMG]](/icons/image2.gif) | E101-E104 plans-merged.pdf1.png | 2024-03-29 20:22 | 1.2M | |
![[IMG]](/icons/image2.gif) | E101-E104 plans-merged.pdf0.png | 2024-03-29 20:22 | 1.9M | |
![[ ]](/icons/layout.gif) | E101-E104 plans-merged.pdf | 2024-03-29 20:21 | 2.9M | |
![[IMG]](/icons/image2.gif) | E101,E401,E402,E403,E102,E103,E104 plans-merged.pdf6.png.svg | 2024-06-05 12:26 | 1.6M | |
![[IMG]](/icons/image2.gif) | E101,E401,E402,E403,E102,E103,E104 plans-merged.pdf6.png | 2024-06-05 12:26 | 1.0M | |
![[IMG]](/icons/image2.gif) | E101,E401,E402,E403,E102,E103,E104 plans-merged.pdf5.png | 2024-04-01 15:37 | 1.1M | |
![[IMG]](/icons/image2.gif) | E101,E401,E402,E403,E102,E103,E104 plans-merged.pdf4.png | 2024-04-01 15:37 | 1.2M | |
![[IMG]](/icons/image2.gif) | E101,E401,E402,E403,E102,E103,E104 plans-merged.pdf3.png | 2024-04-01 15:37 | 813K | |
![[IMG]](/icons/image2.gif) | E101,E401,E402,E403,E102,E103,E104 plans-merged.pdf2.png | 2024-04-01 15:37 | 884K | |
![[IMG]](/icons/image2.gif) | E101,E401,E402,E403,E102,E103,E104 plans-merged.pdf1.png | 2024-04-01 15:37 | 899K | |
![[IMG]](/icons/image2.gif) | E101,E401,E402,E403,E102,E103,E104 plans-merged.pdf0.png | 2024-04-01 15:37 | 1.9M | |
![[ ]](/icons/layout.gif) | E101,E401,E402,E403,E102,E103,E104 plans-merged.pdf | 2024-04-01 15:36 | 4.7M | |
![[IMG]](/icons/image2.gif) | E42FCFA1-D0B0-4546-970B-7FEFBF8459BF_4_5005_c.jpeg | 2023-03-10 17:57 | 15K | |
![[ ]](/icons/layout.gif) | E5E76803-FFC3-A149-A80C-DED597DDC1F2.pdf | 2024-11-23 12:34 | 79K | |
![[IMG]](/icons/image2.gif) | E4.5 Electrical Power Plan.pdf0.png | 2023-12-29 17:50 | 1.2M | |
![[ ]](/icons/layout.gif) | E4.5 Electrical Power Plan.pdf | 2023-12-29 17:50 | 555K | |
![[IMG]](/icons/image2.gif) | E2 Electrical.pdf_0.png | 2024-10-18 15:23 | 735K | |
![[ ]](/icons/layout.gif) | E2 Electrical.pdf | 2024-10-18 15:23 | 399K | |
![[ ]](/icons/layout.gif) | E2.1__FIRST_LEVEL_ELECTRICAL_PLAN_Rev.2_(2).pdf | 2023-02-13 18:37 | 1.1M | |
![[ ]](/icons/layout.gif) | E2.02 Power Plan - Level 2.pdf | 2024-03-12 16:42 | 509K | |
![[ ]](/icons/layout.gif) | E2-02 Power Plan - Level 2.pdf | 2024-03-12 16:44 | 509K | |
![[ ]](/icons/layout.gif) | E2-01 Power Plan - Level 1.pdf | 2024-03-12 16:44 | 676K | |
![[ ]](/icons/layout.gif) | E1B Harkness -SPK CLK Summary 3-24-2025-kk (003).pdf | 2025-04-08 13:25 | 438K | |
![[ ]](/icons/layout.gif) | E 1.3 Electrical Systems Plan.pdf | 2023-03-25 03:10 | 679K | |
![[ ]](/icons/layout.gif) | Dust_Mask_Voluntary_Use_Guidelines_US_Job_Aid_PS5-00296.pdf | 2024-11-23 12:38 | 122K | |
![[IMG]](/icons/image2.gif) | Duplex Low Voltage Wiring Plan[61].pdf1.png | 2023-09-26 12:19 | 84K | |
![[IMG]](/icons/image2.gif) | Duplex Low Voltage Wiring Plan[61].pdf0.png | 2023-09-26 12:19 | 89K | |
![[ ]](/icons/layout.gif) | Duplex Low Voltage Wiring Plan[61].pdf | 2023-09-26 12:19 | 239K | |
![[IMG]](/icons/image2.gif) | Dual port Wireless access point outlet (ceiling)(Purple).svg | 2023-02-10 20:15 | 1.9K | |
![[IMG]](/icons/image2.gif) | Dual Data Wall Outlet(Blue).svg | 2023-02-10 19:02 | 1.7K | |
![[IMG]](/icons/image2.gif) | Dual Data Floor Outlet(Blue).svg | 2023-02-10 19:10 | 1.9K | |
![[IMG]](/icons/image2.gif) | Dual Data Ceiling Outlet(Blue).svg | 2023-02-10 19:06 | 1.9K | |
![[IMG]](/icons/image2.gif) | DropCeiling.jpg | 2024-10-15 20:31 | 3.1M | |
![[IMG]](/icons/image2.gif) | Drawings.pdf_0.png | 2025-09-08 12:07 | 730K | |
![[ ]](/icons/layout.gif) | Drawings.pdf | 2025-09-18 19:30 | 323K | |
![[IMG]](/icons/image2.gif) | Door exit motion.jpg | 2023-04-28 12:05 | 13K | |
![[IMG]](/icons/image2.gif) | Door contact.jpg | 2023-04-28 12:03 | 14K | |
![[IMG]](/icons/image2.gif) | DoorAC.jpg | 2024-10-15 20:31 | 93K | |
![[IMG]](/icons/image2.gif) | Document.png | 2024-11-12 12:00 | 14K | |
![[IMG]](/icons/image2.gif) | Doc - Mar 1 2023 - 10-58 AM (002).pdf.svg | 2023-03-10 19:09 | 592K | |
![[ ]](/icons/layout.gif) | Doc - Mar 1 2023 - 10-58 AM (002).pdf | 2023-03-10 19:09 | 695K | |
![[ ]](/icons/unknown.gif) | Dmarc Extension - Rise Dispensary_details.json | 2025-04-14 20:29 | 2.1K | |
![[ ]](/icons/layout.gif) | Division 27 specs.pdf | 2024-02-02 19:02 | 592K | |
![[ ]](/icons/layout.gif) | Division 27 - Multiple Sections.pdf | 2024-03-27 12:16 | 2.5M | |
![[ ]](/icons/layout.gif) | Division 0 - 00000C Bid Documents (2).pdf | 2024-02-09 23:58 | 4.4M | |
![[ ]](/icons/layout.gif) | Division 0 - 00000C Bid Documents (1).pdf | 2024-02-06 21:18 | 305K | |
![[IMG]](/icons/image2.gif) | Diamond logo.png | 2023-12-14 17:16 | 50K | |
![[IMG]](/icons/image2.gif) | Diagram (9).png.svg | 2023-12-28 07:13 | 703K | |
![[IMG]](/icons/image2.gif) | Diagram (9).png | 2023-12-28 07:13 | 1.2M | |
![[IMG]](/icons/image2.gif) | Dhiraj_T_Python_Trantor Resume.pdf2.png | 2023-09-28 08:55 | 62K | |
![[IMG]](/icons/image2.gif) | Dhiraj_T_Python_Trantor Resume.pdf1.png | 2023-09-28 08:55 | 105K | |
![[IMG]](/icons/image2.gif) | Dhiraj_T_Python_Trantor Resume.pdf0.png | 2023-09-28 08:55 | 127K | |
![[ ]](/icons/layout.gif) | Dhiraj_T_Python_Trantor Resume.pdf | 2023-09-28 08:55 | 59K | |
![[ ]](/icons/layout.gif) | Device Inventory.pdf | 2024-12-02 20:12 | 144K | |
![[IMG]](/icons/image2.gif) | Desert ViewHighVoltage.pdf.svg | 2023-03-03 20:28 | 163K | |
![[ ]](/icons/layout.gif) | Desert ViewHighVoltage.pdf | 2023-03-03 21:17 | 241K | |
![[IMG]](/icons/image2.gif) | Desert ViewHighVoltage-01.jpg.svg | 2023-03-10 19:16 | 180K | |
![[IMG]](/icons/image2.gif) | Desert ViewHighVoltage-01.jpg | 2023-03-10 19:16 | 464K | |
![[IMG]](/icons/image2.gif) | Desert View.pdf.svg | 2023-03-23 11:56 | 326K | |
![[ ]](/icons/layout.gif) | Desert View.pdf | 2023-03-23 11:56 | 233K | |
![[IMG]](/icons/image2.gif) | Denver floor plan.pdf0.png | 2023-09-08 21:11 | 212K | |
![[ ]](/icons/layout.gif) | Denver floor plan.pdf | 2023-09-08 21:11 | 757K | |
![[ ]](/icons/unknown.gif) | Denver _details.json | 2025-09-02 02:40 | 2.5K | |
![[ ]](/icons/layout.gif) | Denver Public Library E-Rate Category 2 Proposal.pdf | 2024-02-10 23:23 | 865K | |
![[IMG]](/icons/image2.gif) | Denver Ipads.pdf_0.png | 2025-04-08 15:54 | 3.3M | |
![[ ]](/icons/layout.gif) | Denver Ipads.pdf | 2025-04-08 15:54 | 2.2M | |
![[ ]](/icons/unknown.gif) | Denver CO 22 Drops Cat6 Cabling_details.json | 2025-05-22 16:21 | 33K | |
![[ ]](/icons/unknown.gif) | Denver CO 22 Drops Cat6 Cabling With Conduit_details.json | 2025-05-22 16:37 | 48K | |
![[ ]](/icons/unknown.gif) | Denver CO 22 Drops Cat6 Cabling-With Conduit_details.json | 2025-05-22 16:45 | 54K | |
![[ ]](/icons/unknown.gif) | Denver - cable corrections_details.json | 2025-09-07 03:02 | 2.1K | |
![[IMG]](/icons/image2.gif) | Demolition Wall Outlet (Gray).svg | 2023-02-10 19:47 | 962 | |
![[IMG]](/icons/image2.gif) | Demolition Floor Outlet (Gray).svg | 2023-02-10 19:49 | 1.2K | |
![[IMG]](/icons/image2.gif) | Demolition Ceiling Outlet (Gray).svg | 2023-02-10 19:48 | 1.2K | |
![[TXT]](/icons/text.gif) | Demo Analyse project-Termination Hardware- Assets List.csv | 2023-05-09 15:26 | 7.5K | |
![[TXT]](/icons/text.gif) | Demo Analyse project-Termination Hardware- Assets List (1).csv | 2023-05-09 17:18 | 8.1K | |
![[ ]](/icons/layout.gif) | Demo 23.pdf | 2023-12-08 02:00 | 402K | |
![[ ]](/icons/layout.gif) | Demo 23-TR-1::R-1.pdf | 2023-12-08 02:00 | 154K | |
![[ ]](/icons/layout.gif) | Demo 23-TR-1.pdf | 2023-12-08 02:00 | 47K | |
![[ ]](/icons/layout.gif) | Demo 23-HomePage.pdf | 2023-12-08 02:00 | 203K | |
![[ ]](/icons/layout.gif) | Demo.pdf | 2023-10-16 10:37 | 16M | |
![[TXT]](/icons/text.gif) | Demo-Telecommunication Spaces- Assets List.csv | 2023-02-11 21:04 | 1.5K | |
![[ ]](/icons/layout.gif) | Demo-TC-1::R-1.pdf | 2023-10-16 10:37 | 539K | |
![[ ]](/icons/layout.gif) | Demo-TC-1.pdf | 2023-10-16 10:37 | 248K | |
![[TXT]](/icons/text.gif) | Demo-Network Room Elements- Assets List.csv | 2023-02-14 17:58 | 1.6K | |
![[TXT]](/icons/text.gif) | Demo-Network Room Elements- Assets List (2).csv | 2023-02-14 19:23 | 1.9K | |
![[ ]](/icons/unknown.gif) | Demo - Mike_details.json | 2024-11-04 15:50 | 40K | |
![[ ]](/icons/layout.gif) | Demo-HomePage.pdf | 2023-10-16 10:36 | 16M | |
![[ ]](/icons/unknown.gif) | Dell proliant.webp | 2023-02-27 21:43 | 82K | |
![[TXT]](/icons/text.gif) | Deleted Attachments.txt | 2025-02-03 14:50 | 121 | |
![[ ]](/icons/layout.gif) | Defensive_Driving_Small_Vehicles_Job_Aid_PS5-00264.pdf | 2024-11-23 13:14 | 115K | |
![[ ]](/icons/unknown.gif) | Data Frame Replacement - Elementary and Middle Schools - E-Rate Compliant_details.json | 2024-12-31 22:28 | 1.4K | |
![[ ]](/icons/unknown.gif) | Data Cabling for Niagara County Information Technology_details.json | 2024-10-16 19:35 | 1.5K | |
![[IMG]](/icons/image2.gif) | DWG-ORD002285-EST005769-LM-REV2 (4.14.2023) copy.pdf0.png | 2023-04-26 16:47 | 111K | |
![[ ]](/icons/layout.gif) | DWG-ORD002285-EST005769-LM-REV2 (4.14.2023) copy.pdf | 2023-04-26 16:47 | 738K | |
![[IMG]](/icons/image2.gif) | DSST.pdf0.png | 2023-07-19 11:44 | 5.7K | |
![[ ]](/icons/layout.gif) | DSST.pdf | 2023-07-19 11:44 | 28K | |
![[ ]](/icons/layout.gif) | DRG Progress Set Drawings 05302023 (1).pdf | 2024-10-15 20:31 | 12M | |
![[ ]](/icons/layout.gif) | DRAFT_03.3_RFP_Section_C_LCLS-II-HE_Sec_7-10_Site_Plan_Drawing_List.pdf | 2025-01-03 21:58 | 50M | |
![[ ]](/icons/layout.gif) | DRAFT_03-3_RFP_Section_C_LCLS-II-HE_Sec_7-10_Site_Plan_Drawing_List.pdf | 2025-01-03 22:01 | 50M | |
![[ ]](/icons/layout.gif) | DQ 2026000176 CCA Fiber Install for Networked Fire Alarm.pdf | 2025-11-07 21:58 | 77K | |
![[ ]](/icons/unknown.gif) | DQ1-GJCA-2026000187 - CCA DQ 2026000187 Fiber Link Installation and Legacy Cable D_details.json | 2025-11-08 12:50 | 15K | |
![[ ]](/icons/layout.gif) | DQ1-GJCA-2026000187 - CCA DQ 2026000187 Fiber Link Installation and Legacy Cable D- Proposal Documents.pdf | 2025-11-09 17:55 | 4.5M | |
![[ ]](/icons/layout.gif) | DQ1-GJCA-2026000176.pdf | 2025-11-02 00:51 | 5.9K | |
![[ ]](/icons/unknown.gif) | DQ1-GJCA-2026000176 - DQ 2026000176 CCA Fiber Install for Networked Fire Alarm_details.json | 2025-11-02 14:03 | 11K | |
![[ ]](/icons/layout.gif) | DQ1-GJCA-2026000176 - DQ 2026000176 CCA Fiber Install for Networked Fire Alarm- Proposal Documents.pdf | 2025-11-02 14:40 | 3.7M | |
![[ ]](/icons/layout.gif) | DPL Central - COB-26r Temp Data and Power from B1.pdf | 2024-02-19 18:46 | 534K | |
![[ ]](/icons/layout.gif) | DPD 1-24_1712238296.pdf | 2024-04-19 12:40 | 16K | |
![[ ]](/icons/layout.gif) | DPD 1-24 Supply & Install Low Voltage Wiring for Town Facilities copy.pdf | 2024-04-19 15:45 | 2.1M | |
![[ ]](/icons/layout.gif) | DPD 1-24 Supply & Install Low Voltage Wiring for Town Facilities.pdf | 2024-04-19 12:40 | 2.0M | |
![[ ]](/icons/layout.gif) | DPD 1-24 Proposal Narrative.pdf | 2024-04-29 20:02 | 48K | |
![[ ]](/icons/unknown.gif) | DNR P&W FIBER OPTIC INSTALLATION AT JESSE OWENS CABINS_details.json | 2024-12-05 12:41 | 1.4K | |
![[IMG]](/icons/image2.gif) | DEN_WH_New Drops Floor plan.pdf_0.png | 2025-05-22 15:28 | 454K | |
![[ ]](/icons/layout.gif) | DEN_WH_New Drops Floor plan.pdf | 2025-05-22 15:28 | 172K | |
![[ ]](/icons/layout.gif) | DEN-AFW_Colorado_Springs-2022-09-30__3_.pdf | 2024-11-21 16:47 | 1.2M | |
![[ ]](/icons/layout.gif) | DE24_47002_RFP_CatTwo.pdf | 2024-02-10 23:41 | 393K | |
![[IMG]](/icons/image2.gif) | DD102-T-1.3_Color.pdf0.png | 2023-10-31 19:05 | 1.0M | |
![[ ]](/icons/layout.gif) | DD102-T-1.3_Color.pdf | 2023-10-31 19:05 | 1.1M | |
![[IMG]](/icons/image2.gif) | DD102-T-1.3_Color (1).pdf0.png | 2023-12-25 02:24 | 1.0M | |
![[ ]](/icons/layout.gif) | DD102-T-1.3_Color (1).pdf | 2023-12-25 02:23 | 1.1M | |
![[IMG]](/icons/image2.gif) | DD102-T-1.2_Color.pdf0.png | 2023-11-03 13:00 | 1.0M | |
![[ ]](/icons/layout.gif) | DD102-T-1.2_Color.pdf | 2023-11-03 12:59 | 6.3M | |
![[IMG]](/icons/image2.gif) | DD102-T-1.1_Color FIRST FLOOR.pdf0.png | 2024-01-16 19:34 | 446K | |
![[ ]](/icons/layout.gif) | DD102-T-1.1_Color FIRST FLOOR.pdf | 2024-01-16 19:34 | 2.1M | |
![[ ]](/icons/layout.gif) | DBA_BUILDING_CO20250016_09_05_2025-1.pdf | 2025-10-30 00:17 | 2.0M | |
![[ ]](/icons/layout.gif) | DBA_BUILDING_CO20250016_07_25_2025.pdf | 2025-10-30 00:01 | 2.0M | |
![[IMG]](/icons/image2.gif) | DATA WALL OUTLET.svg | 2023-06-27 15:55 | 1.1K | |
![[IMG]](/icons/image2.gif) | DATACOMM-41-0075-2T.jpg | 2023-04-18 14:20 | 59K | |
![[ ]](/icons/unknown.gif) | DASNY - CCNY Harris Hall IT Upgrade_details.json | 2024-12-11 21:49 | 1.4K | |
![[ ]](/icons/layout.gif) | D66EDF2A-C86C-FF26-5395-B7A017398AD9.pdf | 2024-11-23 12:38 | 13K | |
![[IMG]](/icons/image2.gif) | D11 | D12.jpeg | 2023-11-03 18:52 | 63K | |
![[IMG]](/icons/image2.gif) | D5 | D6 | D7 | D8 | D9 | D10.jpeg | 2023-11-03 18:53 | 33K | |
![[IMG]](/icons/image2.gif) | D5 | D6 | D7 | D8 | D9 | D10 -2.jpeg | 2023-11-03 18:52 | 90K | |
![[IMG]](/icons/image2.gif) | D3 | D4.jpeg | 2023-11-03 18:53 | 26K | |
![[IMG]](/icons/image2.gif) | D1 | D2.jpeg | 2023-11-03 18:53 | 61K | |
![[IMG]](/icons/image2.gif) | D.HEIC | 2023-09-12 14:17 | 2.1M | |
![[IMG]](/icons/image2.gif) | Cylindrical lock.jpg | 2023-05-01 09:05 | 9.5K | |
![[ ]](/icons/layout.gif) | Culture_of_Early_Reporting_Job_Aid_PS5-00811.pdf | 2024-11-23 12:39 | 164K | |
![[ ]](/icons/layout.gif) | Crystalline_Silica_Awareness_Job_Aid_PS5-00111.pdf | 2024-11-23 12:35 | 102K | |
![[ ]](/icons/layout.gif) | Crane_Signaling_Awareness_Job_Aid_PS5-102972.pdf | 2024-11-23 12:36 | 91K | |
![[ ]](/icons/layout.gif) | Crane_Operator_Safety_Job_Aid_PS5-00867.pdf | 2024-11-23 12:36 | 243K | |
![[ ]](/icons/layout.gif) | CradlePoint 1855 Installation Guide V0 9.pdf | 2025-10-26 16:34 | 40M | |
![[ ]](/icons/layout.gif) | CradlePoint 1855 Installation Guide V0.9.pdf | 2025-10-31 21:00 | 40M | |
![[ ]](/icons/layout.gif) | Cover Sheet.pdf | 2025-09-18 19:30 | 176K | |
![[ ]](/icons/layout.gif) | Cover Letter for DPL 1-24.pdf | 2024-04-29 20:02 | 43K | |
![[ ]](/icons/layout.gif) | Cost.pdf | 2024-12-02 20:12 | 79K | |
![[ ]](/icons/layout.gif) | Corrosive_Safety_Job_Aid_PS5-103312.pdf | 2024-11-23 12:35 | 94K | |
![[IMG]](/icons/image2.gif) | Corning heat shrinks.jpg | 2023-04-25 17:22 | 46K | |
![[IMG]](/icons/image2.gif) | Corning 12strand OS2 cable.jpg | 2023-05-05 08:53 | 11K | |
![[IMG]](/icons/image2.gif) | Corning 4U housing.jpg | 2023-05-05 09:49 | 4.6K | |
![[IMG]](/icons/image2.gif) | Corning 2U housing.jpg | 2023-05-04 08:57 | 224K | |
![[IMG]](/icons/image2.gif) | Corning 1U housing.jpg | 2023-05-04 08:53 | 2.3K | |
![[ ]](/icons/layout.gif) | Copy of STRASBURG terms and conditions.pdf | 2025-03-12 13:40 | 88K | |
![[ ]](/icons/unknown.gif) | Copy of Port Map Cheat Sheet - Experience Port Map (1).xlsx | 2025-10-31 20:58 | 73K | |
![[IMG]](/icons/image2.gif) | Copy of High School Map.pdf_0.png | 2025-08-19 10:08 | 1.7M | |
![[ ]](/icons/layout.gif) | Copy of High School Map.pdf | 2025-08-19 10:08 | 95K | |
![[IMG]](/icons/image2.gif) | Copy of High School Map-.pdf_0.png | 2025-08-04 14:16 | 1.8M | |
![[ ]](/icons/layout.gif) | Copy of High School Map-.pdf | 2025-08-04 14:16 | 94K | |
![[TXT]](/icons/text.gif) | Copy of Access Point Installation-Layout.csv | 2024-02-17 19:40 | 15K | |
![[ ]](/icons/layout.gif) | ContractData-20250604-112249.pdf | 2025-06-04 15:31 | 197K | |
![[IMG]](/icons/image2.gif) | ContractData-20250509-083348.pdf_2.png | 2025-05-09 12:34 | 219K | |
![[IMG]](/icons/image2.gif) | ContractData-20250509-083348.pdf_1.png | 2025-05-09 12:34 | 1.2M | |
![[IMG]](/icons/image2.gif) | ContractData-20250509-083348.pdf_0.png | 2025-05-09 12:34 | 781K | |
![[ ]](/icons/layout.gif) | ContractData-20250509-083348.pdf | 2025-05-09 12:34 | 194K | |
![[ ]](/icons/layout.gif) | ContractData-20250107-050914.pdf | 2025-01-07 22:18 | 205K | |
![[ ]](/icons/layout.gif) | ContractData-20250103-054130.pdf | 2025-01-03 22:45 | 193K | |
![[ ]](/icons/layout.gif) | ContractData-20250103-045059.pdf | 2025-01-03 22:01 | 202K | |
![[ ]](/icons/layout.gif) | ContractData-20241106-084630.pdf | 2024-11-06 13:48 | 147K | |
![[ ]](/icons/layout.gif) | ContractData-20241011-075352.pdf | 2024-10-12 00:00 | 195K | |
![[ ]](/icons/layout.gif) | ContractData-20240910-090536.pdf | 2024-09-10 13:21 | 224K | |
![[ ]](/icons/layout.gif) | ContractData-20240909-034038.pdf | 2024-09-09 19:56 | 195K | |
![[ ]](/icons/layout.gif) | ContractData-20240722-105712.pdf | 2024-07-22 14:59 | 142K | |
![[ ]](/icons/layout.gif) | ContinuouslyImproveforSafetyExcellence_Job_Aid_PS5-00285.pdf | 2024-11-23 12:39 | 90K | |
![[ ]](/icons/layout.gif) | Construction Plans.pdf | 2024-11-08 15:52 | 30M | |
![[ ]](/icons/unknown.gif) | Conduit Install for Verizon Circuit_details.json | 2025-09-05 21:50 | 6.2K | |
![[ ]](/icons/layout.gif) | Compressed_Gas_Cylinder_Safety_Job_Aid_PS5-00316.pdf | 2024-11-23 12:33 | 46K | |
![[ ]](/icons/layout.gif) | Compressed_Air_Safety_Awareness_Job_Aid_PS5-100732.pdf | 2024-11-23 12:38 | 175K | |
![[IMG]](/icons/image2.gif) | Composite cable.jpg | 2023-04-28 11:19 | 54K | |
![[ ]](/icons/unknown.gif) | Commercial Solicitation N6893624Q0146.docx | 2024-10-12 00:00 | 84K | |
![[ ]](/icons/layout.gif) | Combined Synopsis and Solicitation.pdf | 2025-06-04 15:31 | 228K | |
![[ ]](/icons/layout.gif) | Combined+Synopsis+Solicitation+-+Fiber+to+Desk+-+AMENDED.pdf | 2024-02-23 16:49 | 426K | |
![[IMG]](/icons/image2.gif) | Combination voice data Wall outlet (Blue&White).svg | 2023-02-10 20:05 | 675 | |
![[IMG]](/icons/image2.gif) | Combination voice data Floor outlet (Blue&White).svg | 2023-02-10 20:06 | 794 | |
![[IMG]](/icons/image2.gif) | Colorado springs.pdf0.png | 2024-01-08 01:58 | 493K | |
![[ ]](/icons/layout.gif) | Colorado springs.pdf | 2024-01-08 01:57 | 2.7M | |
![[ ]](/icons/compressed.gif) | Colorado River District Barn and Shed.zip | 2024-01-19 16:59 | 70M | |
![[ ]](/icons/layout.gif) | Cold_Stress_Job_Aid_PS5-01304.pdf | 2024-11-23 13:00 | 86K | |
![[IMG]](/icons/image2.gif) | Colarelli-Logo-v2-main-01.png | 2023-11-23 15:21 | 26K | |
![[IMG]](/icons/image2.gif) | Coax 32-port patch panel.jpg | 2023-07-19 13:46 | 333K | |
![[IMG]](/icons/image2.gif) | Coax 16-port panel.jpg | 2023-04-25 15:22 | 3.1K | |
![[ ]](/icons/layout.gif) | Coastal Kids Pediatric Clinic TI.pdf | 2023-10-20 19:51 | 29M | |
![[ ]](/icons/layout.gif) | Coastal Kids Pediatric Clinic TI-HomePage.pdf | 2023-10-20 19:51 | 29M | |
![[IMG]](/icons/image2.gif) | ClubHouse Mezzanine.pdf0.png | 2024-02-12 18:00 | 104K | |
![[ ]](/icons/layout.gif) | ClubHouse Mezzanine.pdf | 2024-02-12 18:00 | 606K | |
![[IMG]](/icons/image2.gif) | ClubHouse Floor 1.pdf0.png | 2024-02-12 18:00 | 167K | |
![[ ]](/icons/layout.gif) | ClubHouse Floor 1.pdf | 2024-02-12 18:00 | 818K | |
![[ ]](/icons/layout.gif) | Class_J_A_Use_of_Brand_Name_or_Equal_References_Interior_Approved_Redacted.pdf | 2025-10-30 00:01 | 1.3M | |
![[ ]](/icons/layout.gif) | City Wide Wiring Upgrades RFP - Final v5 (1) (1).pdf | 2024-10-09 16:02 | 736K | |
![[ ]](/icons/layout.gif) | City Wide Wiring Updates RFP - Answers to RFP Questions.pdf | 2024-10-09 16:02 | 106K | |
![[ ]](/icons/unknown.gif) | City Wide Network Cabling Upgrade_details.json | 2024-10-14 13:48 | 17K | |
![[ ]](/icons/layout.gif) | City Wide Network Cabling Upgrade-Bill of Materials.pdf | 2024-10-11 12:01 | 1.3M | |
![[ ]](/icons/unknown.gif) | Circuit extension for VCT Technologies_details.json | 2025-04-11 21:10 | 1.4K | |
![[ ]](/icons/unknown.gif) | Cherokee Federal- CO Springs Cabling_details.json | 2025-02-03 17:41 | 85K | |
![[IMG]](/icons/image2.gif) | Chain Bldg Floorplan.pdf0.png | 2023-10-18 19:06 | 109K | |
![[ ]](/icons/layout.gif) | Chain Bldg Floorplan.pdf | 2023-10-18 19:06 | 195K | |
![[IMG]](/icons/image2.gif) | Chain Bldg Floorplan (1).pdf0.png | 2023-10-16 22:11 | 109K | |
![[ ]](/icons/layout.gif) | Chain Bldg Floorplan (1).pdf | 2023-10-16 22:11 | 195K | |
![[ ]](/icons/unknown.gif) | Certify OS2 Fiber-1 | 2025-06-12 07:59 | 1.7M | |
![[IMG]](/icons/image2.gif) | Central elementary school merge.pdf4.png | 2024-03-26 19:42 | 251K | |
![[IMG]](/icons/image2.gif) | Central elementary school merge.pdf3.png | 2024-03-26 19:42 | 237K | |
![[IMG]](/icons/image2.gif) | Central elementary school merge.pdf2.png | 2024-03-26 19:42 | 253K | |
![[IMG]](/icons/image2.gif) | Central elementary school merge.pdf1.png | 2024-03-26 19:42 | 195K | |
![[IMG]](/icons/image2.gif) | Central elementary school merge.pdf0.png | 2024-03-26 19:42 | 294K | |
![[ ]](/icons/layout.gif) | Central elementary school merge.pdf | 2024-03-26 19:42 | 356K | |
![[IMG]](/icons/image2.gif) | Central 11 x 17 (1).pdf0.png | 2023-04-28 14:49 | 199K | |
![[ ]](/icons/layout.gif) | Central 11 x 17 (1).pdf | 2023-04-28 14:48 | 3.0M | |
![[IMG]](/icons/image2.gif) | Cayotee.png | 2023-03-03 20:43 | 5.1K | |
![[ ]](/icons/unknown.gif) | Cat8 Materials Quote_details.json | 2025-06-04 16:17 | 1.6K | |
![[ ]](/icons/unknown.gif) | Cat8 1000ft Plenum blue quote_details.json | 2025-08-13 19:57 | 1.6K | |
![[ ]](/icons/unknown.gif) | Cat7 Plenum Cable Quote_details.json | 2024-12-26 21:03 | 1.6K | |
![[IMG]](/icons/image2.gif) | Cat 6 patch cord.jpg | 2023-05-16 17:27 | 604K | |
![[IMG]](/icons/image2.gif) | Cat 6 jack SVG.svg | 2023-07-18 13:39 | 12K | |
![[IMG]](/icons/image2.gif) | Cat 6 jack (1).png.svg | 2023-07-18 14:28 | 18K | |
![[IMG]](/icons/image2.gif) | Cat 6 jack (1).png | 2023-07-18 14:27 | 77K | |
![[IMG]](/icons/image2.gif) | Cat6e-Cat6a-Cable.jpg | 2023-02-10 10:29 | 44K | |
![[IMG]](/icons/image2.gif) | Cat6e-Cat6a-Cable (1).jpg | 2023-02-10 10:34 | 44K | |
![[IMG]](/icons/image2.gif) | Cat 6 cable.png | 2023-05-03 14:37 | 2.1K | |
![[IMG]](/icons/image2.gif) | Cat 6 cable.jpg | 2023-05-16 13:14 | 18K | |
![[IMG]](/icons/image2.gif) | Cat 6 SlimLine Boot Patch Cord.jpg | 2023-05-03 15:38 | 94K | |
![[IMG]](/icons/image2.gif) | Cat 6A term plug.svg | 2023-07-18 13:59 | 19K | |
![[IMG]](/icons/image2.gif) | Cat 6 A modular termplug.jpg.svg | 2023-07-18 14:07 | 43K | |
![[IMG]](/icons/image2.gif) | Cat 6 A modular termplug.jpg | 2023-07-18 14:07 | 21K | |
![[ ]](/icons/unknown.gif) | Cat6A CommsCope Template Project_details.json | 2025-03-17 20:14 | 94K | |
![[IMG]](/icons/image2.gif) | Cat 6A 48-port patch panel SVG.svg | 2023-07-19 13:44 | 33K | |
![[IMG]](/icons/image2.gif) | Cat 6A 48-port patch panel.jpeg | 2023-07-19 13:44 | 424K | |
![[IMG]](/icons/image2.gif) | Cat6A.png | 2023-04-25 12:27 | 73K | |
![[IMG]](/icons/image2.gif) | Cat 6A (raiser cable).svg | 2023-02-10 10:34 | 1.8K | |
![[IMG]](/icons/image2.gif) | Cat 6A (plenum cable).svg | 2023-02-10 10:29 | 1.8K | |
![[IMG]](/icons/image2.gif) | Cat 6A (Plenum)(Blue).svg | 2023-02-10 17:32 | 6.6K | |
![[IMG]](/icons/image2.gif) | Cat 6 48-port patch panel SVG.svg | 2023-07-19 13:41 | 33K | |
![[IMG]](/icons/image2.gif) | Cat 6 48-port patch panel.jpeg | 2023-07-19 13:41 | 424K | |
![[IMG]](/icons/image2.gif) | Cat 6 (raiser cable).svg | 2023-05-23 14:19 | 1.6K | |
![[IMG]](/icons/image2.gif) | Cat 6 (plenum cable).svg | 2023-05-23 13:56 | 1.6K | |
![[IMG]](/icons/image2.gif) | Cat 6 (Plenum)(Blue).svg | 2023-02-10 17:27 | 6.2K | |
![[ ]](/icons/layout.gif) | Care Table Technology Installation Guide.pdf | 2025-10-31 21:01 | 12M | |
![[ ]](/icons/layout.gif) | Care Table Technology Installation Guide (1).pdf | 2025-10-26 16:28 | 12M | |
![[IMG]](/icons/image2.gif) | Card reader.jpg | 2023-04-28 12:24 | 23K | |
![[ ]](/icons/layout.gif) | CarbonSeriesCutSheet.pdf | 2024-10-15 20:31 | 1.2M | |
![[IMG]](/icons/image2.gif) | Capture.PNG.svg | 2023-08-24 21:32 | 344K | |
![[IMG]](/icons/image2.gif) | Capture.PNG | 2023-08-24 21:32 | 1.1M | |
![[ ]](/icons/layout.gif) | Capabilities Statement.pdf | 2024-03-12 16:54 | 2.9M | |
![[ ]](/icons/unknown.gif) | Canvas TEst_details.json | 2025-05-20 14:14 | 18K | |
![[ ]](/icons/layout.gif) | Cams.pdf | 2025-07-28 01:17 | 548K | |
![[IMG]](/icons/image2.gif) | Cam only cable SVG.svg | 2023-05-26 10:15 | 1.5K | |
![[IMG]](/icons/image2.gif) | Camera Only cable.png | 2023-05-26 10:15 | 30K | |
![[IMG]](/icons/image2.gif) | Camera Installation.jpg | 2023-05-01 09:44 | 12K | |
![[IMG]](/icons/image2.gif) | Calling.svg | 2023-05-11 17:49 | 1.7K | |
![[IMG]](/icons/image2.gif) | Calling.jpg | 2023-05-10 18:31 | 34K | |
![[ ]](/icons/unknown.gif) | Cabling for POTS Lines_details.json | 2025-08-28 21:25 | 4.8K | |
![[ ]](/icons/unknown.gif) | Cabling and Installation of 2 wireless access points_details.json | 2025-07-15 23:55 | 10K | |
![[ ]](/icons/unknown.gif) | Cabling _details.json | 2024-10-18 19:49 | 1.3K | |
![[ ]](/icons/unknown.gif) | Cabling Upgrades - Shoal Creek Elementary - RFP 003-025_details.json | 2024-12-31 22:07 | 1.4K | |
![[ ]](/icons/unknown.gif) | Cable install and wireless bridge set up _details.json | 2025-07-15 11:21 | 2.6K | |
![[IMG]](/icons/image2.gif) | Cable dressing.png | 2023-04-19 14:40 | 387K | |
![[ ]](/icons/layout.gif) | Cable Test Results.pdf | 2025-08-19 10:17 | 442K | |
![[ ]](/icons/unknown.gif) | Cable Runs for Room Schedulers_details.json | 2025-04-29 02:58 | 6.0K | |
![[ ]](/icons/unknown.gif) | Cable Repair - Elementary School Labs - E-Rate Compliant_details.json | 2024-12-31 22:24 | 1.4K | |
![[ ]](/icons/layout.gif) | Cable Pathways for E1Y Care Table.pdf | 2025-10-26 16:27 | 215K | |
![[ ]](/icons/layout.gif) | Cabins_-_Pedestals_-_Information_Only.pdf | 2024-12-05 12:41 | 306K | |
![[ ]](/icons/layout.gif) | Cabins_-_Overview_Map_-_Information_Only.pdf | 2024-12-05 12:41 | 406K | |
![[ ]](/icons/layout.gif) | Cabins_-_Conduit_-_As_Built_-_Information_Only.pdf | 2024-12-05 12:41 | 3.9M | |
![[ ]](/icons/layout.gif) | CSV File test.pdf | 2023-10-16 11:18 | 11M | |
![[ ]](/icons/layout.gif) | CSV File test-TR-1::R-2.pdf | 2023-10-16 11:18 | 550K | |
![[ ]](/icons/layout.gif) | CSV File test-TR-1.pdf | 2023-10-16 11:18 | 1.1M | |
![[ ]](/icons/layout.gif) | CSV File test-HomePage.pdf | 2023-10-16 11:18 | 9.0M | |
![[ ]](/icons/layout.gif) | CO_Sample_Certificate_Current.pdf | 2024-11-21 16:49 | 131K | |
![[IMG]](/icons/image2.gif) | CO Springs Cherokee Federal.pdf_0.png | 2024-11-28 02:09 | 739K | |
![[ ]](/icons/layout.gif) | CO Springs Cherokee Federal.pdf | 2024-11-28 02:09 | 444K | |
![[IMG]](/icons/image2.gif) | CO SPRING FP.pdf0.png | 2023-06-27 18:23 | 447K | |
![[ ]](/icons/layout.gif) | CO SPRING FP.pdf | 2023-06-27 18:23 | 240K | |
![[IMG]](/icons/image2.gif) | CONDUIT RUN.svg | 2023-03-10 17:57 | 840 | |
![[ ]](/icons/layout.gif) | COMBO Synopsis-Solicitation.pdf | 2024-03-12 17:18 | 313K | |
![[ ]](/icons/layout.gif) | COI.pdf | 2024-02-10 23:23 | 147K | |
![[ ]](/icons/unknown.gif) | CMSFS Fiberoptic Cable Installation_details.json | 2025-06-04 15:29 | 1.4K | |
![[IMG]](/icons/image2.gif) | CMS-chatsworth-media-assets-catalog-productimages-cube-it-wall-mount-cabinet-cube-it_dooropen_1520x1020.jpeg | 2023-03-03 17:03 | 34K | |
![[IMG]](/icons/image2.gif) | CCSDCrest-Hex0104491.png | 2024-11-12 21:21 | 29K | |
![[ ]](/icons/layout.gif) | CCA DQ 2026000187 Fiber Link Installation and Legacy Cable Decommissioning.pdf | 2025-11-07 20:01 | 241K | |
![[ ]](/icons/layout.gif) | C105-2.pdf | 2025-12-14 17:29 | 193K | |
![[ ]](/icons/layout.gif) | C25-CABLES Wincap Vendor Response Form selected sheets.pdf | 2024-05-01 11:35 | 365K | |
![[ ]](/icons/layout.gif) | C25-CABLES Wincap Vendor Response Form- Systec101.pdf | 2024-05-01 11:22 | 683K | |
![[ ]](/icons/layout.gif) | C25-CABLES BID DOCUMENTS (1).pdf | 2024-05-01 11:22 | 539K | |
![[IMG]](/icons/image2.gif) | C8 patch panel (4).png | 2023-02-20 00:25 | 225K | |
![[ ]](/icons/unknown.gif) | C000770 - Voice & Video Communication Services_details.json | 2024-11-06 13:41 | 1.4K | |
![[ ]](/icons/layout.gif) | C-Invoice.pdf | 2023-11-22 20:47 | 452K | |
![[IMG]](/icons/image2.gif) | ButtSpliceKit.png | 2023-04-25 16:13 | 149K | |
![[IMG]](/icons/image2.gif) | Business Center.png.svg | 2024-03-01 01:40 | 875K | |
![[IMG]](/icons/image2.gif) | Business Center.png | 2024-03-01 01:39 | 1.0M | |
![[ ]](/icons/unknown.gif) | Built test OCt 21_details.json | 2024-10-21 14:03 | 27K | |
![[ ]](/icons/unknown.gif) | Build test_details.json | 2025-06-25 13:14 | 14K | |
![[ ]](/icons/unknown.gif) | Build test 10-25-2024_details.json | 2024-10-28 12:23 | 40K | |
![[ ]](/icons/unknown.gif) | Build tedt 10-25-2024_details.json | 2024-10-25 15:22 | 1.7K | |
![[IMG]](/icons/image2.gif) | Building D.png.svg | 2024-03-01 01:41 | 1.8M | |
![[IMG]](/icons/image2.gif) | Building D.png | 2024-03-01 01:41 | 1.3M | |
![[IMG]](/icons/image2.gif) | Building D.pdf0.png | 2024-02-27 22:13 | 197K | |
![[ ]](/icons/layout.gif) | Building D.pdf | 2024-02-27 22:13 | 1.3M | |
![[IMG]](/icons/image2.gif) | Building C.png.svg | 2024-03-01 01:41 | 1.3M | |
![[IMG]](/icons/image2.gif) | Building C.png | 2024-03-01 01:41 | 1.1M | |
![[IMG]](/icons/image2.gif) | Building C.pdf0.png | 2024-02-27 22:12 | 119K | |
![[ ]](/icons/layout.gif) | Building C.pdf | 2024-02-27 22:12 | 601K | |
![[IMG]](/icons/image2.gif) | Building B.png.svg | 2024-03-01 01:40 | 1.6M | |
![[IMG]](/icons/image2.gif) | Building B.png | 2024-03-01 01:40 | 960K | |
![[IMG]](/icons/image2.gif) | Building B.pdf0.png | 2024-02-27 22:12 | 111K | |
![[ ]](/icons/layout.gif) | Building B.pdf | 2024-02-27 22:12 | 647K | |
![[IMG]](/icons/image2.gif) | Building Automation System 4 Data Drop Outlet (wall)(pink).svg | 2023-02-10 19:54 | 1.1K | |
![[IMG]](/icons/image2.gif) | Building Automation System 4 Data Drop Outlet (wall)(pink) (1).svg | 2023-02-10 14:38 | 1.0K | |
![[IMG]](/icons/image2.gif) | Building Automation System 2 Data Drop Outlet (wall) (pink).svg | 2023-02-10 19:52 | 1.7K | |
![[IMG]](/icons/image2.gif) | Building Automation System 2 Data Drop Outlet (wall) (pink) (2).svg | 2023-05-22 16:52 | 1.6K | |
![[IMG]](/icons/image2.gif) | Building Automation System 2 Data Drop Outlet (wall) (pink) (1).svg | 2023-02-10 14:34 | 1.6K | |
![[IMG]](/icons/image2.gif) | Building A.png.svg | 2024-03-01 01:40 | 1.2M | |
![[IMG]](/icons/image2.gif) | Building A.png | 2024-03-01 01:40 | 953K | |
![[IMG]](/icons/image2.gif) | Building A.pdf0.png | 2024-02-27 22:11 | 109K | |
![[ ]](/icons/layout.gif) | Building A.pdf | 2024-02-27 22:11 | 847K | |
![[ ]](/icons/layout.gif) | Building 5010 Server Rack Replacement and Cable Management Project - Proposal.pdf | 2024-07-23 11:38 | 1.7M | |
![[IMG]](/icons/image2.gif) | Building4 3rd and roof plan.pdf.svg | 2023-04-15 20:00 | 867K | |
![[ ]](/icons/layout.gif) | Building4 3rd and roof plan.pdf | 2023-04-15 20:00 | 924K | |
![[IMG]](/icons/image2.gif) | Building4 1st and 2nd plan.pdf.svg | 2023-04-15 20:00 | 81K | |
![[ ]](/icons/layout.gif) | Building4 1st and 2nd plan.pdf | 2023-04-15 20:00 | 65K | |
![[IMG]](/icons/image2.gif) | Building4 1st and 2nd plan-compressed_1.pdf0.png | 2023-07-12 20:18 | 452K | |
![[IMG]](/icons/image2.gif) | Building4 1st and 2nd plan-compressed_1.pdf.svg | 2023-04-15 20:18 | 206K | |
![[ ]](/icons/layout.gif) | Building4 1st and 2nd plan-compressed_1.pdf | 2023-07-12 20:18 | 162K | |
![[IMG]](/icons/image2.gif) | Building4 1st and 2nd plan-compressed.pdf0.png | 2023-10-07 18:53 | 452K | |
![[ ]](/icons/layout.gif) | Building4 1st and 2nd plan-compressed.pdf | 2023-10-07 18:53 | 158K | |
![[ ]](/icons/layout.gif) | Building+5010+Server+Rack+Replacement+and+Cable+Management.pdf | 2024-07-22 14:54 | 5.5M | |
![[ ]](/icons/unknown.gif) | Build Test_details.json | 2025-06-25 13:16 | 1.3K | |
![[ ]](/icons/unknown.gif) | Build Test 11-22_details.json | 2024-11-22 16:17 | 15K | |
![[ ]](/icons/layout.gif) | Build Test- Proposal Documents.pdf | 2024-11-08 16:02 | 5.1M | |
![[ ]](/icons/unknown.gif) | Build TEst_details.json | 2025-01-06 14:22 | 11K | |
![[IMG]](/icons/image2.gif) | Broomfield Yard Overview.png | 2025-07-03 00:14 | 1.5M | |
![[IMG]](/icons/image2.gif) | Brooklyn Expansion Network Layout.pdf0.png | 2023-12-17 19:21 | 598K | |
![[ ]](/icons/layout.gif) | Brooklyn Expansion Network Layout.pdf | 2023-12-17 19:20 | 472K | |
![[ ]](/icons/unknown.gif) | Brook Army Med Center Video Wall Upgrade_details.json | 2025-10-21 01:38 | 3.2K | |
![[ ]](/icons/layout.gif) | Brook Army Med Center Video Wall Upgrade- Proposal Documents.pdf | 2025-10-22 11:31 | 3.5M | |
![[IMG]](/icons/image2.gif) | Brighton shop.pdf0.png | 2024-01-17 17:25 | 17K | |
![[ ]](/icons/layout.gif) | Brighton shop.pdf | 2024-01-17 17:25 | 47K | |
![[IMG]](/icons/image2.gif) | Bosch battery.jpg | 2023-04-28 12:09 | 22K | |
![[ ]](/icons/unknown.gif) | Board Management Software Platform Print_details.json | 2025-09-04 13:35 | 1.5K | |
![[IMG]](/icons/image2.gif) | BlueSky-BPT-Full-Color-Logo-qhsa81n7gx6qxw8n7e1yoq6mqwiv4z245zvvlc88jc.png | 2025-04-11 21:10 | 5.5K | |
![[ ]](/icons/layout.gif) | Bloodborne_Pathogens_BBP_Job_Aid_PS5-00282.pdf | 2024-11-23 12:35 | 81K | |
![[ ]](/icons/layout.gif) | Blocking_and_Cribbing_Job_Aid_PS5-102267.pdf | 2024-11-23 12:38 | 144K | |
![[ ]](/icons/unknown.gif) | Bldg 1405 Copper to Fiber Installation_details.json | 2025-09-18 19:29 | 1.4K | |
![[ ]](/icons/layout.gif) | Bldg 1405 Copper to Fiber Installation- Proposal Documents.pdf | 2025-09-08 13:41 | 4.7M | |
![[ ]](/icons/layout.gif) | Blasting_Area_Awareness_Job_Aid_PS5-103022.pdf | 2024-11-23 12:38 | 69K | |
![[IMG]](/icons/image2.gif) | Blanks.jpg | 2023-05-09 09:18 | 7.5K | |
![[IMG]](/icons/image2.gif) | Blank (White) (1).svg | 2023-02-10 09:08 | 2.7K | |
![[IMG]](/icons/image2.gif) | BlackMarble_2016_928m_russia_west_labeled.png | 2024-10-18 13:51 | 25M | |
![[IMG]](/icons/image2.gif) | Bidset-Marcos Pizza-Denver, CO_4-28-25.pdf_36.png | 2025-05-19 20:57 | 3.3M | |
![[IMG]](/icons/image2.gif) | Bidset-Marcos Pizza-Denver, CO_4-28-25.pdf_35.png | 2025-05-19 20:57 | 4.6M | |
![[IMG]](/icons/image2.gif) | Bidset-Marcos Pizza-Denver, CO_4-28-25.pdf_34.png | 2025-05-19 20:57 | 2.5M | |
![[IMG]](/icons/image2.gif) | Bidset-Marcos Pizza-Denver, CO_4-28-25.pdf_33.png | 2025-05-19 20:57 | 3.9M | |
![[IMG]](/icons/image2.gif) | Bidset-Marcos Pizza-Denver, CO_4-28-25.pdf_32.png | 2025-05-19 20:57 | 9.2M | |
![[IMG]](/icons/image2.gif) | Bidset-Marcos Pizza-Denver, CO_4-28-25.pdf_31.png | 2025-05-19 20:57 | 6.7M | |
![[IMG]](/icons/image2.gif) | Bidset-Marcos Pizza-Denver, CO_4-28-25.pdf_30.png | 2025-05-19 20:57 | 11M | |
![[IMG]](/icons/image2.gif) | Bidset-Marcos Pizza-Denver, CO_4-28-25.pdf_29.png | 2025-05-19 20:57 | 12M | |
![[IMG]](/icons/image2.gif) | Bidset-Marcos Pizza-Denver, CO_4-28-25.pdf_28.png | 2025-05-19 20:57 | 6.3M | |
![[IMG]](/icons/image2.gif) | Bidset-Marcos Pizza-Denver, CO_4-28-25.pdf_27.png | 2025-05-19 20:57 | 2.4M | |
![[IMG]](/icons/image2.gif) | Bidset-Marcos Pizza-Denver, CO_4-28-25.pdf_26.png | 2025-05-19 20:57 | 9.1M | |
![[IMG]](/icons/image2.gif) | Bidset-Marcos Pizza-Denver, CO_4-28-25.pdf_25.png | 2025-05-19 20:57 | 1.3M | |
![[IMG]](/icons/image2.gif) | Bidset-Marcos Pizza-Denver, CO_4-28-25.pdf_24.png | 2025-05-19 20:57 | 5.0M | |
![[IMG]](/icons/image2.gif) | Bidset-Marcos Pizza-Denver, CO_4-28-25.pdf_23.png | 2025-05-19 20:57 | 3.4M | |
![[IMG]](/icons/image2.gif) | Bidset-Marcos Pizza-Denver, CO_4-28-25.pdf_22.png | 2025-05-19 20:57 | 6.1M | |
![[IMG]](/icons/image2.gif) | Bidset-Marcos Pizza-Denver, CO_4-28-25.pdf_21.png | 2025-05-19 20:57 | 7.0M | |
![[IMG]](/icons/image2.gif) | Bidset-Marcos Pizza-Denver, CO_4-28-25.pdf_20.png | 2025-05-19 20:57 | 9.5M | |
![[IMG]](/icons/image2.gif) | Bidset-Marcos Pizza-Denver, CO_4-28-25.pdf_19.png | 2025-05-19 20:57 | 9.6M | |
![[IMG]](/icons/image2.gif) | Bidset-Marcos Pizza-Denver, CO_4-28-25.pdf_18.png | 2025-05-19 20:57 | 5.4M | |
![[IMG]](/icons/image2.gif) | Bidset-Marcos Pizza-Denver, CO_4-28-25.pdf_17.png | 2025-05-19 20:57 | 5.3M | |
![[IMG]](/icons/image2.gif) | Bidset-Marcos Pizza-Denver, CO_4-28-25.pdf_16.png | 2025-05-19 20:57 | 3.8M | |
![[IMG]](/icons/image2.gif) | Bidset-Marcos Pizza-Denver, CO_4-28-25.pdf_15.png | 2025-05-19 20:57 | 4.8M | |
![[IMG]](/icons/image2.gif) | Bidset-Marcos Pizza-Denver, CO_4-28-25.pdf_14.png | 2025-05-19 20:57 | 2.7M | |
![[IMG]](/icons/image2.gif) | Bidset-Marcos Pizza-Denver, CO_4-28-25.pdf_13.png | 2025-05-19 20:57 | 12M | |
![[IMG]](/icons/image2.gif) | Bidset-Marcos Pizza-Denver, CO_4-28-25.pdf_12.png | 2025-05-19 20:57 | 6.6M | |
![[IMG]](/icons/image2.gif) | Bidset-Marcos Pizza-Denver, CO_4-28-25.pdf_11.png | 2025-05-19 20:57 | 4.5M | |
![[IMG]](/icons/image2.gif) | Bidset-Marcos Pizza-Denver, CO_4-28-25.pdf_10.png | 2025-05-19 20:57 | 5.7M | |
![[IMG]](/icons/image2.gif) | Bidset-Marcos Pizza-Denver, CO_4-28-25.pdf_9.png | 2025-05-19 20:57 | 4.6M | |
![[IMG]](/icons/image2.gif) | Bidset-Marcos Pizza-Denver, CO_4-28-25.pdf_8.png | 2025-05-19 20:57 | 6.3M | |
![[IMG]](/icons/image2.gif) | Bidset-Marcos Pizza-Denver, CO_4-28-25.pdf_7.png | 2025-05-19 20:57 | 14M | |
![[IMG]](/icons/image2.gif) | Bidset-Marcos Pizza-Denver, CO_4-28-25.pdf_6.png | 2025-05-19 20:57 | 9.3M | |
![[IMG]](/icons/image2.gif) | Bidset-Marcos Pizza-Denver, CO_4-28-25.pdf_5.png | 2025-05-19 20:57 | 7.6M | |
![[IMG]](/icons/image2.gif) | Bidset-Marcos Pizza-Denver, CO_4-28-25.pdf_4.png | 2025-05-19 20:57 | 12M | |
![[IMG]](/icons/image2.gif) | Bidset-Marcos Pizza-Denver, CO_4-28-25.pdf_3.png | 2025-05-19 20:57 | 9.9M | |
![[IMG]](/icons/image2.gif) | Bidset-Marcos Pizza-Denver, CO_4-28-25.pdf_2.png | 2025-05-19 20:57 | 7.7M | |
![[IMG]](/icons/image2.gif) | Bidset-Marcos Pizza-Denver, CO_4-28-25.pdf_1.png | 2025-05-19 20:57 | 4.6M | |
![[IMG]](/icons/image2.gif) | Bidset-Marcos Pizza-Denver, CO_4-28-25.pdf_0.png | 2025-05-19 20:57 | 9.0M | |
![[ ]](/icons/layout.gif) | Bidset-Marcos Pizza-Denver, CO_4-28-25.pdf | 2025-05-19 20:50 | 14M | |
![[ ]](/icons/layout.gif) | Bid Set 032724_306 Combined Set.pdf | 2024-04-03 16:00 | 26M | |
![[ ]](/icons/unknown.gif) | Bid Project | City of Aspen Parks and Open Space Office Remodel_details.json | 2024-11-20 15:22 | 3.5K | |
![[ ]](/icons/layout.gif) | Bid No 24-070 Town of Wallingford - Fiber Cable Replacement.pdf | 2025-01-13 16:06 | 295K | |
![[ ]](/icons/layout.gif) | Bid No 24-069 Town of Wallingford - Cable Replacement and Repair - Proposal.pdf | 2025-01-13 23:42 | 164K | |
![[ ]](/icons/layout.gif) | Bid ITB Cl~1.pdf | 2024-11-12 22:21 | 3.3M | |
![[ ]](/icons/layout.gif) | Bid Form York County copy.pdf | 2024-11-12 16:09 | 1.9M | |
![[ ]](/icons/layout.gif) | Bid Form - Solicitation copy.pdf | 2024-10-28 17:34 | 2.1M | |
![[ ]](/icons/layout.gif) | Bid Documents 0002.pdf | 2024-02-05 17:00 | 51M | |
![[ ]](/icons/layout.gif) | Bid Addendum 02_2.pdf | 2024-11-28 15:36 | 278K | |
![[ ]](/icons/layout.gif) | Bid Addendum 02.pdf | 2024-11-28 15:36 | 278K | |
![[ ]](/icons/layout.gif) | Bid Addendum 01_1.pdf | 2024-11-28 15:36 | 4.3M | |
![[ ]](/icons/layout.gif) | Bid Addendum 01.pdf | 2024-11-28 15:36 | 4.3M | |
![[ ]](/icons/layout.gif) | Bid 24-07 TBH Rewire Project DQ.pdf | 2024-03-01 13:59 | 181K | |
![[IMG]](/icons/image2.gif) | Bethoud.pdf0.png | 2024-01-09 03:30 | 353K | |
![[ ]](/icons/layout.gif) | Bethoud.pdf | 2024-01-09 03:30 | 1.7M | |
![[ ]](/icons/layout.gif) | Berthoud CO - Sheet1.pdf | 2024-01-09 04:13 | 123K | |
![[ ]](/icons/layout.gif) | Bench_Grinder_Safety_Job_Aid_PS5-00273.pdf | 2024-11-23 12:38 | 91K | |
![[IMG]](/icons/image2.gif) | Before Install.jpeg | 2023-11-03 14:34 | 131K | |
![[ ]](/icons/layout.gif) | Basic_Rigging_Principles_Part_3_Rigging_Equipment_Job_Aid_PS5-103451.pdf | 2024-11-23 12:36 | 89K | |
![[ ]](/icons/layout.gif) | Basic_Rigging_Principles_Part_2_General_Safety_Job_Aid_PS5-103450.pdf | 2024-11-23 12:36 | 25K | |
![[ ]](/icons/layout.gif) | Basic_Rigging_Principles_Part_1_Hazards_and_Risks_Job_Aid_PS5-102988.pdf | 2024-11-23 12:36 | 17K | |
![[IMG]](/icons/image2.gif) | Basement.png.svg | 2024-02-17 17:21 | 448K | |
![[IMG]](/icons/image2.gif) | Basement.png | 2025-05-19 20:58 | 799K | |
![[ ]](/icons/layout.gif) | Base Bid.pdf | 2024-02-13 19:43 | 143K | |
![[ ]](/icons/layout.gif) | Bahama Bucks Tech plan.pdf | 2023-02-24 14:58 | 5.3M | |
![[IMG]](/icons/image2.gif) | Backbone Cabling.pdf0.png | 2024-02-12 18:00 | 206K | |
![[ ]](/icons/layout.gif) | Backbone Cabling.pdf | 2024-02-12 18:00 | 3.7M | |
![[IMG]](/icons/image2.gif) | Backbone.png.svg | 2024-03-01 01:41 | 742K | |
![[IMG]](/icons/image2.gif) | Backbone.png | 2024-03-01 01:41 | 948K | |
![[ ]](/icons/unknown.gif) | BUCO00102___ADVERTISEMENT_07_10_2025.PDF | 2025-11-01 15:35 | 148M | |
![[IMG]](/icons/image2.gif) | BR8018 Floor Plan - 2nd floor.PNG.svg | 2024-01-24 02:02 | 80K | |
![[IMG]](/icons/image2.gif) | BR8018 Floor Plan - 2nd floor.PNG | 2024-01-24 02:02 | 38K | |
![[IMG]](/icons/image2.gif) | BR8018 Floor Plan - 1st floor.PNG.svg | 2024-06-21 11:42 | 65K | |
![[IMG]](/icons/image2.gif) | BR8018 Floor Plan - 1st floor.PNG | 2024-06-21 11:42 | 34K | |
![[IMG]](/icons/image2.gif) | BR1181 Floor Plan - 1st Floor.pdf0.png | 2024-03-04 18:00 | 65K | |
![[ ]](/icons/layout.gif) | BR1181 Floor Plan - 1st Floor.pdf | 2024-03-04 18:00 | 47K | |
![[IMG]](/icons/image2.gif) | BR1180 Floor plan - 2nd Floor.PNG.svg | 2024-01-23 15:38 | 41K | |
![[IMG]](/icons/image2.gif) | BR1180 Floor plan - 2nd Floor.PNG | 2024-01-23 15:38 | 24K | |
![[IMG]](/icons/image2.gif) | BR1180 Floorplan - 1st Floor.PNG.svg | 2024-01-23 15:33 | 62K | |
![[IMG]](/icons/image2.gif) | BR1180 Floorplan - 1st Floor.PNG | 2024-01-23 15:33 | 40K | |
![[IMG]](/icons/image2.gif) | BR1179 Floorplan.png.svg | 2024-01-23 16:13 | 50K | |
![[IMG]](/icons/image2.gif) | BR1179 Floorplan.png | 2024-01-23 16:13 | 35K | |
![[IMG]](/icons/image2.gif) | BR1174 Floorplan.PNG.svg | 2024-01-23 15:45 | 46K | |
![[IMG]](/icons/image2.gif) | BR1174 Floorplan.PNG | 2024-01-23 15:45 | 34K | |
![[IMG]](/icons/image2.gif) | BR1172 Site Map.pdf_0.png | 2025-12-12 01:39 | 5.2M | |
![[ ]](/icons/layout.gif) | BR1172 Site Map.pdf | 2025-12-12 01:39 | 60K | |
![[IMG]](/icons/image2.gif) | BR1169 Floorplan.pdf0.png | 2024-02-19 15:58 | 61K | |
![[ ]](/icons/layout.gif) | BR1169 Floorplan.pdf | 2024-02-19 15:58 | 47K | |
![[IMG]](/icons/image2.gif) | BR1168 Floorplan.pdf0.png | 2024-02-19 15:40 | 62K | |
![[ ]](/icons/layout.gif) | BR1168 Floorplan.pdf | 2024-02-19 15:40 | 47K | |
![[IMG]](/icons/image2.gif) | BR1166 Floorplan.pdf0.png | 2024-02-19 20:01 | 63K | |
![[ ]](/icons/layout.gif) | BR1166 Floorplan.pdf | 2024-02-19 20:01 | 45K | |
![[IMG]](/icons/image2.gif) | BOM + Heatmapls 3.pdf0.png | 2024-09-25 18:33 | 99K | |
![[ ]](/icons/layout.gif) | BOM + Heatmapls 3.pdf | 2024-09-25 18:33 | 557K | |
![[ ]](/icons/layout.gif) | BID DRAWING SET_LCC Bowman Library Renovation_3-12-2024.pdf | 2024-04-01 19:39 | 28M | |
![[ ]](/icons/layout.gif) | BID 23-24-MUFSD-024 Cabling and Sure Call Installation at Central, Murray and Chatsworth Schools. (1).pdf | 2024-03-17 13:44 | 242K | |
![[ ]](/icons/layout.gif) | BID 23-24-MUFSD-024 Cabling and Sure Call Installation at Central, Murray and Chatsworth Schools(1).pdf | 2024-03-17 13:45 | 242K | |
![[ ]](/icons/layout.gif) | BICSI_RCDD_Certificate.pdf | 2024-10-10 13:47 | 2.0M | |
![[ ]](/icons/layout.gif) | BICSI_Designation_technician_Certificate.pdf | 2024-10-10 13:47 | 1.0M | |
![[ ]](/icons/layout.gif) | B Demo -HomePage.pdf | 2023-10-31 13:30 | 0 | |
![[ ]](/icons/layout.gif) | BD2550 District Security Camera Replacement RFP.pdf | 2024-10-16 15:08 | 385K | |
![[ ]](/icons/layout.gif) | BD2550.pdf | 2024-10-16 15:08 | 54K | |
![[ ]](/icons/unknown.gif) | BD2550 - BD2550 District Security Camera Replacement_details.json | 2024-11-06 13:31 | 1.5K | |
![[IMG]](/icons/image2.gif) | BAckBone Campus.pdf0.png | 2024-02-27 22:06 | 235K | |
![[ ]](/icons/layout.gif) | BAckBone Campus.pdf | 2024-02-27 22:06 | 932K | |
![[ ]](/icons/unknown.gif) | BARTOW COUNTY SCHOOL SYSTEM Cabling_details.json | 2025-08-20 12:37 | 9.0K | |
![[ ]](/icons/layout.gif) | BARTOW COUNTY SCHOOL SYSTEM Cabling- Proposal Documents.pdf | 2025-02-20 11:44 | 4.0M | |
![[ ]](/icons/layout.gif) | BAMC Video Wall PWS_Redacted.pdf | 2025-10-21 00:04 | 234K | |
![[ ]](/icons/layout.gif) | B23C639C-9606-BC68-FC41-EB1EDFEC7732.pdf | 2024-11-23 12:39 | 55K | |
![[ ]](/icons/layout.gif) | B09_Amendment_05_P2024R0022_2_7_24_0005.pdf | 2024-02-09 12:55 | 322K | |
![[ ]](/icons/layout.gif) | B09_Amendment_04_P2024R0022_2_5_24_0004.pdf | 2024-02-09 12:55 | 447K | |
![[ ]](/icons/layout.gif) | B09_Amendment_03_P2024R0022_1_29_24_0003.pdf | 2024-02-09 12:55 | 11M | |
![[ ]](/icons/layout.gif) | B09_Amendment_02_P2024R0022_1_19_24_0002.pdf | 2024-02-09 12:56 | 3.4M | |
![[ ]](/icons/layout.gif) | B08_P2024R0022_ROMO_316223_Solicitation_and_Clauses_1_2_24.pdf | 2024-02-09 12:50 | 873K | |
![[ ]](/icons/layout.gif) | B08_Attachment_5_Wage_Determination.pdf | 2024-02-09 12:50 | 79K | |
![[ ]](/icons/layout.gif) | B08_Attachment_4_ROMO_316223-TechSpecs_Final.pdf | 2024-02-09 13:26 | 7.1M | |
![[ ]](/icons/layout.gif) | B08_Attachment_3_ROMO_316223_-_Fire_Clean_SOW_w_Attachments.pdf | 2024-02-09 12:50 | 12M | |
![[ ]](/icons/layout.gif) | B08_Attachment_2_ROMO_316223_FinalCD_Drawings.pdf | 2024-02-09 12:50 | 38M | |
![[ ]](/icons/layout.gif) | B08_Attachment_1_ROMO_316223-Div01Specs_Final_rev.pdf | 2024-02-09 12:50 | 16M | |
![[IMG]](/icons/image2.gif) | Aurora police dep logo.png | 2023-03-03 21:18 | 15K | |
![[ ]](/icons/layout.gif) | Aurora_Final_Cut.pdf | 2023-03-23 11:55 | 1.7M | |
![[TXT]](/icons/text.gif) | Aurora TEst-Telecommunication Outlets- Assets List 3.csv | 2023-03-06 13:39 | 9.1K | |
![[ ]](/icons/layout.gif) | Attch 1_NAF Clauses.pdf | 2025-01-03 22:44 | 895K | |
![[ ]](/icons/layout.gif) | Attachment F - Checklist.pdf | 2024-10-28 17:34 | 317K | |
![[ ]](/icons/layout.gif) | Attachment E School Safety Affidavit - 3.3.2023.pdf | 2024-09-30 18:16 | 251K | |
![[IMG]](/icons/image2.gif) | Attachment D BUILDING L - 3RD FL - 11X17 (1).pdf0.png | 2024-06-16 22:59 | 72K | |
![[ ]](/icons/layout.gif) | Attachment D BUILDING L - 3RD FL - 11X17 (1).pdf | 2024-06-16 22:59 | 58K | |
![[ ]](/icons/layout.gif) | Attachment C Familial Statement (1).pdf | 2024-09-30 18:17 | 14K | |
![[IMG]](/icons/image2.gif) | Attachment C BUILDING L - 2ND FL - 11X17 (1).pdf0.png | 2024-06-16 22:59 | 100K | |
![[ ]](/icons/layout.gif) | Attachment C BUILDING L - 2ND FL - 11X17 (1).pdf | 2024-06-16 22:59 | 69K | |
![[IMG]](/icons/image2.gif) | Attachment B BUILDING L - 1ST FL - 11X17 (1).pdf0.png | 2024-06-16 22:59 | 108K | |
![[ ]](/icons/layout.gif) | Attachment B BUILDING L - 1ST FL - 11X17 (1).pdf | 2024-06-16 22:59 | 74K | |
![[IMG]](/icons/image2.gif) | Attachment A BUILDING L - BSMT - 11X17 (1).pdf0.png | 2024-06-16 23:00 | 96K | |
![[ ]](/icons/layout.gif) | Attachment A BUILDING L - BSMT - 11X17 (1).pdf | 2024-06-16 23:00 | 60K | |
![[ ]](/icons/unknown.gif) | Attachment A - Master Services Contract Draft.docx | 2025-08-14 20:24 | 91K | |
![[ ]](/icons/unknown.gif) | Attachment A - Agreement for Services.docx | 2024-10-09 16:06 | 89K | |
![[ ]](/icons/layout.gif) | Attachment 9 - Offeror Quote Supplement Form.pdf | 2024-03-06 14:46 | 861K | |
![[ ]](/icons/layout.gif) | Attachment 8 - Brand Name Justification.pdf | 2024-03-06 14:46 | 807K | |
![[ ]](/icons/layout.gif) | Attachment 7 - Diverse Fiber to new WGF Building.pdf | 2024-03-12 17:18 | 2.0M | |
![[ ]](/icons/layout.gif) | Attachment 6 - Task Order Proposal Instructions.pdf | 2024-03-06 14:46 | 255K | |
![[ ]](/icons/layout.gif) | Attachment 6 - Response Form.pdf | 2024-03-12 17:18 | 126K | |
![[ ]](/icons/layout.gif) | Attachment 6 - QA from Previous Solicitation.pdf | 2025-06-04 15:31 | 133K | |
![[ ]](/icons/layout.gif) | Attachment 5b - Supplemental Clauses.pdf | 2024-03-06 14:46 | 1.0M | |
![[ ]](/icons/layout.gif) | Attachment 5a - Provisions and Clauses.pdf | 2024-03-06 14:46 | 3.0M | |
![[ ]](/icons/layout.gif) | Attachment 5 - Site Visit Agenda.pdf | 2024-03-12 17:18 | 115K | |
![[ ]](/icons/layout.gif) | Attachment 5 - DD254 Draft OSP.pdf | 2025-06-04 15:31 | 168K | |
![[ ]](/icons/layout.gif) | Attachment 4 Wage Determination.pdf | 2024-03-12 17:18 | 101K | |
![[ ]](/icons/layout.gif) | Attachment 4 - Wage Determination 23 Dec 2024.pdf | 2025-06-04 15:31 | 105K | |
![[ ]](/icons/layout.gif) | Attachment 4 - Site Visit Agenda.pdf | 2024-03-06 14:46 | 827K | |
![[ ]](/icons/layout.gif) | Attachment 3a - Supplemental Clauses v2.pdf | 2024-03-12 17:18 | 805K | |
![[ ]](/icons/layout.gif) | Attachment 3 - Wage Determination 2015-5405 Rev 21 (26 Dec 23).pdf | 2024-03-06 14:46 | 460K | |
![[ ]](/icons/layout.gif) | Attachment 3 - Provisions and Clauses.pdf | 2024-03-12 17:17 | 1.2M | |
![[ ]](/icons/layout.gif) | Attachment 3 - Additional Applicable Clauses and Provisions.pdf | 2025-06-04 15:31 | 2.0M | |
![[ ]](/icons/layout.gif) | Attachment 2e - Task Order Proposal Instructions.pdf | 2024-03-12 17:18 | 122K | |
![[ ]](/icons/layout.gif) | Attachment 2c Armored Single Mode Fiber Details.pdf | 2024-03-12 17:17 | 1.2M | |
![[ ]](/icons/layout.gif) | Attachment 2b Installation Pictures - updated.pdf | 2024-03-12 17:18 | 3.1M | |
![[ ]](/icons/layout.gif) | Attachment 2a - 90 CS TIC Handbook.pdf | 2024-03-12 17:18 | 3.4M | |
![[ ]](/icons/layout.gif) | Attachment 2 - Wage Determination 2015-5417 Rev 26.pdf | 2024-06-26 14:35 | 499K | |
![[ ]](/icons/layout.gif) | Attachment 2 -PWS Multi-Fiber (V6 TL 22 Feb 24).pdf | 2024-03-12 17:18 | 297K | |
![[ ]](/icons/layout.gif) | Attachment 2 - CLIN Price Sheet.pdf | 2025-06-04 15:31 | 40K | |
![[IMG]](/icons/image2.gif) | Attachment 1b - Building Floorplans.pdf19.png | 2024-03-06 16:17 | 44K | |
![[IMG]](/icons/image2.gif) | Attachment 1b - Building Floorplans.pdf18.png | 2024-03-06 16:17 | 56K | |
![[IMG]](/icons/image2.gif) | Attachment 1b - Building Floorplans.pdf17.png | 2024-03-06 16:17 | 54K | |
![[IMG]](/icons/image2.gif) | Attachment 1b - Building Floorplans.pdf16.png | 2024-03-06 16:17 | 49K | |
![[IMG]](/icons/image2.gif) | Attachment 1b - Building Floorplans.pdf15.png | 2024-03-06 16:17 | 62K | |
![[IMG]](/icons/image2.gif) | Attachment 1b - Building Floorplans.pdf14.png | 2024-03-06 16:17 | 65K | |
![[IMG]](/icons/image2.gif) | Attachment 1b - Building Floorplans.pdf13.png | 2024-03-06 16:17 | 65K | |
![[IMG]](/icons/image2.gif) | Attachment 1b - Building Floorplans.pdf12.png | 2024-03-06 16:17 | 56K | |
![[IMG]](/icons/image2.gif) | Attachment 1b - Building Floorplans.pdf11.png | 2024-03-06 16:17 | 104K | |
![[IMG]](/icons/image2.gif) | Attachment 1b - Building Floorplans.pdf10.png | 2024-03-06 16:17 | 68K | |
![[IMG]](/icons/image2.gif) | Attachment 1b - Building Floorplans.pdf9.png | 2024-03-06 16:17 | 63K | |
![[IMG]](/icons/image2.gif) | Attachment 1b - Building Floorplans.pdf8.png | 2024-03-06 16:17 | 48K | |
![[IMG]](/icons/image2.gif) | Attachment 1b - Building Floorplans.pdf7.png | 2024-03-06 16:17 | 68K | |
![[IMG]](/icons/image2.gif) | Attachment 1b - Building Floorplans.pdf6.png | 2024-03-06 16:17 | 70K | |
![[IMG]](/icons/image2.gif) | Attachment 1b - Building Floorplans.pdf5.png | 2024-03-06 16:17 | 59K | |
![[IMG]](/icons/image2.gif) | Attachment 1b - Building Floorplans.pdf4.png | 2024-03-06 16:17 | 61K | |
![[IMG]](/icons/image2.gif) | Attachment 1b - Building Floorplans.pdf3.png | 2024-03-06 16:17 | 91K | |
![[IMG]](/icons/image2.gif) | Attachment 1b - Building Floorplans.pdf2.png | 2024-03-06 16:17 | 112K | |
![[IMG]](/icons/image2.gif) | Attachment 1b - Building Floorplans.pdf1.png | 2024-03-06 16:17 | 123K | |
![[IMG]](/icons/image2.gif) | Attachment 1b - Building Floorplans.pdf0.png | 2024-03-06 16:17 | 80K | |
![[ ]](/icons/layout.gif) | Attachment 1b - Building Floorplans.pdf | 2024-03-06 16:17 | 5.8M | |
![[ ]](/icons/layout.gif) | Attachment 1a - 90 CS TIC Handbook.pdf | 2024-03-06 14:46 | 1.9M | |
![[ ]](/icons/layout.gif) | Attachment 1 - Performance Work Statement 2 Feb 24.pdf | 2024-03-06 14:46 | 1.3M | |
![[ ]](/icons/layout.gif) | Attachment 1 - PWS for B350 ISP Upgrade Phases 1 and 2.pdf | 2024-06-26 14:35 | 5.2M | |
![[ ]](/icons/layout.gif) | Attachment 1 - Cheyenne Mountain Fiber Install PWS.pdf | 2025-06-04 15:31 | 476K | |
![[IMG]](/icons/image2.gif) | Attachment+5+-+B333+Floor+Plan+with+Scale.pdf.svg | 2023-04-17 21:27 | 416K | |
![[ ]](/icons/layout.gif) | Attachment+5+-+B333+Floor+Plan+with+Scale.pdf | 2023-04-17 21:27 | 622K | |
![[IMG]](/icons/image2.gif) | Attachment+5+-+B333+Floor+Plan+with+Scale (1).pdf0.png | 2023-05-17 18:04 | 1.6M | |
![[ ]](/icons/layout.gif) | Attachment+5+-+B333+Floor+Plan+with+Scale (1).pdf | 2023-05-17 18:04 | 702K | |
![[ ]](/icons/layout.gif) | Attachment+1+-+Solicitation+FA461323Q0006.pdf | 2024-02-05 14:23 | 561K | |
![[ ]](/icons/layout.gif) | Attach1+-+Statement+of+Objectives+(SOO)(Draft).pdf | 2025-05-09 12:35 | 821K | |
![[IMG]](/icons/image2.gif) | Attach.1+-+Statement+of+Objectives+(SOO)(Draft).pdf_24.png | 2025-05-09 12:34 | 1.2M | |
![[IMG]](/icons/image2.gif) | Attach.1+-+Statement+of+Objectives+(SOO)(Draft).pdf_23.png | 2025-05-09 12:34 | 180K | |
![[IMG]](/icons/image2.gif) | Attach.1+-+Statement+of+Objectives+(SOO)(Draft).pdf_22.png | 2025-05-09 12:34 | 267K | |
![[IMG]](/icons/image2.gif) | Attach.1+-+Statement+of+Objectives+(SOO)(Draft).pdf_21.png | 2025-05-09 12:34 | 266K | |
![[IMG]](/icons/image2.gif) | Attach.1+-+Statement+of+Objectives+(SOO)(Draft).pdf_20.png | 2025-05-09 12:34 | 962K | |
![[IMG]](/icons/image2.gif) | Attach.1+-+Statement+of+Objectives+(SOO)(Draft).pdf_19.png | 2025-05-09 12:34 | 754K | |
![[IMG]](/icons/image2.gif) | Attach.1+-+Statement+of+Objectives+(SOO)(Draft).pdf_18.png | 2025-05-09 12:34 | 141K | |
![[IMG]](/icons/image2.gif) | Attach.1+-+Statement+of+Objectives+(SOO)(Draft).pdf_17.png | 2025-05-09 12:34 | 588K | |
![[IMG]](/icons/image2.gif) | Attach.1+-+Statement+of+Objectives+(SOO)(Draft).pdf_16.png | 2025-05-09 12:34 | 470K | |
![[IMG]](/icons/image2.gif) | Attach.1+-+Statement+of+Objectives+(SOO)(Draft).pdf_15.png | 2025-05-09 12:34 | 621K | |
![[IMG]](/icons/image2.gif) | Attach.1+-+Statement+of+Objectives+(SOO)(Draft).pdf_14.png | 2025-05-09 12:34 | 1.2M | |
![[IMG]](/icons/image2.gif) | Attach.1+-+Statement+of+Objectives+(SOO)(Draft).pdf_13.png | 2025-05-09 12:34 | 1.3M | |
![[IMG]](/icons/image2.gif) | Attach.1+-+Statement+of+Objectives+(SOO)(Draft).pdf_12.png | 2025-05-09 12:34 | 1.5M | |
![[IMG]](/icons/image2.gif) | Attach.1+-+Statement+of+Objectives+(SOO)(Draft).pdf_11.png | 2025-05-09 12:34 | 1.9M | |
![[IMG]](/icons/image2.gif) | Attach.1+-+Statement+of+Objectives+(SOO)(Draft).pdf_10.png | 2025-05-09 12:34 | 1.7M | |
![[IMG]](/icons/image2.gif) | Attach.1+-+Statement+of+Objectives+(SOO)(Draft).pdf_9.png | 2025-05-09 12:34 | 1.6M | |
![[IMG]](/icons/image2.gif) | Attach.1+-+Statement+of+Objectives+(SOO)(Draft).pdf_8.png | 2025-05-09 12:34 | 2.0M | |
![[IMG]](/icons/image2.gif) | Attach.1+-+Statement+of+Objectives+(SOO)(Draft).pdf_7.png | 2025-05-09 12:34 | 1.9M | |
![[IMG]](/icons/image2.gif) | Attach.1+-+Statement+of+Objectives+(SOO)(Draft).pdf_6.png | 2025-05-09 12:34 | 1.8M | |
![[IMG]](/icons/image2.gif) | Attach.1+-+Statement+of+Objectives+(SOO)(Draft).pdf_5.png | 2025-05-09 12:34 | 1.8M | |
![[IMG]](/icons/image2.gif) | Attach.1+-+Statement+of+Objectives+(SOO)(Draft).pdf_4.png | 2025-05-09 12:34 | 1.9M | |
![[IMG]](/icons/image2.gif) | Attach.1+-+Statement+of+Objectives+(SOO)(Draft).pdf_3.png | 2025-05-09 12:34 | 1.7M | |
![[IMG]](/icons/image2.gif) | Attach.1+-+Statement+of+Objectives+(SOO)(Draft).pdf_2.png | 2025-05-09 12:34 | 662K | |
![[IMG]](/icons/image2.gif) | Attach.1+-+Statement+of+Objectives+(SOO)(Draft).pdf_1.png | 2025-05-09 12:34 | 660K | |
![[IMG]](/icons/image2.gif) | Attach.1+-+Statement+of+Objectives+(SOO)(Draft).pdf_0.png | 2025-05-09 12:34 | 225K | |
![[ ]](/icons/layout.gif) | Attach.1+-+Statement+of+Objectives+(SOO)(Draft).pdf | 2025-05-09 12:35 | 821K | |
![[DIR]](/icons/folder.gif) | Assets/ | 2025-11-30 14:43 | - | |
![[DIR]](/icons/folder.gif) | Asset_SVGs/ | 2024-01-17 12:59 | - | |
![[ ]](/icons/layout.gif) | Asbestos_Hazards_Workers_in_the_United_States_US_Job_Aid_PS5-102986.pdf | 2024-11-23 12:35 | 19K | |
![[ ]](/icons/layout.gif) | Asbestos_Hazards_Release_Response_Job_Aid_PS5-103489.pdf | 2024-11-23 12:35 | 101K | |
![[ ]](/icons/layout.gif) | Asbestos_Hazards_Products_and_Types_Job_Aid_PS5-103486.pdf | 2024-11-23 12:35 | 24K | |
![[ ]](/icons/layout.gif) | Asbestos_Hazards_Characteristics_Job_Aid_PS5-103485.pdf | 2024-11-23 12:35 | 21K | |
![[ ]](/icons/layout.gif) | Asbestos_Hazards_Avoiding_Exposure_Job_Aid_PS5-103488.pdf | 2024-11-23 12:35 | 25K | |
![[ ]](/icons/layout.gif) | As Built Securitas - Centennial CO - 20230824_6474 Cabling.pdf | 2023-11-03 18:14 | 668K | |
![[ ]](/icons/layout.gif) | As Built Securitas - Centennial CO - 20230824_6474 Cabling (1).pdf | 2023-11-03 18:48 | 668K | |
![[IMG]](/icons/image2.gif) | Aruba 48 port Switch.jpeg | 2023-02-28 17:58 | 7.4K | |
![[ ]](/icons/layout.gif) | Article 8.pdf | 2025-04-08 13:25 | 1.1M | |
![[ ]](/icons/layout.gif) | ArchSpecs_287E17_10-18-2024.pdf | 2024-12-06 19:16 | 10M | |
![[ ]](/icons/layout.gif) | Applying_Electrical_Standards_US_Job_Aid_PS5-00262.pdf | 2024-11-23 12:40 | 93K | |
![[ ]](/icons/layout.gif) | Appendix U.pdf | 2025-01-14 13:40 | 59K | |
![[ ]](/icons/layout.gif) | Appendix S.pdf | 2025-01-14 13:39 | 2.0M | |
![[ ]](/icons/layout.gif) | Appendix I - Work Product Acceptance Form.pdf | 2024-03-18 19:18 | 155K | |
![[ ]](/icons/layout.gif) | Appendix H - Work Assignment Form.pdf | 2024-03-18 19:53 | 134K | |
![[ ]](/icons/layout.gif) | Appendix G - Region List.pdf | 2024-03-18 19:18 | 891K | |
![[ ]](/icons/layout.gif) | Appendix G - Primary Security and Privacy Mandates.pdf | 2024-04-01 11:51 | 148K | |
![[ ]](/icons/layout.gif) | Appendix F - Glossary of Terms.pdf | 2024-04-01 11:51 | 208K | |
![[ ]](/icons/layout.gif) | Appendix E - Region List.pdf | 2024-04-01 11:52 | 1.2M | |
![[ ]](/icons/layout.gif) | Appendix E - Primary Security and Privacy Mandates.pdf | 2024-03-18 19:18 | 148K | |
![[ ]](/icons/layout.gif) | Appendix D - ACH VENDOR PAYMENT FORM.pdf | 2024-03-17 13:44 | 17K | |
![[ ]](/icons/layout.gif) | Appendix C1 - Contractor's Insurance 02Jan2024.pdf | 2024-03-18 19:18 | 307K | |
![[ ]](/icons/layout.gif) | Appendix C - W9.pdf | 2024-03-17 13:44 | 129K | |
![[ ]](/icons/layout.gif) | Appendix C - Standard Clauses 02Jan2024.pdf | 2024-03-18 19:18 | 527K | |
![[ ]](/icons/layout.gif) | Appendix C - IT Standard Contract Clauses 02Jan2024.pdf | 2024-04-01 11:51 | 633K | |
![[ ]](/icons/layout.gif) | Appendix C-2 - ITS Equal Opportunity and Supplier Diversity.pdf | 2024-04-01 11:52 | 612K | |
![[ ]](/icons/layout.gif) | Appendix C-1 - Contractors Insurance Requirements.pdf | 2024-04-01 11:52 | 250K | |
![[ ]](/icons/layout.gif) | Appendix B Standard Terms _ Conditions for Service Contracts .pdf | 2024-02-02 15:30 | 27M | |
![[ ]](/icons/layout.gif) | Appendix B Standard Terms Conditions for Service Contracts.pdf | 2024-02-13 14:03 | 738K | |
![[ ]](/icons/layout.gif) | Appendix B - Contractor Agreement 23-24-MUFSD-024.pdf | 2024-03-17 13:44 | 139K | |
![[ ]](/icons/layout.gif) | Appendix A General Terms and Conditions - Commodities and Non-Professional Services.pdf | 2025-12-14 17:29 | 642K | |
![[ ]](/icons/layout.gif) | Appendix A - Standard Terms & Conditions.pdf | 2024-04-01 11:52 | 209K | |
![[IMG]](/icons/image2.gif) | Appendix A - Cabling Plans By Building, By Floor.pdf11.png | 2024-03-25 18:48 | 260K | |
![[IMG]](/icons/image2.gif) | Appendix A - Cabling Plans By Building, By Floor.pdf10.png | 2024-03-25 18:48 | 245K | |
![[IMG]](/icons/image2.gif) | Appendix A - Cabling Plans By Building, By Floor.pdf9.png | 2024-03-25 18:48 | 250K | |
![[IMG]](/icons/image2.gif) | Appendix A - Cabling Plans By Building, By Floor.pdf8.png | 2024-03-25 18:48 | 242K | |
![[IMG]](/icons/image2.gif) | Appendix A - Cabling Plans By Building, By Floor.pdf7.png | 2024-03-25 18:48 | 196K | |
![[IMG]](/icons/image2.gif) | Appendix A - Cabling Plans By Building, By Floor.pdf6.png | 2024-03-25 18:48 | 254K | |
![[IMG]](/icons/image2.gif) | Appendix A - Cabling Plans By Building, By Floor.pdf5.png | 2024-03-25 18:48 | 249K | |
![[IMG]](/icons/image2.gif) | Appendix A - Cabling Plans By Building, By Floor.pdf4.png | 2024-03-25 18:48 | 218K | |
![[IMG]](/icons/image2.gif) | Appendix A - Cabling Plans By Building, By Floor.pdf3.png | 2024-03-25 18:48 | 212K | |
![[IMG]](/icons/image2.gif) | Appendix A - Cabling Plans By Building, By Floor.pdf2.png | 2024-03-25 18:48 | 214K | |
![[IMG]](/icons/image2.gif) | Appendix A - Cabling Plans By Building, By Floor.pdf1.png | 2024-03-25 18:48 | 164K | |
![[IMG]](/icons/image2.gif) | Appendix A - Cabling Plans By Building, By Floor.pdf0.png | 2024-03-25 18:48 | 269K | |
![[ ]](/icons/layout.gif) | Appendix A - Cabling Plans By Building, By Floor.pdf | 2024-03-25 18:48 | 622K | |
![[ ]](/icons/layout.gif) | Appendix 1 - Equipment and Display Floorplan_amended.pdf | 2025-02-03 14:50 | 592K | |
![[IMG]](/icons/image2.gif) | App Testing 1.png.svg | 2023-11-02 13:45 | 44K | |
![[IMG]](/icons/image2.gif) | App Testing 1.png | 2023-11-03 07:13 | 130K | |
![[ ]](/icons/unknown.gif) | Amy's hallmark Bronx_details.json | 2025-12-15 21:41 | 2.1K | |
![[ ]](/icons/unknown.gif) | Amy's Hallmark New Store_details.json | 2025-12-15 21:36 | 3.6K | |
![[ ]](/icons/unknown.gif) | American Furniture Warehouse-Colorado Springs_details.json | 2024-11-20 16:34 | 1.4K | |
![[ ]](/icons/unknown.gif) | American Eagle- Low Voltage Install_details.json | 2025-10-26 22:12 | 3.0K | |
![[ ]](/icons/unknown.gif) | American Cable Assembly Cat7 Quote_details.json | 2024-11-19 12:28 | 1.6K | |
![[ ]](/icons/layout.gif) | Am_0004_W9128F25RA043_Narrative.pdf | 2025-11-01 15:33 | 71K | |
![[ ]](/icons/layout.gif) | Am_0004_W9128F25RA043_Attachments.pdf | 2025-11-01 15:33 | 5.3M | |
![[ ]](/icons/layout.gif) | Am_0003_W9128F25RA043_Narrative.1.pdf | 2025-10-29 23:51 | 75K | |
![[ ]](/icons/layout.gif) | Am_0003_W9128F25RA043_Attachments1.pdf | 2025-10-29 23:57 | 28M | |
![[ ]](/icons/layout.gif) | Am_0002_W9128F25RA043_Narrative1.pdf | 2025-11-01 15:33 | 304K | |
![[ ]](/icons/layout.gif) | Am_0002_W9128F25RA043_Narrative.pdf | 2025-10-30 00:03 | 304K | |
![[ ]](/icons/layout.gif) | Am_0002_W9128F25RA043_Narrative.1.pdf | 2025-10-29 23:53 | 304K | |
![[ ]](/icons/layout.gif) | Am_0002_W9128F25RA043_Attachments.1.pdf | 2025-10-30 00:15 | 19M | |
![[ ]](/icons/layout.gif) | Am_0002_W9128F25RA043_Attachments-1.pdf | 2025-11-01 15:34 | 19M | |
![[ ]](/icons/layout.gif) | Already_Installed_Handhole.pdf | 2024-12-05 12:41 | 347K | |
![[ ]](/icons/layout.gif) | Ajay.pdf | 2023-10-23 15:54 | 94K | |
![[ ]](/icons/layout.gif) | Ajay-HomePage.pdf | 2023-10-23 15:54 | 94K | |
![[IMG]](/icons/image2.gif) | Airiel floor plan.png | 2025-12-14 18:08 | 7.7M | |
![[ ]](/icons/unknown.gif) | Ai 1_details.json | 2024-10-25 15:41 | 8.9K | |
![[ ]](/icons/unknown.gif) | Ai 1 Copied_details.json | 2024-10-21 13:12 | 7.7K | |
![[ ]](/icons/layout.gif) | Ai 1 Copied- Proposal Documents.pdf | 2024-11-14 12:32 | 527K | |
![[TXT]](/icons/text.gif) | Address test2.csv | 2023-03-10 18:44 | 1.0K | |
![[TXT]](/icons/text.gif) | Address test.csv | 2023-03-10 18:32 | 939 | |
![[ ]](/icons/layout.gif) | Additional Drops.pdf | 2025-11-14 03:23 | 1.6M | |
![[ ]](/icons/layout.gif) | Addendum_to_Bid_Quote_Base_Template__Non-Federal_Funds__Rev.pdf | 2024-12-05 12:46 | 175K | |
![[ ]](/icons/layout.gif) | Addendum_2_template.pdf | 2024-11-21 16:51 | 49K | |
![[ ]](/icons/layout.gif) | Addendum_1.pdf | 2024-11-21 16:51 | 97K | |
![[ ]](/icons/layout.gif) | Addendum_-_One_01_20241116.pdf | 2024-11-20 15:24 | 1.5M | |
![[ ]](/icons/layout.gif) | Addendum 2 Drawings.pdf | 2024-11-28 15:34 | 222K | |
![[ ]](/icons/layout.gif) | Addendum 2 Complete.pdf | 2024-11-28 15:36 | 278K | |
![[ ]](/icons/layout.gif) | Addendum 2 11.18.24.pdf | 2024-11-28 15:33 | 278K | |
![[ ]](/icons/layout.gif) | Addendum 2 11-18-24.pdf | 2024-11-28 15:36 | 278K | |
![[ ]](/icons/layout.gif) | Addendum 2.pdf | 2024-11-28 15:34 | 47K | |
![[ ]](/icons/layout.gif) | Addendum 1 Specifications.pdf | 2024-11-28 15:32 | 720K | |
![[ ]](/icons/layout.gif) | Addendum 1 Instructions to Bidders.pdf | 2024-11-28 15:32 | 258K | |
![[ ]](/icons/layout.gif) | Addendum 1 Drawings.pdf | 2024-11-28 15:32 | 2.4M | |
![[ ]](/icons/layout.gif) | Addendum 1 Complete.pdf | 2024-11-28 15:34 | 4.3M | |
![[ ]](/icons/layout.gif) | Addendum 1 AIA Document.pdf | 2024-11-28 15:32 | 267K | |
![[ ]](/icons/layout.gif) | Addendum 1 11.15.24.pdf | 2024-11-28 15:34 | 4.3M | |
![[ ]](/icons/layout.gif) | Addendum 1 11-15-24.pdf | 2024-11-28 15:36 | 4.3M | |
![[ ]](/icons/layout.gif) | Addendum1.pdf | 2024-10-21 20:30 | 59K | |
![[ ]](/icons/layout.gif) | Addendum 1 .pdf | 2024-11-28 15:32 | 61K | |
![[ ]](/icons/layout.gif) | Addendum 1-8.pdf | 2024-10-28 17:34 | 1.7M | |
![[ ]](/icons/layout.gif) | Addendum 1 (1).pdf | 2024-02-13 14:03 | 174K | |
![[ ]](/icons/layout.gif) | Addendum # 2 DPD 1-24 - Supply and Install Low Voltage Wiring for Town Facilities.pdf | 2024-04-29 20:02 | 102K | |
![[ ]](/icons/layout.gif) | Addendum #2 .pdf | 2025-12-14 17:29 | 147K | |
![[ ]](/icons/layout.gif) | Addendum # 1 DPD 1-24 - Supply and Install Low Voltage Wiring for Town Facilities.pdf | 2024-04-29 20:02 | 449K | |
![[ ]](/icons/layout.gif) | Addendum #1.pdf | 2024-02-02 15:46 | 174K | |
![[IMG]](/icons/image2.gif) | Adapter-with-connector.png | 2023-04-25 17:13 | 42K | |
![[ ]](/icons/layout.gif) | Adams 12 Proposal .pdf | 2025-02-21 15:14 | 129K | |
![[IMG]](/icons/image2.gif) | Ad12_Logo_Color_RGB (1).png | 2025-02-21 15:50 | 3.9K | |
![[IMG]](/icons/image2.gif) | AccessControlv2.jpg | 2024-10-15 20:31 | 2.8M | |
![[ ]](/icons/layout.gif) | A_02_00_JA_Fire_Alarm_Panels_Power_MCS__Final__Redacted.pdf | 2025-11-01 15:34 | 351K | |
![[IMG]](/icons/image2.gif) | ASM rework.pdf0.png | 2023-05-19 20:12 | 27K | |
![[ ]](/icons/layout.gif) | ASM rework.pdf | 2023-05-19 20:12 | 24K | |
![[IMG]](/icons/image2.gif) | ASM rework (1).pdf0.png | 2023-05-22 09:28 | 30K | |
![[ ]](/icons/layout.gif) | ASM rework (1).pdf | 2023-05-22 09:28 | 30K | |
![[ ]](/icons/layout.gif) | APP TEST-Invoice.pdf | 2024-02-23 15:18 | 32K | |
![[ ]](/icons/unknown.gif) | AO-AMC Fresh Meadows 7_details.json | 2025-06-11 02:01 | 1.6K | |
![[IMG]](/icons/image2.gif) | AMys hallmark.pdf0.png | 2023-07-01 03:56 | 20K | |
![[ ]](/icons/layout.gif) | AMys hallmark.pdf | 2023-07-01 03:56 | 40K | |
![[ ]](/icons/layout.gif) | AMENDMENT 0001 IFB 70Z0G125BCGA00002.pdf | 2025-01-07 22:18 | 245K | |
![[ ]](/icons/unknown.gif) | AMC 2657 AMC Boston Common 19 Boston MA_details.json | 2025-12-15 16:16 | 94K | |
![[ ]](/icons/unknown.gif) | AMC 2253 Paramus NJ Garden State 16 _details.json | 2025-11-28 18:02 | 94K | |
![[ ]](/icons/layout.gif) | AMC 2151 Fresh Meadows.pdf | 2025-07-04 17:24 | 3.5M | |
![[ ]](/icons/unknown.gif) | AMC 2112 19th Street East 6 - WAP Refresh_details.json | 2025-08-20 12:36 | 5.0K | |
![[ ]](/icons/unknown.gif) | AMC 475 NEW CITY CHICAGO_details.json | 2025-08-15 20:34 | 2.0K | |
![[ ]](/icons/unknown.gif) | AMC 133 RIVER EAST 21 CHICAGO_details.json | 2025-08-15 20:34 | 7.7K | |
![[ ]](/icons/unknown.gif) | AMC 08650Clifton NJ Commons 16_details.json | 2025-11-28 18:17 | 94K | |
![[ ]](/icons/unknown.gif) | AMC - 2151 Fresh Meadows NY_details.json | 2025-07-04 17:34 | 3.7K | |
![[ ]](/icons/unknown.gif) | AMC - 552 Empire 25 Project_details.json | 2025-11-09 14:53 | 11K | |
![[ ]](/icons/unknown.gif) | AMC - 552 Empire 25 Project Work Order_details.json | 2025-08-20 16:01 | 2.9K | |
![[ ]](/icons/unknown.gif) | AMC-73 Marlton 8_details.json | 2025-11-09 15:40 | 41K | |
![[ ]](/icons/unknown.gif) | AMC - 0558 Staten Island NY_details.json | 2025-07-28 11:58 | 2.1K | |
![[ ]](/icons/layout.gif) | ALTA_Survey_MIBC_F6_Lots_2A-1A.pdf | 2024-10-21 20:18 | 2.2M | |
![[ ]](/icons/layout.gif) | AFW_Surprise_-_In-Rack_Sprinkler_Product_Info.pdf | 2024-11-21 16:47 | 573K | |
![[ ]](/icons/layout.gif) | AFW_Colorado_Springs_-_Scope_of_Work_Exhibit_A_-_Fire_Protection.pdf | 2024-11-21 16:47 | 112K | |
![[ ]](/icons/layout.gif) | AFLCMC Building 1614 HN Fiber to Desk 2024-PZI-1238-Bill of Materials.pdf | 2024-02-23 16:49 | 6.3M | |
![[ ]](/icons/layout.gif) | AFLCMC+B1614+Fiber+to+Desk+Bid+Schedule.xlsx - Google Sheets.pdf | 2024-02-23 16:49 | 63K | |
![[ ]](/icons/layout.gif) | AFLCMC+B1614+Fiber+to+Desk+Bid+Schedule.xlsx - 1614 Fiber to Desk Bid Schedule.pdf | 2024-02-21 15:11 | 63K | |
![[ ]](/icons/unknown.gif) | AFLCMC+B1614+Fiber+to+Desk+Bid+Schedule.xlsx | 2024-02-23 16:49 | 19K | |
![[IMG]](/icons/image2.gif) | AFB Broomfield.pdf0.png | 2023-10-26 17:57 | 352K | |
![[ ]](/icons/layout.gif) | AFB Broomfield.pdf | 2023-10-26 17:57 | 3.4M | |
![[IMG]](/icons/image2.gif) | ADP.svg | 2023-04-27 13:27 | 2.3K | |
![[IMG]](/icons/image2.gif) | ADP.png | 2023-04-18 15:04 | 1.5K | |
![[ ]](/icons/layout.gif) | ADDENDUM #1 Library Renovation_3-27-2024.pdf | 2024-04-01 19:39 | 14M | |
![[ ]](/icons/layout.gif) | ACT Enviro - Denver CO - 2023.pdf | 2023-09-20 19:26 | 2.4M | |
![[ ]](/icons/layout.gif) | ACT Denver CABLING.pdf | 2023-09-20 19:25 | 538K | |
![[ ]](/icons/layout.gif) | ACT Denver.pdf | 2023-10-11 13:45 | 26M | |
![[ ]](/icons/layout.gif) | ACT Denver-MDF-1.pdf | 2023-10-11 13:45 | 21K | |
![[ ]](/icons/layout.gif) | ACT Denver-HomePage.pdf | 2023-10-11 13:44 | 26M | |
![[IMG]](/icons/image2.gif) | ACMS.pdf0.png | 2023-10-06 13:04 | 157K | |
![[ ]](/icons/layout.gif) | ACMS.pdf | 2023-10-06 13:04 | 192K | |
![[IMG]](/icons/image2.gif) | ACHS Theater Wing.pdf0.png | 2023-10-10 11:58 | 70K | |
![[ ]](/icons/layout.gif) | ACHS Theater Wing.pdf | 2023-10-10 11:58 | 2.4M | |
![[IMG]](/icons/image2.gif) | ACHS Main Floor.pdf0.png | 2023-10-09 13:31 | 165K | |
![[ ]](/icons/layout.gif) | ACHS Main Floor.pdf | 2023-10-09 13:31 | 2.4M | |
![[IMG]](/icons/image2.gif) | ACHS Basement.pdf0.png | 2023-10-06 15:35 | 29K | |
![[IMG]](/icons/image2.gif) | ACHS Basement.pdf.svg | 2023-03-29 18:58 | 117K | |
![[ ]](/icons/layout.gif) | ACHS Basement.pdf | 2023-10-06 15:35 | 461K | |
![[IMG]](/icons/image2.gif) | ACHS Base Plan 2011 2012.pdf0.png | 2023-10-06 16:21 | 558K | |
![[ ]](/icons/layout.gif) | ACHS Base Plan 2011 2012.pdf | 2023-10-06 16:21 | 150K | |
![[ ]](/icons/unknown.gif) | ACHS AP Install and Patch Cord Cabling_details.json | 2025-12-16 15:22 | 3.1K | |
![[ ]](/icons/unknown.gif) | ACHS AP Install_details.json | 2025-12-16 15:20 | 2.8K | |
![[IMG]](/icons/image2.gif) | ACHS 2nd Floor.pdf0.png | 2023-10-10 10:39 | 70K | |
![[IMG]](/icons/image2.gif) | ACHS 2nd Floor.pdf.svg | 2023-04-06 14:38 | 290K | |
![[ ]](/icons/layout.gif) | ACHS 2nd Floor.pdf | 2023-10-10 10:39 | 657K | |
![[ ]](/icons/layout.gif) | ACFrOgBbN3EEOj0dT0WQKBhMCGizu-L3ADmWyftUAtCvt1jJIRImKea7twFwcyQnfOVZB3UjUNmgzGfDY4ujDoxDQJO7o9W1DANwjEiUteD_mGnDU97EheJMIDc8lx8uEaj7gmZDFsYrudlvPG5dcF1hNNxmoRmb81VKePl8Ag==.pdf | 2025-06-11 01:41 | 1.6M | |
![[ ]](/icons/layout.gif) | A23 RFQ HQ003424R0058 Amend 0001.pdf | 2024-02-27 20:57 | 150K | |
![[ ]](/icons/layout.gif) | A23 RFQ HQ003424R0058.pdf | 2024-02-27 20:57 | 415K | |
![[ ]](/icons/layout.gif) | A23 Attachment 1 SOW Amend 0001.pdf | 2024-02-27 20:56 | 1.2M | |
![[ ]](/icons/layout.gif) | A23 Attachment 1 SOW.pdf | 2024-02-27 20:56 | 125K | |
![[ ]](/icons/layout.gif) | A8D57AA0-D378-3040-E129-3025CF6F5C74.pdf | 2024-11-23 12:40 | 95K | |
![[IMG]](/icons/image2.gif) | A2-41-OVERALL-FOURTH-FLOOR-PLAN-Rev.0.pdf0.png | 2023-05-01 22:58 | 317K | |
![[ ]](/icons/layout.gif) | A2-41-OVERALL-FOURTH-FLOOR-PLAN-Rev.0.pdf | 2023-05-01 22:58 | 1.5M | |
![[IMG]](/icons/image2.gif) | A2-31-OVERALL-THIRD-FLOOR-PLAN-Rev.0.pdf0.png | 2023-05-05 11:56 | 316K | |
![[ ]](/icons/layout.gif) | A2-31-OVERALL-THIRD-FLOOR-PLAN-Rev.0.pdf | 2023-05-05 11:56 | 1.5M | |
![[IMG]](/icons/image2.gif) | A2-21-OVERALL-SECOND-FLOOR-PLAN-Rev.0.pdf0.png | 2023-05-01 23:00 | 376K | |
![[ ]](/icons/layout.gif) | A2-21-OVERALL-SECOND-FLOOR-PLAN-Rev.0.pdf | 2023-05-01 22:59 | 2.0M | |
![[IMG]](/icons/image2.gif) | A2-11-OVERALL-FIRST-FLOOR-PLAN-Rev.0.pdf0.png | 2023-05-01 23:01 | 389K | |
![[ ]](/icons/layout.gif) | A2-11-OVERALL-FIRST-FLOOR-PLAN-Rev.0.pdf | 2023-05-01 23:00 | 2.6M | |
![[ ]](/icons/layout.gif) | A2+-+Related+Construction+Plans+-+V1.pdf | 2024-02-23 16:49 | 1.8M | |
![[IMG]](/icons/image2.gif) | A1+-+Fiber+to+Desk+Plans+-+V1.pdf7.png | 2024-02-22 16:39 | 378K | |
![[IMG]](/icons/image2.gif) | A1+-+Fiber+to+Desk+Plans+-+V1.pdf6.png | 2024-02-22 16:39 | 634K | |
![[IMG]](/icons/image2.gif) | A1+-+Fiber+to+Desk+Plans+-+V1.pdf5.png | 2024-02-22 16:39 | 1.1M | |
![[IMG]](/icons/image2.gif) | A1+-+Fiber+to+Desk+Plans+-+V1.pdf4.png | 2024-02-22 16:39 | 594K | |
![[IMG]](/icons/image2.gif) | A1+-+Fiber+to+Desk+Plans+-+V1.pdf3.png | 2024-02-22 16:39 | 700K | |
![[IMG]](/icons/image2.gif) | A1+-+Fiber+to+Desk+Plans+-+V1.pdf2.png | 2024-02-22 16:39 | 809K | |
![[IMG]](/icons/image2.gif) | A1+-+Fiber+to+Desk+Plans+-+V1.pdf1.png | 2024-02-22 16:39 | 720K | |
![[IMG]](/icons/image2.gif) | A1+-+Fiber+to+Desk+Plans+-+V1.pdf0.png | 2024-02-22 16:39 | 461K | |
![[ ]](/icons/layout.gif) | A1+-+Fiber+to+Desk+Plans+-+V1.pdf | 2024-02-23 16:49 | 3.6M | |
![[IMG]](/icons/image2.gif) | A.S.M office Loveland.pdf0.png | 2023-05-23 11:58 | 29K | |
![[ ]](/icons/layout.gif) | A.S.M office Loveland.pdf | 2023-05-23 11:58 | 29K | |
![[IMG]](/icons/image2.gif) | A.S.M Office CO Springs.pdf0.png | 2023-06-27 18:23 | 16K | |
![[ ]](/icons/layout.gif) | A.S.M Office CO Springs.pdf | 2023-06-27 18:23 | 12K | |
![[ ]](/icons/layout.gif) | A-415_11TH FL FINISH.pdf | 2024-02-13 21:13 | 2.6M | |
![[ ]](/icons/unknown.gif) | <cabletrayplan.pdf> 2.textClipping | 2024-10-09 18:20 | 800K | |
![[ ]](/icons/unknown.gif) | <cabletrayplan.pdf>.textClipping | 2024-10-14 12:56 | 800K | |
![[IMG]](/icons/image2.gif) | 1703829634768.JPEG.svg | 2024-01-29 13:50 | 145K | |
![[IMG]](/icons/image2.gif) | 1703829634768.JPEG | 2024-01-29 13:50 | 73K | |
![[IMG]](/icons/image2.gif) | 1703829634677.JPEG | 2024-02-07 13:49 | 77K | |
![[IMG]](/icons/image2.gif) | 1698516238107.jpg.svg | 2023-10-29 16:41 | 2.3M | |
![[IMG]](/icons/image2.gif) | 1698516238107.jpg | 2023-10-29 16:41 | 3.6M | |
![[IMG]](/icons/image2.gif) | 1698516238026.jpg.svg | 2023-10-29 16:39 | 2.9M | |
![[IMG]](/icons/image2.gif) | 1698516238026.jpg | 2023-10-29 16:39 | 3.9M | |
![[IMG]](/icons/image2.gif) | 1425664750.svg | 2023-10-19 20:41 | 42K | |
![[IMG]](/icons/image2.gif) | 1016047269.jpeg | 2023-02-14 18:15 | 2.4K | |
![[IMG]](/icons/image2.gif) | 271766196_301709212003394_1912979904860807909_n.jpg | 2024-12-11 02:36 | 69K | |
![[ ]](/icons/layout.gif) | 2233600 PHASE 1 BID FULL COMBINED SET SPEC 18NOV2024.pdf | 2024-12-11 22:00 | 72M | |
![[ ]](/icons/layout.gif) | 2233600 PHASE 1 BID FULL COMBINED SET DWG 18NOV2024.pdf | 2024-12-11 22:00 | 67M | |
![[ ]](/icons/layout.gif) | 260501-1-0_-_Floor_Boxes_-_Approved_-_4.24.24.pdf | 2024-11-21 16:51 | 5.3M | |
![[ ]](/icons/layout.gif) | 260501-1-0_-_Floor_Boxes_-_Approved_-_4-24-24.pdf | 2024-11-21 16:51 | 5.3M | |
![[ ]](/icons/layout.gif) | 241119 SCT Low Voltage RFQP Final.pdf | 2024-11-23 12:17 | 623K | |
![[ ]](/icons/layout.gif) | 240418_GSHS_Annex_-_DRAWINGS.pdf | 2024-04-24 11:24 | 3.5M | |
![[ ]](/icons/layout.gif) | 240232-005 letter.pdf | 2024-11-08 17:55 | 71K | |
![[ ]](/icons/layout.gif) | 240232-005-samsung-tv-s-mounts-wiring-and-cables.pdf | 2024-09-03 18:31 | 870K | |
![[ ]](/icons/unknown.gif) | 240232-005-samsung-tv-s-mounts-wiring-and-cables._details.json | 2024-10-16 14:29 | 1.5K | |
![[ ]](/icons/layout.gif) | 240216_Goodwill_-_Falcon_ELEC_Permit_Set.pdf | 2024-02-27 22:17 | 1.7M | |
![[IMG]](/icons/image2.gif) | 240096-002-cisco-system-installation.pdf24.png | 2024-04-18 12:12 | 8.9K | |
![[IMG]](/icons/image2.gif) | 240096-002-cisco-system-installation.pdf23.png | 2024-04-18 12:12 | 16K | |
![[IMG]](/icons/image2.gif) | 240096-002-cisco-system-installation.pdf22.png | 2024-04-18 12:12 | 3.6K | |
![[IMG]](/icons/image2.gif) | 240096-002-cisco-system-installation.pdf21.png | 2024-04-18 12:12 | 15K | |
![[IMG]](/icons/image2.gif) | 240096-002-cisco-system-installation.pdf20.png | 2024-04-18 12:12 | 169K | |
![[IMG]](/icons/image2.gif) | 240096-002-cisco-system-installation.pdf19.png | 2024-04-18 12:12 | 175K | |
![[IMG]](/icons/image2.gif) | 240096-002-cisco-system-installation.pdf18.png | 2024-04-18 12:12 | 17K | |
![[IMG]](/icons/image2.gif) | 240096-002-cisco-system-installation.pdf17.png | 2024-04-18 12:12 | 3.7K | |
![[IMG]](/icons/image2.gif) | 240096-002-cisco-system-installation.pdf16.png | 2024-04-18 12:12 | 4.0K | |
![[IMG]](/icons/image2.gif) | 240096-002-cisco-system-installation.pdf15.png | 2024-04-18 12:12 | 12K | |
![[IMG]](/icons/image2.gif) | 240096-002-cisco-system-installation.pdf14.png | 2024-04-18 12:12 | 31K | |
![[IMG]](/icons/image2.gif) | 240096-002-cisco-system-installation.pdf13.png | 2024-04-18 12:12 | 22K | |
![[IMG]](/icons/image2.gif) | 240096-002-cisco-system-installation.pdf12.png | 2024-04-18 12:12 | 13K | |
![[IMG]](/icons/image2.gif) | 240096-002-cisco-system-installation.pdf11.png | 2024-04-18 12:12 | 12K | |
![[IMG]](/icons/image2.gif) | 240096-002-cisco-system-installation.pdf10.png | 2024-04-18 12:12 | 22K | |
![[IMG]](/icons/image2.gif) | 240096-002-cisco-system-installation.pdf9.png | 2024-04-18 12:12 | 12K | |
![[IMG]](/icons/image2.gif) | 240096-002-cisco-system-installation.pdf8.png | 2024-04-18 12:12 | 8.5K | |
![[IMG]](/icons/image2.gif) | 240096-002-cisco-system-installation.pdf7.png | 2024-04-18 12:12 | 8.0K | |
![[IMG]](/icons/image2.gif) | 240096-002-cisco-system-installation.pdf6.png | 2024-04-18 12:12 | 3.6K | |
![[IMG]](/icons/image2.gif) | 240096-002-cisco-system-installation.pdf5.png | 2024-04-18 12:12 | 9.2K | |
![[IMG]](/icons/image2.gif) | 240096-002-cisco-system-installation.pdf4.png | 2024-04-18 12:12 | 3.7K | |
![[IMG]](/icons/image2.gif) | 240096-002-cisco-system-installation.pdf3.png | 2024-04-18 12:12 | 3.7K | |
![[IMG]](/icons/image2.gif) | 240096-002-cisco-system-installation.pdf2.png | 2024-04-18 12:12 | 49K | |
![[IMG]](/icons/image2.gif) | 240096-002-cisco-system-installation.pdf1.png | 2024-04-18 12:12 | 3.8K | |
![[IMG]](/icons/image2.gif) | 240096-002-cisco-system-installation.pdf0.png | 2024-04-18 12:12 | 15K | |
![[ ]](/icons/layout.gif) | 240096-002-cisco-system-installation.pdf | 2024-04-18 12:13 | 1.3M | |
![[ ]](/icons/layout.gif) | 240083-002-tv-installation.pdf | 2024-03-06 14:06 | 1.3M | |
![[ ]](/icons/layout.gif) | 240083-002-addendum.pdf | 2024-03-06 14:06 | 154K | |
![[ ]](/icons/layout.gif) | 202412_supportingdocs_PE-55391-NONST-2025-000000011-2024-12-19_11_25_92-58090c50-fc3a-4075-8ad5-4556c45439c3.pdf | 2024-12-31 21:21 | 485K | |
![[ ]](/icons/unknown.gif) | 81023 - Request for Proposal: Structured Cabling Replacement 2 facilites_details.json | 2025-07-31 01:29 | 91K | |
![[IMG]](/icons/image2.gif) | 63536CB0-8DFA-4F01-9F02-BCE8343C8392.jpeg.svg | 2023-12-22 16:35 | 555K | |
![[IMG]](/icons/image2.gif) | 63536CB0-8DFA-4F01-9F02-BCE8343C8392.jpeg | 2023-12-22 16:35 | 723K | |
![[IMG]](/icons/image2.gif) | 43534DCC-C322-4955-A609-B36BD73CB99B.jpeg.svg | 2023-12-29 21:20 | 405K | |
![[IMG]](/icons/image2.gif) | 43534DCC-C322-4955-A609-B36BD73CB99B.jpeg | 2023-12-29 21:20 | 353K | |
![[IMG]](/icons/image2.gif) | 24277 e 5th pl.pdf0.png | 2023-07-17 16:00 | 9.5K | |
![[ ]](/icons/layout.gif) | 24277 e 5th pl.pdf | 2023-07-17 16:00 | 41K | |
![[ ]](/icons/layout.gif) | 12345.pdf | 2023-06-23 12:50 | 92K | |
![[ ]](/icons/layout.gif) | 12345-TR-2::R-1.pdf | 2023-06-23 12:50 | 32K | |
![[ ]](/icons/layout.gif) | 12345-TR-2.pdf | 2023-06-23 12:50 | 16K | |
![[ ]](/icons/layout.gif) | 12345-HomePage.pdf | 2023-06-23 12:50 | 46K | |
![[IMG]](/icons/image2.gif) | 9956_Testfit (1).pdf_0.png | 2025-10-26 20:36 | 4.5M | |
![[ ]](/icons/layout.gif) | 9956_Testfit (1).pdf | 2025-10-26 20:36 | 714K | |
![[IMG]](/icons/image2.gif) | 9956_E101.pdf_0.png | 2025-09-29 15:37 | 5.8M | |
![[ ]](/icons/layout.gif) | 9956_E101.pdf | 2025-09-29 15:36 | 744K | |
![[ ]](/icons/layout.gif) | 9254- Decom WorkOrder.pdf | 2025-07-14 10:29 | 211K | |
![[ ]](/icons/layout.gif) | 9187-Rough in WorkOrder.pdf | 2025-05-31 11:25 | 209K | |
![[IMG]](/icons/image2.gif) | 8958_Testfit (1).pdf_0.png | 2025-10-31 20:36 | 4.3M | |
![[ ]](/icons/layout.gif) | 8958_Testfit (1).pdf | 2025-10-31 20:36 | 750K | |
![[IMG]](/icons/image2.gif) | 7100 E Belleview.pdf0.png | 2023-08-10 10:27 | 290K | |
![[ ]](/icons/layout.gif) | 7100 E Belleview.pdf | 2023-08-10 10:27 | 1.1M | |
![[IMG]](/icons/image2.gif) | 6155HTfYCHL._AC_SL1311_.svg | 2023-02-09 13:27 | 40K | |
![[ ]](/icons/layout.gif) | 4569-0001_ALTA_LOT_2__2024-04-30__FINAL.pdf | 2024-05-22 18:39 | 1.1M | |
![[IMG]](/icons/image2.gif) | 4129 Marked Up Data Prints.png | 2025-09-19 01:40 | 161K | |
![[ ]](/icons/layout.gif) | 4129 - DWGv10 - Audio - JCrew - Factory - Chappaqua, NY - 06-20-2025 - Revised No VCs.pdf | 2025-09-19 01:38 | 3.5M | |
![[ ]](/icons/layout.gif) | 4129 - DWGv1.0 - Audio - JCrew - Factory - Chappaqua, NY - 06.20.2025 - Revised No VCs.pdf | 2025-09-19 01:32 | 3.5M | |
![[ ]](/icons/layout.gif) | 4129 - DWGv1.0 - Audio - JCrew - Factory - Chappaqua, NY - 06-20-2025 - Revised No VCs.pdf | 2025-09-19 01:37 | 3.5M | |
![[ ]](/icons/layout.gif) | 2948 Bid Form.pdf | 2024-10-22 13:30 | 2.2M | |
![[ ]](/icons/unknown.gif) | 2679-NV-Las Vegas-W. Azure Dr. Install_details.json | 2024-10-30 22:33 | 1.9K | |
![[ ]](/icons/unknown.gif) | 2636-TX-Richardson-W. Renner Install_details.json | 2024-10-30 22:30 | 28K | |
![[ ]](/icons/unknown.gif) | 2608-TX-Bedford-Central Dr. Install_details.json | 2024-10-30 22:27 | 30K | |
![[ ]](/icons/unknown.gif) | 2551-TX-Lucas-SEC Angel Pkwy & McGarity Ln Install_details.json | 2024-10-30 22:06 | 28K | |
![[IMG]](/icons/image2.gif) | 2530_48G_PoE_J9772A_z.png | 2023-02-27 20:59 | 75K | |
![[ ]](/icons/unknown.gif) | 2489-Blue Diamond & Buffalo, LV Install_details.json | 2024-10-30 22:01 | 28K | |
![[ ]](/icons/unknown.gif) | 2472-NV-Las Vegas-W. Lake Mead Blvd Install_details.json | 2024-10-30 22:35 | 1.4K | |
![[ ]](/icons/unknown.gif) | 2412-TX-Celina-S. Preston Install_details.json | 2024-10-30 22:34 | 1.4K | |
![[ ]](/icons/unknown.gif) | 2397-NV-Las Vegas-Decatur and Alta Dr. Install_details.json | 2024-10-30 21:57 | 28K | |
![[ ]](/icons/unknown.gif) | 2381-NV-Henderson-St. Rose Pkwy Install_details.json | 2024-10-30 22:36 | 1.4K | |
![[ ]](/icons/unknown.gif) | 2253 CC Survey - AP port map.xlsx | 2025-11-28 17:53 | 115K | |
![[ ]](/icons/layout.gif) | 2253 CC Survey - AP port map - AP Info.pdf | 2025-11-28 17:52 | 184K | |
![[ ]](/icons/unknown.gif) | 2243-TX-Azle-Boyd Rd Install_details.json | 2024-10-30 21:41 | 28K | |
![[ ]](/icons/layout.gif) | 2151 - Site-AP Info.xlsx - Google Sheets.pdf | 2025-07-04 17:22 | 169K | |
![[ ]](/icons/layout.gif) | 2151 - Site-AP Info.pdf | 2025-07-04 17:23 | 169K | |
![[ ]](/icons/unknown.gif) | 2149-TX-Irving-N MacArthur Blvd Install_details.json | 2024-10-30 22:32 | 1.6K | |
![[ ]](/icons/unknown.gif) | 2116 - Survey-AP info.xlsx | 2025-06-09 18:18 | 108K | |
![[ ]](/icons/layout.gif) | 2112 19th Street East 6 - AMC.pdf | 2025-07-04 18:07 | 2.8M | |
![[ ]](/icons/layout.gif) | 2112 - Survey-AP Info.pdf | 2025-07-04 18:07 | 157K | |
![[ ]](/icons/unknown.gif) | 2025 - AMC 2112 19th Street East 6 - WAP Refresh_details.json | 2025-07-04 17:48 | 5.1K | |
![[ ]](/icons/unknown.gif) | 2025 - 2116 AMC Lincoln Square 13 Project Work oraer_details.json | 2025-06-18 23:04 | 11K | |
![[ ]](/icons/layout.gif) | 2025 - 2116 AMC Lincoln Square-OM3 Fiber Uplink.pdf | 2025-06-11 01:30 | 6.0M | |
![[ ]](/icons/layout.gif) | 2025 - 2116 AMC Lincoln Square-OM3 Fiber Uplink (2).pdf | 2025-06-06 19:59 | 5.8M | |
![[ ]](/icons/layout.gif) | 2025-24 Data Cabling for Niagara County Courthouse.pdf | 2025-03-10 23:28 | 657K | |
![[ ]](/icons/unknown.gif) | 2025-24 - Data Cabling for Niagara County Courthouse_details.json | 2025-03-10 23:27 | 1.4K | |
![[ ]](/icons/unknown.gif) | 2025- 008 Library Wiring_details.json | 2025-07-16 00:26 | 2.8K | |
![[ ]](/icons/layout.gif) | 2025- 008 Library Wiring- Proposal Documents.pdf | 2025-07-16 00:29 | 4.2M | |
![[ ]](/icons/layout.gif) | 2024 E-rate 470 vendor Q_A .pdf | 2024-02-10 23:23 | 122K | |
![[ ]](/icons/layout.gif) | 2024.08.15_Shea_Helix_Bldg_C_100__CD_DRAWINGS_Core-Shell.pdf | 2024-10-21 20:19 | 82M | |
![[ ]](/icons/layout.gif) | 2024.01.31_DPL IEP_BID SPEC.pdf | 2024-02-16 20:40 | 4.5M | |
![[ ]](/icons/layout.gif) | 2024.01.31_DPL IEP_BID DOCUMENTS.pdf | 2024-02-13 19:32 | 12M | |
![[ ]](/icons/layout.gif) | 2024-RFQ-05 S1 Delta County Fairgrounds Site.pdf | 2024-05-18 02:31 | 336K | |
![[ ]](/icons/layout.gif) | 2024-RFQ-05 DC Fairgrounds - Fiber Cabling Specs.pdf | 2024-05-18 02:31 | 105K | |
![[ ]](/icons/layout.gif) | 2024-39 Data Cabling II for Niagara County Information Technology.pdf | 2024-10-15 21:07 | 647K | |
![[ ]](/icons/layout.gif) | 2024-39 Bid Info.pdf | 2024-10-15 21:07 | 39K | |
![[ ]](/icons/layout.gif) | 2024-39A - Addendum 1.pdf | 2024-10-22 20:20 | 213K | |
![[ ]](/icons/unknown.gif) | 2024-39 - Data Cabling II for Niagara County Information Technology_details.json | 2024-10-28 13:27 | 25K | |
![[ ]](/icons/layout.gif) | 2024-35 Data Cabling for Niagara County Information Technology.pdf | 2024-05-10 01:10 | 643K | |
![[ ]](/icons/layout.gif) | 2024-09.04 - Preschool Addendum 02 .pdf | 2024-11-12 22:19 | 22M | |
![[ ]](/icons/layout.gif) | 2024-09-04 - Preschool Addendum 02 .pdf | 2024-11-12 22:20 | 22M | |
![[ ]](/icons/layout.gif) | 2024-08.23 - Preschool Addendum 01.pdf | 2024-11-12 22:18 | 37M | |
![[ ]](/icons/layout.gif) | 2024-08-23 - Preschool Addendum 01.pdf | 2024-11-12 22:19 | 37M | |
![[ ]](/icons/layout.gif) | 2024-08-19 - PSAE Wage Rates .pdf | 2024-11-12 22:20 | 546K | |
![[ ]](/icons/layout.gif) | 2024-08-15_Shea_Helix_Bldg_C_100__CD_DRAWINGS_Core-Shell.pdf | 2024-10-21 20:30 | 82M | |
![[ ]](/icons/layout.gif) | 2024-01-31_DPL IEP_BID SPEC.pdf | 2024-02-19 18:45 | 4.5M | |
![[ ]](/icons/layout.gif) | 2024-+01-31_DPL IEP_BID DOCUMENTS.pdf | 2024-02-19 18:45 | 12M | |
![[ ]](/icons/layout.gif) | 2023.03.28_-_Permit_Set_-_MEP-part-3.pdf | 2023-03-31 19:19 | 544K | |
![[ ]](/icons/layout.gif) | 2023.03.28_-_Permit_Set_-_MEP-part-2.pdf | 2023-04-04 17:34 | 659K | |
![[ ]](/icons/layout.gif) | 2023-1228 4th St N - Progress Report 2 - Metering Matrix.pdf | 2024-03-29 12:48 | 270K | |
![[ ]](/icons/layout.gif) | 2023-1228 4th St N - Permit - Project Manual VOL 2.pdf | 2024-03-29 12:47 | 7.0M | |
![[ ]](/icons/layout.gif) | 2023-1228 4th St N - Permit - Project Manual VOL 1.pdf | 2024-03-29 12:47 | 8.9M | |
![[ ]](/icons/layout.gif) | 2023-1228 4th St N - 50 CD - Low Voltage - Building D.pdf | 2024-03-29 12:47 | 5.6M | |
![[ ]](/icons/layout.gif) | 2023-1228 4th St N - 50 CD - Low Voltage - Building A.pdf | 2024-03-29 12:46 | 5.2M | |
![[ ]](/icons/layout.gif) | 2023-002 City Wide Network Cabling Upgrades (Attachment B).pdf | 2024-10-09 16:06 | 66M | |
![[ ]](/icons/layout.gif) | 2022_11_30 - RDH Surgery - CD DRAWINGS.pdf | 2023-11-24 21:25 | 63M | |
![[ ]](/icons/layout.gif) | 2001 South Road 22659 F.pdf | 2025-10-26 22:18 | 458K | |
![[ ]](/icons/unknown.gif) | 1559 WingStop Project Co Survey_details.json | 2024-10-30 20:55 | 1.4K | |
![[ ]](/icons/layout.gif) | 1185 Platteville CO Cabling .pdf | 2024-01-19 03:01 | 1.0M | |
![[ ]](/icons/layout.gif) | 1185 Platteville CO Cabling -TR-1.pdf | 2024-01-19 03:01 | 41K | |
![[ ]](/icons/layout.gif) | 1185 Platteville CO Cabling - Sheet1.pdf | 2024-01-09 03:12 | 123K | |
![[ ]](/icons/layout.gif) | 1185 Platteville CO Cabling -Labelling-List.pdf | 2024-01-09 03:20 | 21K | |
![[ ]](/icons/unknown.gif) | 1185 Platteville CO Cabling -Labelling-List.numbers | 2024-01-09 03:17 | 121K | |
![[ ]](/icons/layout.gif) | 1185 Platteville CO Cabling -HomePage.pdf | 2024-01-19 03:01 | 1.0M | |
![[ ]](/icons/layout.gif) | 1185 Platteville CO Cabling -Bill of Materials.pdf | 2024-01-09 02:55 | 14M | |
![[IMG]](/icons/image2.gif) | 1183 floor plan.pdf0.png | 2024-08-12 11:09 | 380K | |
![[ ]](/icons/layout.gif) | 1183 floor plan.pdf | 2024-08-12 11:09 | 157K | |
![[ ]](/icons/layout.gif) | 1183 Windsor CO Cabling.pdf | 2024-02-21 13:19 | 1.1M | |
![[ ]](/icons/layout.gif) | 1183 Windsor CO Cabling-TR-1.pdf | 2024-02-21 13:19 | 11K | |
![[ ]](/icons/layout.gif) | 1183 Windsor CO Cabling-HomePage.pdf | 2024-02-21 13:19 | 1.1M | |
![[ ]](/icons/unknown.gif) | 1181 Parker CO - A24 is not working_details.json | 2024-11-13 00:21 | 2.7K | |
![[IMG]](/icons/image2.gif) | 1181 Parker.PNG.svg | 2024-01-07 22:45 | 123K | |
![[IMG]](/icons/image2.gif) | 1181 Parker.PNG | 2024-01-07 22:45 | 234K | |
![[IMG]](/icons/image2.gif) | 1181 As-Built.PNG | 2024-11-13 00:18 | 362K | |
![[IMG]](/icons/image2.gif) | 1179 Northglenn.PNG.svg | 2024-01-07 23:04 | 130K | |
![[IMG]](/icons/image2.gif) | 1179 Northglenn.PNG | 2024-01-07 23:04 | 631K | |
![[ ]](/icons/layout.gif) | 1177 Longmont CO Cabling.pdf | 2024-01-19 02:58 | 161K | |
![[ ]](/icons/layout.gif) | 1177 Longmont CO Cabling-TR-1.pdf | 2024-01-19 02:58 | 41K | |
![[ ]](/icons/layout.gif) | 1177 Longmont CO Cabling - Sheet1.pdf | 2024-01-04 03:26 | 106K | |
![[ ]](/icons/layout.gif) | 1177 Longmont CO Cabling-Labelling-List.pdf | 2024-01-04 17:46 | 52K | |
![[TXT]](/icons/text.gif) | 1177 Longmont CO Cabling-Labelling-List (1).csv | 2024-02-07 13:49 | 969 | |
![[ ]](/icons/layout.gif) | 1177 Longmont CO Cabling-HomePage.pdf | 2024-01-19 02:58 | 121K | |
![[ ]](/icons/layout.gif) | 1177 Longmont CO Cabling-Bill of Materials.pdf | 2024-01-09 02:41 | 11M | |
![[ ]](/icons/layout.gif) | 1177 Longmont CO Cabling (1).pdf | 2024-01-08 02:36 | 161K | |
![[IMG]](/icons/image2.gif) | 1177 Longmont CO.pdf0.png | 2024-01-24 23:07 | 50K | |
![[ ]](/icons/layout.gif) | 1177 Longmont CO.pdf | 2024-01-24 23:07 | 121K | |
![[ ]](/icons/unknown.gif) | 1176 Littleton CO Cabling Install-Change Order_details.json | 2024-11-12 23:40 | 2.0K | |
![[IMG]](/icons/image2.gif) | 1176 Boulder.pdf0.png | 2024-01-16 20:03 | 467K | |
![[ ]](/icons/layout.gif) | 1176 Boulder.pdf | 2024-01-16 20:03 | 2.2M | |
![[ ]](/icons/layout.gif) | 1175 Greeley CO Cabling.pdf | 2024-01-19 03:23 | 1.0M | |
![[ ]](/icons/layout.gif) | 1175 Greeley CO Cabling-TR-1.pdf | 2024-01-19 03:23 | 43K | |
![[ ]](/icons/layout.gif) | 1175 Greeley CO Cabling-HomePage.pdf | 2024-01-19 03:23 | 949K | |
![[IMG]](/icons/image2.gif) | 1174 Golden.PNG.svg | 2024-01-07 23:14 | 165K | |
![[IMG]](/icons/image2.gif) | 1174 Golden.PNG | 2024-01-07 23:14 | 374K | |
![[ ]](/icons/layout.gif) | 1173 Fort Collins CO Floor plan.pdf | 2024-01-07 20:58 | 102K | |
![[ ]](/icons/layout.gif) | 1173 Fort Collins CO Cabling.pdf | 2024-01-19 03:11 | 141K | |
![[ ]](/icons/layout.gif) | 1173 Fort Collins CO Cabling-TR-1.pdf | 2024-01-19 03:11 | 41K | |
![[ ]](/icons/layout.gif) | 1173 Fort Collins CO Cabling-HomePage.pdf | 2024-01-19 03:11 | 101K | |
![[ ]](/icons/layout.gif) | 1172 Colorado Spring CO Cabling.pdf | 2024-01-14 20:44 | 219K | |
![[ ]](/icons/layout.gif) | 1172 Colorado Spring CO Cabling-TR-2.pdf | 2024-01-14 20:44 | 42K | |
![[ ]](/icons/layout.gif) | 1172 Colorado Spring CO Cabling-TR-1.pdf | 2024-01-14 20:44 | 43K | |
![[ ]](/icons/layout.gif) | 1172 Colorado Spring CO Cabling-HomePage.pdf | 2024-01-14 20:44 | 137K | |
![[IMG]](/icons/image2.gif) | 1171 main floor.pdf0.png | 2024-06-04 18:01 | 64K | |
![[ ]](/icons/layout.gif) | 1171 main floor.pdf | 2024-06-04 18:01 | 63K | |
![[IMG]](/icons/image2.gif) | 1170 new floor plan.pdf0.png | 2024-08-12 11:11 | 380K | |
![[ ]](/icons/layout.gif) | 1170 new floor plan.pdf | 2024-08-12 11:11 | 157K | |
![[ ]](/icons/layout.gif) | 1170 Broomfield CO Cabling-HomePage.pdf | 2024-08-12 11:33 | 9.6K | |
![[IMG]](/icons/image2.gif) | 1170 Broomfield CO As - Built.pdf_0.png | 2024-11-13 00:12 | 2.3M | |
![[ ]](/icons/layout.gif) | 1170 Broomfield CO As - Built.pdf | 2024-11-13 00:12 | 1.0M | |
![[ ]](/icons/unknown.gif) | 1170 Broomfield CO, A18 is not working_details.json | 2024-11-13 00:13 | 2.4K | |
![[IMG]](/icons/image2.gif) | 1170 Broomfield.PNG.svg | 2024-01-07 23:20 | 155K | |
![[IMG]](/icons/image2.gif) | 1170 Broomfield.PNG | 2024-01-07 23:20 | 613K | |
![[IMG]](/icons/image2.gif) | 1169 Aurora.PNG.svg | 2024-01-07 22:58 | 505K | |
![[IMG]](/icons/image2.gif) | 1169 Aurora.PNG | 2024-01-07 22:58 | 820K | |
![[IMG]](/icons/image2.gif) | 1168 Boulder.PNG.svg | 2024-01-07 23:24 | 73K | |
![[IMG]](/icons/image2.gif) | 1168 Boulder.PNG | 2024-01-07 23:24 | 267K | |
![[IMG]](/icons/image2.gif) | 1167 Berthoud CO Cabling.pdf1.png | 2024-01-31 12:57 | 18K | |
![[IMG]](/icons/image2.gif) | 1167 Berthoud CO Cabling.pdf0.png | 2024-01-31 12:57 | 393K | |
![[ ]](/icons/layout.gif) | 1167 Berthoud CO Cabling.pdf | 2024-01-31 12:57 | 1.5M | |
![[ ]](/icons/layout.gif) | 1167 Berthoud CO Cabling-TR-1.pdf | 2024-01-19 03:05 | 42K | |
![[ ]](/icons/layout.gif) | 1167 Berthoud CO Cabling - Sheet1.pdf | 2024-01-03 13:48 | 102K | |
![[ ]](/icons/layout.gif) | 1167 Berthoud CO Cabling-Labelling-List.pdf | 2024-01-09 04:06 | 36K | |
![[ ]](/icons/layout.gif) | 1167 Berthoud CO Cabling-HomePage.pdf | 2024-01-19 03:05 | 1.4M | |
![[ ]](/icons/layout.gif) | 1167 Berthoud CO Cabling-Bill of Materials.pdf | 2024-01-09 04:05 | 16M | |
![[IMG]](/icons/image2.gif) | 1166 Aurora.PNG.svg | 2024-01-07 22:49 | 46K | |
![[IMG]](/icons/image2.gif) | 1166 Aurora.PNG | 2024-01-07 22:49 | 254K | |
![[ ]](/icons/layout.gif) | 948 countywide camera upgrade Invoice sample.pdf | 2024-07-11 01:37 | 46K | |
![[ ]](/icons/layout.gif) | 948 - Countywide Camera Upgrade (Cabling) - Proposal.pdf | 2024-07-11 01:37 | 240K | |
![[IMG]](/icons/image2.gif) | 606c4ff6a408bf29017d55de_starbird_logo.png | 2025-09-07 02:55 | 29K | |
![[ ]](/icons/layout.gif) | 472_17032_RWG_Kinross WiFi Cabling - DC Spec With PV (1).pdf | 2024-12-02 20:29 | 2.5M | |
![[ ]](/icons/layout.gif) | 472_17032_RWG_Kinross (KCF)_Wi-Fi Cabling Infrastructure_DTMB-0415 (Advertisment).pdf | 2024-12-02 20:29 | 120K | |
![[ ]](/icons/layout.gif) | 472.17032.RWG Kinross WIFI BID Drawings.pdf | 2024-12-02 20:29 | 7.3M | |
![[ ]](/icons/layout.gif) | 472-17032-RWG Kinross WIFI BID Drawings.pdf | 2024-12-02 20:30 | 7.3M | |
![[IMG]](/icons/image2.gif) | 458cb9b5-38a6-4597-af62-407408c3a366.jpeg | 2023-11-03 14:29 | 81K | |
![[ ]](/icons/layout.gif) | 442-303 Addendum 1 Summary.pdf | 2024-11-06 14:10 | 89K | |
![[ ]](/icons/layout.gif) | 442-303 Addendum 1 Revised SPECS.pdf | 2024-11-06 14:10 | 1.2M | |
![[ ]](/icons/layout.gif) | 442-303 Addendum 1 Revised DWGs.pdf | 2024-11-06 14:10 | 13M | |
![[IMG]](/icons/image2.gif) | 360 degree Camera.svg | 2023-05-26 08:30 | 10K | |
![[IMG]](/icons/image2.gif) | 360 degree Camera.png | 2023-05-26 08:30 | 27K | |
![[IMG]](/icons/image2.gif) | 315 floor plan.pdf_0.png | 2025-09-17 22:36 | 2.7M | |
![[ ]](/icons/layout.gif) | 315 floor plan.pdf | 2025-09-17 22:36 | 750K | |
![[ ]](/icons/unknown.gif) | 221-1 | 2024-06-03 23:59 | 48K | |
![[ ]](/icons/unknown.gif) | 202-1 | 2024-06-03 23:59 | 65K | |
![[IMG]](/icons/image2.gif) | 176 Candelas Marketplace.jpg.svg | 2024-05-02 14:28 | 351K | |
![[IMG]](/icons/image2.gif) | 176 Candelas Marketplace.jpg | 2024-05-02 14:28 | 370K | |
![[ ]](/icons/unknown.gif) | 131 8th Ave Troubleshoot and Certify Fiber_details.json | 2025-06-19 23:04 | 1.6K | |
![[ ]](/icons/unknown.gif) | 131 8th Ave NY, Fiber test_details.json | 2025-06-06 21:12 | 2.1K | |
![[ ]](/icons/unknown.gif) | 131 8th Ave NY, Fiber 2nd Test_details.json | 2025-06-18 22:00 | 1.4K | |
![[ ]](/icons/layout.gif) | 131 8 TH.pdf | 2025-06-06 21:16 | 2.5M | |
![[ ]](/icons/layout.gif) | 131 8 TH (1).pdf | 2025-06-18 22:05 | 5.7M | |
![[ ]](/icons/unknown.gif) | 119-1 | 2024-06-03 23:59 | 62K | |
![[ ]](/icons/unknown.gif) | 112-1 | 2024-06-03 23:59 | 70K | |
![[IMG]](/icons/image2.gif) | 81aAt6DbUVL._SL1500_.jpg | 2023-02-10 08:54 | 160K | |
![[IMG]](/icons/image2.gif) | 81YN46uOgcL._SL1500_.jpg | 2023-06-05 13:18 | 142K | |
![[ ]](/icons/layout.gif) | 81 TUNNELS SECTIONS.pdf | 2024-10-03 16:29 | 238K | |
![[ ]](/icons/layout.gif) | 80 TUNNELS PLANS.pdf | 2024-10-03 16:29 | 295K | |
![[IMG]](/icons/image2.gif) | 72 port Fiber LC fiber enclosure.svg | 2023-02-28 17:53 | 115K | |
![[ ]](/icons/layout.gif) | 70RFPW24QW9000004 AM0005.pdf | 2024-11-06 13:48 | 95K | |
![[ ]](/icons/layout.gif) | 70RFPW24QW9000004 AM0004.pdf | 2024-11-06 13:48 | 89K | |
![[ ]](/icons/layout.gif) | 70RFPW24QW9000004 AM0003.pdf | 2024-11-06 13:48 | 94K | |
![[ ]](/icons/layout.gif) | 70RFPW24QW9000004 AM0002.pdf | 2024-11-06 13:48 | 94K | |
![[ ]](/icons/layout.gif) | 70RFPW24QW9000004 AM0001.pdf | 2024-11-06 13:48 | 155K | |
![[ ]](/icons/layout.gif) | 70RFPW24QW8000002 Solicitation Document.pdf | 2024-10-28 17:15 | 13M | |
![[ ]](/icons/layout.gif) | 70RFPW24QW8000002 Amendment 0009.pdf | 2024-10-28 17:15 | 104K | |
![[ ]](/icons/layout.gif) | 70RFPW24QW8000002 Amendment 0008.pdf | 2024-10-28 17:15 | 89K | |
![[ ]](/icons/layout.gif) | 70RFPW24QW8000002 Amendment 0007.pdf | 2024-10-28 17:15 | 89K | |
![[ ]](/icons/layout.gif) | 70RFPW24QW8000002 Amendment 0006.pdf | 2024-10-28 17:15 | 109K | |
![[ ]](/icons/layout.gif) | 70RFPW24QW8000002 Amendment 0005.pdf | 2024-10-28 17:15 | 88K | |
![[ ]](/icons/layout.gif) | 70RFPW24QW8000002 Amendment 0004.pdf | 2024-10-28 17:15 | 88K | |
![[ ]](/icons/layout.gif) | 70RFPW24QW8000002 Amendment 0002.pdf | 2024-10-28 17:15 | 88K | |
![[ ]](/icons/layout.gif) | 70RFPW24QW8000002 A0003 0625.pdf | 2024-10-28 17:15 | 88K | |
![[ ]](/icons/layout.gif) | 70RFPW24QW8000002 A0001 0606.pdf | 2024-10-28 17:15 | 88K | |
![[IMG]](/icons/image2.gif) | 51ND19OC5yL._SL1000_.jpg | 2023-06-05 13:15 | 43K | |
![[IMG]](/icons/image2.gif) | 51JYMY8Gh-L._SX569_.jpg | 2023-02-10 14:04 | 8.2K | |
![[IMG]](/icons/image2.gif) | 48 port modular patch panel.jpg | 2023-05-03 15:59 | 5.3K | |
![[IMG]](/icons/image2.gif) | 48 Switch .svg | 2023-02-28 17:58 | 260K | |
![[IMG]](/icons/image2.gif) | 48-port modular patch panel.jpg.svg | 2023-06-21 17:20 | 23K | |
![[IMG]](/icons/image2.gif) | 48-port modular patch panel.jpg | 2023-06-21 17:20 | 20K | |
![[IMG]](/icons/image2.gif) | 48-port modular Patch panel.svg | 2023-05-22 16:00 | 9.0K | |
![[IMG]](/icons/image2.gif) | 48-port mod patch panel.jpg | 2023-05-09 08:55 | 112K | |
![[IMG]](/icons/image2.gif) | 45u.svg | 2023-02-10 20:39 | 300K | |
![[ ]](/icons/layout.gif) | 36C77623B0042.pdf | 2024-02-05 22:37 | 80K | |
![[ ]](/icons/layout.gif) | 36C24724Q0255_1.pdf | 2024-02-23 18:07 | 734K | |
![[IMG]](/icons/image2.gif) | 32-port Coax patch panel SVG.svg | 2023-07-19 13:46 | 13K | |
![[ ]](/icons/layout.gif) | 27_17_20_Commissioning_of_Communications_2019.pdf | 2024-11-04 19:13 | 133K | |
![[ ]](/icons/layout.gif) | 27_15_43_Communications_Faceplates_and_Connectors_2019.pdf | 2024-11-04 19:13 | 156K | |
![[ ]](/icons/layout.gif) | 27_15_00_Communications_Horizontal_Cabling_2019.pdf | 2024-11-04 19:13 | 144K | |
![[ ]](/icons/layout.gif) | 27_13_00_Communications_Backbone_Cabling_2019.pdf | 2024-11-04 19:13 | 125K | |
![[ ]](/icons/layout.gif) | 27_13_00_Communications_Backbone_Cabling_2019 (1).pdf | 2024-11-04 19:13 | 125K | |
![[ ]](/icons/layout.gif) | 27_11_19_Communications_Termination_Equipment_2019.pdf | 2024-11-04 19:13 | 159K | |
![[ ]](/icons/layout.gif) | 27_11_00_Communications_Equipment_Room_Fittings_2019.pdf | 2024-11-04 19:13 | 179K | |
![[ ]](/icons/layout.gif) | 27_10_00_Communications_General_Requirements_2019.pdf | 2024-11-04 19:13 | 151K | |
![[ ]](/icons/layout.gif) | 27_05_53_Identification_for_Communications_Systems_2019.pdf | 2024-11-04 19:13 | 164K | |
![[ ]](/icons/layout.gif) | 27_05_39_Surface_Raceways_For_Communications_Systems_2019.pdf | 2024-11-04 19:13 | 149K | |
![[ ]](/icons/layout.gif) | 27_05_33_Conduit_and_Boxes_2019.pdf | 2024-11-04 19:13 | 185K | |
![[ ]](/icons/layout.gif) | 27_05_29_Common_Work___Hangers_and_Supports_2019.pdf | 2024-11-04 19:13 | 160K | |
![[ ]](/icons/layout.gif) | 27_05_28_Common_Work-_Sleeves__Penetrations_and_Firestopping_2019.pdf | 2024-11-04 19:13 | 152K | |
![[ ]](/icons/layout.gif) | 27_05_26_Grounding_and_Bonding_2019.pdf | 2024-11-04 19:13 | 164K | |
![[ ]](/icons/layout.gif) | 27_01_00_Operations_and_Maintenance_of_Structure_Cabling_and_Enclosures_2019.pdf | 2024-11-04 19:13 | 110K | |
![[ ]](/icons/layout.gif) | 27_00_40_Warranty_2019.pdf | 2024-11-04 19:13 | 134K | |
![[ ]](/icons/layout.gif) | 27_00_10_Basic_Communications_Requirements_2019.pdf | 2024-11-04 19:13 | 253K | |
![[ ]](/icons/layout.gif) | 27 16 19 Communications Patch Cords (Rev012023).pdf | 2024-11-04 19:13 | 76K | |
![[ ]](/icons/layout.gif) | 27 00 20 - Contractor Qualifications 2019-2 (1).pdf | 2024-11-04 19:13 | 168K | |
![[ ]](/icons/layout.gif) | 27-50-00-Public-Address-General-Requirements-2019.pdf | 2024-11-04 19:13 | 1.7M | |
![[IMG]](/icons/image2.gif) | 26EF8A0C-5CFF-408E-AF43-B7C548605287_4_5005_c.jpeg | 2023-10-25 19:35 | 9.3K | |
![[ ]](/icons/unknown.gif) | 25-025 - Internal Connections-Structured Cabling (E-Rate)_details.json | 2025-02-21 15:50 | 1.8K | |
![[ ]](/icons/layout.gif) | 25-025 - Internal Connections-Structured Cabling (E-Rate) Bid - Proposal.pdf | 2025-02-21 12:32 | 224K | |
![[ ]](/icons/layout.gif) | 25-025 - Internal Connections-Structured Cabling (E-Rate)- Proposal Documents.pdf | 2025-02-21 15:52 | 3.7M | |
![[IMG]](/icons/image2.gif) | 24 port unloaded patvh panel.jpeg | 2023-02-10 20:56 | 73K | |
![[IMG]](/icons/image2.gif) | 24 port standart patch panel.jpeg | 2023-02-28 17:47 | 17K | |
![[IMG]](/icons/image2.gif) | 24 port patch panel.svg | 2023-02-28 17:47 | 64K | |
![[ ]](/icons/unknown.gif) | 24Q0146 Amendment 2.docx | 2024-10-12 00:00 | 28K | |
![[ ]](/icons/unknown.gif) | 24Q0146 Amendment 1.docx | 2024-10-12 00:00 | 39K | |
![[IMG]](/icons/image2.gif) | 24-port modular patch panel.png | 2023-02-10 15:16 | 48K | |
![[IMG]](/icons/image2.gif) | 24-port modular Patch panel.svg | 2023-02-20 00:02 | 9.0K | |
![[IMG]](/icons/image2.gif) | 24-port modular Patch panel (1).svg | 2023-02-20 00:25 | 30K | |
![[IMG]](/icons/image2.gif) | 24-CPS-SCS-01 RFB Drawings.pdf_5.png | 2024-10-30 18:59 | 3.3M | |
![[IMG]](/icons/image2.gif) | 24-CPS-SCS-01 RFB Drawings.pdf_4.png | 2024-10-30 18:59 | 3.3M | |
![[IMG]](/icons/image2.gif) | 24-CPS-SCS-01 RFB Drawings.pdf_3.png | 2024-10-30 18:59 | 3.1M | |
![[IMG]](/icons/image2.gif) | 24-CPS-SCS-01 RFB Drawings.pdf_2.png | 2024-10-30 18:59 | 3.9M | |
![[IMG]](/icons/image2.gif) | 24-CPS-SCS-01 RFB Drawings.pdf_1.png | 2024-10-30 18:59 | 3.1M | |
![[IMG]](/icons/image2.gif) | 24-CPS-SCS-01 RFB Drawings.pdf_0.png | 2024-10-30 18:59 | 4.3M | |
![[ ]](/icons/layout.gif) | 24-CPS-SCS-01 RFB Drawings.pdf | 2024-10-30 18:57 | 2.8M | |
![[ ]](/icons/layout.gif) | 24-CPS-SCS-01 RFB Drawings (1).pdf | 2024-10-30 12:38 | 2.8M | |
![[ ]](/icons/layout.gif) | 24-CPS-SCS-01 RFB.pdf | 2024-10-30 12:38 | 457K | |
![[ ]](/icons/layout.gif) | 24-CPS-SCS-01 Bid Forms.pdf | 2024-10-30 12:40 | 130K | |
![[ ]](/icons/unknown.gif) | 24-CPS-SCS-01 Bid Forms.docx | 2024-10-30 12:38 | 50K | |
![[ ]](/icons/layout.gif) | 24-1010_-_Tesla_Denver_-_100__CD_set.pdf | 2024-10-21 20:19 | 103M | |
![[ ]](/icons/unknown.gif) | 24-25-04 206 - Cabling Contractor_details.json | 2025-02-10 17:46 | 1.4K | |
![[ ]](/icons/layout.gif) | 24-041 As-Needed LV Cabling Services RFP.pdf | 2024-06-06 00:28 | 550K | |
![[IMG]](/icons/image2.gif) | 23RemM0328(Version=1) p1.pdf0.png | 2023-05-15 13:23 | 337K | |
![[ ]](/icons/layout.gif) | 23RemM0328(Version=1) p1.pdf | 2023-05-15 13:23 | 1.1M | |
![[IMG]](/icons/image2.gif) | 22 RemoM323(Version=2).pdf2.png | 2023-05-10 14:38 | 3.1M | |
![[IMG]](/icons/image2.gif) | 22 RemoM323(Version=2).pdf1.png | 2023-05-10 14:38 | 2.0M | |
![[IMG]](/icons/image2.gif) | 22 RemoM323(Version=2).pdf0.png | 2023-05-10 14:38 | 1.6M | |
![[ ]](/icons/layout.gif) | 22 RemoM323(Version=2).pdf | 2023-05-10 14:37 | 1.8M | |
![[ ]](/icons/layout.gif) | 22-059 Rangely Dist Hospital Surgery Systec SC #7757 Executed.pdf | 2024-02-09 14:59 | 2.7M | |
![[ ]](/icons/unknown.gif) | 21-BRCJX-0057_White_Hamilton Logo_powered by Concurrent_RGB-T.webp | 2023-12-25 23:19 | 11K | |
![[IMG]](/icons/image2.gif) | 19-Relay-Rack.svg | 2023-05-15 06:24 | 1.5K | |
![[IMG]](/icons/image2.gif) | 19-1U-Vertical-Wall-Mount-Bracket.svg | 2023-05-15 06:24 | 1.2K | |
![[IMG]](/icons/image2.gif) | 18-4 cable.jpg | 2023-04-28 12:33 | 2.4K | |
![[IMG]](/icons/image2.gif) | 16-4 cable.jpg | 2023-05-01 18:29 | 31K | |
![[IMG]](/icons/image2.gif) | 12 strand OS2 cable.jpg | 2023-04-25 16:35 | 2.1K | |
![[ ]](/icons/layout.gif) | 12a IFB Relocate Library Special Collections FY25.pdf | 2025-01-07 22:18 | 744K | |
![[ ]](/icons/layout.gif) | 12a. IFB Relocate Library Special Collections FY25.pdf | 2025-01-07 22:16 | 744K | |
![[IMG]](/icons/image2.gif) | 12 W radios drop.jpg | 2023-05-03 15:44 | 2.9K | |
![[IMG]](/icons/image2.gif) | 12 W ladder rack.jpg | 2023-05-03 15:42 | 32K | |
![[IMG]](/icons/image2.gif) | 12W Wall Angle kit.png | 2023-05-03 15:46 | 42K | |
![[IMG]](/icons/image2.gif) | 12U.svg | 2023-03-02 22:19 | 26K | |
![[ ]](/icons/layout.gif) | 12 - Roxborough High School Infrastructure Plans-6030.pdf | 2025-01-14 13:42 | 3.0M | |
![[IMG]](/icons/image2.gif) | 12â Ladder rack.svg | 2023-02-14 17:41 | 4.5K | |
![[IMG]](/icons/image2.gif) | 11th floor SS.jpg.svg | 2024-02-13 20:56 | 861K | |
![[IMG]](/icons/image2.gif) | 11th floor SS.jpg | 2024-02-13 21:13 | 1.0M | |
![[ ]](/icons/layout.gif) | 11 - Central High School Infrastructure Plans - 6010.pdf | 2025-01-14 13:42 | 2.5M | |
![[IMG]](/icons/image2.gif) | 10th floor SS.jpg.svg | 2024-02-13 20:56 | 1.8M | |
![[IMG]](/icons/image2.gif) | 10th floor SS.jpg | 2024-02-13 21:13 | 1.3M | |
![[IMG]](/icons/image2.gif) | 10ft Cable Ladder.svg | 2023-02-14 18:55 | 4.0K | |
![[IMG]](/icons/image2.gif) | 10ft Cable Ladder.jpeg | 2023-02-14 18:55 | 7.7K | |
![[IMG]](/icons/image2.gif) | 10.inch vertical manager.JPG | 2023-04-25 14:24 | 35K | |
![[IMG]](/icons/image2.gif) | 10.inch W vertical cable manager.png | 2023-04-19 15:43 | 67K | |
![[ ]](/icons/layout.gif) | 10 - Philadelphia Military Academy @ Elverson Infrastructure Plans-5050.pdf | 2025-01-14 13:42 | 846K | |
![[IMG]](/icons/image2.gif) | 9th Floor SS.jpg.svg | 2024-02-13 20:57 | 1.3M | |
![[IMG]](/icons/image2.gif) | 9th Floor SS.jpg | 2024-02-13 21:13 | 1.1M | |
![[ ]](/icons/layout.gif) | 9 - Clemente & The Linc Infrastructure Plans-7730&5660.pdf | 2025-01-14 13:42 | 6.0M | |
![[ ]](/icons/layout.gif) | 8 - RFP 25-025 Addendum 1.pdf | 2025-02-14 19:19 | 184K | |
![[ ]](/icons/layout.gif) | 8 - Olney High School Infrastructure Plans - 7060.pdf | 2025-01-14 13:42 | 2.5M | |
![[ ]](/icons/layout.gif) | 8-AFW_COLORADO_SPECIFICATIONS.pdf | 2024-11-21 16:45 | 9.3M | |
![[IMG]](/icons/image2.gif) | 8-5-2024 Additional Denver Drop Scope.pdf0.png | 2024-08-19 14:08 | 222K | |
![[ ]](/icons/layout.gif) | 8-5-2024 Additional Denver Drop Scope.pdf | 2024-08-19 14:08 | 964K | |
![[ ]](/icons/layout.gif) | 7BAF5E85-CA5B-0A52-4CD2-693380E77078.pdf | 2024-11-23 12:35 | 172K | |
![[IMG]](/icons/image2.gif) | 7A2E0A66-4590-4C09-B10B-76F91787B2BD.jpeg.svg | 2024-01-19 21:24 | 513K | |
![[IMG]](/icons/image2.gif) | 7A2E0A66-4590-4C09-B10B-76F91787B2BD.jpeg | 2024-01-19 21:24 | 684K | |
![[ ]](/icons/layout.gif) | 7.n Wage Rate Determination FY25.pdf | 2025-01-07 22:16 | 79K | |
![[ ]](/icons/layout.gif) | 7.AFW_COLORADO_LANDSCAPE.pdf | 2024-11-21 16:41 | 11M | |
![[ ]](/icons/layout.gif) | 7-n Wage Rate Determination FY25.pdf | 2025-01-07 22:18 | 79K | |
![[ ]](/icons/layout.gif) | 7 - Proforma Contract-Over 10K-041923.pdf | 2025-02-14 19:23 | 295K | |
![[ ]](/icons/layout.gif) | 7 - Fels, Samuel High School Infrastructure Plans-7120.pdf | 2025-01-14 13:42 | 435K | |
![[ ]](/icons/layout.gif) | 7-AFW_COLORADO_LANDSCAPE.pdf | 2024-11-21 16:47 | 11M | |
![[IMG]](/icons/image2.gif) | 6smb.jpeg | 2023-04-25 10:45 | 8.0K | |
![[IMG]](/icons/image2.gif) | 6U (1).svg | 2023-03-03 17:03 | 39K | |
![[ ]](/icons/unknown.gif) | 6A jack.webp | 2023-02-09 15:00 | 4.9K | |
![[IMG]](/icons/image2.gif) | 6.inch wire harness.png | 2023-04-28 12:17 | 167K | |
![[IMG]](/icons/image2.gif) | 6.inch vertical manager.JPG | 2023-04-25 14:18 | 17K | |
![[IMG]](/icons/image2.gif) | 6. inch W vertical cable manager.png | 2023-04-19 15:40 | 44K | |
![[ ]](/icons/layout.gif) | 6.AFW_COLORADO_CIVIL.pdf | 2024-11-21 16:41 | 91M | |
![[IMG]](/icons/image2.gif) | 6-smb (white).jpg.svg | 2023-07-18 13:03 | 10K | |
![[IMG]](/icons/image2.gif) | 6-smb (white).jpg | 2023-07-18 14:01 | 11K | |
![[IMG]](/icons/image2.gif) | 6-port smb SVG.svg | 2023-07-18 14:01 | 8.3K | |
![[IMG]](/icons/image2.gif) | 6-port faceplate.avif | 2023-02-10 19:18 | 3.6K | |
![[ ]](/icons/layout.gif) | 6 - Strawberry Mansion High School Infrastructure Plans-4140.pdf | 2025-01-14 13:42 | 2.3M | |
![[ ]](/icons/layout.gif) | 6 - Adams 12 Five Star Schools Debarment Certification.pdf | 2025-02-14 19:23 | 325K | |
![[ ]](/icons/layout.gif) | 6-AFW_COLORADO_CIVIL.pdf | 2024-11-21 16:48 | 91M | |
![[IMG]](/icons/image2.gif) | 5 wrk area merged.pdf4.png | 2023-05-18 16:50 | 21K | |
![[IMG]](/icons/image2.gif) | 5 wrk area merged.pdf3.png | 2023-05-18 16:50 | 53K | |
![[IMG]](/icons/image2.gif) | 5 wrk area merged.pdf2.png | 2023-05-18 16:50 | 42K | |
![[IMG]](/icons/image2.gif) | 5 wrk area merged.pdf1.png | 2023-05-18 16:50 | 34K | |
![[IMG]](/icons/image2.gif) | 5 wrk area merged.pdf0.png | 2023-05-18 16:50 | 34K | |
![[ ]](/icons/layout.gif) | 5 wrk area merged.pdf | 2023-05-18 16:50 | 187K | |
![[ ]](/icons/layout.gif) | 5.AFW_COLORADO_ELECTRICAL.pdf | 2024-11-21 16:41 | 13M | |
![[ ]](/icons/layout.gif) | 5 - Price Proposal Form pdf format.pdf | 2025-02-14 19:36 | 257K | |
![[ ]](/icons/layout.gif) | 5 - Overbrook High School Infrastructure Plans-4020.pdf | 2025-01-14 13:42 | 1.3M | |
![[ ]](/icons/layout.gif) | 5-AFW_COLORADO_ELECTRICAL.pdf | 2024-11-21 16:48 | 13M | |
![[ ]](/icons/layout.gif) | 4th Street North Mixed Use Development - Silverthorne CO - Invitation to Bid.pdf | 2024-03-29 12:48 | 218K | |
![[IMG]](/icons/image2.gif) | 4 inch firestop sleeve.jpeg | 2023-02-10 15:09 | 5.0K | |
![[IMG]](/icons/image2.gif) | 4U housing.jpg | 2023-04-25 16:41 | 339K | |
![[ ]](/icons/layout.gif) | 4B2B2023-B956-9EEE-6F66-85E0E142261C.pdf | 2024-11-23 12:40 | 174K | |
![[ ]](/icons/layout.gif) | 4B2B343F-FB7D-9892-541C-45CD97DF4CAA.pdf | 2024-11-23 12:40 | 175K | |
![[ ]](/icons/layout.gif) | 4B2B22AB-D7DD-DE33-E514-17373D75164F.pdf | 2024-11-23 12:40 | 156K | |
![[ ]](/icons/layout.gif) | 4B2B22A3-D9DD-21D7-3D0A-22CD2AB6016B.pdf | 2024-11-23 12:40 | 184K | |
![[ ]](/icons/layout.gif) | 4.AFW_COLORADO_PLUMBING.pdf | 2024-11-21 16:41 | 4.0M | |
![[IMG]](/icons/image2.gif) | 4-port faceplate.jpg | 2023-02-10 19:54 | 11K | |
![[ ]](/icons/layout.gif) | 4 - Bartram, John High School Infrastructure Plans-1010.pdf | 2025-01-14 13:42 | 619K | |
![[ ]](/icons/layout.gif) | 4 - Appendix A-2 - Floor Plans for School Sites_v2.pdf | 2025-02-14 19:19 | 3.8M | |
![[ ]](/icons/layout.gif) | 4-AFW_COLORADO_PLUMBING.pdf | 2024-11-21 16:48 | 4.0M | |
![[IMG]](/icons/image2.gif) | 4â Firestop sleeve.svg | 2023-02-10 15:09 | 483 | |
![[IMG]](/icons/image2.gif) | 3rd floor.pdf0.png | 2024-01-22 22:03 | 219K | |
![[ ]](/icons/layout.gif) | 3rd floor.pdf | 2024-01-22 22:03 | 332K | |
![[IMG]](/icons/image2.gif) | 3rd floor. cabling.pdf0.png | 2024-01-22 22:03 | 147K | |
![[ ]](/icons/layout.gif) | 3rd floor. cabling.pdf | 2024-01-22 22:03 | 293K | |
![[IMG]](/icons/image2.gif) | 3rd Foor SS.jpg.svg | 2024-02-13 20:57 | 930K | |
![[IMG]](/icons/image2.gif) | 3rd Foor SS.jpg | 2024-02-13 21:13 | 1.0M | |
![[ ]](/icons/layout.gif) | 3 coat stucco system.pdf | 2024-11-12 22:31 | 109K | |
![[ ]](/icons/unknown.gif) | 3 coat stucco system.docx | 2024-11-12 22:25 | 76K | |
![[ ]](/icons/unknown.gif) | 3__CSI-Subcontractor_Pre-qualification_Form.docx | 2024-10-21 20:31 | 108K | |
![[ ]](/icons/layout.gif) | 3 SITE PLAN.pdf | 2024-10-03 16:29 | 381K | |
![[ ]](/icons/layout.gif) | 3.c Specs_22020230_Relocate Library Special Collections Waesche_19Jan2024.PDF.pdf | 2025-01-07 22:16 | 16M | |
![[ ]](/icons/layout.gif) | 3.c Drawings_22020230_Relocate Library Special Collections Waesche_19Jan2024..pdf | 2025-01-07 22:16 | 25M | |
![[ ]](/icons/layout.gif) | 3.AFW_COLORADO_MECHANICAL.pdf | 2024-11-21 16:41 | 3.0M | |
![[IMG]](/icons/image2.gif) | 3-port faceplate.jpg | 2023-02-10 19:13 | 1.4M | |
![[ ]](/icons/layout.gif) | 3-c Specs_22020230_Relocate Library Special Collections Waesche_19Jan2024.pdf | 2025-01-14 15:39 | 16M | |
![[ ]](/icons/layout.gif) | 3-c Specs_22020230_Relocate Library Special Collections Waesche_19Jan2024.PDF.pdf | 2025-01-14 15:37 | 16M | |
![[ ]](/icons/layout.gif) | 3-c Drawings_22020230_Relocate Library Special Collections Waesche_19Jan2024.pdf | 2025-01-14 15:37 | 25M | |
![[ ]](/icons/layout.gif) | 3-c Drawings_22020230_Relocate Library Special Collections Waesche_19Jan2024..pdf | 2025-01-14 15:36 | 25M | |
![[ ]](/icons/layout.gif) | 3 - CAPA Infrastructure Plans - 2020.pdf | 2025-01-14 13:42 | 7.8M | |
![[ ]](/icons/layout.gif) | 3 - Appendix A-1 - Division 27 Technical Guidelines.pdf | 2025-02-14 19:19 | 2.1M | |
![[ ]](/icons/layout.gif) | 3-AFW_COLORADO_MECHANICAL.pdf | 2024-11-21 16:48 | 3.0M | |
![[ ]](/icons/layout.gif) | 3-20 F04600A01_BergenValleyES Addition_ConstDocs-Dwgs_07-31-2023.pdf | 2024-01-17 15:22 | 16M | |
![[IMG]](/icons/image2.gif) | 2u horizontal cable manager.jpg | 2023-05-03 16:01 | 4.3K | |
![[IMG]](/icons/image2.gif) | 2u APC.jpeg | 2023-02-27 21:50 | 3.7K | |
![[IMG]](/icons/image2.gif) | 2 port smb.jpg | 2023-02-10 20:15 | 8.2K | |
![[IMG]](/icons/image2.gif) | 2 port fp.jpg | 2023-02-10 20:05 | 6.0K | |
![[IMG]](/icons/image2.gif) | 2 port decora.jpg | 2023-02-10 20:06 | 2.0K | |
![[IMG]](/icons/image2.gif) | 2 inch firestop sleeve.jpeg | 2023-02-10 15:06 | 5.1K | |
![[IMG]](/icons/image2.gif) | 2fp.jpg | 2023-05-16 17:40 | 922 | |
![[IMG]](/icons/image2.gif) | 2final_1.png | 2024-10-30 12:57 | 306K | |
![[IMG]](/icons/image2.gif) | 2 data drops floor plan.pdf_0.png | 2025-08-19 10:11 | 1.0M | |
![[ ]](/icons/layout.gif) | 2 data drops floor plan.pdf | 2025-08-19 10:11 | 1.0M | |
![[IMG]](/icons/image2.gif) | 2_Post_rack_with_low_cost_cable_managers_expd.jpeg | 2023-02-10 20:39 | 45K | |
![[IMG]](/icons/image2.gif) | 2U wiremanager SVG.svg | 2023-07-19 13:49 | 12K | |
![[IMG]](/icons/image2.gif) | 2U wire manager.jpg | 2023-07-19 13:49 | 25K | |
![[IMG]](/icons/image2.gif) | 2U-Server.svg | 2023-02-27 21:43 | 94K | |
![[IMG]](/icons/image2.gif) | 2 Port Network Rack with cable Managers 45u.svg | 2023-02-04 18:59 | 300K | |
![[IMG]](/icons/image2.gif) | 2 POST RACK - 45RU WITH 4%22 VERTICAL WIRE MANAGEMENT.svg | 2023-02-10 20:39 | 1.5K | |
![[IMG]](/icons/image2.gif) | 2N stand.jpg | 2023-05-01 08:50 | 17K | |
![[IMG]](/icons/image2.gif) | 2N main unit.jpg | 2023-04-28 12:55 | 19K | |
![[ ]](/icons/layout.gif) | 2.AFW_COLORADO_STRUCTURAL.pdf | 2024-11-21 16:41 | 8.4M | |
![[IMG]](/icons/image2.gif) | 2-post rack.jpg | 2023-05-08 16:57 | 1.7K | |
![[IMG]](/icons/image2.gif) | 2-fp SVG.svg | 2023-05-16 17:40 | 2.7K | |
![[IMG]](/icons/image2.gif) | 2-fp (white).jpg.svg | 2023-07-18 14:13 | 3.5K | |
![[IMG]](/icons/image2.gif) | 2-fp (white).jpg | 2023-07-18 14:13 | 42K | |
![[ ]](/icons/layout.gif) | 2 - Childs Infrastructure Plans - 2260.pdf | 2025-01-14 13:42 | 4.4M | |
![[ ]](/icons/layout.gif) | 2 - Appendix A_ Statement of Work.pdf | 2025-02-14 19:19 | 180K | |
![[ ]](/icons/layout.gif) | 2-AFW_COLORADO_STRUCTURAL.pdf | 2024-11-21 16:48 | 8.4M | |
![[IMG]](/icons/image2.gif) | 2â Firestop sleeve.svg | 2023-02-10 15:06 | 483 | |
![[IMG]](/icons/image2.gif) | 1x6 Coax splitter SVG.svg | 2023-08-07 09:01 | 70K | |
![[IMG]](/icons/image2.gif) | 1x6 Coax splitter.jpeg.svg | 2023-08-07 09:01 | 89K | |
![[IMG]](/icons/image2.gif) | 1x6 Coax splitter.jpeg | 2023-08-07 09:01 | 64K | |
![[IMG]](/icons/image2.gif) | 1x4 splitter.jpg | 2023-04-25 13:50 | 1.8K | |
![[IMG]](/icons/image2.gif) | 1 port decora.jpg | 2023-02-10 20:02 | 1.9K | |
![[IMG]](/icons/image2.gif) | 1 inch firestop sleeve.jpeg | 2023-02-10 15:04 | 3.7K | |
![[IMG]](/icons/image2.gif) | 1U housing.png | 2023-04-25 17:10 | 77K | |
![[IMG]](/icons/image2.gif) | 1U cable manager.jpeg | 2023-04-25 15:48 | 8.6K | |
![[IMG]](/icons/image2.gif) | 1 PORT DATA OUTLET.PNG.svg | 2023-08-10 10:35 | 450 | |
![[IMG]](/icons/image2.gif) | 1 PORT DATA OUTLET.PNG | 2023-08-10 10:35 | 903 | |
![[ ]](/icons/layout.gif) | 1.AFW_COLORADO_ARCHITECTURAL.pdf | 2024-11-21 16:42 | 20M | |
![[IMG]](/icons/image2.gif) | 1-smb.png | 2023-05-03 14:57 | 444K | |
![[IMG]](/icons/image2.gif) | 1-port fp.png | 2023-05-03 14:54 | 8.8K | |
![[IMG]](/icons/image2.gif) | 1-port-for-keystone-jack-facplate.svg | 2023-02-09 13:38 | 513 | |
![[ ]](/icons/layout.gif) | 1 - South Philadelphia High School Infrastructure Plans -2000.pdf | 2025-01-14 13:42 | 4.5M | |
![[ ]](/icons/layout.gif) | 1 - RFP 25-025_Internal Connections - Structured Cabling (E-Rate).pdf | 2025-02-14 19:19 | 169K | |
![[ ]](/icons/layout.gif) | 1-AFW_COLORADO_ARCHITECTURAL.pdf | 2024-11-21 16:48 | 20M | |
![[ ]](/icons/layout.gif) | 1-20 F04600A01_BergenValleyES Addition_ConstDocs-Dwgs_07-31-2023.pdf | 2024-01-17 15:16 | 28M | |
![[IMG]](/icons/image2.gif) | 1â Firestop sleeve.svg | 2023-02-10 15:04 | 483 | |
![[ ]](/icons/layout.gif) | 0865 CC Survey - AP port map.xlsx - AP Info.pdf | 2025-11-28 17:38 | 182K | |
![[ ]](/icons/unknown.gif) | 0865 CC Survey - AP port map.xlsx | 2025-11-28 17:39 | 115K | |
![[ ]](/icons/layout.gif) | 0865 CC Survey - AP port map- AP Info.pdf | 2025-11-28 17:39 | 182K | |
![[ ]](/icons/layout.gif) | 08 EC C&A CSP - Construction Documents-Updated.pdf | 2024-11-18 20:01 | 152M | |
![[ ]](/icons/layout.gif) | 07-contractor-special-notice-23.pdf | 2024-11-23 12:17 | 5.3M | |
![[IMG]](/icons/image2.gif) | 0687 Cisco AP Plan Remarked.pdf0.png | 2023-09-04 16:08 | 2.0M | |
![[ ]](/icons/layout.gif) | 0687 Cisco AP Plan Remarked.pdf | 2023-09-04 16:08 | 2.2M | |
![[IMG]](/icons/image2.gif) | 0687 Cisco AP Plan Remarked (1).pdf0.png | 2023-09-08 12:22 | 2.0M | |
![[ ]](/icons/layout.gif) | 0687 Cisco AP Plan Remarked (1).pdf | 2023-09-08 12:22 | 2.2M | |
![[ ]](/icons/layout.gif) | 0633 E501 Electrical Details.pdf | 2024-03-27 12:17 | 131K | |
![[ ]](/icons/layout.gif) | 0632 E422 TPS Enlarged Guestroom Electrical Plans.pdf | 2024-03-27 12:17 | 475K | |
![[ ]](/icons/layout.gif) | 0631 E421 TPS Enlarged Guestroom Electrical Plans.pdf | 2024-03-27 12:17 | 428K | |
![[ ]](/icons/layout.gif) | 0630 E420 SHS Enlarged Guestroom Electrical Plans.pdf | 2024-03-27 12:17 | 426K | |
![[ ]](/icons/layout.gif) | 0629 E413 Enlarged Laundry & Break Lighting Plan.pdf | 2024-03-27 12:17 | 1.1M | |
![[ ]](/icons/layout.gif) | 0628 E412 Enlarged Lobby & Lounge Lighting Plan.pdf | 2024-03-27 12:17 | 1.1M | |
![[ ]](/icons/layout.gif) | 0627 E411 Enlarged Meeting & BOH Lighting Plan.pdf | 2024-03-27 12:17 | 1.0M | |
![[ ]](/icons/layout.gif) | 0626 E403 Enlarged Laundry & Break Power Plan.pdf | 2024-03-27 12:17 | 599K | |
![[ ]](/icons/layout.gif) | 0625 E402 Enlarged Lobby & Lounge Power Plan.pdf | 2024-03-27 12:17 | 777K | |
![[ ]](/icons/layout.gif) | 0624 E401 Enlarged Meeting & BOH Power Plan.pdf | 2024-03-27 12:17 | 563K | |
![[ ]](/icons/layout.gif) | 0558 CC Survey - AP port map.xlsx - AP Info.pdf | 2025-07-28 12:54 | 173K | |
![[ ]](/icons/unknown.gif) | 0558 CC Survey - AP port map.xlsx | 2025-07-28 12:53 | 114K | |
![[ ]](/icons/layout.gif) | 0558 CC Survey - AP port map - AP Info.pdf | 2025-07-28 12:55 | 173K | |
![[ ]](/icons/layout.gif) | 0552 CC Survey - AP port map.xlsx - AP Info.pdf | 2025-11-09 14:47 | 194K | |
![[ ]](/icons/layout.gif) | 0552 CC Survey - AP port map- AP Info.pdf | 2025-11-09 14:48 | 194K | |
![[IMG]](/icons/image2.gif) | 0471 Cisco AP Plan Remarked.pdf0.png | 2024-08-26 21:22 | 1.7M | |
![[ ]](/icons/layout.gif) | 0471 Cisco AP Plan Remarked.pdf | 2024-08-26 21:22 | 2.6M | |
![[ ]](/icons/layout.gif) | 031 Specifications.pdf | 2024-12-11 21:50 | 13M | |
![[IMG]](/icons/image2.gif) | 0267 E101 Main Level Power Plan.pdf0.png | 2024-04-01 15:41 | 1.9M | |
![[ ]](/icons/layout.gif) | 0267 E101 Main Level Power Plan.pdf | 2024-04-01 15:41 | 177K | |
![[ ]](/icons/unknown.gif) | 0133 CC Survey - AP port map (2).xlsx | 2025-08-14 19:52 | 126K | |
![[ ]](/icons/layout.gif) | 0125 Division 0 - Geotechnical Report.pdf | 2024-04-04 17:08 | 6.2M | |
![[ ]](/icons/layout.gif) | 0123 Division 0 - Multiple Sections.pdf | 2024-04-04 17:08 | 5.3M | |
![[ ]](/icons/layout.gif) | 0122 Division 0 - 00000C Bid Documents.pdf | 2024-04-04 17:08 | 28K | |
![[IMG]](/icons/image2.gif) | 0117 ELV1 Electrical Low Voltage Plan.pdf0.png | 2024-04-05 11:24 | 490K | |
![[ ]](/icons/layout.gif) | 0117 ELV1 Electrical Low Voltage Plan.pdf | 2024-04-05 11:24 | 215K | |
![[ ]](/icons/layout.gif) | 0090 E2.02 Power Plan - Level 2.pdf | 2024-03-12 16:41 | 509K | |
![[ ]](/icons/layout.gif) | 0090 E2-02 Power Plan - Level 2.pdf | 2024-03-12 16:45 | 509K | |
![[ ]](/icons/layout.gif) | 0088 E0.03 Electrical Specifications.pdf | 2024-03-12 16:41 | 401K | |
![[ ]](/icons/layout.gif) | 0088 E0-03 Electrical Specifications.pdf | 2024-03-12 16:45 | 401K | |
![[ ]](/icons/layout.gif) | 0087 E0.02 Electrical Specifications.pdf | 2024-03-12 16:41 | 441K | |
![[ ]](/icons/layout.gif) | 0087 E0-02 Electrical Specifications.pdf | 2024-03-12 16:45 | 441K | |
![[ ]](/icons/layout.gif) | 0086 Division 0 - Multiple Sections.pdf | 2024-02-06 21:43 | 3.8M | |
![[ ]](/icons/layout.gif) | 0086 CS1 Cover Sheet (Electrical).pdf | 2024-03-12 16:41 | 401K | |
![[ ]](/icons/layout.gif) | 0085 Division 0 - 00000B Table of Contents.pdf | 2024-02-06 21:43 | 85K | |
![[ ]](/icons/layout.gif) | 0084 Division 0 - 00000C Bid Documents.pdf | 2024-02-06 21:43 | 173K | |
![[ ]](/icons/layout.gif) | 0083 Division 12 - 123200 Plastic Laminate Faced Casework.pdf | 2024-02-06 21:43 | 686K | |
![[ ]](/icons/layout.gif) | 0082 Division 10 - Multiple Sections.pdf | 2024-02-06 21:43 | 1.0M | |
![[ ]](/icons/layout.gif) | 0081 Division 9 - Multiple Sections.pdf | 2024-02-06 21:43 | 3.2M | |
![[ ]](/icons/layout.gif) | 0080 Division 8 - Multiple Sections.pdf | 2024-02-06 21:43 | 3.5M | |
![[ ]](/icons/layout.gif) | 0079 Division 7 - Multiple Sections.pdf | 2024-02-06 21:43 | 2.5M | |
![[ ]](/icons/layout.gif) | 0078 Division 6 - Multiple Sections.pdf | 2024-02-06 21:39 | 805K | |
![[ ]](/icons/layout.gif) | 0077 Division 5 - 055900 Metal Wainscots.pdf | 2024-02-06 21:39 | 352K | |
![[ ]](/icons/layout.gif) | 0076 Division 2 - 024100 Demolition.pdf | 2024-02-06 21:39 | 554K | |
![[ ]](/icons/layout.gif) | 0075 Division 1 - Multiple Sections.pdf | 2024-02-06 21:39 | 7.5M | |
![[ ]](/icons/layout.gif) | 0074 Planholders List.pdf | 2024-04-17 11:55 | 12K | |
![[ ]](/icons/layout.gif) | 0074 Division 0 - 00000C Bid Documents.pdf | 2024-02-06 21:39 | 14M | |
![[ ]](/icons/layout.gif) | 0073 Planholders List.pdf | 2024-04-17 11:55 | 10K | |
![[ ]](/icons/layout.gif) | 0073 Division 0 - 00000B Table of Contents.pdf | 2024-02-06 21:39 | 456K | |
![[ ]](/icons/unknown.gif) | 0073 CC Survey - AP port map.xlsx | 2025-11-09 15:32 | 114K | |
![[ ]](/icons/layout.gif) | 0073 CC Survey - AP port map.pdf | 2025-11-09 15:32 | 190K | |
![[ ]](/icons/layout.gif) | 0072 Division 0 - 00000C Bid Documents.pdf | 2024-02-06 21:39 | 78K | |
![[ ]](/icons/layout.gif) | 0071 Division 28 - Multiple Sections.pdf | 2024-04-17 11:53 | 1.0M | |
![[ ]](/icons/layout.gif) | 0071 Division 0 - 00000A Cover Page.pdf | 2024-02-06 21:39 | 79K | |
![[ ]](/icons/layout.gif) | 0070 Division 27 - Multiple Sections.pdf | 2024-04-17 11:53 | 1.6M | |
![[ ]](/icons/layout.gif) | 0069 Division 26 - Multiple Sections.pdf | 2024-04-17 11:53 | 2.0M | |
![[ ]](/icons/layout.gif) | 0069 C-15 Irrigation Details.pdf | 2024-02-07 12:57 | 139K | |
![[ ]](/icons/layout.gif) | 0068 Division 23 - Multiple Sections.pdf | 2024-04-17 11:53 | 3.0M | |
![[ ]](/icons/layout.gif) | 0068 C-14 Irrigation Plan.pdf | 2024-02-07 12:57 | 128K | |
![[ ]](/icons/layout.gif) | 0068 Addendum 2 Spec.pdf | 2024-02-06 21:44 | 199K | |
![[ ]](/icons/layout.gif) | 0067 Division 22 - Multiple Sections.pdf | 2024-04-17 11:54 | 1.9M | |
![[ ]](/icons/layout.gif) | 0067 C-13 Landscape Details.pdf | 2024-02-07 12:57 | 89K | |
![[ ]](/icons/layout.gif) | 0066 Division 21 - 210500 Common Work Results For Fire Suppression.pdf | 2024-04-17 11:54 | 374K | |
![[ ]](/icons/layout.gif) | 0066 C-12 Landscape Plan.pdf | 2024-02-07 12:57 | 151K | |
![[ ]](/icons/layout.gif) | 0065 SW-5 Stormwater Pollution Prevention Plan Details.pdf | 2024-02-07 12:57 | 3.6M | |
![[ ]](/icons/layout.gif) | 0065 Division 12 - 123600 Countertops.pdf | 2024-04-17 11:54 | 105K | |
![[ ]](/icons/layout.gif) | 0064 SW-4 Stormwater Pollution Prevention Plan Details.pdf | 2024-02-07 12:57 | 3.9M | |
![[ ]](/icons/layout.gif) | 0064 Division 10 - Multiple Sections.pdf | 2024-04-17 11:54 | 824K | |
![[ ]](/icons/layout.gif) | 0063 SW-3 Stormwater Pollution Prevention Plan Details.pdf | 2024-02-07 12:57 | 4.2M | |
![[ ]](/icons/layout.gif) | 0063 Division 9 - Multiple Sections.pdf | 2024-04-17 11:53 | 1.3M | |
![[ ]](/icons/layout.gif) | 0062 SW-2 Stormwater Pollution Prevention Plan Details.pdf | 2024-02-07 12:57 | 3.6M | |
![[ ]](/icons/layout.gif) | 0062 Division 8 - Multiple Sections.pdf | 2024-04-17 11:54 | 2.4M | |
![[ ]](/icons/layout.gif) | 0061 SW-1 Stormwater Pollution Prevention Plan.pdf | 2024-02-07 12:57 | 921K | |
![[ ]](/icons/layout.gif) | 0061 Division 7 - 079200 Joint Sealants.pdf | 2024-04-17 11:53 | 166K | |
![[ ]](/icons/layout.gif) | 0060 Division 6 - Multiple Sections.pdf | 2024-04-17 11:54 | 361K | |
![[ ]](/icons/layout.gif) | 0060 C-11 Details.pdf | 2024-02-07 12:57 | 3.8M | |
![[IMG]](/icons/image2.gif) | 0059 ELV1 Electrical Low Voltage Plan.pdf0.png | 2024-04-04 17:21 | 491K | |
![[ ]](/icons/layout.gif) | 0059 ELV1 Electrical Low Voltage Plan.pdf | 2024-04-04 17:21 | 239K | |
![[ ]](/icons/layout.gif) | 0059 Division 3 - 030516 Underslab Vapor Barrier.pdf | 2024-04-17 11:54 | 50K | |
![[ ]](/icons/layout.gif) | 0058 Division 2 - Multiple Sections.pdf | 2024-04-17 11:54 | 4.4M | |
![[ ]](/icons/layout.gif) | 0058 C-9 Utility Plan.pdf | 2024-02-07 12:58 | 657K | |
![[ ]](/icons/layout.gif) | 0057 Division 0 - 00000B Table of Contents.pdf | 2024-04-17 11:54 | 377K | |
![[ ]](/icons/layout.gif) | 0057 C-8 Cross Sections.pdf | 2024-02-07 12:58 | 816K | |
![[ ]](/icons/layout.gif) | 0056 Division 0 - 00000C Bid Documents.pdf | 2024-04-17 11:53 | 177K | |
![[ ]](/icons/layout.gif) | 0056 C-7 Grading & Drainage Plan.pdf | 2024-02-07 12:58 | 666K | |
![[ ]](/icons/layout.gif) | 0055 Division 1 - Multiple Sections.pdf | 2024-04-17 11:54 | 1.4M | |
![[ ]](/icons/layout.gif) | 0055 C-6 Horizontal Control Plan.pdf | 2024-02-07 12:58 | 687K | |
![[ ]](/icons/layout.gif) | 0054 Division 0 - 00000C Bid Documents.pdf | 2024-04-17 11:53 | 6.1M | |
![[ ]](/icons/layout.gif) | 0054 C-5 Site Plan.pdf | 2024-02-07 12:58 | 854K | |
![[ ]](/icons/layout.gif) | 0053 Division 0 - 00000B Table of Contents.pdf | 2024-04-17 11:54 | 412K | |
![[ ]](/icons/layout.gif) | 0053 C-4 Demolition Plan.pdf | 2024-02-07 12:58 | 667K | |
![[ ]](/icons/layout.gif) | 0052 Division 0 - 00000C Bid Documents.pdf | 2024-04-17 11:53 | 1.0M | |
![[ ]](/icons/layout.gif) | 0052 C-3 Notes.pdf | 2024-02-07 12:58 | 921K | |
![[ ]](/icons/layout.gif) | 0051 Division 0 - 00000B Table of Contents.pdf | 2024-04-17 11:54 | 96K | |
![[ ]](/icons/layout.gif) | 0051 C-2 Notes.pdf | 2024-02-07 12:58 | 903K | |
![[ ]](/icons/layout.gif) | 0050 Division 0 - 00000C Bid Documents.pdf | 2024-04-17 11:53 | 1.9M | |
![[ ]](/icons/layout.gif) | 005B997C-AB32-9494-F595-D59B29728FC6.pdf | 2024-11-23 12:40 | 31K | |
![[ ]](/icons/layout.gif) | 005B91BA-9C81-68EA-B6D9-120CE7B4351E.pdf | 2024-11-23 12:40 | 41K | |
![[ ]](/icons/layout.gif) | 0049 Division 0 - 00000B Table of Contents.pdf | 2024-04-17 11:54 | 376K | |
![[ ]](/icons/layout.gif) | 0048 Division 0 - 00000C Bid Documents.pdf | 2024-04-17 11:53 | 39K | |
![[ ]](/icons/layout.gif) | 0047 Division 0 - 00000A Cover Page.pdf | 2024-04-17 11:54 | 157K | |
![[IMG]](/icons/image2.gif) | 00406300_1__44081.svg | 2023-02-10 16:36 | 1.7K | |
![[ ]](/icons/layout.gif) | 001116 Invitation 01 11.6.24 R1.pdf | 2024-12-11 21:57 | 46K | |
![[ ]](/icons/layout.gif) | 001116 Invitation 01 11-6-24 R1.pdf | 2024-12-11 21:59 | 46K | |
![[ ]](/icons/layout.gif) | 0011 Planholders List.pdf | 2024-02-06 20:01 | 12K | |
![[ ]](/icons/layout.gif) | 0010 S4.1 Framing Plan.pdf | 2024-02-07 12:57 | 111K | |
![[ ]](/icons/layout.gif) | 0009 S3.2 Foundation Details.pdf | 2024-02-07 12:57 | 125K | |
![[ ]](/icons/layout.gif) | 0009 Division 0 - Multiple Sections.pdf | 2024-02-06 20:05 | 4.7M | |
![[ ]](/icons/layout.gif) | 0008 S3.1 Foundation Details.pdf | 2024-02-07 12:57 | 119K | |
![[ ]](/icons/layout.gif) | 0008 Division 0 - 00000B Table of Contents.pdf | 2024-02-06 20:01 | 337K | |
![[ ]](/icons/layout.gif) | 0007 S2.1 Foundation Plan.pdf | 2024-02-07 12:57 | 112K | |
![[ ]](/icons/layout.gif) | 0007 Division 0 - 00000A Cover Page.pdf | 2024-02-06 20:01 | 91K | |
![[ ]](/icons/layout.gif) | 0006 S1.1 Structural Notes.pdf | 2024-02-07 12:57 | 165K | |
![[ ]](/icons/layout.gif) | 0006 Division 0 - 00000C Reference Image.pdf | 2024-02-06 20:01 | 172K | |
![[ ]](/icons/layout.gif) | 0005 G1.1 Code Summary Plan.pdf | 2024-02-07 12:57 | 593K | |
![[ ]](/icons/layout.gif) | 0004 T1.2 Scope Of Work Schedule.pdf | 2024-02-07 12:57 | 616K | |
![[ ]](/icons/layout.gif) | 0003 1 Hardware Details.pdf | 2024-02-06 20:00 | 159K | |
![[ ]](/icons/layout.gif) | 000 ALL DRAWINGS harris hall.pdf | 2024-12-11 21:50 | 21M | |
![[ ]](/icons/layout.gif) | 00_22_00_Buckley_Power_Independence_09_29_2025.1.pdf | 2025-10-29 23:57 | 673K | |
![[ ]](/icons/layout.gif) | 00_10_00_CLIN_Notes_Buckley_Power_Independence_09_02_2025.pdf | 2025-11-01 15:34 | 172K | |
![[ ]](/icons/layout.gif) | #canvas test new- Proposal Documents.pdf | 2025-06-17 11:18 | 901K | |
![[ ]](/icons/unknown.gif) | #2025-04 NEW CANAAN HIGH SCHOOL-NETWORK WIRING AUDIO INTERCOM_details.json | 2025-07-07 10:36 | 7.4K | |
![[ ]](/icons/layout.gif) | #2025-04 NEW CANAAN HIGH SCHOOL-NETWORK WIRING AUDIO INTERCOM- Proposal Documents.pdf | 2025-06-25 13:45 | 4.5M | |
|